SU852159A3 - Средство дл регулировани ростаРАСТЕНий - Google Patents
Средство дл регулировани ростаРАСТЕНий Download PDFInfo
- Publication number
- SU852159A3 SU852159A3 SU772452843A SU2452843A SU852159A3 SU 852159 A3 SU852159 A3 SU 852159A3 SU 772452843 A SU772452843 A SU 772452843A SU 2452843 A SU2452843 A SU 2452843A SU 852159 A3 SU852159 A3 SU 852159A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- alkyl
- formula
- compounds
- radical
- reacting
- Prior art date
Links
- 230000008635 plant growth Effects 0.000 title claims abstract description 5
- 150000001875 compounds Chemical class 0.000 claims abstract description 26
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 11
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 8
- 239000001257 hydrogen Substances 0.000 claims abstract description 7
- 125000002252 acyl group Chemical group 0.000 claims abstract description 6
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 claims abstract description 5
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims abstract description 3
- 125000003435 aroyl group Chemical group 0.000 claims abstract description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 3
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims abstract description 3
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 3
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 3
- 239000001301 oxygen Substances 0.000 claims abstract description 3
- 230000001105 regulatory effect Effects 0.000 claims abstract description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract 2
- 239000013543 active substance Substances 0.000 claims description 7
- 239000007787 solid Substances 0.000 claims description 7
- 239000007788 liquid Substances 0.000 claims description 6
- 150000002741 methionine derivatives Chemical class 0.000 claims description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 4
- 230000009471 action Effects 0.000 claims description 3
- 239000000969 carrier Substances 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 2
- 239000000460 chlorine Substances 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 125000000623 heterocyclic group Chemical group 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 229910052717 sulfur Chemical group 0.000 claims description 2
- 239000011593 sulfur Chemical group 0.000 claims description 2
- 150000002431 hydrogen Chemical group 0.000 claims 2
- 229910052799 carbon Inorganic materials 0.000 claims 1
- 150000002367 halogens Chemical class 0.000 claims 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims 1
- -1 3,5-dichlorophenyl Chemical group 0.000 abstract description 10
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract description 8
- FFEARJCKVFRZRR-BYPYZUCNSA-N L-methionine Chemical compound CSCC[C@H](N)C(O)=O FFEARJCKVFRZRR-BYPYZUCNSA-N 0.000 abstract description 5
- 229930182817 methionine Natural products 0.000 abstract description 5
- 239000000203 mixture Substances 0.000 abstract description 5
- 150000003839 salts Chemical class 0.000 abstract description 4
- 150000001412 amines Chemical class 0.000 abstract description 2
- 239000012948 isocyanate Substances 0.000 abstract 4
- 150000002513 isocyanates Chemical class 0.000 abstract 4
- 229940053195 antiepileptics hydantoin derivative Drugs 0.000 abstract 3
- 150000001469 hydantoins Chemical class 0.000 abstract 3
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 abstract 2
- 239000004202 carbamide Substances 0.000 abstract 2
