TW202233190A - 作為PI3Kδ抑制劑的咪唑並[1,5-A]吡衍生物 - Google Patents
作為PI3Kδ抑制劑的咪唑並[1,5-A]吡衍生物 Download PDFInfo
- Publication number
- TW202233190A TW202233190A TW111114434A TW111114434A TW202233190A TW 202233190 A TW202233190 A TW 202233190A TW 111114434 A TW111114434 A TW 111114434A TW 111114434 A TW111114434 A TW 111114434A TW 202233190 A TW202233190 A TW 202233190A
- Authority
- TW
- Taiwan
- Prior art keywords
- compound
- alkyl
- heteroaryl
- cycloalkyl
- chloro
- Prior art date
Links
- 102100036056 Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit delta isoform Human genes 0.000 title description 27
- 101710204747 Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit delta isoform Proteins 0.000 title description 27
- 239000003112 inhibitor Substances 0.000 title description 8
- MIFJMFOVENWQDP-UHFFFAOYSA-N imidazo[1,5-a]pyrazine Chemical class C1=CN=CC2=CN=CN21 MIFJMFOVENWQDP-UHFFFAOYSA-N 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims abstract description 501
- 150000003839 salts Chemical class 0.000 claims abstract description 34
- -1 halo-C 2-6 alkenyl Chemical group 0.000 claims description 285
- 125000000217 alkyl group Chemical group 0.000 claims description 148
- 125000000623 heterocyclic group Chemical group 0.000 claims description 116
- 125000001072 heteroaryl group Chemical group 0.000 claims description 111
- 125000003118 aryl group Chemical group 0.000 claims description 102
- 239000001257 hydrogen Substances 0.000 claims description 102
- 229910052739 hydrogen Inorganic materials 0.000 claims description 102
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 101
- 239000000460 chlorine Substances 0.000 claims description 73
- 150000002431 hydrogen Chemical class 0.000 claims description 59
- 125000001424 substituent group Chemical group 0.000 claims description 57
- 125000005842 heteroatom Chemical group 0.000 claims description 55
- 229910052801 chlorine Inorganic materials 0.000 claims description 53
- 229910052736 halogen Inorganic materials 0.000 claims description 51
- 150000002367 halogens Chemical class 0.000 claims description 51
- 229910052757 nitrogen Inorganic materials 0.000 claims description 44
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 34
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 32
- 229910052760 oxygen Inorganic materials 0.000 claims description 31
- 229910052717 sulfur Inorganic materials 0.000 claims description 31
- 229920006395 saturated elastomer Polymers 0.000 claims description 30
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 28
- 229910052794 bromium Inorganic materials 0.000 claims description 24
- 229910052731 fluorine Inorganic materials 0.000 claims description 21
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 20
- 125000003545 alkoxy group Chemical group 0.000 claims description 17
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims description 15
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 claims description 14
- 125000006570 (C5-C6) heteroaryl group Chemical group 0.000 claims description 13
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 12
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 claims description 11
- 239000003814 drug Substances 0.000 claims description 10
- 125000004429 atom Chemical group 0.000 claims description 9
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 claims description 9
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 8
- 150000001335 aliphatic alkanes Chemical class 0.000 claims description 8
- 238000002360 preparation method Methods 0.000 claims description 8
- 229940125782 compound 2 Drugs 0.000 claims description 7
- 208000005017 glioblastoma Diseases 0.000 claims description 7
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 6
- QFLWZFQWSBQYPS-AWRAUJHKSA-N (3S)-3-[[(2S)-2-[[(2S)-2-[5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]-3-methylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-[1-bis(4-chlorophenoxy)phosphorylbutylamino]-4-oxobutanoic acid Chemical compound CCCC(NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](NC(=O)CCCCC1SC[C@@H]2NC(=O)N[C@H]12)C(C)C)P(=O)(Oc1ccc(Cl)cc1)Oc1ccc(Cl)cc1 QFLWZFQWSBQYPS-AWRAUJHKSA-N 0.000 claims description 5
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims description 5
- 125000006569 (C5-C6) heterocyclic group Chemical group 0.000 claims description 5
- 125000002373 5 membered heterocyclic group Chemical group 0.000 claims description 5
- 125000004070 6 membered heterocyclic group Chemical group 0.000 claims description 5
- AOSZTAHDEDLTLQ-AZKQZHLXSA-N (1S,2S,4R,8S,9S,11S,12R,13S,19S)-6-[(3-chlorophenyl)methyl]-12,19-difluoro-11-hydroxy-8-(2-hydroxyacetyl)-9,13-dimethyl-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one Chemical compound C([C@@H]1C[C@H]2[C@H]3[C@]([C@]4(C=CC(=O)C=C4[C@@H](F)C3)C)(F)[C@@H](O)C[C@@]2([C@@]1(C1)C(=O)CO)C)N1CC1=CC=CC(Cl)=C1 AOSZTAHDEDLTLQ-AZKQZHLXSA-N 0.000 claims description 4
- YJLIKUSWRSEPSM-WGQQHEPDSA-N (2r,3r,4s,5r)-2-[6-amino-8-[(4-phenylphenyl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol Chemical compound C=1C=C(C=2C=CC=CC=2)C=CC=1CNC1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O YJLIKUSWRSEPSM-WGQQHEPDSA-N 0.000 claims description 4
- VIJSPAIQWVPKQZ-BLECARSGSA-N (2s)-2-[[(2s)-2-[[(2s)-2-[[(2s)-2-[[(2s)-2-[[(2s)-2-acetamido-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]amino]-4,4-dimethylpentanoyl]amino]-4-methylpentanoyl]amino]propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid Chemical compound NC(=N)NCCC[C@@H](C(O)=O)NC(=O)[C@H](C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCNC(N)=N)NC(C)=O VIJSPAIQWVPKQZ-BLECARSGSA-N 0.000 claims description 4
- UDQTXCHQKHIQMH-KYGLGHNPSA-N (3ar,5s,6s,7r,7ar)-5-(difluoromethyl)-2-(ethylamino)-5,6,7,7a-tetrahydro-3ah-pyrano[3,2-d][1,3]thiazole-6,7-diol Chemical compound S1C(NCC)=N[C@H]2[C@@H]1O[C@H](C(F)F)[C@@H](O)[C@@H]2O UDQTXCHQKHIQMH-KYGLGHNPSA-N 0.000 claims description 4
- HUWSZNZAROKDRZ-RRLWZMAJSA-N (3r,4r)-3-azaniumyl-5-[[(2s,3r)-1-[(2s)-2,3-dicarboxypyrrolidin-1-yl]-3-methyl-1-oxopentan-2-yl]amino]-5-oxo-4-sulfanylpentane-1-sulfonate Chemical compound OS(=O)(=O)CC[C@@H](N)[C@@H](S)C(=O)N[C@@H]([C@H](C)CC)C(=O)N1CCC(C(O)=O)[C@H]1C(O)=O HUWSZNZAROKDRZ-RRLWZMAJSA-N 0.000 claims description 4
- ONBQEOIKXPHGMB-VBSBHUPXSA-N 1-[2-[(2s,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-4,6-dihydroxyphenyl]-3-(4-hydroxyphenyl)propan-1-one Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1OC1=CC(O)=CC(O)=C1C(=O)CCC1=CC=C(O)C=C1 ONBQEOIKXPHGMB-VBSBHUPXSA-N 0.000 claims description 4
- FQMZXMVHHKXGTM-UHFFFAOYSA-N 2-(1-adamantyl)-n-[2-[2-(2-hydroxyethylamino)ethylamino]quinolin-5-yl]acetamide Chemical compound C1C(C2)CC(C3)CC2CC13CC(=O)NC1=CC=CC2=NC(NCCNCCO)=CC=C21 FQMZXMVHHKXGTM-UHFFFAOYSA-N 0.000 claims description 4
- TVTJUIAKQFIXCE-HUKYDQBMSA-N 2-amino-9-[(2R,3S,4S,5R)-4-fluoro-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-prop-2-ynyl-1H-purine-6,8-dione Chemical compound NC=1NC(C=2N(C(N(C=2N=1)[C@@H]1O[C@@H]([C@H]([C@H]1O)F)CO)=O)CC#C)=O TVTJUIAKQFIXCE-HUKYDQBMSA-N 0.000 claims description 4
- 229940126657 Compound 17 Drugs 0.000 claims description 4
- OJFKUJDRGJSAQB-UHFFFAOYSA-N TAK-632 Chemical compound C1=C(NC(=O)CC=2C=C(C=CC=2)C(F)(F)F)C(F)=CC=C1OC(C(=C1S2)C#N)=CC=C1N=C2NC(=O)C1CC1 OJFKUJDRGJSAQB-UHFFFAOYSA-N 0.000 claims description 4
- SPXSEZMVRJLHQG-XMMPIXPASA-N [(2R)-1-[[4-[(3-phenylmethoxyphenoxy)methyl]phenyl]methyl]pyrrolidin-2-yl]methanol Chemical compound C(C1=CC=CC=C1)OC=1C=C(OCC2=CC=C(CN3[C@H](CCC3)CO)C=C2)C=CC=1 SPXSEZMVRJLHQG-XMMPIXPASA-N 0.000 claims description 4
- LNUFLCYMSVYYNW-ZPJMAFJPSA-N [(2r,3r,4s,5r,6r)-2-[(2r,3r,4s,5r,6r)-6-[(2r,3r,4s,5r,6r)-6-[(2r,3r,4s,5r,6r)-6-[[(3s,5s,8r,9s,10s,13r,14s,17r)-10,13-dimethyl-17-[(2r)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1h-cyclopenta[a]phenanthren-3-yl]oxy]-4,5-disulfo Chemical compound O([C@@H]1[C@@H](COS(O)(=O)=O)O[C@@H]([C@@H]([C@H]1OS(O)(=O)=O)OS(O)(=O)=O)O[C@@H]1[C@@H](COS(O)(=O)=O)O[C@@H]([C@@H]([C@H]1OS(O)(=O)=O)OS(O)(=O)=O)O[C@@H]1[C@@H](COS(O)(=O)=O)O[C@H]([C@@H]([C@H]1OS(O)(=O)=O)OS(O)(=O)=O)O[C@@H]1C[C@@H]2CC[C@H]3[C@@H]4CC[C@@H]([C@]4(CC[C@@H]3[C@@]2(C)CC1)C)[C@H](C)CCCC(C)C)[C@H]1O[C@H](COS(O)(=O)=O)[C@@H](OS(O)(=O)=O)[C@H](OS(O)(=O)=O)[C@H]1OS(O)(=O)=O LNUFLCYMSVYYNW-ZPJMAFJPSA-N 0.000 claims description 4
- PSLUFJFHTBIXMW-WYEYVKMPSA-N [(3r,4ar,5s,6s,6as,10s,10ar,10bs)-3-ethenyl-10,10b-dihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-6-(2-pyridin-2-ylethylcarbamoyloxy)-5,6,6a,8,9,10-hexahydro-2h-benzo[f]chromen-5-yl] acetate Chemical compound O([C@@H]1[C@@H]([C@]2(O[C@](C)(CC(=O)[C@]2(O)[C@@]2(C)[C@@H](O)CCC(C)(C)[C@@H]21)C=C)C)OC(=O)C)C(=O)NCCC1=CC=CC=N1 PSLUFJFHTBIXMW-WYEYVKMPSA-N 0.000 claims description 4
- 125000002355 alkine group Chemical group 0.000 claims description 4
- 229940126142 compound 16 Drugs 0.000 claims description 4
- 229940125851 compound 27 Drugs 0.000 claims description 4
- 229940127573 compound 38 Drugs 0.000 claims description 4
- 229940126540 compound 41 Drugs 0.000 claims description 4
- 229940125936 compound 42 Drugs 0.000 claims description 4
- 229940127271 compound 49 Drugs 0.000 claims description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 4
- IOMMMLWIABWRKL-WUTDNEBXSA-N nazartinib Chemical compound C1N(C(=O)/C=C/CN(C)C)CCCC[C@H]1N1C2=C(Cl)C=CC=C2N=C1NC(=O)C1=CC=NC(C)=C1 IOMMMLWIABWRKL-WUTDNEBXSA-N 0.000 claims description 4
- PIDFDZJZLOTZTM-KHVQSSSXSA-N ombitasvir Chemical compound COC(=O)N[C@@H](C(C)C)C(=O)N1CCC[C@H]1C(=O)NC1=CC=C([C@H]2N([C@@H](CC2)C=2C=CC(NC(=O)[C@H]3N(CCC3)C(=O)[C@@H](NC(=O)OC)C(C)C)=CC=2)C=2C=CC(=CC=2)C(C)(C)C)C=C1 PIDFDZJZLOTZTM-KHVQSSSXSA-N 0.000 claims description 4
- SZUVGFMDDVSKSI-WIFOCOSTSA-N (1s,2s,3s,5r)-1-(carboxymethyl)-3,5-bis[(4-phenoxyphenyl)methyl-propylcarbamoyl]cyclopentane-1,2-dicarboxylic acid Chemical compound O=C([C@@H]1[C@@H]([C@](CC(O)=O)([C@H](C(=O)N(CCC)CC=2C=CC(OC=3C=CC=CC=3)=CC=2)C1)C(O)=O)C(O)=O)N(CCC)CC(C=C1)=CC=C1OC1=CC=CC=C1 SZUVGFMDDVSKSI-WIFOCOSTSA-N 0.000 claims description 3
- GHYOCDFICYLMRF-UTIIJYGPSA-N (2S,3R)-N-[(2S)-3-(cyclopenten-1-yl)-1-[(2R)-2-methyloxiran-2-yl]-1-oxopropan-2-yl]-3-hydroxy-3-(4-methoxyphenyl)-2-[[(2S)-2-[(2-morpholin-4-ylacetyl)amino]propanoyl]amino]propanamide Chemical compound C1(=CCCC1)C[C@@H](C(=O)[C@@]1(OC1)C)NC([C@H]([C@@H](C1=CC=C(C=C1)OC)O)NC([C@H](C)NC(CN1CCOCC1)=O)=O)=O GHYOCDFICYLMRF-UTIIJYGPSA-N 0.000 claims description 3
- GCTFTMWXZFLTRR-GFCCVEGCSA-N (2r)-2-amino-n-[3-(difluoromethoxy)-4-(1,3-oxazol-5-yl)phenyl]-4-methylpentanamide Chemical compound FC(F)OC1=CC(NC(=O)[C@H](N)CC(C)C)=CC=C1C1=CN=CO1 GCTFTMWXZFLTRR-GFCCVEGCSA-N 0.000 claims description 3
- WWTBZEKOSBFBEM-SPWPXUSOSA-N (2s)-2-[[2-benzyl-3-[hydroxy-[(1r)-2-phenyl-1-(phenylmethoxycarbonylamino)ethyl]phosphoryl]propanoyl]amino]-3-(1h-indol-3-yl)propanoic acid Chemical compound N([C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)O)C(=O)C(CP(O)(=O)[C@H](CC=1C=CC=CC=1)NC(=O)OCC=1C=CC=CC=1)CC1=CC=CC=C1 WWTBZEKOSBFBEM-SPWPXUSOSA-N 0.000 claims description 3
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 claims description 3
- XFJBGINZIMNZBW-CRAIPNDOSA-N 5-chloro-2-[4-[(1r,2s)-2-[2-(5-methylsulfonylpyridin-2-yl)oxyethyl]cyclopropyl]piperidin-1-yl]pyrimidine Chemical compound N1=CC(S(=O)(=O)C)=CC=C1OCC[C@H]1[C@@H](C2CCN(CC2)C=2N=CC(Cl)=CN=2)C1 XFJBGINZIMNZBW-CRAIPNDOSA-N 0.000 claims description 3
- XRWSZZJLZRKHHD-WVWIJVSJSA-N asunaprevir Chemical compound O=C([C@@H]1C[C@H](CN1C(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)OC1=NC=C(C2=CC=C(Cl)C=C21)OC)N[C@]1(C(=O)NS(=O)(=O)C2CC2)C[C@H]1C=C XRWSZZJLZRKHHD-WVWIJVSJSA-N 0.000 claims description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 3
- 229940125797 compound 12 Drugs 0.000 claims description 3
- 229940126543 compound 14 Drugs 0.000 claims description 3
- 229940126208 compound 22 Drugs 0.000 claims description 3
- 229940125961 compound 24 Drugs 0.000 claims description 3
- 229940125900 compound 59 Drugs 0.000 claims description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 3
- ASGMFNBUXDJWJJ-JLCFBVMHSA-N (1R,3R)-3-[[3-bromo-1-[4-(5-methyl-1,3,4-thiadiazol-2-yl)phenyl]pyrazolo[3,4-d]pyrimidin-6-yl]amino]-N,1-dimethylcyclopentane-1-carboxamide Chemical compound BrC1=NN(C2=NC(=NC=C21)N[C@H]1C[C@@](CC1)(C(=O)NC)C)C1=CC=C(C=C1)C=1SC(=NN=1)C ASGMFNBUXDJWJJ-JLCFBVMHSA-N 0.000 claims description 2
- UAOUIVVJBYDFKD-XKCDOFEDSA-N (1R,9R,10S,11R,12R,15S,18S,21R)-10,11,21-trihydroxy-8,8-dimethyl-14-methylidene-4-(prop-2-enylamino)-20-oxa-5-thia-3-azahexacyclo[9.7.2.112,15.01,9.02,6.012,18]henicosa-2(6),3-dien-13-one Chemical compound C([C@@H]1[C@@H](O)[C@@]23C(C1=C)=O)C[C@H]2[C@]12C(N=C(NCC=C)S4)=C4CC(C)(C)[C@H]1[C@H](O)[C@]3(O)OC2 UAOUIVVJBYDFKD-XKCDOFEDSA-N 0.000 claims description 2
- ABJSOROVZZKJGI-OCYUSGCXSA-N (1r,2r,4r)-2-(4-bromophenyl)-n-[(4-chlorophenyl)-(2-fluoropyridin-4-yl)methyl]-4-morpholin-4-ylcyclohexane-1-carboxamide Chemical compound C1=NC(F)=CC(C(NC(=O)[C@H]2[C@@H](C[C@@H](CC2)N2CCOCC2)C=2C=CC(Br)=CC=2)C=2C=CC(Cl)=CC=2)=C1 ABJSOROVZZKJGI-OCYUSGCXSA-N 0.000 claims description 2
- GLGNXYJARSMNGJ-VKTIVEEGSA-N (1s,2s,3r,4r)-3-[[5-chloro-2-[(1-ethyl-6-methoxy-2-oxo-4,5-dihydro-3h-1-benzazepin-7-yl)amino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide Chemical compound CCN1C(=O)CCCC2=C(OC)C(NC=3N=C(C(=CN=3)Cl)N[C@H]3[C@H]([C@@]4([H])C[C@@]3(C=C4)[H])C(N)=O)=CC=C21 GLGNXYJARSMNGJ-VKTIVEEGSA-N 0.000 claims description 2
- IUSARDYWEPUTPN-OZBXUNDUSA-N (2r)-n-[(2s,3r)-4-[[(4s)-6-(2,2-dimethylpropyl)spiro[3,4-dihydropyrano[2,3-b]pyridine-2,1'-cyclobutane]-4-yl]amino]-3-hydroxy-1-[3-(1,3-thiazol-2-yl)phenyl]butan-2-yl]-2-methoxypropanamide Chemical compound C([C@H](NC(=O)[C@@H](C)OC)[C@H](O)CN[C@@H]1C2=CC(CC(C)(C)C)=CN=C2OC2(CCC2)C1)C(C=1)=CC=CC=1C1=NC=CS1 IUSARDYWEPUTPN-OZBXUNDUSA-N 0.000 claims description 2
- STBLNCCBQMHSRC-BATDWUPUSA-N (2s)-n-[(3s,4s)-5-acetyl-7-cyano-4-methyl-1-[(2-methylnaphthalen-1-yl)methyl]-2-oxo-3,4-dihydro-1,5-benzodiazepin-3-yl]-2-(methylamino)propanamide Chemical compound O=C1[C@@H](NC(=O)[C@H](C)NC)[C@H](C)N(C(C)=O)C2=CC(C#N)=CC=C2N1CC1=C(C)C=CC2=CC=CC=C12 STBLNCCBQMHSRC-BATDWUPUSA-N 0.000 claims description 2
- IWZSHWBGHQBIML-ZGGLMWTQSA-N (3S,8S,10R,13S,14S,17S)-17-isoquinolin-7-yl-N,N,10,13-tetramethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-amine Chemical compound CN(C)[C@H]1CC[C@]2(C)C3CC[C@@]4(C)[C@@H](CC[C@@H]4c4ccc5ccncc5c4)[C@@H]3CC=C2C1 IWZSHWBGHQBIML-ZGGLMWTQSA-N 0.000 claims description 2