- 150000002540 isothiocyanates Chemical class 0.000 abstract 2
- 150000002825 nitriles Chemical class 0.000 abstract 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 abstract 1
- KKFDJZZADQONDE-UHFFFAOYSA-N (hydridonitrato)hydroxidocarbon(.) Chemical class O[C]=N KKFDJZZADQONDE-UHFFFAOYSA-N 0.000 abstract 1
- MWLKEJXYXYRWIH-UHFFFAOYSA-N 2-amino-4-methylsulfanylbutanenitrile Chemical class CSCCC(N)C#N MWLKEJXYXYRWIH-UHFFFAOYSA-N 0.000 abstract 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract 1
- 239000004480 active ingredient Substances 0.000 abstract 1
- 229910052783 alkali metal Inorganic materials 0.000 abstract 1
- 150000001340 alkali metals Chemical class 0.000 abstract 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 abstract 1
- 150000001342 alkaline earth metals Chemical class 0.000 abstract 1
- 150000001350 alkyl halides Chemical class 0.000 abstract 1
- 150000001408 amides Chemical class 0.000 abstract 1
- 150000001449 anionic compounds Chemical class 0.000 abstract 1
- 125000003710 aryl alkyl group Chemical group 0.000 abstract 1
- 125000004181 carboxyalkyl group Chemical group 0.000 abstract 1
- 125000004093 cyano group Chemical group *C#N 0.000 abstract 1
- 239000003085 diluting agent Substances 0.000 abstract 1
- 150000002148 esters Chemical class 0.000 abstract 1
- 125000001188 haloalkyl group Chemical group 0.000 abstract 1
- 125000005843 halogen group Chemical group 0.000 abstract 1
- 229910001385 heavy metal Inorganic materials 0.000 abstract 1
- 229910001412 inorganic anion Inorganic materials 0.000 abstract 1
- 239000000376 reactant Substances 0.000 abstract 1
- 125000003107 substituted aryl group Chemical group 0.000 abstract 1
- 150000003672 ureas Chemical class 0.000 abstract 1
- 241000196324 Embryophyta Species 0.000 description 16
- 235000013399 edible fruits Nutrition 0.000 description 12
- 238000012360 testing method Methods 0.000 description 11
- 229940091173 hydantoin Drugs 0.000 description 10
- 239000000243 solution Substances 0.000 description 7
- 239000003795 chemical substances by application Substances 0.000 description 6
- 238000005507 spraying Methods 0.000 description 6
- 229920000742 Cotton Polymers 0.000 description 5
- 241000227653 Lycopersicon Species 0.000 description 5
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 5
- 244000046052 Phaseolus vulgaris Species 0.000 description 5
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 5
- 239000000853 adhesive Substances 0.000 description 5
- 230000001070 adhesive effect Effects 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- 230000017260 vegetative to reproductive phase transition of meristem Effects 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- 240000004713 Pisum sativum Species 0.000 description 4
- 235000010582 Pisum sativum Nutrition 0.000 description 4
- 240000008042 Zea mays Species 0.000 description 4
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 4
- 230000035613 defoliation Effects 0.000 description 4
- 238000002474 experimental method Methods 0.000 description 4
- 239000000945 filler Substances 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- 125000004372 methylthioethyl group Chemical group [H]C([H])([H])SC([H])([H])C([H])([H])* 0.000 description 4
- 239000003381 stabilizer Substances 0.000 description 4
- 244000099147 Ananas comosus Species 0.000 description 3
- 235000007119 Ananas comosus Nutrition 0.000 description 3
- 241000219146 Gossypium Species 0.000 description 3
- 240000005979 Hordeum vulgare Species 0.000 description 3
- 235000007340 Hordeum vulgare Nutrition 0.000 description 3
- 238000011161 development Methods 0.000 description 3
- 230000018109 developmental process Effects 0.000 description 3
- 239000004495 emulsifiable concentrate Substances 0.000 description 3
- 239000000839 emulsion Substances 0.000 description 3
- WJRBRSLFGCUECM-UHFFFAOYSA-N hydantoin Chemical compound O=C1CNC(=O)N1 WJRBRSLFGCUECM-UHFFFAOYSA-N 0.000 description 3
- 230000035515 penetration Effects 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 230000005070 ripening Effects 0.000 description 3
- 239000002689 soil Substances 0.000 description 3
- 239000004094 surface-active agent Substances 0.000 description 3
- 239000004563 wettable powder Substances 0.000 description 3
- 239000000080 wetting agent Substances 0.000 description 3
- 235000007516 Chrysanthemum Nutrition 0.000 description 2
- 240000008067 Cucumis sativus Species 0.000 description 2
- 235000009849 Cucumis sativus Nutrition 0.000 description 2
- 244000020551 Helianthus annuus Species 0.000 description 2
- 235000003222 Helianthus annuus Nutrition 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 2
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 2
- 230000001133 acceleration Effects 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 235000013339 cereals Nutrition 0.000 description 2
- 239000000084 colloidal system Substances 0.000 description 2
- 238000004040 coloring Methods 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 235000005822 corn Nutrition 0.000 description 2
- 238000005260 corrosion Methods 0.000 description 2
- 230000007797 corrosion Effects 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 230000035784 germination Effects 0.000 description 2
- 230000009036 growth inhibition Effects 0.000 description 2
- 238000003306 harvesting Methods 0.000 description 2
- 230000006698 induction Effects 0.000 description 2
- 239000003112 inhibitor Substances 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 235000009973 maize Nutrition 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 230000000877 morphologic effect Effects 0.000 description 2
- 230000004660 morphological change Effects 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 230000001681 protective effect Effects 0.000 description 2
- 239000013008 thixotropic agent Substances 0.000 description 2
- 238000009736 wetting Methods 0.000 description 2
- WWTBZEKOSBFBEM-SPWPXUSOSA-N (2s)-2-[[2-benzyl-3-[hydroxy-[(1r)-2-phenyl-1-(phenylmethoxycarbonylamino)ethyl]phosphoryl]propanoyl]amino]-3-(1h-indol-3-yl)propanoic acid Chemical compound N([C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)O)C(=O)C(CP(O)(=O)[C@H](CC=1C=CC=CC=1)NC(=O)OCC=1C=CC=CC=1)CC1=CC=CC=C1 WWTBZEKOSBFBEM-SPWPXUSOSA-N 0.000 description 1
- RMSGQZDGSZOJMU-UHFFFAOYSA-N 1-butyl-2-phenylbenzene Chemical group CCCCC1=CC=CC=C1C1=CC=CC=C1 RMSGQZDGSZOJMU-UHFFFAOYSA-N 0.000 description 1
- MLBQIJZYOUBKNF-UHFFFAOYSA-N 1-methyl-5-(2-methylsulfanylethyl)-3-phenylimidazolidine-2,4-dione Chemical compound O=C1C(CCSC)N(C)C(=O)N1C1=CC=CC=C1 MLBQIJZYOUBKNF-UHFFFAOYSA-N 0.000 description 1
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 1
- 125000004201 2,4-dichlorophenyl group Chemical group [H]C1=C([H])C(*)=C(Cl)C([H])=C1Cl 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 1
- KFTWQRHZAGERKL-UHFFFAOYSA-N 3-(2-methylphenyl)-5-(2-methylsulfanylethyl)imidazolidine-2,4-dione Chemical compound O=C1C(CCSC)NC(=O)N1C1=CC=CC=C1C KFTWQRHZAGERKL-UHFFFAOYSA-N 0.000 description 1