- MPDDTAJMJCESGV-CTUHWIOQSA-M (3r,5r)-7-[2-(4-fluorophenyl)-5-[methyl-[(1r)-1-phenylethyl]carbamoyl]-4-propan-2-ylpyrazol-3-yl]-3,5-dihydroxyheptanoate Chemical compound C1([C@@H](C)N(C)C(=O)C2=NN(C(CC[C@@H](O)C[C@@H](O)CC([O-])=O)=C2C(C)C)C=2C=CC(F)=CC=2)=CC=CC=C1 MPDDTAJMJCESGV-CTUHWIOQSA-M 0.000 claims description 2
- YQOLEILXOBUDMU-KRWDZBQOSA-N (4R)-5-[(6-bromo-3-methyl-2-pyrrolidin-1-ylquinoline-4-carbonyl)amino]-4-(2-chlorophenyl)pentanoic acid Chemical compound CC1=C(C2=C(C=CC(=C2)Br)N=C1N3CCCC3)C(=O)NC[C@H](CCC(=O)O)C4=CC=CC=C4Cl YQOLEILXOBUDMU-KRWDZBQOSA-N 0.000 claims description 2
- KQZLRWGGWXJPOS-NLFPWZOASA-N 1-[(1R)-1-(2,4-dichlorophenyl)ethyl]-6-[(4S,5R)-4-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-5-methylcyclohexen-1-yl]pyrazolo[3,4-b]pyrazine-3-carbonitrile Chemical compound ClC1=C(C=CC(=C1)Cl)[C@@H](C)N1N=C(C=2C1=NC(=CN=2)C1=CC[C@@H]([C@@H](C1)C)N1[C@@H](CCC1)CO)C#N KQZLRWGGWXJPOS-NLFPWZOASA-N 0.000 claims description 2
- WZZBNLYBHUDSHF-DHLKQENFSA-N 1-[(3s,4s)-4-[8-(2-chloro-4-pyrimidin-2-yloxyphenyl)-7-fluoro-2-methylimidazo[4,5-c]quinolin-1-yl]-3-fluoropiperidin-1-yl]-2-hydroxyethanone Chemical compound CC1=NC2=CN=C3C=C(F)C(C=4C(=CC(OC=5N=CC=CN=5)=CC=4)Cl)=CC3=C2N1[C@H]1CCN(C(=O)CO)C[C@@H]1F WZZBNLYBHUDSHF-DHLKQENFSA-N 0.000 claims description 2
- PYRKKGOKRMZEIT-UHFFFAOYSA-N 2-[6-(2-cyclopropylethoxy)-9-(2-hydroxy-2-methylpropyl)-1h-phenanthro[9,10-d]imidazol-2-yl]-5-fluorobenzene-1,3-dicarbonitrile Chemical compound C1=C2C3=CC(CC(C)(O)C)=CC=C3C=3NC(C=4C(=CC(F)=CC=4C#N)C#N)=NC=3C2=CC=C1OCCC1CC1 PYRKKGOKRMZEIT-UHFFFAOYSA-N 0.000 claims description 2
- FMKGJQHNYMWDFJ-CVEARBPZSA-N 2-[[4-(2,2-difluoropropoxy)pyrimidin-5-yl]methylamino]-4-[[(1R,4S)-4-hydroxy-3,3-dimethylcyclohexyl]amino]pyrimidine-5-carbonitrile Chemical compound FC(COC1=NC=NC=C1CNC1=NC=C(C(=N1)N[C@H]1CC([C@H](CC1)O)(C)C)C#N)(C)F FMKGJQHNYMWDFJ-CVEARBPZSA-N 0.000 claims description 2
- YSUIQYOGTINQIN-UZFYAQMZSA-N 2-amino-9-[(1S,6R,8R,9S,10R,15R,17R,18R)-8-(6-aminopurin-9-yl)-9,18-difluoro-3,12-dihydroxy-3,12-bis(sulfanylidene)-2,4,7,11,13,16-hexaoxa-3lambda5,12lambda5-diphosphatricyclo[13.2.1.06,10]octadecan-17-yl]-1H-purin-6-one Chemical compound NC1=NC2=C(N=CN2[C@@H]2O[C@@H]3COP(S)(=O)O[C@@H]4[C@@H](COP(S)(=O)O[C@@H]2[C@@H]3F)O[C@H]([C@H]4F)N2C=NC3=C2N=CN=C3N)C(=O)N1 YSUIQYOGTINQIN-UZFYAQMZSA-N 0.000 claims description 2
- LFOIDLOIBZFWDO-UHFFFAOYSA-N 2-methoxy-6-[6-methoxy-4-[(3-phenylmethoxyphenyl)methoxy]-1-benzofuran-2-yl]imidazo[2,1-b][1,3,4]thiadiazole Chemical compound N1=C2SC(OC)=NN2C=C1C(OC1=CC(OC)=C2)=CC1=C2OCC(C=1)=CC=CC=1OCC1=CC=CC=C1 LFOIDLOIBZFWDO-UHFFFAOYSA-N 0.000 claims description 2
- QBWKPGNFQQJGFY-QLFBSQMISA-N 3-[(1r)-1-[(2r,6s)-2,6-dimethylmorpholin-4-yl]ethyl]-n-[6-methyl-3-(1h-pyrazol-4-yl)imidazo[1,2-a]pyrazin-8-yl]-1,2-thiazol-5-amine Chemical compound N1([C@H](C)C2=NSC(NC=3C4=NC=C(N4C=C(C)N=3)C3=CNN=C3)=C2)C[C@H](C)O[C@H](C)C1 QBWKPGNFQQJGFY-QLFBSQMISA-N 0.000 claims description 2
- WYFCZWSWFGJODV-MIANJLSGSA-N 4-[[(1s)-2-[(e)-3-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]prop-2-enoyl]-5-(4-methyl-2-oxopiperazin-1-yl)-3,4-dihydro-1h-isoquinoline-1-carbonyl]amino]benzoic acid Chemical compound O=C1CN(C)CCN1C1=CC=CC2=C1CCN(C(=O)\C=C\C=1C(=CC=C(Cl)C=1F)N1N=NN=C1)[C@@H]2C(=O)NC1=CC=C(C(O)=O)C=C1 WYFCZWSWFGJODV-MIANJLSGSA-N 0.000 claims description 2
- 229940126639 Compound 33 Drugs 0.000 claims description 2
- 229940127007 Compound 39 Drugs 0.000 claims description 2
- OPFJDXRVMFKJJO-ZHHKINOHSA-N N-{[3-(2-benzamido-4-methyl-1,3-thiazol-5-yl)-pyrazol-5-yl]carbonyl}-G-dR-G-dD-dD-dD-NH2 Chemical compound S1C(C=2NN=C(C=2)C(=O)NCC(=O)N[C@H](CCCN=C(N)N)C(=O)NCC(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CC(O)=O)C(N)=O)=C(C)N=C1NC(=O)C1=CC=CC=C1 OPFJDXRVMFKJJO-ZHHKINOHSA-N 0.000 claims description 2
- LJOOWESTVASNOG-UFJKPHDISA-N [(1s,3r,4ar,7s,8s,8as)-3-hydroxy-8-[2-[(4r)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,4,4a,7,8,8a-octahydronaphthalen-1-yl] (2s)-2-methylbutanoate Chemical compound C([C@H]1[C@@H](C)C=C[C@H]2C[C@@H](O)C[C@@H]([C@H]12)OC(=O)[C@@H](C)CC)CC1C[C@@H](O)CC(=O)O1 LJOOWESTVASNOG-UFJKPHDISA-N 0.000 claims description 2
- SMNRFWMNPDABKZ-WVALLCKVSA-N [[(2R,3S,4R,5S)-5-(2,6-dioxo-3H-pyridin-3-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [[[(2R,3S,4S,5R,6R)-4-fluoro-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl] hydrogen phosphate Chemical compound OC[C@H]1O[C@H](OP(O)(=O)OP(O)(=O)OP(O)(=O)OP(O)(=O)OC[C@H]2O[C@H]([C@H](O)[C@@H]2O)C2C=CC(=O)NC2=O)[C@H](O)[C@@H](F)[C@@H]1O SMNRFWMNPDABKZ-WVALLCKVSA-N 0.000 claims description 2
- KGNDCEVUMONOKF-UGPLYTSKSA-N benzyl n-[(2r)-1-[(2s,4r)-2-[[(2s)-6-amino-1-(1,3-benzoxazol-2-yl)-1,1-dihydroxyhexan-2-yl]carbamoyl]-4-[(4-methylphenyl)methoxy]pyrrolidin-1-yl]-1-oxo-4-phenylbutan-2-yl]carbamate Chemical compound C1=CC(C)=CC=C1CO[C@H]1CN(C(=O)[C@@H](CCC=2C=CC=CC=2)NC(=O)OCC=2C=CC=CC=2)[C@H](C(=O)N[C@@H](CCCCN)C(O)(O)C=2OC3=CC=CC=C3N=2)C1 KGNDCEVUMONOKF-UGPLYTSKSA-N 0.000 claims description 2
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 2
- 229940125904 compound 1 Drugs 0.000 claims description 2
- 229940125773 compound 10 Drugs 0.000 claims description 2
- 229940125758 compound 15 Drugs 0.000 claims description 2
- 229940125810 compound 20 Drugs 0.000 claims description 2
- 229940126086 compound 21 Drugs 0.000 claims description 2
- 229940125833 compound 23 Drugs 0.000 claims description 2
- 229940125846 compound 25 Drugs 0.000 claims description 2
- 229940127204 compound 29 Drugs 0.000 claims description 2
- 229940126214 compound 3 Drugs 0.000 claims description 2
- 229940125877 compound 31 Drugs 0.000 claims description 2
- 229940125878 compound 36 Drugs 0.000 claims description 2
- 229940125807 compound 37 Drugs 0.000 claims description 2
- 229940125844 compound 46 Drugs 0.000 claims description 2
- 229940125898 compound 5 Drugs 0.000 claims description 2
- 229940126545 compound 53 Drugs 0.000 claims description 2
- 229940127113 compound 57 Drugs 0.000 claims description 2
- ZLVXBBHTMQJRSX-VMGNSXQWSA-N jdtic Chemical compound C1([C@]2(C)CCN(C[C@@H]2C)C[C@H](C(C)C)NC(=O)[C@@H]2NCC3=CC(O)=CC=C3C2)=CC=CC(O)=C1 ZLVXBBHTMQJRSX-VMGNSXQWSA-N 0.000 claims description 2
- OOKAZRDERJMRCJ-KOUAFAAESA-N (3r)-7-[(1s,2s,4ar,6s,8s)-2,6-dimethyl-8-[(2s)-2-methylbutanoyl]oxy-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-3-hydroxy-5-oxoheptanoic acid Chemical compound C1=C[C@H](C)[C@H](CCC(=O)C[C@@H](O)CC(O)=O)C2[C@@H](OC(=O)[C@@H](C)CC)C[C@@H](C)C[C@@H]21 OOKAZRDERJMRCJ-KOUAFAAESA-N 0.000 claims 2
- VUEGYUOUAAVYAS-JGGQBBKZSA-N (6ar,9s,10ar)-9-(dimethylsulfamoylamino)-7-methyl-6,6a,8,9,10,10a-hexahydro-4h-indolo[4,3-fg]quinoline Chemical compound C1=CC([C@H]2C[C@@H](CN(C)[C@@H]2C2)NS(=O)(=O)N(C)C)=C3C2=CNC3=C1 VUEGYUOUAAVYAS-JGGQBBKZSA-N 0.000 claims 2
- DEVSOMFAQLZNKR-RJRFIUFISA-N (z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-n'-pyrazin-2-ylprop-2-enehydrazide Chemical compound FC(F)(F)C1=CC(C(F)(F)F)=CC(C2=NN(\C=C/C(=O)NNC=3N=CC=NC=3)C=N2)=C1 DEVSOMFAQLZNKR-RJRFIUFISA-N 0.000 claims 2
- KKHFRAFPESRGGD-UHFFFAOYSA-N 1,3-dimethyl-7-[3-(n-methylanilino)propyl]purine-2,6-dione Chemical compound C1=NC=2N(C)C(=O)N(C)C(=O)C=2N1CCCN(C)C1=CC=CC=C1 KKHFRAFPESRGGD-UHFFFAOYSA-N 0.000 claims 2
- MHSLDASSAFCCDO-UHFFFAOYSA-N 1-(5-tert-butyl-2-methylpyrazol-3-yl)-3-(4-pyridin-4-yloxyphenyl)urea Chemical compound CN1N=C(C(C)(C)C)C=C1NC(=O)NC(C=C1)=CC=C1OC1=CC=NC=C1 MHSLDASSAFCCDO-UHFFFAOYSA-N 0.000 claims 2
- WGFNXGPBPIJYLI-UHFFFAOYSA-N 2,6-difluoro-3-[(3-fluorophenyl)sulfonylamino]-n-(3-methoxy-1h-pyrazolo[3,4-b]pyridin-5-yl)benzamide Chemical compound C1=C2C(OC)=NNC2=NC=C1NC(=O)C(C=1F)=C(F)C=CC=1NS(=O)(=O)C1=CC=CC(F)=C1 WGFNXGPBPIJYLI-UHFFFAOYSA-N 0.000 claims 2
- VVCMGAUPZIKYTH-VGHSCWAPSA-N 2-acetyloxybenzoic acid;[(2s,3r)-4-(dimethylamino)-3-methyl-1,2-diphenylbutan-2-yl] propanoate;1,3,7-trimethylpurine-2,6-dione Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O.CN1C(=O)N(C)C(=O)C2=C1N=CN2C.C([C@](OC(=O)CC)([C@H](C)CN(C)C)C=1C=CC=CC=1)C1=CC=CC=C1 VVCMGAUPZIKYTH-VGHSCWAPSA-N 0.000 claims 2
- RSIWALKZYXPAGW-NSHDSACASA-N 6-(3-fluorophenyl)-3-methyl-7-[(1s)-1-(7h-purin-6-ylamino)ethyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one Chemical compound C=1([C@@H](NC=2C=3N=CNC=3N=CN=2)C)N=C2SC=C(C)N2C(=O)C=1C1=CC=CC(F)=C1 RSIWALKZYXPAGW-NSHDSACASA-N 0.000 claims 2
- JQUCWIWWWKZNCS-LESHARBVSA-N C(C1=CC=CC=C1)(=O)NC=1SC[C@H]2[C@@](N1)(CO[C@H](C2)C)C=2SC=C(N2)NC(=O)C2=NC=C(C=C2)OC(F)F Chemical compound C(C1=CC=CC=C1)(=O)NC=1SC[C@H]2[C@@](N1)(CO[C@H](C2)C)C=2SC=C(N2)NC(=O)C2=NC=C(C=C2)OC(F)F JQUCWIWWWKZNCS-LESHARBVSA-N 0.000 claims 2
- LVDRREOUMKACNJ-BKMJKUGQSA-N N-[(2R,3S)-2-(4-chlorophenyl)-1-(1,4-dimethyl-2-oxoquinolin-7-yl)-6-oxopiperidin-3-yl]-2-methylpropane-1-sulfonamide Chemical compound CC(C)CS(=O)(=O)N[C@H]1CCC(=O)N([C@@H]1c1ccc(Cl)cc1)c1ccc2c(C)cc(=O)n(C)c2c1 LVDRREOUMKACNJ-BKMJKUGQSA-N 0.000 claims 2
- QOVYHDHLFPKQQG-NDEPHWFRSA-N N[C@@H](CCC(=O)N1CCC(CC1)NC1=C2C=CC=CC2=NC(NCC2=CN(CCCNCCCNC3CCCCC3)N=N2)=N1)C(O)=O Chemical compound N[C@@H](CCC(=O)N1CCC(CC1)NC1=C2C=CC=CC2=NC(NCC2=CN(CCCNCCCNC3CCCCC3)N=N2)=N1)C(O)=O QOVYHDHLFPKQQG-NDEPHWFRSA-N 0.000 claims 2
- ZBELDPMWYXDLNY-UHFFFAOYSA-N methyl 9-(4-bromo-2-fluoroanilino)-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate Chemical compound C12=C3SC(C(=N)OC)=NC3=CC=C2N=CN=C1NC1=CC=C(Br)C=C1F ZBELDPMWYXDLNY-UHFFFAOYSA-N 0.000 claims 2
- OMBVEVHRIQULKW-DNQXCXABSA-M (3r,5r)-7-[3-(4-fluorophenyl)-8-oxo-7-phenyl-1-propan-2-yl-5,6-dihydro-4h-pyrrolo[2,3-c]azepin-2-yl]-3,5-dihydroxyheptanoate Chemical compound O=C1C=2N(C(C)C)C(CC[C@@H](O)C[C@@H](O)CC([O-])=O)=C(C=3C=CC(F)=CC=3)C=2CCCN1C1=CC=CC=C1 OMBVEVHRIQULKW-DNQXCXABSA-M 0.000 claims 1
- UNILWMWFPHPYOR-KXEYIPSPSA-M 1-[6-[2-[3-[3-[3-[2-[2-[3-[[2-[2-[[(2r)-1-[[2-[[(2r)-1-[3-[2-[2-[3-[[2-(2-amino-2-oxoethoxy)acetyl]amino]propoxy]ethoxy]ethoxy]propylamino]-3-hydroxy-1-oxopropan-2-yl]amino]-2-oxoethyl]amino]-3-[(2r)-2,3-di(hexadecanoyloxy)propyl]sulfanyl-1-oxopropan-2-yl Chemical compound O=C1C(SCCC(=O)NCCCOCCOCCOCCCNC(=O)COCC(=O)N[C@@H](CSC[C@@H](COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC)C(=O)NCC(=O)N[C@H](CO)C(=O)NCCCOCCOCCOCCCNC(=O)COCC(N)=O)CC(=O)N1CCNC(=O)CCCCCN\1C2=CC=C(S([O-])(=O)=O)C=C2CC/1=C/C=C/C=C/C1=[N+](CC)C2=CC=C(S([O-])(=O)=O)C=C2C1 UNILWMWFPHPYOR-KXEYIPSPSA-M 0.000 claims 1
- NPRYCHLHHVWLQZ-TURQNECASA-N 2-amino-9-[(2R,3S,4S,5R)-4-fluoro-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-prop-2-ynylpurin-8-one Chemical compound NC1=NC=C2N(C(N(C2=N1)[C@@H]1O[C@@H]([C@H]([C@H]1O)F)CO)=O)CC#C NPRYCHLHHVWLQZ-TURQNECASA-N 0.000 claims 1
- GAAHSFKFIMENOG-UHFFFAOYSA-N 4-[[2-[4-[2-(4-acetylpiperazin-1-yl)-2-oxoethyl]anilino]-5-fluoropyrimidin-4-yl]amino]-n-(2-chlorophenyl)benzamide Chemical compound C1CN(C(=O)C)CCN1C(=O)CC(C=C1)=CC=C1NC1=NC=C(F)C(NC=2C=CC(=CC=2)C(=O)NC=2C(=CC=CC=2)Cl)=N1 GAAHSFKFIMENOG-UHFFFAOYSA-N 0.000 claims 1
- PNUZDKCDAWUEGK-CYZMBNFOSA-N Sitafloxacin Chemical compound C([C@H]1N)N(C=2C(=C3C(C(C(C(O)=O)=CN3[C@H]3[C@H](C3)F)=O)=CC=2F)Cl)CC11CC1 PNUZDKCDAWUEGK-CYZMBNFOSA-N 0.000 claims 1
- JAXFJECJQZDFJS-XHEPKHHKSA-N gtpl8555 Chemical compound OC(=O)C[C@H](N)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N1CCC[C@@H]1C(=O)N[C@H](B1O[C@@]2(C)[C@H]3C[C@H](C3(C)C)C[C@H]2O1)CCC1=CC=C(F)C=C1 JAXFJECJQZDFJS-XHEPKHHKSA-N 0.000 claims 1
- FDBYIYFVSAHJLY-UHFFFAOYSA-N resmetirom Chemical compound N1C(=O)C(C(C)C)=CC(OC=2C(=CC(=CC=2Cl)N2C(NC(=O)C(C#N)=N2)=O)Cl)=N1 FDBYIYFVSAHJLY-UHFFFAOYSA-N 0.000 claims 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 abstract description 37
- 108091007960 PI3Ks Proteins 0.000 abstract description 36
- 238000000034 method Methods 0.000 abstract description 31
- 201000010099 disease Diseases 0.000 abstract description 20
- 208000035475 disorder Diseases 0.000 abstract description 17
- 239000008194 pharmaceutical composition Substances 0.000 abstract description 13
- 102000010400 1-phosphatidylinositol-3-kinase activity proteins Human genes 0.000 abstract 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 519
- 201000006417 multiple sclerosis Diseases 0.000 description 224
- 239000000203 mixture Substances 0.000 description 194
- 235000019439 ethyl acetate Nutrition 0.000 description 147
- 239000000047 product Substances 0.000 description 132
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 121
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 120
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 114
- 239000012267 brine Substances 0.000 description 106
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 106
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 102
- 239000007832 Na2SO4 Substances 0.000 description 94
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 94
- 229910052938 sodium sulfate Inorganic materials 0.000 description 94
- 235000011152 sodium sulphate Nutrition 0.000 description 94
- 239000007787 solid Substances 0.000 description 91
- 239000011541 reaction mixture Substances 0.000 description 85
- 239000012044 organic layer Substances 0.000 description 76
- 238000010898 silica gel chromatography Methods 0.000 description 68
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 66
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 65
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 65
- 239000002904 solvent Substances 0.000 description 63
- 239000000243 solution Substances 0.000 description 59
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 49
- 239000002585 base Substances 0.000 description 48
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 38
- 239000012071 phase Substances 0.000 description 37
- 102000038030 PI3Ks Human genes 0.000 description 35
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 34
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 33
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 32
- 238000002953 preparative HPLC Methods 0.000 description 32
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 31
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 28
- 238000004440 column chromatography Methods 0.000 description 28
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 27
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 26
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 26
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 26
- 239000003921 oil Substances 0.000 description 26
- LQZMLBORDGWNPD-UHFFFAOYSA-N N-iodosuccinimide Chemical compound IN1C(=O)CCC1=O LQZMLBORDGWNPD-UHFFFAOYSA-N 0.000 description 25
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 25
- 239000011734 sodium Substances 0.000 description 25
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 24
- 108090000430 Phosphatidylinositol 3-kinases Proteins 0.000 description 24