- WNYMNSDTGPQZFZ-UHFFFAOYSA-N 3-(4-methoxyphenyl)-5-(2-methylsulfanylethyl)imidazolidine-2,4-dione Chemical compound C1=CC(OC)=CC=C1N1C(=O)C(CCSC)NC1=O WNYMNSDTGPQZFZ-UHFFFAOYSA-N 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- LLJRXVHJOJRCSM-UHFFFAOYSA-N 3-pyridin-4-yl-1H-indole Chemical group C=1NC2=CC=CC=C2C=1C1=CC=NC=C1 LLJRXVHJOJRCSM-UHFFFAOYSA-N 0.000 description 1
- YWXGNVFTDAYHNE-UHFFFAOYSA-N 5-(2-methylsulfanylethyl)-2,4-dioxo-3-phenyl-n-propylimidazolidine-1-carboxamide Chemical compound O=C1N(C(=O)NCCC)C(CCSC)C(=O)N1C1=CC=CC=C1 YWXGNVFTDAYHNE-UHFFFAOYSA-N 0.000 description 1
- GRGTVWVUPQXEBN-UHFFFAOYSA-N 5-(2-methylsulfanylethyl)-3-(4-propan-2-ylphenyl)imidazolidine-2,4-dione Chemical compound O=C1C(CCSC)NC(=O)N1C1=CC=C(C(C)C)C=C1 GRGTVWVUPQXEBN-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 244000056139 Brassica cretica Species 0.000 description 1
- 235000003351 Brassica cretica Nutrition 0.000 description 1
- 235000003343 Brassica rupestris Nutrition 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 240000005250 Chrysanthemum indicum Species 0.000 description 1
- 244000189548 Chrysanthemum x morifolium Species 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- 241001579180 Matthiola longipetala Species 0.000 description 1
- 241000207836 Olea <angiosperm> Species 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- LNUFLCYMSVYYNW-ZPJMAFJPSA-N [(2r,3r,4s,5r,6r)-2-[(2r,3r,4s,5r,6r)-6-[(2r,3r,4s,5r,6r)-6-[(2r,3r,4s,5r,6r)-6-[[(3s,5s,8r,9s,10s,13r,14s,17r)-10,13-dimethyl-17-[(2r)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1h-cyclopenta[a]phenanthren-3-yl]oxy]-4,5-disulfo Chemical compound O([C@@H]1[C@@H](COS(O)(=O)=O)O[C@@H]([C@@H]([C@H]1OS(O)(=O)=O)OS(O)(=O)=O)O[C@@H]1[C@@H](COS(O)(=O)=O)O[C@@H]([C@@H]([C@H]1OS(O)(=O)=O)OS(O)(=O)=O)O[C@@H]1[C@@H](COS(O)(=O)=O)O[C@H]([C@@H]([C@H]1OS(O)(=O)=O)OS(O)(=O)=O)O[C@@H]1C[C@@H]2CC[C@H]3[C@@H]4CC[C@@H]([C@]4(CC[C@@H]3[C@@]2(C)CC1)C)[C@H](C)CCCC(C)C)[C@H]1O[C@H](COS(O)(=O)=O)[C@@H](OS(O)(=O)=O)[C@H](OS(O)(=O)=O)[C@H]1OS(O)(=O)=O LNUFLCYMSVYYNW-ZPJMAFJPSA-N 0.000 description 1
- RPHFCAMQRZXSPG-UHFFFAOYSA-N [Br-].CC(C[SH+]N1C(=O)N(C(=O)C1)C1=CC=CC=C1)C Chemical compound [Br-].CC(C[SH+]N1C(=O)N(C(=O)C1)C1=CC=CC=C1)C RPHFCAMQRZXSPG-UHFFFAOYSA-N 0.000 description 1
- 239000006096 absorbing agent Substances 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 239000002518 antifoaming agent Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- QKSKPIVNLNLAAV-UHFFFAOYSA-N bis(2-chloroethyl) sulfide Chemical compound ClCCSCCCl QKSKPIVNLNLAAV-UHFFFAOYSA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 229930002875 chlorophyll Natural products 0.000 description 1
- 235000019804 chlorophyll Nutrition 0.000 description 1
- ATNHDLDRLWWWCB-AENOIHSZSA-M chlorophyll a Chemical compound C1([C@@H](C(=O)OC)C(=O)C2=C3C)=C2N2C3=CC(C(CC)=C3C)=[N+]4C3=CC3=C(C=C)C(C)=C5N3[Mg-2]42[N+]2=C1[C@@H](CCC(=O)OC\C=C(/C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)[C@H](C)C2=C5 ATNHDLDRLWWWCB-AENOIHSZSA-M 0.000 description 1
- 229940125773 compound 10 Drugs 0.000 description 1
- 229940126208 compound 22 Drugs 0.000 description 1
- 229940126214 compound 3 Drugs 0.000 description 1
- 239000013068 control sample Substances 0.000 description 1
- 239000006184 cosolvent Substances 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000000003 effect on germination Effects 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- DNJIEGIFACGWOD-UHFFFAOYSA-N ethanethiol Chemical compound CCS DNJIEGIFACGWOD-UHFFFAOYSA-N 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 230000008014 freezing Effects 0.000 description 1