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 24
- 210000004027 cell Anatomy 0.000 description 23
- 239000012074 organic phase Substances 0.000 description 23
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 22
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 22
- 239000007858 starting material Substances 0.000 description 22
- HDUSGGZSLVCDKY-UHFFFAOYSA-N 1-(5-chloro-2-hydroxy-4-methylphenyl)ethanone Chemical compound CC(=O)C1=CC(Cl)=C(C)C=C1O HDUSGGZSLVCDKY-UHFFFAOYSA-N 0.000 description 20
- 238000004128 high performance liquid chromatography Methods 0.000 description 20
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 20
- 238000002347 injection Methods 0.000 description 19
- 239000007924 injection Substances 0.000 description 19
- 239000003208 petroleum Substances 0.000 description 19
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 18
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 18
- 239000012488 sample solution Substances 0.000 description 17
- 125000002950 monocyclic group Chemical group 0.000 description 15
- 229910000069 nitrogen hydride Inorganic materials 0.000 description 15
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 15
- VOQMFPPAYMCUTJ-UHFFFAOYSA-N 1-(5-chloro-4-fluoro-2-hydroxyphenyl)ethanone Chemical compound CC(=O)C1=CC(Cl)=C(F)C=C1O VOQMFPPAYMCUTJ-UHFFFAOYSA-N 0.000 description 14
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 14
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 12
- 210000001744 T-lymphocyte Anatomy 0.000 description 12
- 239000002253 acid Substances 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 12
- 239000011737 fluorine Substances 0.000 description 12
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 12
- INLFZTRHTAKIMI-UHFFFAOYSA-N imidazo[1,5-a]pyridin-8-amine Chemical compound NC1=CC=CN2C=NC=C12 INLFZTRHTAKIMI-UHFFFAOYSA-N 0.000 description 12
- JMANUKZDKDKBJP-UHFFFAOYSA-N imidazo[1,5-a]pyridine Chemical class C1=CC=CC2=CN=CN21 JMANUKZDKDKBJP-UHFFFAOYSA-N 0.000 description 12
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 12
- 239000010410 layer Substances 0.000 description 12
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 12
- 230000002829 reductive effect Effects 0.000 description 12
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 12
- 235000017557 sodium bicarbonate Nutrition 0.000 description 12
- LENLQGBLVGGAMF-UHFFFAOYSA-N tributyl([1,2,4]triazolo[1,5-a]pyridin-6-yl)stannane Chemical compound C1=C([Sn](CCCC)(CCCC)CCCC)C=CC2=NC=NN21 LENLQGBLVGGAMF-UHFFFAOYSA-N 0.000 description 12
- WJKHJLXJJJATHN-UHFFFAOYSA-N triflic anhydride Chemical compound FC(F)(F)S(=O)(=O)OS(=O)(=O)C(F)(F)F WJKHJLXJJJATHN-UHFFFAOYSA-N 0.000 description 12
- HRJLBPBABHQLKQ-UHFFFAOYSA-N 1-(5-chloro-4-fluoro-2-hydroxy-3-iodophenyl)ethanone Chemical compound CC(=O)C1=CC(Cl)=C(F)C(I)=C1O HRJLBPBABHQLKQ-UHFFFAOYSA-N 0.000 description 11
- 206010028980 Neoplasm Diseases 0.000 description 11
- 125000002619 bicyclic group Chemical group 0.000 description 11
- 239000012043 crude product Substances 0.000 description 11
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 11
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 11
- 229910000027 potassium carbonate Inorganic materials 0.000 description 11
- 235000015320 potassium carbonate Nutrition 0.000 description 11
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 10
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 10
- 150000001412 amines Chemical class 0.000 description 10
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid group Chemical group C(CC(O)(C(=O)O)CC(=O)O)(=O)O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 10
- 230000000694 effects Effects 0.000 description 10
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 10
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl chloride Substances ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 10
- 238000000926 separation method Methods 0.000 description 10
- 102100036052 Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit gamma isoform Human genes 0.000 description 9
- 101710096503 Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit gamma isoform Proteins 0.000 description 9
- 102000001708 Protein Isoforms Human genes 0.000 description 9
- 108010029485 Protein Isoforms Proteins 0.000 description 9
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 9
- 210000003719 b-lymphocyte Anatomy 0.000 description 9
- 239000012230 colorless oil Substances 0.000 description 9
- 238000001914 filtration Methods 0.000 description 9
- 239000001301 oxygen Substances 0.000 description 9
- RCEYBRZCZBLABQ-UHFFFAOYSA-N 1-(5-chloro-2-hydroxy-3-iodo-4-methylphenyl)ethanone Chemical compound CC(=O)C1=CC(Cl)=C(C)C(I)=C1O RCEYBRZCZBLABQ-UHFFFAOYSA-N 0.000 description 8
- GQHTUMJGOHRCHB-UHFFFAOYSA-N 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine Chemical compound C1CCCCN2CCCN=C21 GQHTUMJGOHRCHB-UHFFFAOYSA-N 0.000 description 8
- 208000010839 B-cell chronic lymphocytic leukemia Diseases 0.000 description 8
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 8
- 125000004432 carbon atom Chemical group C* 0.000 description 8
- 230000006870 function Effects 0.000 description 8
- 125000001183 hydrocarbyl group Chemical group 0.000 description 8
- QLNJFJADRCOGBJ-UHFFFAOYSA-N propionamide Chemical compound CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 description 8
- 229940080818 propionamide Drugs 0.000 description 8
- 230000011664 signaling Effects 0.000 description 8
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 8
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 8
- CXNIUSPIQKWYAI-UHFFFAOYSA-N xantphos Chemical compound C=12OC3=C(P(C=4C=CC=CC=4)C=4C=CC=CC=4)C=CC=C3C(C)(C)C2=CC=CC=1P(C=1C=CC=CC=1)C1=CC=CC=C1 CXNIUSPIQKWYAI-UHFFFAOYSA-N 0.000 description 8
- KZPYGQFFRCFCPP-UHFFFAOYSA-N 1,1'-bis(diphenylphosphino)ferrocene Chemical compound [Fe+2].C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1 KZPYGQFFRCFCPP-UHFFFAOYSA-N 0.000 description 7
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 7
- 241000699670 Mus sp. Species 0.000 description 7
- 125000004122 cyclic group Chemical group 0.000 description 7
- 230000005764 inhibitory process Effects 0.000 description 7
- 229910052740 iodine Inorganic materials 0.000 description 7
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 7
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 7
- 238000000746 purification Methods 0.000 description 7
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 7
- 229910000029 sodium carbonate Inorganic materials 0.000 description 7
- 235000017550 sodium carbonate Nutrition 0.000 description 7
- MNWBNISUBARLIT-UHFFFAOYSA-N sodium cyanide Chemical compound [Na+].N#[C-] MNWBNISUBARLIT-UHFFFAOYSA-N 0.000 description 7
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 7
- 235000019345 sodium thiosulphate Nutrition 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 7
- 238000004809 thin layer chromatography Methods 0.000 description 7
- PWRBCZZQRRPXAB-UHFFFAOYSA-N 3-chloropyridine Chemical compound ClC1=CC=CN=C1 PWRBCZZQRRPXAB-UHFFFAOYSA-N 0.000 description 6
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 6
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 6
- 208000031671 Large B-Cell Diffuse Lymphoma Diseases 0.000 description 6
- 208000031422 Lymphocytic Chronic B-Cell Leukemia Diseases 0.000 description 6
- 229910019213 POCl3 Inorganic materials 0.000 description 6
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 6
- 235000019270 ammonium chloride Nutrition 0.000 description 6
- 201000011510 cancer Diseases 0.000 description 6
- 229910052799 carbon Inorganic materials 0.000 description 6
- 230000003197 catalytic effect Effects 0.000 description 6
- 238000004296 chiral HPLC Methods 0.000 description 6
- 125000001309 chloro group Chemical group Cl* 0.000 description 6
- 206010012818 diffuse large B-cell lymphoma Diseases 0.000 description 6
- 230000035772 mutation Effects 0.000 description 6
- 230000001105 regulatory effect Effects 0.000 description 6
- 239000012279 sodium borohydride Substances 0.000 description 6
- 229910000033 sodium borohydride Inorganic materials 0.000 description 6
- 239000011593 sulfur Substances 0.000 description 6
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 6
- IALMZCHEKHGVSY-UHFFFAOYSA-N 2-[5-chloro-4-fluoro-2-propan-2-yloxy-3-[6-(trifluoromethyl)pyridin-3-yl]phenyl]propanoic acid Chemical compound ClC=1C(=C(C(=C(C=1)C(C(=O)O)C)OC(C)C)C=1C=NC(=CC=1)C(F)(F)F)F IALMZCHEKHGVSY-UHFFFAOYSA-N 0.000 description 5
- 125000004493 2-methylbut-1-yl group Chemical group CC(C*)CC 0.000 description 5
- 125000004917 3-methyl-2-butyl group Chemical group CC(C(C)*)C 0.000 description 5
- XLHYAEBESNFTCA-UHFFFAOYSA-N 4-chloro-3-fluorophenol Chemical compound OC1=CC=C(Cl)C(F)=C1 XLHYAEBESNFTCA-UHFFFAOYSA-N 0.000 description 5
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 5
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 5
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 5
- 101001120056 Homo sapiens Phosphatidylinositol 3-kinase regulatory subunit alpha Proteins 0.000 description 5
- 206010021245 Idiopathic thrombocytopenic purpura Diseases 0.000 description 5
- 102100026169 Phosphatidylinositol 3-kinase regulatory subunit alpha Human genes 0.000 description 5
- 208000031951 Primary immunodeficiency Diseases 0.000 description 5
- 208000031981 Thrombocytopenic Idiopathic Purpura Diseases 0.000 description 5
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 5
- 239000012346 acetyl chloride Substances 0.000 description 5
- 125000002029 aromatic hydrocarbon group Chemical group 0.000 description 5
- 201000003710 autoimmune thrombocytopenic purpura Diseases 0.000 description 5
- 230000033228 biological regulation Effects 0.000 description 5
- 239000003153 chemical reaction reagent Substances 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- 238000004587 chromatography analysis Methods 0.000 description 5
- 230000004069 differentiation Effects 0.000 description 5
- 150000002460 imidazoles Chemical class 0.000 description 5
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 5
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 5
- FMKOJHQHASLBPH-UHFFFAOYSA-N isopropyl iodide Chemical compound CC(C)I FMKOJHQHASLBPH-UHFFFAOYSA-N 0.000 description 5
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 5
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 5
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 5
- 239000000546 pharmaceutical excipient Substances 0.000 description 5
- 206010039073 rheumatoid arthritis Diseases 0.000 description 5
- 208000024891 symptom Diseases 0.000 description 5
- 201000000596 systemic lupus erythematosus Diseases 0.000 description 5
- YWCRKRXZQPVQFC-UHFFFAOYSA-N 1-(3-bromo-5-chloro-4-fluoro-2-hydroxyphenyl)ethanone Chemical compound CC(=O)C1=CC(Cl)=C(F)C(Br)=C1O YWCRKRXZQPVQFC-UHFFFAOYSA-N 0.000 description 4
- KUQDVFZXIWFJGV-UHFFFAOYSA-N 1-(3-bromo-5-chloro-4-fluoro-2-propan-2-yloxyphenyl)ethanone Chemical compound BrC=1C(=C(C=C(C=1F)Cl)C(C)=O)OC(C)C KUQDVFZXIWFJGV-UHFFFAOYSA-N 0.000 description 4
- UTSOWTMADMJMHY-UHFFFAOYSA-N 1-[5-chloro-3-(6-chloropyridin-3-yl)-4-fluoro-2-hydroxyphenyl]ethanone Chemical compound ClC=1C(=C(C(=C(C=1)C(C)=O)O)C=1C=NC(=CC=1)Cl)F UTSOWTMADMJMHY-UHFFFAOYSA-N 0.000 description 4
- PHTPUSDIFBSVJO-UHFFFAOYSA-N 1-[5-chloro-4-fluoro-2-hydroxy-3-[6-(trifluoromethyl)pyridin-3-yl]phenyl]ethanone Chemical compound ClC=1C(=C(C(=C(C=1)C(C)=O)O)C=1C=NC(=CC=1)C(F)(F)F)F PHTPUSDIFBSVJO-UHFFFAOYSA-N 0.000 description 4
- ZSEQAMAIFWZICW-UHFFFAOYSA-N 1-[5-chloro-4-fluoro-2-propan-2-yloxy-3-[6-(trifluoromethyl)pyridin-3-yl]phenyl]ethanone Chemical compound ClC=1C(=C(C(=C(C=1)C(C)=O)OC(C)C)C=1C=NC(=CC=1)C(F)(F)F)F ZSEQAMAIFWZICW-UHFFFAOYSA-N 0.000 description 4
- HZNVUJQVZSTENZ-UHFFFAOYSA-N 2,3-dichloro-5,6-dicyano-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(C#N)=C(C#N)C1=O HZNVUJQVZSTENZ-UHFFFAOYSA-N 0.000 description 4
- UAUHUJOCZDVIAN-UHFFFAOYSA-N 2-(3-bromo-5-chloro-4-fluoro-2-propan-2-yloxyphenyl)propanoic acid Chemical compound BrC=1C(=C(C=C(C=1F)Cl)C(C(=O)O)C)OC(C)C UAUHUJOCZDVIAN-UHFFFAOYSA-N 0.000 description 4
- FCSSPCOFDUKHPV-UHFFFAOYSA-N 2-Propenyl propyl disulfide Chemical compound CCCSSCC=C FCSSPCOFDUKHPV-UHFFFAOYSA-N 0.000 description 4
- XLNHIOKPJSFFJD-UHFFFAOYSA-N 2-[5-chloro-3-(6-chloropyridin-3-yl)-4-fluoro-2-propan-2-yloxyphenyl]propan-1-ol Chemical compound ClC=1C(=C(C(=C(C=1)C(CO)C)OC(C)C)C=1C=NC(=CC=1)Cl)F XLNHIOKPJSFFJD-UHFFFAOYSA-N 0.000 description 4
- IIWHJLMSNDKWSV-UHFFFAOYSA-N 2-[5-chloro-4-fluoro-2-propan-2-yloxy-3-[6-(trifluoromethyl)pyridin-3-yl]phenyl]propan-1-ol Chemical compound ClC=1C(=C(C(=C(C=1)C(CO)C)OC(C)C)C=1C=NC(=CC=1)C(F)(F)F)F IIWHJLMSNDKWSV-UHFFFAOYSA-N 0.000 description 4
- YJAUOMJZNFPPMV-UHFFFAOYSA-N 2-chloro-5-(3-chloro-2-fluoro-6-propan-2-yloxy-5-prop-1-en-2-ylphenyl)pyridine Chemical compound ClC1=NC=C(C=C1)C1=C(C(=CC(=C1OC(C)C)C(=C)C)Cl)F YJAUOMJZNFPPMV-UHFFFAOYSA-N 0.000 description 4
- 125000004398 2-methyl-2-butyl group Chemical group CC(C)(CC)* 0.000 description 4
- JEKWFNHTPCLLLO-UHFFFAOYSA-N 3-bromo-1-chloro-2-fluoro-4-propan-2-yloxy-5-prop-1-en-2-ylbenzene Chemical compound BrC=1C(=C(C=C(C=1OC(C)C)C(=C)C)Cl)F JEKWFNHTPCLLLO-UHFFFAOYSA-N 0.000 description 4
- IPESTLQMUSQOPL-UHFFFAOYSA-N 5-(3-chloro-2-fluoro-6-propan-2-yloxy-5-prop-1-en-2-ylphenyl)-2-(trifluoromethyl)pyridine Chemical compound ClC=1C(=C(C(=C(C=1)C(=C)C)OC(C)C)C=1C=CC(=NC=1)C(F)(F)F)F IPESTLQMUSQOPL-UHFFFAOYSA-N 0.000 description 4
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 4
- 229910004373 HOAc Inorganic materials 0.000 description 4
- 241000282412 Homo Species 0.000 description 4
- 206010061598 Immunodeficiency Diseases 0.000 description 4
- 208000029462 Immunodeficiency disease Diseases 0.000 description 4
- 206010061218 Inflammation Diseases 0.000 description 4
- 241001465754 Metazoa Species 0.000 description 4
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 4
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 4
- 101100030361 Neurospora crassa (strain ATCC 24698 / 74-OR23-1A / CBS 708.71 / DSM 1257 / FGSC 987) pph-3 gene Proteins 0.000 description 4
- 208000015914 Non-Hodgkin lymphomas Diseases 0.000 description 4
- 108030003690 Phosphatidylinositol-4,5-bisphosphate 3-kinases Proteins 0.000 description 4
- 229910006124 SOCl2 Inorganic materials 0.000 description 4
- 229910000831 Steel Inorganic materials 0.000 description 4
- 208000001589 activated PI3K-delta syndrome Diseases 0.000 description 4
- 238000005576 amination reaction Methods 0.000 description 4
- 210000004369 blood Anatomy 0.000 description 4
- 239000008280 blood Substances 0.000 description 4
- 125000001246 bromo group Chemical group Br* 0.000 description 4
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 4
- 238000009833 condensation Methods 0.000 description 4
- 230000005494 condensation Effects 0.000 description 4
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 4
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 4
- 238000011161 development Methods 0.000 description 4
- 230000018109 developmental process Effects 0.000 description 4
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 4
- 229940079593 drug Drugs 0.000 description 4
- 201000003444 follicular lymphoma Diseases 0.000 description 4
- 210000001280 germinal center Anatomy 0.000 description 4
- 210000001102 germinal center b cell Anatomy 0.000 description 4
- 125000005843 halogen group Chemical group 0.000 description 4
- 229960003445 idelalisib Drugs 0.000 description 4
- YKLIKGKUANLGSB-HNNXBMFYSA-N idelalisib Chemical compound C1([C@@H](NC=2[C]3N=CN=C3N=CN=2)CC)=NC2=CC=CC(F)=C2C(=O)N1C1=CC=CC=C1 YKLIKGKUANLGSB-HNNXBMFYSA-N 0.000 description 4
- 230000007813 immunodeficiency Effects 0.000 description 4
- 208000014135 immunodeficiency 14 Diseases 0.000 description 4
- 230000004054 inflammatory process Effects 0.000 description 4
- LSEFCHWGJNHZNT-UHFFFAOYSA-M methyl(triphenyl)phosphanium;bromide Chemical compound [Br-].C=1C=CC=CC=1[P+](C=1C=CC=CC=1)(C)C1=CC=CC=C1 LSEFCHWGJNHZNT-UHFFFAOYSA-M 0.000 description 4
- GDOPTJXRTPNYNR-UHFFFAOYSA-N methyl-cyclopentane Natural products CC1CCCC1 GDOPTJXRTPNYNR-UHFFFAOYSA-N 0.000 description 4
- 210000000056 organ Anatomy 0.000 description 4
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 4
- 230000002265 prevention Effects 0.000 description 4
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 4
- 210000003289 regulatory T cell Anatomy 0.000 description 4
- 125000006413 ring segment Chemical group 0.000 description 4
- 239000000741 silica gel Substances 0.000 description 4
- 229910002027 silica gel Inorganic materials 0.000 description 4
- 239000010959 steel Substances 0.000 description 4
- 239000003826 tablet Substances 0.000 description 4
- 239000011701 zinc Substances 0.000 description 4
- QOWBXWFYRXSBAS-UHFFFAOYSA-N (2,4-dimethoxyphenyl)methanamine Chemical compound COC1=CC=C(CN)C(OC)=C1 QOWBXWFYRXSBAS-UHFFFAOYSA-N 0.000 description 3
- IOQORVDNYPOZPL-VQTJNVASSA-N (5S,6R)-5-(4-chlorophenyl)-6-cyclopropyl-3-[6-methoxy-5-(4-methylimidazol-1-yl)pyridin-2-yl]-5,6-dihydro-2H-1,2,4-oxadiazine Chemical compound ClC1=CC=C(C=C1)[C@@H]1NC(=NO[C@@H]1C1CC1)C1=NC(=C(C=C1)N1C=NC(=C1)C)OC IOQORVDNYPOZPL-VQTJNVASSA-N 0.000 description 3
- NEWKAXPVJZLECS-UHFFFAOYSA-N 1-(4-chloro-5-fluoro-2-hydroxyphenyl)ethanone Chemical compound CC(=O)C1=CC(F)=C(Cl)C=C1O NEWKAXPVJZLECS-UHFFFAOYSA-N 0.000 description 3
- IMJDZOGXYXJSBH-UHFFFAOYSA-N 1-(5-chloro-2-ethoxy-3-iodo-4-methylphenyl)ethanol Chemical compound CCOC1=C(I)C(C)=C(Cl)C=C1C(C)O IMJDZOGXYXJSBH-UHFFFAOYSA-N 0.000 description 3
- SFAGKEPCFUVVFB-UHFFFAOYSA-N 1-(5-chloro-2-ethoxy-3-iodo-4-methylphenyl)ethanone Chemical compound CCOC1=C(I)C(C)=C(Cl)C=C1C(C)=O SFAGKEPCFUVVFB-UHFFFAOYSA-N 0.000 description 3
- CTBNZCXPULIMIZ-UHFFFAOYSA-N 1-(5-chloro-2-ethoxy-4-fluoro-3-iodophenyl)ethanone Chemical compound CCOC1=C(I)C(F)=C(Cl)C=C1C(C)=O CTBNZCXPULIMIZ-UHFFFAOYSA-N 0.000 description 3
- CUQUONIEKMZSIW-UHFFFAOYSA-N 1-(5-chloro-2-ethoxy-4-methyl-3-morpholin-4-ylphenyl)ethanol Chemical compound ClC=1C(=C(C(=C(C=1)C(C)O)OCC)N1CCOCC1)C CUQUONIEKMZSIW-UHFFFAOYSA-N 0.000 description 3
- QHOHMWIYMNXIKM-UHFFFAOYSA-N 1-[5-chloro-3-(6-chloropyridin-3-yl)-4-fluoro-2-propan-2-yloxyphenyl]ethanone Chemical compound ClC=1C(=C(C(=C(C=1)C(C)=O)OC(C)C)C=1C=NC(=CC=1)Cl)F QHOHMWIYMNXIKM-UHFFFAOYSA-N 0.000 description 3
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-Lutidine Substances CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 3
- HQPNSSFLFCZDNF-UHFFFAOYSA-N 2-(3-bromo-5-chloro-4-fluoro-2-propan-2-yloxyphenyl)propan-1-ol Chemical compound BrC=1C(=C(C=C(C=1F)Cl)C(CO)C)OC(C)C HQPNSSFLFCZDNF-UHFFFAOYSA-N 0.000 description 3
- BQAWHDZXKMWCAV-UHFFFAOYSA-N 2-[5-chloro-3-(6-chloropyridin-3-yl)-4-fluoro-2-propan-2-yloxyphenyl]propanoic acid Chemical compound ClC=1C(=C(C(=C(C=1)C(C(=O)O)C)OC(C)C)C=1C=NC(=CC=1)Cl)F BQAWHDZXKMWCAV-UHFFFAOYSA-N 0.000 description 3
- FFNVQNRYTPFDDP-UHFFFAOYSA-N 2-cyanopyridine Chemical compound N#CC1=CC=CC=N1 FFNVQNRYTPFDDP-UHFFFAOYSA-N 0.000 description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- 208000023275 Autoimmune disease Diseases 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- 108091006027 G proteins Proteins 0.000 description 3
- 102000030782 GTP binding Human genes 0.000 description 3
- 108091000058 GTP-Binding Proteins 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- 208000035186 Hemolytic Autoimmune Anemia Diseases 0.000 description 3
- 206010020751 Hypersensitivity Diseases 0.000 description 3
- 208000025205 Mantle-Cell Lymphoma Diseases 0.000 description 3
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 3
- 101710093328 Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit alpha isoform Proteins 0.000 description 3
- 102100038332 Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit alpha isoform Human genes 0.000 description 3
- 102100036061 Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit beta isoform Human genes 0.000 description 3
- 101710125691 Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit beta isoform Proteins 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- 230000005867 T cell response Effects 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 230000004913 activation Effects 0.000 description 3
- 239000004480 active ingredient Substances 0.000 description 3
- 125000000304 alkynyl group Chemical group 0.000 description 3
- 208000006673 asthma Diseases 0.000 description 3
- 201000000448 autoimmune hemolytic anemia Diseases 0.000 description 3
- UWTDFICHZKXYAC-UHFFFAOYSA-N boron;oxolane Chemical compound [B].C1CCOC1 UWTDFICHZKXYAC-UHFFFAOYSA-N 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 208000032852 chronic lymphocytic leukemia Diseases 0.000 description 3
- 238000005520 cutting process Methods 0.000 description 3
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 3
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 3
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 3
- 230000002950 deficient Effects 0.000 description 3
- 230000001419 dependent effect Effects 0.000 description 3
- 239000000032 diagnostic agent Substances 0.000 description 3
- 229940039227 diagnostic agent Drugs 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 239000012458 free base Substances 0.000 description 3
- 230000028993 immune response Effects 0.000 description 3
- 230000002779 inactivation Effects 0.000 description 3
- 208000027866 inflammatory disease Diseases 0.000 description 3
- 239000011630 iodine Substances 0.000 description 3
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 3
- 238000002955 isolation Methods 0.000 description 3
- 210000000265 leukocyte Anatomy 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 230000007246 mechanism Effects 0.000 description 3
- XLURAXFXXHZJJI-UHFFFAOYSA-N methyl 3-(N-(2-cyanoacetyl)anilino)pentanoate Chemical compound CCC(CC(=O)OC)N(C(=O)CC#N)C1=CC=CC=C1 XLURAXFXXHZJJI-UHFFFAOYSA-N 0.000 description 3
- SSOTYQVWRNGZOH-UHFFFAOYSA-N methyl 3-anilinopent-2-enoate Chemical compound COC(=O)C=C(CC)NC1=CC=CC=C1 SSOTYQVWRNGZOH-UHFFFAOYSA-N 0.000 description 3
- PWOBQFDKNJTZND-UHFFFAOYSA-N methyl 3-anilinopentanoate Chemical compound COC(=O)CC(CC)NC1=CC=CC=C1 PWOBQFDKNJTZND-UHFFFAOYSA-N 0.000 description 3
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 3
- 125000004430 oxygen atom Chemical group O* 0.000 description 3
- SIOXPEMLGUPBBT-UHFFFAOYSA-N picolinic acid Chemical compound OC(=O)C1=CC=CC=N1 SIOXPEMLGUPBBT-UHFFFAOYSA-N 0.000 description 3
- 108090000623 proteins and genes Proteins 0.000 description 3
- 125000004076 pyridyl group Chemical group 0.000 description 3
- 102000027426 receptor tyrosine kinases Human genes 0.000 description 3
- 108091008598 receptor tyrosine kinases Proteins 0.000 description 3
- 230000007115 recruitment Effects 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 3
- 125000004434 sulfur atom Chemical group 0.000 description 3
- 208000011580 syndromic disease Diseases 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- 230000008685 targeting Effects 0.000 description 3
- 210000001519 tissue Anatomy 0.000 description 3
- YTNMKXLFLXQYTH-UHFFFAOYSA-N (3-bromo-2-methylphenyl)-diphenylphosphane Chemical compound BrC=1C(=C(C=CC=1)P(C1=CC=CC=C1)C1=CC=CC=C1)C YTNMKXLFLXQYTH-UHFFFAOYSA-N 0.000 description 2
- OYXCTHVMOQFONQ-UHFFFAOYSA-N (3-chloropyridin-2-yl)methanamine;dihydrochloride Chemical compound Cl.Cl.NCC1=NC=CC=C1Cl OYXCTHVMOQFONQ-UHFFFAOYSA-N 0.000 description 2
- DEPQAELCACZEMN-UHFFFAOYSA-N (3-chloropyridin-2-yl)methanamine;hydrochloride Chemical compound Cl.NCC1=NC=CC=C1Cl DEPQAELCACZEMN-UHFFFAOYSA-N 0.000 description 2
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 2
- 125000005962 1,4-oxazepanyl group Chemical group 0.000 description 2
- MJPAOSGAPWEJHC-UHFFFAOYSA-N 1-(3-amino-5-chloro-2-ethoxy-4-methylphenyl)ethanone Chemical compound NC=1C(=C(C=C(C=1C)Cl)C(C)=O)OCC MJPAOSGAPWEJHC-UHFFFAOYSA-N 0.000 description 2
- LQNYOSWQUKAKNL-UHFFFAOYSA-N 1-(3-chloropyridin-2-yl)ethanamine Chemical compound CC(N)C1=NC=CC=C1Cl LQNYOSWQUKAKNL-UHFFFAOYSA-N 0.000 description 2
- LZDZGKFMOJUAKB-UHFFFAOYSA-N 1-(4,5-dichloro-2-hydroxyphenyl)ethanone Chemical compound CC(=O)C1=CC(Cl)=C(Cl)C=C1O LZDZGKFMOJUAKB-UHFFFAOYSA-N 0.000 description 2
- PNDYFOOZNPRWEA-UHFFFAOYSA-N 1-(5-chloro-2-ethoxy-4-fluoro-3-iodophenyl)ethanol Chemical compound ClC=1C(=C(C(=C(C=1)C(C)O)OCC)I)F PNDYFOOZNPRWEA-UHFFFAOYSA-N 0.000 description 2
- BIJTXUJDYGXALS-UHFFFAOYSA-N 1-(5-chloro-2-ethoxy-4-methyl-3-morpholin-4-ylphenyl)ethanone Chemical compound ClC=1C(=C(C(=C(C=1)C(C)=O)OCC)N1CCOCC1)C BIJTXUJDYGXALS-UHFFFAOYSA-N 0.000 description 2
- AWCWCCNDRWFRJC-UHFFFAOYSA-N 1-(5-chloro-2-ethoxy-4-methyl-3-nitrophenyl)ethanone Chemical compound ClC=1C(=C(C(=C(C=1)C(C)=O)OCC)[N+](=O)[O-])C AWCWCCNDRWFRJC-UHFFFAOYSA-N 0.000 description 2
- BCKNEGUIQOGMCD-UHFFFAOYSA-N 1-(5-chloro-2-ethoxy-4-methylphenyl)ethanol Chemical compound CCOC1=CC(C)=C(Cl)C=C1C(C)O BCKNEGUIQOGMCD-UHFFFAOYSA-N 0.000 description 2
- AQEIZZYETVGOGX-UHFFFAOYSA-N 1-(5-chloro-2-ethoxy-4-methylphenyl)ethanone Chemical compound CCOC1=CC(C)=C(Cl)C=C1C(C)=O AQEIZZYETVGOGX-UHFFFAOYSA-N 0.000 description 2
- UQVHWGGRXQWGGY-UHFFFAOYSA-N 1-(5-chloro-2-hydroxy-4-methyl-3-nitrophenyl)ethanone Chemical compound CC(=O)C1=CC(Cl)=C(C)C([N+]([O-])=O)=C1O UQVHWGGRXQWGGY-UHFFFAOYSA-N 0.000 description 2
- LSYLYVABWOCJRT-UHFFFAOYSA-N 1-(5-chloro-2-methoxy-4-methyl-3-pyridin-3-ylphenyl)ethanol Chemical compound ClC=1C(=C(C(=C(C=1)C(C)O)OC)C=1C=CC=NC=1)C LSYLYVABWOCJRT-UHFFFAOYSA-N 0.000 description 2
- HCSVVHOWMIGNFT-UHFFFAOYSA-N 1-(5-chloro-3-iodo-2-methoxy-4-methylphenyl)ethanol Chemical compound ClC=1C(=C(C(=C(C=1)C(C)O)OC)I)C HCSVVHOWMIGNFT-UHFFFAOYSA-N 0.000 description 2
- YKQUFCLEMACJAK-UHFFFAOYSA-N 1-(5-chloro-3-iodo-2-methoxy-4-methylphenyl)ethanone Chemical compound COC1=C(I)C(C)=C(Cl)C=C1C(C)=O YKQUFCLEMACJAK-UHFFFAOYSA-N 0.000 description 2
- COHVEJAEBUYUEV-UHFFFAOYSA-N 1-[5-chloro-2-ethoxy-3-(4-methoxyphenyl)-4-methylphenyl]ethanone Chemical compound ClC=1C=C(C(=C(C=1C)C1=CC=C(C=C1)OC)OCC)C(C)=O COHVEJAEBUYUEV-UHFFFAOYSA-N 0.000 description 2
- CMJGCWFPFFVNEC-UHFFFAOYSA-N 1-[5-chloro-2-ethoxy-4-fluoro-3-(oxan-4-yl)phenyl]ethanone Chemical compound ClC=1C(=C(C(=C(C=1)C(C)=O)OCC)C1CCOCC1)F CMJGCWFPFFVNEC-UHFFFAOYSA-N 0.000 description 2
- BZZYQTMIMCFIEP-UHFFFAOYSA-N 1-[5-chloro-2-ethoxy-4-fluoro-3-[6-(trifluoromethyl)pyridin-3-yl]phenyl]ethanol Chemical compound ClC=1C(=C(C(=C(C=1)C(C)O)OCC)C=1C=NC(=CC=1)C(F)(F)F)F BZZYQTMIMCFIEP-UHFFFAOYSA-N 0.000 description 2
- BYNWFCMSSKLQMM-UHFFFAOYSA-N 1-[5-chloro-2-ethoxy-4-methyl-3-(6-methylpyridin-3-yl)phenyl]ethanol Chemical compound ClC=1C(=C(C(=C(C=1)C(C)O)OCC)C=1C=NC(=CC=1)C)C BYNWFCMSSKLQMM-UHFFFAOYSA-N 0.000 description 2
- HQQIGTWWGYYZPI-UHFFFAOYSA-N 1-[5-chloro-2-hydroxy-4-methyl-3-[6-(trifluoromethyl)pyridin-3-yl]phenyl]ethanone Chemical compound ClC=1C(=C(C(=C(C=1)C(C)=O)O)C=1C=NC(=CC=1)C(F)(F)F)C HQQIGTWWGYYZPI-UHFFFAOYSA-N 0.000 description 2
- APUOHFZGOSCGRI-UHFFFAOYSA-N 1-[5-chloro-3-(3,6-dihydro-2H-pyran-4-yl)-2-ethoxy-4-fluorophenyl]ethanol Chemical compound ClC=1C(=C(C(=C(C=1)C(C)O)OCC)C=1CCOCC=1)F APUOHFZGOSCGRI-UHFFFAOYSA-N 0.000 description 2
- RPZATSRXKUVWEZ-UHFFFAOYSA-N 1-[5-chloro-3-(3,6-dihydro-2H-pyran-4-yl)-2-ethoxy-4-fluorophenyl]ethanone Chemical compound ClC=1C(=C(C(=C(C=1)C(C)=O)OCC)C=1CCOCC=1)F RPZATSRXKUVWEZ-UHFFFAOYSA-N 0.000 description 2
- KDVKTIPDKJXGQW-UHFFFAOYSA-N 1-[5-chloro-4-fluoro-2-hydroxy-3-[2-methoxy-6-(trifluoromethyl)pyridin-3-yl]phenyl]ethanone Chemical compound ClC=1C(=C(C(=C(C=1)C(C)=O)O)C=1C(=NC(=CC=1)C(F)(F)F)OC)F KDVKTIPDKJXGQW-UHFFFAOYSA-N 0.000 description 2
- KKRWUQNDHSJDLK-UHFFFAOYSA-N 1-[5-chloro-4-methyl-2-propan-2-yloxy-3-[6-(trifluoromethyl)pyridin-3-yl]phenyl]ethanol Chemical compound ClC=1C(=C(C(=C(C=1)C(C)O)OC(C)C)C=1C=NC(=CC=1)C(F)(F)F)C KKRWUQNDHSJDLK-UHFFFAOYSA-N 0.000 description 2
- SBQZQBBNLQOIDR-UHFFFAOYSA-N 1-chloro-4-ethoxy-3-(4-methoxyphenyl)-2-methyl-5-prop-1-en-2-ylbenzene Chemical group ClC=1C(=C(C(=C(C=1)C(=C)C)OCC)C1=CC=C(C=C1)OC)C SBQZQBBNLQOIDR-UHFFFAOYSA-N 0.000 description 2
- QHNMNLVIVUEVGS-UHFFFAOYSA-N 1-chloro-5-(1-chloroethyl)-4-ethoxy-2-methylbenzene Chemical compound ClC1=C(C=C(C(=C1)C(C)Cl)OCC)C QHNMNLVIVUEVGS-UHFFFAOYSA-N 0.000 description 2
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 2
- SODQFLRLAOALCF-UHFFFAOYSA-N 1lambda3-bromacyclohexa-1,3,5-triene Chemical compound Br1=CC=CC=C1 SODQFLRLAOALCF-UHFFFAOYSA-N 0.000 description 2
- IDRYDEJZKVBXMK-UHFFFAOYSA-N 2-(5-chloro-2-ethoxy-3-iodo-4-methylphenyl)propanenitrile Chemical compound ClC=1C(=C(C(=C(C=1)C(C#N)C)OCC)I)C IDRYDEJZKVBXMK-UHFFFAOYSA-N 0.000 description 2
- UGLOHXHEAJUEHY-UHFFFAOYSA-N 2-(5-chloro-2-ethoxy-4-methylphenyl)propanenitrile Chemical compound ClC=1C(=CC(=C(C=1)C(C#N)C)OCC)C UGLOHXHEAJUEHY-UHFFFAOYSA-N 0.000 description 2
- DZVYHTQPNAFCLK-UHFFFAOYSA-N 2-(5-chloro-2-methoxy-4-methyl-3-pyridin-3-ylphenyl)propanenitrile Chemical compound ClC=1C(=C(C(=C(C=1)C(C#N)C)OC)C=1C=NC=CC=1)C DZVYHTQPNAFCLK-UHFFFAOYSA-N 0.000 description 2