- 238000007710 freezing Methods 0.000 description 1
- 230000004345 fruit ripening Effects 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 230000012010 growth Effects 0.000 description 1
- 239000003630 growth substance Substances 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 239000003621 irrigation water Substances 0.000 description 1
- ZLVXBBHTMQJRSX-VMGNSXQWSA-N jdtic Chemical compound C1([C@]2(C)CCN(C[C@@H]2C)C[C@H](C(C)C)NC(=O)[C@@H]2NCC3=CC(O)=CC=C3C2)=CC=CC(O)=C1 ZLVXBBHTMQJRSX-VMGNSXQWSA-N 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 230000035800 maturation Effects 0.000 description 1
- 239000008268 mayonnaise Substances 0.000 description 1
- 235000010746 mayonnaise Nutrition 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 235000010460 mustard Nutrition 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 125000000744 organoheteryl group Chemical group 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 230000000361 pesticidal effect Effects 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 230000008121 plant development Effects 0.000 description 1
- 230000010152 pollination Effects 0.000 description 1
- 239000004584 polyacrylic acid Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- ARENMZZMCSLORU-UHFFFAOYSA-N propan-2-yl naphthalene-1-sulfonate Chemical compound C1=CC=C2C(S(=O)(=O)OC(C)C)=CC=CC2=C1 ARENMZZMCSLORU-UHFFFAOYSA-N 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000013049 sediment Substances 0.000 description 1
- 238000004062 sedimentation Methods 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- 150000008054 sulfonate salts Chemical class 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/66—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/72—Two oxygen atoms, e.g. hydantoin
- C07D233/76—Two oxygen atoms, e.g. hydantoin with substituted hydrocarbon radicals attached to the third ring carbon atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/50—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton
- C07C323/51—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton having the sulfur atoms of the thio groups bound to acyclic carbon atoms of the carbon skeleton
- C07C323/57—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton having the sulfur atoms of the thio groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being further substituted by nitrogen atoms, not being part of nitro or nitroso groups
- C07C323/58—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton having the sulfur atoms of the thio groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being further substituted by nitrogen atoms, not being part of nitro or nitroso groups with amino groups bound to the carbon skeleton
- C07C323/59—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton having the sulfur atoms of the thio groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being further substituted by nitrogen atoms, not being part of nitro or nitroso groups with amino groups bound to the carbon skeleton with acylated amino groups bound to the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/12—Systems containing only non-condensed rings with a six-membered ring
- C07C2601/14—The ring being saturated
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7319579A FR2230629B1 (enExample) | 1973-05-22 | 1973-05-22 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU852159A3 true SU852159A3 (ru) | 1981-07-30 |