- AEEMDRFWLKYBBS-UHFFFAOYSA-N 2-(5-chloro-2-methoxy-4-methyl-3-pyridin-3-ylphenyl)propanoic acid Chemical compound ClC=1C(=C(C(=C(C=1)C(C(=O)O)C)OC)C=1C=NC=CC=1)C AEEMDRFWLKYBBS-UHFFFAOYSA-N 0.000 description 2
- UNLSKZGWPPJDBO-UHFFFAOYSA-N 2-[5-chloro-2-ethoxy-3-(4-methoxyphenyl)-4-methylphenyl]propan-1-ol Chemical compound ClC=1C=C(C(=C(C=1C)C1=CC=C(C=C1)OC)OCC)C(CO)C UNLSKZGWPPJDBO-UHFFFAOYSA-N 0.000 description 2
- DHMGQBXJJQAGLA-UHFFFAOYSA-N 2-[5-chloro-2-ethoxy-3-(4-methoxyphenyl)-4-methylphenyl]propanoic acid Chemical compound ClC=1C=C(C(=C(C=1C)C1=CC=C(C=C1)OC)OCC)C(C(=O)O)C DHMGQBXJJQAGLA-UHFFFAOYSA-N 0.000 description 2
- NXLBKGDDYGRINS-UHFFFAOYSA-N 2-[5-chloro-2-ethoxy-4-fluoro-3-(oxan-4-yl)phenyl]propan-1-ol Chemical compound ClC=1C(=C(C(=C(C=1)C(CO)C)OCC)C1CCOCC1)F NXLBKGDDYGRINS-UHFFFAOYSA-N 0.000 description 2
- RCPMIBYQZBVALW-UHFFFAOYSA-N 2-[5-chloro-2-ethoxy-4-fluoro-3-(oxan-4-yl)phenyl]propan-2-ol Chemical compound ClC=1C(=C(C(=C(C=1)C(C)(C)O)OCC)C1CCOCC1)F RCPMIBYQZBVALW-UHFFFAOYSA-N 0.000 description 2
- NDDYDNPABJZBSW-UHFFFAOYSA-N 2-[5-chloro-2-ethoxy-4-fluoro-3-(oxan-4-yl)phenyl]propanal Chemical compound ClC=1C(=C(C(=C(C=1)C(C=O)C)OCC)C1CCOCC1)F NDDYDNPABJZBSW-UHFFFAOYSA-N 0.000 description 2
- QFJSOTGUKAICEM-UHFFFAOYSA-N 2-[5-chloro-2-ethoxy-4-fluoro-3-(oxan-4-yl)phenyl]propanoic acid Chemical compound ClC=1C(=C(C(=C(C=1)C(C(=O)O)C)OCC)C1CCOCC1)F QFJSOTGUKAICEM-UHFFFAOYSA-N 0.000 description 2
- AEPGJSRMRCLMAQ-UHFFFAOYSA-N 2-[5-chloro-2-ethoxy-4-fluoro-3-[6-(trifluoromethyl)pyridin-3-yl]phenyl]propanenitrile Chemical compound ClC=1C(=C(C(=C(C=1)C(C#N)C)OCC)C=1C=NC(=CC=1)C(F)(F)F)F AEPGJSRMRCLMAQ-UHFFFAOYSA-N 0.000 description 2
- SUPPXDFAULVNJG-UHFFFAOYSA-N 2-[5-chloro-2-ethoxy-4-fluoro-3-[6-(trifluoromethyl)pyridin-3-yl]phenyl]propanoic acid Chemical compound ClC=1C(=C(C(=C(C=1)C(C(=O)O)C)OCC)C=1C=NC(=CC=1)C(F)(F)F)F SUPPXDFAULVNJG-UHFFFAOYSA-N 0.000 description 2
- XMAIWJHIBRDQKE-UHFFFAOYSA-N 2-[5-chloro-2-ethoxy-4-methyl-3-(6-methylpyridin-3-yl)phenyl]propanenitrile Chemical compound ClC=1C(=C(C(=C(C=1)C(C#N)C)OCC)C=1C=NC(=CC=1)C)C XMAIWJHIBRDQKE-UHFFFAOYSA-N 0.000 description 2
- KPYFYZMAYQMNMR-UHFFFAOYSA-N 2-[5-chloro-2-ethoxy-4-methyl-3-(6-methylpyridin-3-yl)phenyl]propanoic acid Chemical compound ClC=1C(=C(C(=C(C=1)C(C(=O)O)C)OCC)C=1C=NC(=CC=1)C)C KPYFYZMAYQMNMR-UHFFFAOYSA-N 0.000 description 2
- ZMSIRHIRCQALFU-UHFFFAOYSA-N 2-[5-chloro-4-methyl-2-propan-2-yloxy-3-[6-(trifluoromethyl)pyridin-3-yl]phenyl]propanenitrile Chemical compound ClC=1C(=C(C(=C(C=1)C(C#N)C)OC(C)C)C=1C=NC(=CC=1)C(F)(F)F)C ZMSIRHIRCQALFU-UHFFFAOYSA-N 0.000 description 2
- WSTXZWLFKDAGBQ-UHFFFAOYSA-N 2-[5-chloro-4-methyl-2-propan-2-yloxy-3-[6-(trifluoromethyl)pyridin-3-yl]phenyl]propanoic acid Chemical compound ClC=1C(=C(C(=C(C=1)C(C(=O)O)C)OC(C)C)C=1C=NC(=CC=1)C(F)(F)F)C WSTXZWLFKDAGBQ-UHFFFAOYSA-N 0.000 description 2
- FXAIJJJJRMRZDS-UHFFFAOYSA-N 2-ethyl-4-hydroxy-6-oxo-1-phenyl-2,3-dihydropyridine-5-carbonitrile Chemical compound C(C)C1CC(=C(C(N1C1=CC=CC=C1)=O)C#N)O FXAIJJJJRMRZDS-UHFFFAOYSA-N 0.000 description 2
- YEDUAINPPJYDJZ-UHFFFAOYSA-N 2-hydroxybenzothiazole Chemical compound C1=CC=C2SC(O)=NC2=C1 YEDUAINPPJYDJZ-UHFFFAOYSA-N 0.000 description 2
- VBEYJZVICNLLDA-UHFFFAOYSA-N 2-methoxy-6-(trifluoromethyl)pyridine Chemical compound COC1=CC=CC(C(F)(F)F)=N1 VBEYJZVICNLLDA-UHFFFAOYSA-N 0.000 description 2
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 2
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- QZSCGKNCUKJDAJ-UHFFFAOYSA-N 3-[5-chloro-3-(1-chloroethyl)-2-ethoxy-6-methylphenyl]-5-(trifluoromethyl)pyridine Chemical compound ClC=1C(=C(C(=C(C=1)C(C)Cl)OCC)C=1C=NC=C(C=1)C(F)(F)F)C QZSCGKNCUKJDAJ-UHFFFAOYSA-N 0.000 description 2
- NGKNCQIEAWBPFJ-UHFFFAOYSA-N 3-[5-chloro-3-(1-chloroethyl)-2-methoxy-6-methylphenyl]pyridine Chemical compound ClC=1C(=C(C(=C(C=1)C(C)Cl)OC)C=1C=CC=NC=1)C NGKNCQIEAWBPFJ-UHFFFAOYSA-N 0.000 description 2
- VQXHGXDVBHJJJU-UHFFFAOYSA-N 3-methyl-2h-pyrazolo[3,4-d]pyrimidin-4-amine Chemical compound N1=CN=C(N)C2=C(C)NN=C21 VQXHGXDVBHJJJU-UHFFFAOYSA-N 0.000 description 2
- YEJRWHAVMIAJKC-UHFFFAOYSA-N 4-Butyrolactone Chemical compound O=C1CCCO1 YEJRWHAVMIAJKC-UHFFFAOYSA-N 0.000 description 2
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 2
- XVZZCEHIWPLAJL-UHFFFAOYSA-N 4-chloro-6-ethyl-2-oxo-1-phenylpyridine-3-carbonitrile Chemical compound ClC1=C(C(N(C(=C1)CC)C1=CC=CC=C1)=O)C#N XVZZCEHIWPLAJL-UHFFFAOYSA-N 0.000 description 2
- WAUWXCUPDOXYKS-UHFFFAOYSA-N 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1h-pyridin-2-one Chemical compound O1C(C)(C)C(C)(C)OB1C1=CC=C(O)N=C1 WAUWXCUPDOXYKS-UHFFFAOYSA-N 0.000 description 2
- VFVCESHEVMVNKS-UHFFFAOYSA-N 5-[3-chloro-5-(1-chloroethyl)-2-methyl-6-propan-2-yloxyphenyl]-2-(trifluoromethyl)pyridine Chemical compound ClC=1C(=C(C(=C(C=1)C(C)Cl)OC(C)C)C=1C=CC(=NC=1)C(F)(F)F)C VFVCESHEVMVNKS-UHFFFAOYSA-N 0.000 description 2
- DYOONIYDADUTLS-UHFFFAOYSA-N 5-[5-chloro-3-(1-chloroethyl)-2-ethoxy-6-methylphenyl]-2-methylpyridine Chemical compound ClC=1C(=C(C(=C(C=1)C(C)Cl)OCC)C=1C=CC(=NC=1)C)C DYOONIYDADUTLS-UHFFFAOYSA-N 0.000 description 2
- XBMGMUJNRRQVIR-UHFFFAOYSA-N 5-bromo-7h-pyrrolo[2,3-d]pyrimidin-4-amine Chemical compound NC1=NC=NC2=C1C(Br)=CN2 XBMGMUJNRRQVIR-UHFFFAOYSA-N 0.000 description 2
- XXRUAAOADAPPII-UHFFFAOYSA-N 6-(trifluoromethyl)-1h-pyridin-2-one Chemical compound OC1=CC=CC(C(F)(F)F)=N1 XXRUAAOADAPPII-UHFFFAOYSA-N 0.000 description 2
- CBQFJPTZWQPVHI-UHFFFAOYSA-N 6-ethyl-4-methoxy-2-oxo-1-phenylpyridine-3-carbonitrile Chemical compound C(C)C1=CC(=C(C(N1C1=CC=CC=C1)=O)C#N)OC CBQFJPTZWQPVHI-UHFFFAOYSA-N 0.000 description 2
- PEHVGBZKEYRQSX-UHFFFAOYSA-N 7-deaza-adenine Chemical compound NC1=NC=NC2=C1C=CN2 PEHVGBZKEYRQSX-UHFFFAOYSA-N 0.000 description 2
- SJVQHLPISAIATJ-ZDUSSCGKSA-N 8-chloro-2-phenyl-3-[(1S)-1-(7H-purin-6-ylamino)ethyl]-1-isoquinolinone Chemical compound C1([C@@H](NC=2C=3N=CNC=3N=CN=2)C)=CC2=CC=CC(Cl)=C2C(=O)N1C1=CC=CC=C1 SJVQHLPISAIATJ-ZDUSSCGKSA-N 0.000 description 2
- 208000004998 Abdominal Pain Diseases 0.000 description 2
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 2
- 208000024893 Acute lymphoblastic leukemia Diseases 0.000 description 2
- 208000014697 Acute lymphocytic leukaemia Diseases 0.000 description 2
- 208000008190 Agammaglobulinemia Diseases 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 2
- 208000032791 BCR-ABL1 positive chronic myelogenous leukemia Diseases 0.000 description 2
- KGPCXNMKOUOHNY-UHFFFAOYSA-N BrC=1C(=C(C=C(C1F)Cl)C(C)C1=NC(=C2N1C=CC=C2Cl)C)OC(C)C Chemical compound BrC=1C(=C(C=C(C1F)Cl)C(C)C1=NC(=C2N1C=CC=C2Cl)C)OC(C)C KGPCXNMKOUOHNY-UHFFFAOYSA-N 0.000 description 2
- 238000006418 Brown reaction Methods 0.000 description 2
- 210000001266 CD8-positive T-lymphocyte Anatomy 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- 208000010833 Chronic myeloid leukaemia Diseases 0.000 description 2
- 208000002881 Colic Diseases 0.000 description 2
- 206010009944 Colon cancer Diseases 0.000 description 2
- OKKJLVBELUTLKV-MZCSYVLQSA-N Deuterated methanol Chemical compound [2H]OC([2H])([2H])[2H] OKKJLVBELUTLKV-MZCSYVLQSA-N 0.000 description 2
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 2
- 102000003688 G-Protein-Coupled Receptors Human genes 0.000 description 2
- 108090000045 G-Protein-Coupled Receptors Proteins 0.000 description 2
- 206010018372 Glomerulonephritis membranous Diseases 0.000 description 2
- 238000007341 Heck reaction Methods 0.000 description 2
- 101001057504 Homo sapiens Interferon-stimulated gene 20 kDa protein Proteins 0.000 description 2
- 101001055144 Homo sapiens Interleukin-2 receptor subunit alpha Proteins 0.000 description 2
- 206010020983 Hypogammaglobulinaemia Diseases 0.000 description 2
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 2
- 102100026878 Interleukin-2 receptor subunit alpha Human genes 0.000 description 2
- 239000003810 Jones reagent Substances 0.000 description 2
- 229930194542 Keto Natural products 0.000 description 2
- OUYCCCASQSFEME-QMMMGPOBSA-N L-tyrosine Chemical compound OC(=O)[C@@H](N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-QMMMGPOBSA-N 0.000 description 2
- 229910010084 LiAlH4 Inorganic materials 0.000 description 2
- 241000186779 Listeria monocytogenes Species 0.000 description 2
- 208000005777 Lupus Nephritis Diseases 0.000 description 2
- 206010025323 Lymphomas Diseases 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- 208000033761 Myelogenous Chronic BCR-ABL Positive Leukemia Diseases 0.000 description 2
- 208000014767 Myeloproliferative disease Diseases 0.000 description 2
- 239000012828 PI3K inhibitor Substances 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- 208000035109 Pneumococcal Infections Diseases 0.000 description 2
- 208000006664 Precursor Cell Lymphoblastic Leukemia-Lymphoma Diseases 0.000 description 2
- 102000014400 SH2 domains Human genes 0.000 description 2
- 108050003452 SH2 domains Proteins 0.000 description 2
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 2
- 206010047115 Vasculitis Diseases 0.000 description 2
- 208000033559 Waldenström macroglobulinemia Diseases 0.000 description 2
- 238000007239 Wittig reaction Methods 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- 229960001138 acetylsalicylic acid Drugs 0.000 description 2
- 125000003342 alkenyl group Chemical group 0.000 description 2
- 150000004703 alkoxides Chemical class 0.000 description 2
- 208000026935 allergic disease Diseases 0.000 description 2
- 230000007815 allergy Effects 0.000 description 2
- 239000011260 aqueous acid Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 2
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 2
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 2
- 239000013060 biological fluid Substances 0.000 description 2
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 2
- 210000004556 brain Anatomy 0.000 description 2
- 239000007853 buffer solution Substances 0.000 description 2
- 229910000024 caesium carbonate Inorganic materials 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 125000002837 carbocyclic group Chemical group 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 230000011712 cell development Effects 0.000 description 2
- 238000012512 characterization method Methods 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- 238000010367 cloning Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 230000008878 coupling Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- NKLCNNUWBJBICK-UHFFFAOYSA-N dess–martin periodinane Chemical compound C1=CC=C2I(OC(=O)C)(OC(C)=O)(OC(C)=O)OC(=O)C2=C1 NKLCNNUWBJBICK-UHFFFAOYSA-N 0.000 description 2
- 125000004925 dihydropyridyl group Chemical group N1(CC=CC=C1)* 0.000 description 2
- 125000005594 diketone group Chemical group 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical group C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- 229950004949 duvelisib Drugs 0.000 description 2
- 239000003623 enhancer Substances 0.000 description 2
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 2
- 239000012530 fluid Substances 0.000 description 2
- 238000001640 fractional crystallisation Methods 0.000 description 2
- 201000009277 hairy cell leukemia Diseases 0.000 description 2
- 125000001188 haloalkyl group Chemical group 0.000 description 2
- 210000002443 helper t lymphocyte Anatomy 0.000 description 2
- BXWNKGSJHAJOGX-UHFFFAOYSA-N hexadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCO BXWNKGSJHAJOGX-UHFFFAOYSA-N 0.000 description 2
- 125000003707 hexyloxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 2
- 230000037417 hyperactivation Effects 0.000 description 2
- 230000036039 immunity Effects 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 125000000842 isoxazolyl group Chemical group 0.000 description 2
- 125000000468 ketone group Chemical group 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 239000012280 lithium aluminium hydride Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 230000036210 malignancy Effects 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 201000007924 marginal zone B-cell lymphoma Diseases 0.000 description 2
- 208000021937 marginal zone lymphoma Diseases 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 230000001404 mediated effect Effects 0.000 description 2
- 239000012528 membrane Substances 0.000 description 2
- 230000008172 membrane trafficking Effects 0.000 description 2
- 201000008350 membranous glomerulonephritis Diseases 0.000 description 2
- 231100000855 membranous nephropathy Toxicity 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- NQMRYBIKMRVZLB-UHFFFAOYSA-N methylamine hydrochloride Chemical compound [Cl-].[NH3+]C NQMRYBIKMRVZLB-UHFFFAOYSA-N 0.000 description 2
- 201000000050 myeloid neoplasm Diseases 0.000 description 2
- PVWOIHVRPOBWPI-UHFFFAOYSA-N n-propyl iodide Chemical compound CCCI PVWOIHVRPOBWPI-UHFFFAOYSA-N 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- 125000002560 nitrile group Chemical group 0.000 description 2
- 150000002828 nitro derivatives Chemical class 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 125000002971 oxazolyl group Chemical group 0.000 description 2
- 238000007911 parenteral administration Methods 0.000 description 2
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 2
- 150000003905 phosphatidylinositols Chemical class 0.000 description 2
- 229940043441 phosphoinositide 3-kinase inhibitor Drugs 0.000 description 2
- 150000003906 phosphoinositides Chemical class 0.000 description 2
- 230000026731 phosphorylation Effects 0.000 description 2
- 238000006366 phosphorylation reaction Methods 0.000 description 2
- XUWHAWMETYGRKB-UHFFFAOYSA-N piperidin-2-one Chemical compound O=C1CCCCN1 XUWHAWMETYGRKB-UHFFFAOYSA-N 0.000 description 2
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 2
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 2
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 230000035755 proliferation Effects 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- USPWKWBDZOARPV-UHFFFAOYSA-N pyrazolidine Chemical compound C1CNNC1 USPWKWBDZOARPV-UHFFFAOYSA-N 0.000 description 2
- 125000000168 pyrrolyl group Chemical group 0.000 description 2
- 230000006798 recombination Effects 0.000 description 2
- 238000005215 recombination Methods 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 230000014932 regulation of isotype switching Effects 0.000 description 2
- 230000004044 response Effects 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- 230000019491 signal transduction Effects 0.000 description 2