Family
ID=9120215
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU772452843A SU852159A3 (ru) | 1973-05-22 | 1977-02-15 | Средство дл регулировани ростаРАСТЕНий |
Country Status (21)
| Country | Link |
|---|---|
| US (1) | US3990883A (enExample) |
| JP (1) | JPS5018634A (enExample) |
| AR (1) | AR217226A1 (enExample) |
| BE (1) | BE815441A (enExample) |
| BG (2) | BG23537A3 (enExample) |
| BR (1) | BR7404193D0 (enExample) |
| CH (1) | CH601987A5 (enExample) |
| DD (1) | DD113838A5 (enExample) |
| DE (1) | DE2423273A1 (enExample) |
| EG (1) | EG11068A (enExample) |
| ES (1) | ES426586A1 (enExample) |
| FR (1) | FR2230629B1 (enExample) |
| GB (1) | GB1476333A (enExample) |
| IL (1) | IL44874A (enExample) |
| IN (1) | IN140277B (enExample) |
| IT (1) | IT1047039B (enExample) |
| KE (1) | KE3072A (enExample) |
| OA (1) | OA04707A (enExample) |
| PH (1) | PH14463A (enExample) |
| SU (1) | SU852159A3 (enExample) |
| ZA (1) | ZA743177B (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| PH13853A (en) * | 1975-01-13 | 1980-10-22 | Stauffer Chemical Co | Substituted thiomethylurea herbicides |
| JPS567383Y2 (enExample) * | 1976-06-30 | 1981-02-18 | ||
| US4343805A (en) * | 1978-12-16 | 1982-08-10 | John Wyeth & Brother Limited | Heterocyclic compounds |
| AU1395983A (en) * | 1982-05-03 | 1983-11-10 | Uniroyal Inc. | Substituted urea herbicides |
| US4604127A (en) * | 1984-07-17 | 1986-08-05 | Eli Lilly And Company | Herbicidal pyridazinylimidazolidinone compounds |
| US4600430A (en) * | 1985-02-22 | 1986-07-15 | Eli Lilly And Company | Pyridinylimidazolidinone compounds |
| US4859228A (en) * | 1987-07-16 | 1989-08-22 | Ici Americas Inc | Novel 5-aminomethylene-2,4-imidazolidinediones and 5-aminomethylene-2-thionoimidazolidine-4-ones |
| FR2651495A1 (fr) * | 1989-09-04 | 1991-03-08 | Rhone Poulenc Chimie | Procede de preparation de l'acide amino-1 cyclopropanecarboxylique et d'un de ses intermediaires de synthese. |
| AR102942A1 (es) | 2014-12-11 | 2017-04-05 | Bayer Cropscience Ag | Derivados de arilsulfuro y arilsulfóxido de cinco miembros c-n-conectados, como plaguicidas |
| GB2561540A (en) | 2017-03-13 | 2018-10-24 | Nodthera Ltd | Chemical compounds |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3020145A (en) * | 1955-12-22 | 1962-02-06 | Du Pont | Herbicidal composition and method employing substituted ureas |
| CH430323A (de) * | 1964-03-04 | 1967-02-15 | Sandoz Ag | Verfahren und Mittel zur Unkrautbekämpfung |
| US3340042A (en) * | 1964-11-30 | 1967-09-05 | Schwartz Herbert | Post-emergence herbicidal mixture and method of use |
| US3671212A (en) * | 1970-10-13 | 1972-06-20 | Monsanto Co | Growth-promoting compositions and methods |
| AU4102272A (en) * | 1971-12-29 | 1973-10-18 | Nippon Soda Company, Limited | Plant growth regulating composition, method and use of 1-methionine, dl-methionine and esters and salts thereof |
-
1972
- 1972-05-22 BG BG030060A patent/BG23537A3/xx unknown
-
1973
- 1973-05-22 FR FR7319579A patent/FR2230629B1/fr not_active Expired
-
1974
- 1974-05-14 DE DE2423273A patent/DE2423273A1/de not_active Withdrawn
- 1974-05-17 ZA ZA00743177A patent/ZA743177B/xx unknown
- 1974-05-20 AR AR253825A patent/AR217226A1/es active
- 1974-05-21 DD DD178653A patent/DD113838A5/xx unknown
- 1974-05-21 IL IL44874A patent/IL44874A/xx unknown
- 1974-05-21 IT IT51151/74A patent/IT1047039B/it active
- 1974-05-21 EG EG183/74A patent/EG11068A/xx active
- 1974-05-21 CH CH694974A patent/CH601987A5/xx not_active IP Right Cessation