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 235000010265 sodium sulphite Nutrition 0.000 description 2
- 239000011877 solvent mixture Substances 0.000 description 2
- 230000000392 somatic effect Effects 0.000 description 2
- 230000004083 survival effect Effects 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- DYHSDKLCOJIUFX-UHFFFAOYSA-N tert-butoxycarbonyl anhydride Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 2
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 2
- 229940124597 therapeutic agent Drugs 0.000 description 2
- 238000002560 therapeutic procedure Methods 0.000 description 2
- COIOYMYWGDAQPM-UHFFFAOYSA-N tris(2-methylphenyl)phosphane Chemical compound CC1=CC=CC=C1P(C=1C(=CC=CC=1)C)C1=CC=CC=C1C COIOYMYWGDAQPM-UHFFFAOYSA-N 0.000 description 2
- OUYCCCASQSFEME-UHFFFAOYSA-N tyrosine Natural products OC(=O)C(N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-UHFFFAOYSA-N 0.000 description 2
- IALMZCHEKHGVSY-VIFPVBQESA-N (2S)-2-[5-chloro-4-fluoro-2-propan-2-yloxy-3-[6-(trifluoromethyl)pyridin-3-yl]phenyl]propanoic acid Chemical compound ClC=1C(=C(C(=C(C=1)[C@@H](C(=O)O)C)OC(C)C)C=1C=NC(=CC=1)C(F)(F)F)F IALMZCHEKHGVSY-VIFPVBQESA-N 0.000 description 1
- ITOFPJRDSCGOSA-KZLRUDJFSA-N (2s)-2-[[(4r)-4-[(3r,5r,8r,9s,10s,13r,14s,17r)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1h-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]-3-(1h-indol-3-yl)propanoic acid Chemical compound C([C@H]1CC2)[C@H](O)CC[C@]1(C)[C@@H](CC[C@]13C)[C@@H]2[C@@H]3CC[C@@H]1[C@H](C)CCC(=O)N[C@H](C(O)=O)CC1=CNC2=CC=CC=C12 ITOFPJRDSCGOSA-KZLRUDJFSA-N 0.000 description 1
- 125000004511 1,2,3-thiadiazolyl group Chemical group 0.000 description 1
- 125000001399 1,2,3-triazolyl group Chemical group N1N=NC(=C1)* 0.000 description 1
- 125000004504 1,2,4-oxadiazolyl group Chemical group 0.000 description 1
- 125000004514 1,2,4-thiadiazolyl group Chemical group 0.000 description 1
- 125000001376 1,2,4-triazolyl group Chemical group N1N=C(N=C1)* 0.000 description 1
- CDCHBOQVXIGZHA-UHFFFAOYSA-N 1,2-dihydropyrrol-5-one Chemical compound O=C1NCC=C1 CDCHBOQVXIGZHA-UHFFFAOYSA-N 0.000 description 1
- OIXUJRCCNNHWFI-UHFFFAOYSA-N 1,2-dioxane Chemical compound C1CCOOC1 OIXUJRCCNNHWFI-UHFFFAOYSA-N 0.000 description 1
- 125000001781 1,3,4-oxadiazolyl group Chemical group 0.000 description 1
- 125000004520 1,3,4-thiadiazolyl group Chemical group 0.000 description 1
- IGERFAHWSHDDHX-UHFFFAOYSA-N 1,3-dioxanyl Chemical group [CH]1OCCCO1 IGERFAHWSHDDHX-UHFFFAOYSA-N 0.000 description 1
- 125000005940 1,4-dioxanyl group Chemical group 0.000 description 1
- LMTDPKYREUZYAO-UHFFFAOYSA-N 1,4-dioxepane Chemical compound C1COCCOC1 LMTDPKYREUZYAO-UHFFFAOYSA-N 0.000 description 1
- JBYHSSAVUBIJMK-UHFFFAOYSA-N 1,4-oxathiane Chemical compound C1CSCCO1 JBYHSSAVUBIJMK-UHFFFAOYSA-N 0.000 description 1
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-Ethyl-3-(3-dimethylaminopropyl)carbodiimide Substances CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 1
- CYWYGXVLUIFMBZ-UHFFFAOYSA-N 1-[5-chloro-2-ethoxy-4-methyl-3-[5-(trifluoromethyl)pyridin-3-yl]phenyl]ethanol Chemical compound ClC=1C(=C(C(=C(C=1)C(C)O)OCC)C=1C=NC=C(C=1)C(F)(F)F)C CYWYGXVLUIFMBZ-UHFFFAOYSA-N 0.000 description 1
- XJCDLSVGRFNYCA-UHFFFAOYSA-N 1-[5-chloro-4-methyl-2-propan-2-yloxy-3-[6-(trifluoromethyl)pyridin-3-yl]phenyl]ethanone Chemical compound ClC=1C(=C(C(=C(C=1)C(C)=O)OC(C)C)C=1C=NC(=CC=1)C(F)(F)F)C XJCDLSVGRFNYCA-UHFFFAOYSA-N 0.000 description 1
- FOZVXADQAHVUSV-UHFFFAOYSA-N 1-bromo-2-(2-bromoethoxy)ethane Chemical compound BrCCOCCBr FOZVXADQAHVUSV-UHFFFAOYSA-N 0.000 description 1
- 125000004973 1-butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000004972 1-butynyl group Chemical group [H]C([H])([H])C([H])([H])C#C* 0.000 description 1
- QIAZJYGTKLYKPN-UHFFFAOYSA-N 1-chloro-5-(1-chloroethyl)-4-ethoxy-3-iodo-2-methylbenzene Chemical compound ClC1=C(C(=C(C(=C1)C(C)Cl)OCC)I)C QIAZJYGTKLYKPN-UHFFFAOYSA-N 0.000 description 1
- CXSMUARJOOOMOB-UHFFFAOYSA-N 1-fluoropyrrolidine-2,5-dione Chemical compound FN1C(=O)CCC1=O CXSMUARJOOOMOB-UHFFFAOYSA-N 0.000 description 1
- 125000000530 1-propynyl group Chemical group [H]C([H])([H])C#C* 0.000 description 1
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 1
- UJJHWFGVHXKQAA-UHFFFAOYSA-N 2-(5-chloro-2-ethoxy-3-iodo-4-methylphenyl)propanoic acid Chemical compound ClC=1C(=C(C(=C(C=1)C(C(=O)O)C)OCC)I)C UJJHWFGVHXKQAA-UHFFFAOYSA-N 0.000 description 1
- POACPGNYWRQULL-UHFFFAOYSA-N 2-(5-chloro-2-ethoxy-4-methyl-3-morpholin-4-ylphenyl)propanenitrile Chemical compound ClC=1C(=C(C(=C(C=1)C(C#N)C)OCC)N1CCOCC1)C POACPGNYWRQULL-UHFFFAOYSA-N 0.000 description 1
- RMOCKYRHZMCGKO-UHFFFAOYSA-N 2-(5-chloro-2-ethoxy-4-methyl-3-morpholin-4-ylphenyl)propanoic acid Chemical compound ClC=1C(=C(C(=C(C=1)C(C(=O)O)C)OCC)N1CCOCC1)C RMOCKYRHZMCGKO-UHFFFAOYSA-N 0.000 description 1
- RTJXXVOZDCIBPM-UHFFFAOYSA-N 2-(5-chloro-2-ethoxy-4-methylphenyl)propanoic acid Chemical compound CCOC1=CC(C)=C(Cl)C=C1C(C)C(O)=O RTJXXVOZDCIBPM-UHFFFAOYSA-N 0.000 description 1
- IUVCFHHAEHNCFT-INIZCTEOSA-N 2-[(1s)-1-[4-amino-3-(3-fluoro-4-propan-2-yloxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-6-fluoro-3-(3-fluorophenyl)chromen-4-one Chemical compound C1=C(F)C(OC(C)C)=CC=C1C(C1=C(N)N=CN=C11)=NN1[C@@H](C)C1=C(C=2C=C(F)C=CC=2)C(=O)C2=CC(F)=CC=C2O1 IUVCFHHAEHNCFT-INIZCTEOSA-N 0.000 description 1
- SUXOFRNZVUPLLJ-UHFFFAOYSA-N 2-[5-chloro-2-ethoxy-4-methyl-3-[5-(trifluoromethyl)pyridin-3-yl]phenyl]propanenitrile Chemical compound ClC=1C(=C(C(=C(C=1)C(C#N)C)OCC)C=1C=NC=C(C=1)C(F)(F)F)C SUXOFRNZVUPLLJ-UHFFFAOYSA-N 0.000 description 1
- MDSUHTXHQNXLML-UHFFFAOYSA-N 2-[5-chloro-2-ethoxy-4-methyl-3-[5-(trifluoromethyl)pyridin-3-yl]phenyl]propanoic acid Chemical compound ClC=1C(=C(C(=C(C=1)C(C(=O)O)C)OCC)C=1C=NC=C(C=1)C(F)(F)F)C MDSUHTXHQNXLML-UHFFFAOYSA-N 0.000 description 1
- GONSDVSNRVDRPU-UHFFFAOYSA-N 2-[6-(trifluoromethyl)pyridin-3-yl]acetic acid Chemical compound OC(=O)CC1=CC=C(C(F)(F)F)N=C1 GONSDVSNRVDRPU-UHFFFAOYSA-N 0.000 description 1
- SCVJRXQHFJXZFZ-KVQBGUIXSA-N 2-amino-9-[(2r,4s,5r)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3h-purine-6-thione Chemical compound C1=2NC(N)=NC(=S)C=2N=CN1[C@H]1C[C@H](O)[C@@H](CO)O1 SCVJRXQHFJXZFZ-KVQBGUIXSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- 125000000069 2-butynyl group Chemical group [H]C([H])([H])C#CC([H])([H])* 0.000 description 1
- IZOIOCQPMHHDHN-UHFFFAOYSA-N 2-fluoro-6-(trifluoromethyl)pyridine Chemical compound FC1=CC=CC(C(F)(F)F)=N1 IZOIOCQPMHHDHN-UHFFFAOYSA-N 0.000 description 1
- 125000004918 2-methyl-2-pentyl group Chemical group CC(C)(CCC)* 0.000 description 1
- 125000004922 2-methyl-3-pentyl group Chemical group CC(C)C(CC)* 0.000 description 1
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 1
- 125000004485 2-pyrrolidinyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])([H])C1([H])* 0.000 description 1
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000001698 2H-pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 1
- XEMDFESAXKSEGI-UHFFFAOYSA-N 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine Chemical compound O1C(C)(C)C(C)(C)OB1C1=CC=CN=C1 XEMDFESAXKSEGI-UHFFFAOYSA-N 0.000 description 1
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- FVMDYYGIDFPZAX-UHFFFAOYSA-N 3-hydroxyphenylacetic acid Chemical compound OC(=O)CC1=CC=CC(O)=C1 FVMDYYGIDFPZAX-UHFFFAOYSA-N 0.000 description 1
- 125000004919 3-methyl-2-pentyl group Chemical group CC(C(C)*)CC 0.000 description 1
- 125000004921 3-methyl-3-pentyl group Chemical group CC(CC)(CC)* 0.000 description 1
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000004364 3-pyrrolinyl group Chemical group [H]C1=C([H])C([H])([H])N(*)C1([H])[H] 0.000 description 1
- UFCSPXKDSVQPOP-UHFFFAOYSA-N 4-(5-chloro-2-ethoxy-6-fluoro-3-prop-1-en-2-ylphenyl)oxane Chemical compound ClC=1C(=C(C(=C(C=1)C(=C)C)OCC)C1CCOCC1)F UFCSPXKDSVQPOP-UHFFFAOYSA-N 0.000 description 1
- UXOZPJRNGVXBFQ-UHFFFAOYSA-N 4-[5-chloro-3-(1-chloroethyl)-2-ethoxy-6-methylphenyl]morpholine Chemical compound ClC=1C(=C(C(=C(C=1)C(C)Cl)OCC)N1CCOCC1)C UXOZPJRNGVXBFQ-UHFFFAOYSA-N 0.000 description 1
- 229960000549 4-dimethylaminophenol Drugs 0.000 description 1
- 125000004920 4-methyl-2-pentyl group Chemical group CC(CC(C)*)C 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 125000001826 4H-pyranyl group Chemical group O1C(=CCC=C1)* 0.000 description 1
- 125000001054 5 membered carbocyclic group Chemical group 0.000 description 1
- 125000004606 5,6,7,8-tetrahydroisoquinolinyl group Chemical group C1(=NC=CC=2CCCCC12)* 0.000 description 1
- NTSLROIKFLNUIJ-UHFFFAOYSA-N 5-Ethyl-2-methylpyridine Chemical compound CCC1=CC=C(C)N=C1 NTSLROIKFLNUIJ-UHFFFAOYSA-N 0.000 description 1
- JQIXERPYMMFOKI-UHFFFAOYSA-N 5-[5-chloro-2-ethoxy-6-methyl-3-[1-(3-methyl-2H-imidazol-1-yl)ethyl]phenyl]-2-(trifluoromethyl)pyridine Chemical compound CCOc1c(cc(Cl)c(C)c1-c1ccc(nc1)C(F)(F)F)C(C)N1CN(C)C=C1 JQIXERPYMMFOKI-UHFFFAOYSA-N 0.000 description 1
- CVQDIDSMTSNIOP-UHFFFAOYSA-N 5-[5-chloro-3-(1-chloroethyl)-2-ethoxy-6-fluorophenyl]-2-(trifluoromethyl)pyridine Chemical compound ClC=1C(=C(C(=C(C=1)C(C)Cl)OCC)C=1C=CC(=NC=1)C(F)(F)F)F CVQDIDSMTSNIOP-UHFFFAOYSA-N 0.000 description 1
- PYNIISSXZPAFSG-UHFFFAOYSA-N 5-chloro-2-methoxy-4-methyl-3-pyridin-3-ylbenzoic acid Chemical compound ClC=1C(=C(C(=C(C(=O)O)C=1)OC)C=1C=NC=CC=1)C PYNIISSXZPAFSG-UHFFFAOYSA-N 0.000 description 1
- 125000004008 6 membered carbocyclic group Chemical group 0.000 description 1
- QGDANURRXYTUQB-UHFFFAOYSA-N 6-[1-(4-amino-3-methylpyrazolo[3,4-d]pyrimidin-1-yl)ethyl]-4-chloro-2-oxo-1-phenylpyridine-3-carbonitrile Chemical compound NC1=C2C(=NC=N1)N(N=C2C)C(C)C1=CC(=C(C(N1C1=CC=CC=C1)=O)C#N)Cl QGDANURRXYTUQB-UHFFFAOYSA-N 0.000 description 1
- FVTBDILDKKWFMJ-UHFFFAOYSA-N 6-ethyl-4-hydroxy-2-oxo-1-phenylpyridine-3-carbonitrile Chemical compound C(C)C1=CC(=C(C(N1C1=CC=CC=C1)=O)C#N)O FVTBDILDKKWFMJ-UHFFFAOYSA-N 0.000 description 1
- OZAIFHULBGXAKX-VAWYXSNFSA-N AIBN Substances N#CC(C)(C)\N=N\C(C)(C)C#N OZAIFHULBGXAKX-VAWYXSNFSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 1
- 208000031261 Acute myeloid leukaemia Diseases 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- YCIPQJTZJGUXND-UHFFFAOYSA-N Aglaia odorata Alkaloid Natural products C1=CC(OC)=CC=C1C1(C(C=2C(=O)N3CCCC3=NC=22)C=3C=CC=CC=3)C2(O)C2=C(OC)C=C(OC)C=C2O1 YCIPQJTZJGUXND-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 208000032116 Autoimmune Experimental Encephalomyelitis Diseases 0.000 description 1
- NOWKCMXCCJGMRR-UHFFFAOYSA-N Aziridine Chemical compound C1CN1 NOWKCMXCCJGMRR-UHFFFAOYSA-N 0.000 description 1
- 208000003950 B-cell lymphoma Diseases 0.000 description 1
- 229910015845 BBr3 Inorganic materials 0.000 description 1
- 208000035143 Bacterial infection Diseases 0.000 description 1
- 206010005003 Bladder cancer Diseases 0.000 description 1
- 206010005949 Bone cancer Diseases 0.000 description 1
- 208000018084 Bone neoplasm Diseases 0.000 description 1
- IRNDRFZZTJBMNL-UHFFFAOYSA-N BrN1CN(C=C1)C(C)C1=C(C(=C(C(=C1)Cl)C)C=1C(=NOC1C)C)OC Chemical compound BrN1CN(C=C1)C(C)C1=C(C(=C(C(=C1)Cl)C)C=1C(=NOC1C)C)OC IRNDRFZZTJBMNL-UHFFFAOYSA-N 0.000 description 1
- 208000003174 Brain Neoplasms Diseases 0.000 description 1
- 206010006187 Breast cancer Diseases 0.000 description 1
- 208000026310 Breast neoplasm Diseases 0.000 description 1
- ISMDILRWKSYCOD-GNKBHMEESA-N C(C1=CC=CC=C1)[C@@H]1NC(OCCCCCCCCCCCNC([C@@H](NC(C[C@@H]1O)=O)C(C)C)=O)=O Chemical compound C(C1=CC=CC=C1)[C@@H]1NC(OCCCCCCCCCCCNC([C@@H](NC(C[C@@H]1O)=O)C(C)C)=O)=O ISMDILRWKSYCOD-GNKBHMEESA-N 0.000 description 1
- 125000000172 C5-C10 aryl group Chemical group 0.000 description 1
- BQXUPNKLZNSUMC-YUQWMIPFSA-N CCN(CCCCCOCC(=O)N[C@H](C(=O)N1C[C@H](O)C[C@H]1C(=O)N[C@@H](C)c1ccc(cc1)-c1scnc1C)C(C)(C)C)CCOc1ccc(cc1)C(=O)c1c(sc2cc(O)ccc12)-c1ccc(O)cc1 Chemical compound CCN(CCCCCOCC(=O)N[C@H](C(=O)N1C[C@H](O)C[C@H]1C(=O)N[C@@H](C)c1ccc(cc1)-c1scnc1C)C(C)(C)C)CCOc1ccc(cc1)C(=O)c1c(sc2cc(O)ccc12)-c1ccc(O)cc1 BQXUPNKLZNSUMC-YUQWMIPFSA-N 0.000 description 1
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 1
- 206010008342 Cervix carcinoma Diseases 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 208000006545 Chronic Obstructive Pulmonary Disease Diseases 0.000 description 1
- 108091007958 Class I PI3Ks Proteins 0.000 description 1
- 208000001333 Colorectal Neoplasms Diseases 0.000 description 1
- 108090000695 Cytokines Proteins 0.000 description 1
- 102000004127 Cytokines Human genes 0.000 description 1
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N DMSO Substances CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 1
- 101150014361 Delta gene Proteins 0.000 description 1
- 101000652725 Drosophila melanogaster Transcription initiation factor TFIID subunit 5 Proteins 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- 208000000461 Esophageal Neoplasms Diseases 0.000 description 1
- 241000400611 Eucalyptus deanei Species 0.000 description 1
- RRSNDVCODIMOFX-MPKOGUQCSA-N Fc1c(Cl)cccc1[C@H]1[C@@H](NC2(CCCCC2)[C@@]11C(=O)Nc2cc(Cl)ccc12)C(=O)Nc1ccc(cc1)C(=O)NCCCCCc1cccc2C(=O)N(Cc12)C1CCC(=O)NC1=O Chemical compound Fc1c(Cl)cccc1[C@H]1[C@@H](NC2(CCCCC2)[C@@]11C(=O)Nc2cc(Cl)ccc12)C(=O)Nc1ccc(cc1)C(=O)NCCCCCc1cccc2C(=O)N(Cc12)C1CCC(=O)NC1=O RRSNDVCODIMOFX-MPKOGUQCSA-N 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- 108010009306 Forkhead Box Protein O1 Proteins 0.000 description 1
- 102000009561 Forkhead Box Protein O1 Human genes 0.000 description 1
- 102000034355 G beta-gamma complex Human genes 0.000 description 1
- 108091006102 G beta-gamma complex Proteins 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 206010064571 Gene mutation Diseases 0.000 description 1
- 101150023475 Gfi1 gene Proteins 0.000 description 1
- 241000147041 Guaiacum officinale Species 0.000 description 1
- SQUHHTBVTRBESD-UHFFFAOYSA-N Hexa-Ac-myo-Inositol Natural products CC(=O)OC1C(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O SQUHHTBVTRBESD-UHFFFAOYSA-N 0.000 description 1
- 101000752722 Homo sapiens Apoptosis-stimulating of p53 protein 1 Proteins 0.000 description 1
- 101001120097 Homo sapiens Phosphatidylinositol 3-kinase regulatory subunit beta Proteins 0.000 description 1
- 101001116549 Homo sapiens Protein CBFA2T2 Proteins 0.000 description 1
- 101001000998 Homo sapiens Protein phosphatase 1 regulatory subunit 12C Proteins 0.000 description 1
- 101000927796 Homo sapiens Rho guanine nucleotide exchange factor 7 Proteins 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- XQFRJNBWHJMXHO-RRKCRQDMSA-N IDUR Chemical compound C1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C(I)=C1 XQFRJNBWHJMXHO-RRKCRQDMSA-N 0.000 description 1
- 208000008839 Kidney Neoplasms Diseases 0.000 description 1
- 208000032376 Lung infection Diseases 0.000 description 1
- 206010058467 Lung neoplasm malignant Diseases 0.000 description 1
- 208000008771 Lymphadenopathy Diseases 0.000 description 1
- 208000028018 Lymphocytic leukaemia Diseases 0.000 description 1
- 206010025327 Lymphopenia Diseases 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 238000003820 Medium-pressure liquid chromatography Methods 0.000 description 1
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 description 1
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- 201000003793 Myelodysplastic syndrome Diseases 0.000 description 1
- 150000001204 N-oxides Chemical class 0.000 description 1
- 206010030155 Oesophageal carcinoma Diseases 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- 206010033128 Ovarian cancer Diseases 0.000 description 1
- 206010061535 Ovarian neoplasm Diseases 0.000 description 1
- 229940124780 PI3K delta inhibitor Drugs 0.000 description 1
- 101150046396 PIK3R1 gene Proteins 0.000 description 1
- UBXIJOJXUFYNRG-RJKBCLGNSA-N PIP[3'](17:0/20:4(5Z,8Z,11Z,14Z)) Chemical compound CCCCC\C=C/C\C=C/C\C=C/C\C=C/CCCC(=O)O[C@H](COC(=O)CCCCCCCCCCCCCCCC)COP(O)(=O)O[C@H]1C(O)C(O)C(O)[C@@H](OP(O)(O)=O)C1O UBXIJOJXUFYNRG-RJKBCLGNSA-N 0.000 description 1
- 108010011536 PTEN Phosphohydrolase Proteins 0.000 description 1
- 102000014160 PTEN Phosphohydrolase Human genes 0.000 description 1
- 206010061902 Pancreatic neoplasm Diseases 0.000 description 1
- 241000721454 Pemphigus Species 0.000 description 1
- 241000009328 Perro Species 0.000 description 1
- 102000003993 Phosphatidylinositol 3-kinases Human genes 0.000 description 1
- 102000017343 Phosphatidylinositol kinases Human genes 0.000 description 1
- 108050005377 Phosphatidylinositol kinases Proteins 0.000 description 1
- 108010001441 Phosphopeptides Proteins 0.000 description 1
- 108091000080 Phosphotransferase Proteins 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 206010060862 Prostate cancer Diseases 0.000 description 1
- 208000000236 Prostatic Neoplasms Diseases 0.000 description 1
- 102000001253 Protein Kinase Human genes 0.000 description 1
- 201000004681 Psoriasis Diseases 0.000 description 1
- 229910019020 PtO2 Inorganic materials 0.000 description 1
- 108091008773 RAR-related orphan receptors γ Proteins 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 208000035415 Reinfection Diseases 0.000 description 1
- 206010038389 Renal cancer Diseases 0.000 description 1
- 206010057190 Respiratory tract infections Diseases 0.000 description 1
- 206010039491 Sarcoma Diseases 0.000 description 1
- 229940124639 Selective inhibitor Drugs 0.000 description 1
- 206010041067 Small cell lung cancer Diseases 0.000 description 1
- 208000021712 Soft tissue sarcoma Diseases 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 208000005718 Stomach Neoplasms Diseases 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 230000033540 T cell apoptotic process Effects 0.000 description 1
- 206010042971 T-cell lymphoma Diseases 0.000 description 1
- 208000027585 T-cell non-Hodgkin lymphoma Diseases 0.000 description 1
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical compound C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 description 1
- 230000010632 Transcription Factor Activity Effects 0.000 description 1
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 1
- 208000007097 Urinary Bladder Neoplasms Diseases 0.000 description 1
- 208000006105 Uterine Cervical Neoplasms Diseases 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 208000002552 acute disseminated encephalomyelitis Diseases 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- YKIOKAURTKXMSB-UHFFFAOYSA-N adams's catalyst Chemical compound O=[Pt]=O YKIOKAURTKXMSB-UHFFFAOYSA-N 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000002009 alkene group Chemical group 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 208000037884 allergic airway inflammation Diseases 0.000 description 1
- 208000030961 allergic reaction Diseases 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 238000012435 analytical chromatography Methods 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 230000033115 angiogenesis Effects 0.000 description 1
- 125000002178 anthracenyl group Chemical group C1(=CC=CC2=CC3=CC=CC=C3C=C12)* 0.000 description 1
- 230000005875 antibody response Effects 0.000 description 1
- 239000000427 antigen Substances 0.000 description 1
- 102000036639 antigens Human genes 0.000 description 1
- 108091007433 antigens Proteins 0.000 description 1
- 238000003491 array Methods 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 230000001363 autoimmune Effects 0.000 description 1
- 230000005784 autoimmunity Effects 0.000 description 1
- 125000003725 azepanyl group Chemical group 0.000 description 1
- 125000002393 azetidinyl group Chemical group 0.000 description 1
- 208000022362 bacterial infectious disease Diseases 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 125000004601 benzofurazanyl group Chemical group N1=C2C(=NO1)C(=CC=C2)* 0.000 description 1
- GPRLTFBKWDERLU-UHFFFAOYSA-N bicyclo[2.2.2]octane Chemical group C1CC2CCC1CC2 GPRLTFBKWDERLU-UHFFFAOYSA-N 0.000 description 1
- GNTFBMAGLFYMMZ-UHFFFAOYSA-N bicyclo[3.2.2]nonane Chemical group C1CC2CCC1CCC2 GNTFBMAGLFYMMZ-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- IFVTZJHWGZSXFD-UHFFFAOYSA-N biphenylene Chemical group C1=CC=C2C3=CC=CC=C3C2=C1 IFVTZJHWGZSXFD-UHFFFAOYSA-N 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 1
- 239000008116 calcium stearate Substances 0.000 description 1
- 235000013539 calcium stearate Nutrition 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 229910002091 carbon monoxide Inorganic materials 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 230000003915 cell function Effects 0.000 description 1
- 230000010261 cell growth Effects 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 201000007455 central nervous system cancer Diseases 0.000 description 1
- 201000010881 cervical cancer Diseases 0.000 description 1
- 229960000541 cetyl alcohol Drugs 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- WCZVZNOTHYJIEI-UHFFFAOYSA-N cinnoline Chemical compound N1=NC=CC2=CC=CC=C21 WCZVZNOTHYJIEI-UHFFFAOYSA-N 0.000 description 1
- 206010009887 colitis Diseases 0.000 description 1
- 208000029742 colonic neoplasm Diseases 0.000 description 1
- 238000002648 combination therapy Methods 0.000 description 1
- 239000008139 complexing agent Substances 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 235000008504 concentrate Nutrition 0.000 description 1
- 239000012059 conventional drug carrier Substances 0.000 description 1
- 125000003678 cyclohexadienyl group Chemical group C1(=CC=CCC1)* 0.000 description 1
- 125000006547 cyclononyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 230000016396 cytokine production Effects 0.000 description 1
- 230000003436 cytoskeletal effect Effects 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 230000007123 defense Effects 0.000 description 1
- 230000007812 deficiency Effects 0.000 description 1
- 230000006735 deficit Effects 0.000 description 1
- 125000005959 diazepanyl group Chemical group 0.000 description 1
- 125000004852 dihydrofuranyl group Chemical group O1C(CC=C1)* 0.000 description 1
- 125000005043 dihydropyranyl group Chemical group O1C(CCC=C1)* 0.000 description 1
- 125000005057 dihydrothienyl group Chemical group S1C(CC=C1)* 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- HPYNZHMRTTWQTB-UHFFFAOYSA-N dimethylpyridine Natural products CC1=CC=CN=C1C HPYNZHMRTTWQTB-UHFFFAOYSA-N 0.000 description 1
- WJJMNDUMQPNECX-UHFFFAOYSA-N dipicolinic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=N1 WJJMNDUMQPNECX-UHFFFAOYSA-N 0.000 description 1
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 1
- 229910000397 disodium phosphate Inorganic materials 0.000 description 1
- 235000019800 disodium phosphate Nutrition 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 125000005411 dithiolanyl group Chemical group S1SC(CC1)* 0.000 description 1
- 239000003596 drug target Substances 0.000 description 1
- 229940125436 dual inhibitor Drugs 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 239000012636 effector Substances 0.000 description 1
- 210000003162 effector t lymphocyte Anatomy 0.000 description 1
- 125000002587 enol group Chemical group 0.000 description 1
- 150000002085 enols Chemical group 0.000 description 1
- 201000004101 esophageal cancer Diseases 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 208000012997 experimental autoimmune encephalomyelitis Diseases 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- KTWOOEGAPBSYNW-UHFFFAOYSA-N ferrocene Chemical compound [Fe+2].C=1C=C[CH-]C=1.C=1C=C[CH-]C=1 KTWOOEGAPBSYNW-UHFFFAOYSA-N 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 238000003818 flash chromatography Methods 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 230000003325 follicular Effects 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 239000003205 fragrance Substances 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 125000004281 furazan-3-yl group Chemical group [H]C1=NON=C1* 0.000 description 1
- 125000003838 furazanyl group Chemical group 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 206010017758 gastric cancer Diseases 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 230000002068 genetic effect Effects 0.000 description 1
- 210000004602 germ cell Anatomy 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 229940091561 guaiac Drugs 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 201000010536 head and neck cancer Diseases 0.000 description 1
- 208000014829 head and neck neoplasm Diseases 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- 201000005787 hematologic cancer Diseases 0.000 description 1
- 230000002489 hematologic effect Effects 0.000 description 1
- 208000024200 hematopoietic and lymphoid system neoplasm Diseases 0.000 description 1
- 206010073071 hepatocellular carcinoma Diseases 0.000 description 1
- 231100000844 hepatocellular carcinoma Toxicity 0.000 description 1
- RYPKRALMXUUNKS-UHFFFAOYSA-N hex-2-ene Chemical group CCCC=CC RYPKRALMXUUNKS-UHFFFAOYSA-N 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000013632 homeostatic process Effects 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 125000002636 imidazolinyl group Chemical group 0.000 description 1
- 125000005945 imidazopyridyl group Chemical group 0.000 description 1
- 230000001900 immune effect Effects 0.000 description 1
- 230000037451 immune surveillance Effects 0.000 description 1
- 210000000987 immune system Anatomy 0.000 description 1
- 230000006058 immune tolerance Effects 0.000 description 1
- 208000027969 immunodeficiency 36 Diseases 0.000 description 1
- 238000009169 immunotherapy Methods 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 description 1
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 210000005007 innate immune system Anatomy 0.000 description 1
- 229960000367 inositol Drugs 0.000 description 1
- 238000003780 insertion Methods 0.000 description 1
- 230000037431 insertion Effects 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 230000003834 intracellular effect Effects 0.000 description 1
- 230000010189 intracellular transport Effects 0.000 description 1
- 238000004255 ion exchange chromatography Methods 0.000 description 1
- 230000007794 irritation Effects 0.000 description 1
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 1
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 1
- 125000001786 isothiazolyl group Chemical group 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 201000010982 kidney cancer Diseases 0.000 description 1
- 238000011813 knockout mouse model Methods 0.000 description 1
- 230000011268 leukocyte chemotaxis Effects 0.000 description 1
- 150000002632 lipids Chemical class 0.000 description 1
- 238000003819 low-pressure liquid chromatography Methods 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 201000005202 lung cancer Diseases 0.000 description 1
- 208000020816 lung neoplasm Diseases 0.000 description 1
- 206010025135 lupus erythematosus Diseases 0.000 description 1
- 208000018555 lymphatic system disease Diseases 0.000 description 1
- 208000003747 lymphoid leukemia Diseases 0.000 description 1
- 231100001023 lymphopenia Toxicity 0.000 description 1
- 201000007919 lymphoplasmacytic lymphoma Diseases 0.000 description 1
- 239000008176 lyophilized powder Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- NXPHGHWWQRMDIA-UHFFFAOYSA-M magnesium;carbanide;bromide Chemical compound [CH3-].[Mg+2].[Br-] NXPHGHWWQRMDIA-UHFFFAOYSA-M 0.000 description 1
- 230000003211 malignant effect Effects 0.000 description 1
- 208000015486 malignant pancreatic neoplasm Diseases 0.000 description 1
- 230000035800 maturation Effects 0.000 description 1
- 210000003519 mature b lymphocyte Anatomy 0.000 description 1
- 201000001441 melanoma Diseases 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- CKJNUZNMWOVDFN-UHFFFAOYSA-N methanone Chemical compound O=[CH-] CKJNUZNMWOVDFN-UHFFFAOYSA-N 0.000 description 1
- KDROYSXSRRDIIO-UHFFFAOYSA-N methyl 3-pentoxypentanoate Chemical compound CCCCCOC(CC)CC(=O)OC KDROYSXSRRDIIO-UHFFFAOYSA-N 0.000 description 1
- 235000019799 monosodium phosphate Nutrition 0.000 description 1
- 125000004572 morpholin-3-yl group Chemical group N1C(COCC1)* 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- 230000004899 motility Effects 0.000 description 1
- 206010028417 myasthenia gravis Diseases 0.000 description 1
- PSHKMPUSSFXUIA-UHFFFAOYSA-N n,n-dimethylpyridin-2-amine Chemical compound CN(C)C1=CC=CC=N1 PSHKMPUSSFXUIA-UHFFFAOYSA-N 0.000 description 1
- YCJZWBZJSYLMPB-UHFFFAOYSA-N n-(2-chloropyrimidin-4-yl)-2,5-dimethyl-1-phenylimidazole-4-carboxamide Chemical compound CC=1N(C=2C=CC=CC=2)C(C)=NC=1C(=O)NC1=CC=NC(Cl)=N1 YCJZWBZJSYLMPB-UHFFFAOYSA-N 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 239000007922 nasal spray Substances 0.000 description 1
- 201000002120 neuroendocrine carcinoma Diseases 0.000 description 1
- 210000000440 neutrophil Anatomy 0.000 description 1
- 208000002154 non-small cell lung carcinoma Diseases 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- UMRZSTCPUPJPOJ-KNVOCYPGSA-N norbornane Chemical group C1C[C@H]2CC[C@@H]1C2 UMRZSTCPUPJPOJ-KNVOCYPGSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- WCPAKWJPBJAGKN-UHFFFAOYSA-N oxadiazole Chemical compound C1=CON=N1 WCPAKWJPBJAGKN-UHFFFAOYSA-N 0.000 description 1