- 1974-05-21 GB GB2260474A patent/GB1476333A/en not_active Expired
- 1974-05-21 JP JP49057755A patent/JPS5018634A/ja active Pending
- 1974-05-22 BE BE144668A patent/BE815441A/xx unknown
- 1974-05-22 BR BR4193/74A patent/BR7404193D0/pt unknown
- 1974-05-22 IN IN1116/CAL/74A patent/IN140277B/en unknown
- 1974-05-22 OA OA55207A patent/OA04707A/xx unknown
- 1974-05-22 ES ES0426586A patent/ES426586A1/es not_active Expired
- 1974-05-22 BG BG026759A patent/BG22993A3/xx unknown
- 1974-05-22 US US05/472,471 patent/US3990883A/en not_active Expired - Lifetime
-
1977
- 1977-02-15 SU SU772452843A patent/SU852159A3/ru active
-
1978
- 1978-09-08 PH PH21591A patent/PH14463A/en unknown
-
1980
- 1980-08-14 KE KE3072A patent/KE3072A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| PH14463A (en) | 1981-07-29 |
| IL44874A (en) | 1978-07-31 |
| CH601987A5 (enExample) | 1978-07-14 |
| GB1476333A (en) | 1977-06-10 |
| FR2230629B1 (enExample) | 1979-02-23 |
| BG22993A3 (bg) | 1977-05-20 |
| DD113838A5 (enExample) | 1975-07-05 |
| JPS5018634A (enExample) | 1975-02-27 |
| OA04707A (fr) | 1980-08-31 |
| BR7404193D0 (pt) | 1975-09-23 |
| IL44874A0 (en) | 1974-07-31 |
| IT1047039B (it) | 1980-09-10 |
| IN140277B (enExample) | 1976-10-09 |
| ZA743177B (en) | 1976-01-28 |
| EG11068A (en) | 1976-12-31 |
| FR2230629A1 (enExample) | 1974-12-20 |
| BG23537A3 (bg) | 1977-09-15 |
| ES426586A1 (es) | 1976-07-01 |
| DE2423273A1 (de) | 1974-12-19 |
| KE3072A (en) | 1980-08-29 |
| US3990883A (en) | 1976-11-09 |
| AR217226A1 (es) | 1980-03-14 |
| BE815441A (fr) | 1974-09-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1695968C3 (de) | 4-Methylthiazolyl-5-carboxanilidverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung als fungizide Mittel | |
| DE2808317C2 (enExample) | ||
| SU852159A3 (ru) | Средство дл регулировани ростаРАСТЕНий | |
| HK81192A (en) | Microbiocide compounds | |
| SU639406A3 (ru) | Средство дл дефолиации растений | |
| US2911336A (en) | Fungicides | |
| CA1108618A (en) | 1, 2, 3-thiadiazol-3-in-5-ylidene ureas, a process for their manufacture and their use in regulating the growth of plants | |
| SU561490A3 (ru) | Состав дл регулировани роста растений | |
| US4093444A (en) | Hydantoin derivatives and methods for regulating plant-growth | |
| IL43840A (en) | Derivatives of 2-substituted 1,3,4-oxadiazole-5-thiol and fungicidal compositions containing them | |
| US3836350A (en) | Ureidotriazoles as yield increasing agents for crop plants | |
| AU672273B2 (en) | Microbicides | |
| SU578817A3 (ru) | Состав дл регулировани роста растений | |
| JPH0324002A (ja) | 植物成長調節剤 | |
| PL87037B1 (enExample) | ||
| EP0051884A1 (en) | Amino-cyclopropyl-carboxylic-acid derivatives for the loosening of fruit and/or leaves on plants | |
| DE2112643C3 (de) | Formamidin-Derivate und sie enthaltende Mittel | |
| US3326748A (en) | Control of powdery mildew with zinc and antimony n, n-dibutyldithiocarbamates | |
| CA1073924A (en) | Ureidoacetic acid derivatives | |
| EA004532B1 (ru) | Применение регулятора роста на основе семикарбазона для повышения урожая | |
| US3323986A (en) | Method for control of powdery mildew | |
| JPH08268809A (ja) | ジカルボキサミド化合物をベースとする新規の殺菌性組成物 | |
| US3247056A (en) | Methods for inhibiting bacteria, fungi and nematodes with 1, 3, 2-dithioarsenols | |
| AT393589B (de) | Fungizide mittel | |
| DE2719810A1 (de) | 1,2,3-thiadiazolin-2-id-derivate, verfahren zur herstellung dieser verbindungen sowie diese enthaltende mittel mit wachstumsregulatorischer wirkung fuer pflanzen |