- 125000001715 oxadiazolyl group Chemical group 0.000 description 1
- 125000003551 oxepanyl group Chemical group 0.000 description 1
- 125000003566 oxetanyl group Chemical group 0.000 description 1
- 125000000466 oxiranyl group Chemical group 0.000 description 1
- MUJIDPITZJWBSW-UHFFFAOYSA-N palladium(2+) Chemical compound [Pd+2] MUJIDPITZJWBSW-UHFFFAOYSA-N 0.000 description 1
- PIBWKRNGBLPSSY-UHFFFAOYSA-L palladium(II) chloride Chemical compound Cl[Pd]Cl PIBWKRNGBLPSSY-UHFFFAOYSA-L 0.000 description 1
- 201000002528 pancreatic cancer Diseases 0.000 description 1
- 208000008443 pancreatic carcinoma Diseases 0.000 description 1
- 230000008506 pathogenesis Effects 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 125000002080 perylenyl group Chemical group C1(=CC=C2C=CC=C3C4=CC=CC5=CC=CC(C1=C23)=C45)* 0.000 description 1
- CSHWQDPOILHKBI-UHFFFAOYSA-N peryrene Natural products C1=CC(C2=CC=CC=3C2=C2C=CC=3)=C3C2=CC=CC3=C1 CSHWQDPOILHKBI-UHFFFAOYSA-N 0.000 description 1
- 238000009522 phase III clinical trial Methods 0.000 description 1
- 125000005561 phenanthryl group Chemical group 0.000 description 1
- 229960003424 phenylacetic acid Drugs 0.000 description 1
- 239000003279 phenylacetic acid Substances 0.000 description 1
- FVZVCSNXTFCBQU-UHFFFAOYSA-N phosphanyl Chemical group [PH2] FVZVCSNXTFCBQU-UHFFFAOYSA-N 0.000 description 1
- 239000008363 phosphate buffer Substances 0.000 description 1
- 239000008055 phosphate buffer solution Substances 0.000 description 1
- 230000000865 phosphorylative effect Effects 0.000 description 1
- 102000020233 phosphotransferase Human genes 0.000 description 1
- 125000000612 phthaloyl group Chemical group C(C=1C(C(=O)*)=CC=CC1)(=O)* 0.000 description 1
- IBBMAWULFFBRKK-UHFFFAOYSA-N picolinamide Chemical compound NC(=O)C1=CC=CC=N1 IBBMAWULFFBRKK-UHFFFAOYSA-N 0.000 description 1
- 230000036470 plasma concentration Effects 0.000 description 1
- 210000004180 plasmocyte Anatomy 0.000 description 1
- 125000003367 polycyclic group Chemical group 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- VVWRJUBEIPHGQF-MDZDMXLPSA-N propan-2-yl (ne)-n-propan-2-yloxycarbonyliminocarbamate Chemical compound CC(C)OC(=O)\N=N\C(=O)OC(C)C VVWRJUBEIPHGQF-MDZDMXLPSA-N 0.000 description 1
- VVWRJUBEIPHGQF-UHFFFAOYSA-N propan-2-yl n-propan-2-yloxycarbonyliminocarbamate Chemical compound CC(C)OC(=O)N=NC(=O)OC(C)C VVWRJUBEIPHGQF-UHFFFAOYSA-N 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 108060006633 protein kinase Proteins 0.000 description 1
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 1
- DNXIASIHZYFFRO-UHFFFAOYSA-N pyrazoline Chemical compound C1CN=NC1 DNXIASIHZYFFRO-UHFFFAOYSA-N 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- UBQKCCHYAOITMY-UHFFFAOYSA-N pyridin-2-ol Chemical compound OC1=CC=CC=N1 UBQKCCHYAOITMY-UHFFFAOYSA-N 0.000 description 1
- VTGOHKSTWXHQJK-UHFFFAOYSA-N pyrimidin-2-ol Chemical compound OC1=NC=CC=N1 VTGOHKSTWXHQJK-UHFFFAOYSA-N 0.000 description 1
- 125000004527 pyrimidin-4-yl group Chemical group N1=CN=C(C=C1)* 0.000 description 1
- 125000004528 pyrimidin-5-yl group Chemical group N1=CN=CC(=C1)* 0.000 description 1
- 125000006085 pyrrolopyridyl group Chemical group 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000015440 regulation of plasma cell differentiation Effects 0.000 description 1
- 230000008672 reprogramming Effects 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- CDAISMWEOUEBRE-UHFFFAOYSA-N scyllo-inosotol Natural products OC1C(O)C(O)C(O)C(O)C1O CDAISMWEOUEBRE-UHFFFAOYSA-N 0.000 description 1
- 230000009758 senescence Effects 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 238000001542 size-exclusion chromatography Methods 0.000 description 1
- 208000000587 small cell lung carcinoma Diseases 0.000 description 1
- AJPJDKMHJJGVTQ-UHFFFAOYSA-M sodium dihydrogen phosphate Chemical compound [Na+].OP(O)([O-])=O AJPJDKMHJJGVTQ-UHFFFAOYSA-M 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 229910000162 sodium phosphate Inorganic materials 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- VNFWTIYUKDMAOP-UHFFFAOYSA-N sphos Chemical compound COC1=CC=CC(OC)=C1C1=CC=CC=C1P(C1CCCCC1)C1CCCCC1 VNFWTIYUKDMAOP-UHFFFAOYSA-N 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 201000011549 stomach cancer Diseases 0.000 description 1
- 238000000859 sublimation Methods 0.000 description 1
- 230000008022 sublimation Effects 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- KZNICNPSHKQLFF-UHFFFAOYSA-N succinimide Chemical compound O=C1CCC(=O)N1 KZNICNPSHKQLFF-UHFFFAOYSA-N 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000004546 suspension concentrate Substances 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 238000003419 tautomerization reaction Methods 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 125000005942 tetrahydropyridyl group Chemical group 0.000 description 1
- 125000005958 tetrahydrothienyl group Chemical group 0.000 description 1
- 125000004632 tetrahydrothiopyranyl group Chemical group S1C(CCCC1)* 0.000 description 1
- 125000003831 tetrazolyl group Chemical group 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 125000001113 thiadiazolyl group Chemical group 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- 125000001583 thiepanyl group Chemical group 0.000 description 1
- 125000002053 thietanyl group Chemical group 0.000 description 1
- VOVUARRWDCVURC-UHFFFAOYSA-N thiirane Chemical compound C1CS1 VOVUARRWDCVURC-UHFFFAOYSA-N 0.000 description 1
- 125000005503 thioxanyl group Chemical group 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 238000011200 topical administration Methods 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 238000005809 transesterification reaction Methods 0.000 description 1
- 230000005945 translocation Effects 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- JLTRXTDYQLMHGR-UHFFFAOYSA-N trimethylaluminium Chemical compound C[Al](C)C JLTRXTDYQLMHGR-UHFFFAOYSA-N 0.000 description 1
- 210000004881 tumor cell Anatomy 0.000 description 1
- 208000029729 tumor suppressor gene on chromosome 11 Diseases 0.000 description 1
- 201000005112 urinary bladder cancer Diseases 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 230000003612 virological effect Effects 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Images
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/495—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with two or more nitrogen atoms as the only ring heteroatoms, e.g. piperazine or tetrazines
- A61K31/4985—Pyrazines or piperazines ortho- or peri-condensed with heterocyclic ring systems
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P29/00—Non-central analgesic, antipyretic or antiinflammatory agents, e.g. antirheumatic agents; Non-steroidal antiinflammatory drugs [NSAID]
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
- A61P35/02—Antineoplastic agents specific for leukemia
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/02—Immunomodulators
- A61P37/06—Immunosuppressants, e.g. drugs for graft rejection
Landscapes
- Health & Medical Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- General Health & Medical Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Medicinal Chemistry (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Immunology (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- Epidemiology (AREA)
- Transplantation (AREA)
- Oncology (AREA)
- Hematology (AREA)
- Pain & Pain Management (AREA)
- Rheumatology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| WOPCT/CN2016/108897 | 2016-12-07 | ||
| CN2016108897 | 2016-12-07 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| TW202233190A true TW202233190A (zh) | 2022-09-01 |
Family
ID=62491736
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| TW111114434A TW202233190A (zh) | 2016-12-07 | 2017-12-07 | 作為PI3Kδ抑制劑的咪唑並[1,5-A]吡衍生物 |
| TW106143023A TWI762534B (zh) | 2016-12-07 | 2017-12-07 | 作為PI3Kδ抑制劑的咪唑並[1,5-A]吡衍生物 |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| TW106143023A TWI762534B (zh) | 2016-12-07 | 2017-12-07 | 作為PI3Kδ抑制劑的咪唑並[1,5-A]吡衍生物 |
Country Status (16)
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA3045959A1 (en) | 2016-12-07 | 2018-06-14 | Beigene, Ltd. | Imidazo [1,5-a] pyrazine derivatives as pi3kdelta inhibitors |
| BR112020004500A2 (pt) * | 2017-09-08 | 2020-12-01 | Beigene, Ltd. | derivados de imidazo [1,5-a] pirazina como inibidores de pi3kdelta |
| US20230011916A1 (en) * | 2019-11-21 | 2023-01-12 | Beigene, Ltd. | Methods of cancer treatment using anti-ox40 antibodies in combination with pi3 kinase delta inhibitors |
| KR102344185B1 (ko) * | 2020-02-26 | 2021-12-27 | 계명대학교 산학협력단 | 신규한 Pim 키나아제 억제제 및 이의 용도 |
| AU2022280905A1 (en) * | 2021-05-27 | 2024-01-18 | Beigene Switzerland Gmbh | SALTS OF A PI3Kdelta INHIBITOR, CRYSTALLINE FORMS, METHODS OF PREPARATION, AND USES THEREFORE |
| WO2023040810A1 (en) * | 2021-09-14 | 2023-03-23 | Beigene, Ltd. | Methods of cancer treatment using a combination of btk inhibitors and pi3 kinase inhibitors |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| UA83509C2 (en) | 2003-10-15 | 2008-07-25 | Оси Фармасьютикалз, Инк. | Imidazopyrazines as tyrosine kinase inhibitors |
| BRPI1014572B8 (pt) | 2009-04-16 | 2022-07-19 | Fundacion Centro Nac De Investigaciones Oncologicas Carlos Iii | Imidazopirazinas para uso como inibidores de cinase |
| RU2013138835A (ru) | 2011-02-09 | 2015-03-20 | Ф. Хоффманн-Ля Рош Аг | Гетероциклические соединения в качестве ингибиторов pi3 киназы |
| ES2588186T3 (es) * | 2012-01-10 | 2016-10-31 | Bayer Intellectual Property Gmbh | Imidazopirazinas sustituidas como inhibidores de la quinasa Akt |
| AU2013337717B2 (en) | 2012-11-01 | 2018-10-25 | Infinity Pharmaceuticals, Inc. | Treatment of cancers using PI3 kinase isoform modulators |
| CA2914284A1 (en) | 2013-05-30 | 2014-12-04 | Infinity Pharmaceuticals, Inc. | Treatment of cancers using pi3 kinase isoform modulators |
| CA2922058A1 (en) * | 2013-10-18 | 2015-04-23 | Medivation Technologies, Inc. | Heterocyclic compounds and methods of use |
| PL3179991T3 (pl) | 2014-08-11 | 2022-02-14 | Acerta Pharma B.V. | Kombinacje terapeutyczne inhibitora btk i inhibitora bcl-2 |
| CA3045959A1 (en) * | 2016-12-07 | 2018-06-14 | Beigene, Ltd. | Imidazo [1,5-a] pyrazine derivatives as pi3kdelta inhibitors |
| BR112020004500A2 (pt) | 2017-09-08 | 2020-12-01 | Beigene, Ltd. | derivados de imidazo [1,5-a] pirazina como inibidores de pi3kdelta |
-
2017
- 2017-12-07 CA CA3045959A patent/CA3045959A1/en active Pending
- 2017-12-07 EP EP17877406.3A patent/EP3551630A4/en not_active Withdrawn
- 2017-12-07 TW TW111114434A patent/TW202233190A/zh unknown
- 2017-12-07 AU AU2017372377A patent/AU2017372377B2/en not_active Ceased
- 2017-12-07 CN CN201780076039.3A patent/CN110267959B/zh not_active Expired - Fee Related
- 2017-12-07 US US16/466,621 patent/US11136323B2/en active Active
- 2017-12-07 TW TW106143023A patent/TWI762534B/zh not_active IP Right Cessation
- 2017-12-07 MX MX2019006612A patent/MX394882B/es unknown
- 2017-12-07 BR BR112019011847-0A patent/BR112019011847A2/pt not_active IP Right Cessation
- 2017-12-07 EA EA201991355A patent/EA201991355A1/ru unknown
- 2017-12-07 JP JP2019530790A patent/JP7064495B2/ja not_active Expired - Fee Related
- 2017-12-07 CN CN202210507333.8A patent/CN114805366A/zh active Pending
- 2017-12-07 WO PCT/CN2017/114970 patent/WO2018103688A1/en not_active Ceased
- 2017-12-07 NZ NZ754944A patent/NZ754944A/en not_active IP Right Cessation
- 2017-12-07 KR KR1020197019710A patent/KR20190091339A/ko not_active Ceased
- 2017-12-07 SG SG10201912192RA patent/SG10201912192RA/en unknown
-
2019
- 2019-05-24 ZA ZA2019/03286A patent/ZA201903286B/en unknown
- 2019-05-29 IL IL266986A patent/IL266986B/en unknown
-
2021
- 2021-07-08 US US17/370,728 patent/US11725012B2/en active Active
-
2022
- 2022-02-07 IL IL290419A patent/IL290419B2/en unknown
- 2022-04-22 JP JP2022070763A patent/JP2022090051A/ja active Pending
- 2022-05-31 AU AU2022203737A patent/AU2022203737A1/en not_active Abandoned
Also Published As
| Publication number | Publication date |
|---|---|
| AU2022203737A1 (en) | 2022-06-23 |
| MX394882B (es) | 2025-03-24 |
| AU2017372377A1 (en) | 2019-07-18 |
| SG10201912192RA (en) | 2020-02-27 |
| AU2017372377B2 (en) | 2022-03-03 |
| CA3045959A1 (en) | 2018-06-14 |
| EP3551630A4 (en) | 2020-07-15 |
| IL266986B (en) | 2022-03-01 |
| US11136323B2 (en) | 2021-10-05 |
| ZA201903286B (en) | 2021-01-27 |
| CN110267959A (zh) | 2019-09-20 |
| CN110267959B (zh) | 2022-05-27 |
| MX2019006612A (es) | 2019-08-01 |
| US20220098202A1 (en) | 2022-03-31 |
| TWI762534B (zh) | 2022-05-01 |
| US20190367523A1 (en) | 2019-12-05 |
| JP7064495B2 (ja) | 2022-05-10 |
| NZ754944A (en) | 2023-02-24 |
| IL290419A (en) | 2022-04-01 |
| BR112019011847A2 (pt) | 2019-10-29 |
| EA201991355A1 (ru) | 2019-11-29 |
| IL266986A (en) | 2019-07-31 |
| CN114805366A (zh) | 2022-07-29 |
| TW201833113A (zh) | 2018-09-16 |
| EP3551630A1 (en) | 2019-10-16 |
| WO2018103688A1 (en) | 2018-06-14 |
| KR20190091339A (ko) | 2019-08-05 |
| JP2020500909A (ja) | 2020-01-16 |
| IL290419B2 (en) | 2023-02-01 |
| US11725012B2 (en) | 2023-08-15 |
| IL290419B (en) | 2022-10-01 |
| JP2022090051A (ja) | 2022-06-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| TWI762534B (zh) | 作為PI3Kδ抑制劑的咪唑並[1,5-A]吡衍生物 | |
| WO2020103896A1 (en) | Pyrrolo[2,3-b]pyridines as hpk1 inhibitor and uses thereof | |
| CA3145751A1 (en) | Pyrrolo[2, 3-b]pyrazines as hpk1 inhibitor and the use thereof | |
| ES2770693T3 (es) | Derivados de imidazopiridazina como inhibidores de caseína quinasa 1 delta/épsilon | |
| CN110997677A (zh) | 具有改进的双重选择性的Btk抑制剂 | |
| TWI817956B (zh) | 咪唑並[1,5-A]吡嗪衍生物作爲PI3Kδ 抑制劑 | |
| CN116981458A (zh) | 具有四氢吲哚-1-甲酰胺作为bcl-2抑制剂的化合物 | |
| TW202214634A (zh) | 雜環化合物及其衍生物 | |
| WO2024067445A1 (zh) | 新型prmt5抑制剂及其应用 | |
| WO2020048409A1 (en) | 1,5-NAPHTHYRIDIN-4(1H)-ONE DERIVATIVES AS PI3Kbeta INHIBITORS | |
| WO2024230803A1 (en) | Isoquinolinone derivatives and 4h-quinolizinone derivatives and pharmarceutical compositions thereof for the treatment of disease | |
| HK40008309B (en) | Imidazo [1,5-a] pyrazine derivatives as pi3kdelta inhibitors | |
| HK40008309A (en) | Imidazo [1,5-a] pyrazine derivatives as pi3kdelta inhibitors | |
| EA040746B1 (ru) | ПРОИЗВОДНЫЕ ИМИДАЗО[1,5-а]ПИРАЗИНА В КАЧЕСТВЕ ИНГИБИТОРОВ PI3Kδ | |
| HK40091563B (zh) | 嘧啶酮类化合物及其用途 | |
| HK40091563A (zh) | 嘧啶酮类化合物及其用途 | |
| EA040339B1 (ru) | ПРОИЗВОДНЫЕ ИМИДАЗО[1,5-а]ПИРАЗИНА КАК ИНГИБИТОРЫ PI3Kδ |