SU633474A3 - Способ получени -замещенных производных 3(фенил) пиперидина или их солей - Google Patents
Способ получени -замещенных производных 3(фенил) пиперидина или их солейInfo
- Publication number
- SU633474A3 SU633474A3 SU762355260A SU2355260A SU633474A3 SU 633474 A3 SU633474 A3 SU 633474A3 SU 762355260 A SU762355260 A SU 762355260A SU 2355260 A SU2355260 A SU 2355260A SU 633474 A3 SU633474 A3 SU 633474A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- piperidine
- mixture
- evaporated
- dimethoxyphenyl
- substituted
- Prior art date
Links
- 150000003839 salts Chemical class 0.000 title claims description 10
- 238000000034 method Methods 0.000 title claims description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 title 1
- -1 N-substituted 3- (phenyl) piperidine Chemical class 0.000 claims description 14
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 claims description 9
- 239000000284 extract Substances 0.000 claims description 9
- 150000001875 compounds Chemical class 0.000 claims description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Natural products CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- ROFVJSWBDQUQGW-UHFFFAOYSA-N piperidin-1-ium;bromide Chemical compound Br.C1CCNCC1 ROFVJSWBDQUQGW-UHFFFAOYSA-N 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 6
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 239000001632 sodium acetate Substances 0.000 claims description 5
- 235000017281 sodium acetate Nutrition 0.000 claims description 5
- 239000002585 base Substances 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 239000011541 reaction mixture Substances 0.000 claims description 3
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 150000008064 anhydrides Chemical class 0.000 claims description 2
- 238000009835 boiling Methods 0.000 claims description 2
- 230000003993 interaction Effects 0.000 claims description 2
- 125000003884 phenylalkyl group Chemical group 0.000 claims description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims 1
- 125000006239 protecting group Chemical group 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 42
- 239000000203 mixture Substances 0.000 description 32
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 30
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 22
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 21
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 21
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 20
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 20
- 239000000047 product Substances 0.000 description 20
- 239000000243 solution Substances 0.000 description 19
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 15
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 13
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 12
- 238000002360 preparation method Methods 0.000 description 11
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 10
- 239000000741 silica gel Substances 0.000 description 10
- 229910002027 silica gel Inorganic materials 0.000 description 10
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 10
- 229940086542 triethylamine Drugs 0.000 description 10
- GFRXXGINNMABOS-UHFFFAOYSA-N 3-(3,4-dimethoxyphenyl)piperidine Chemical compound C1=C(OC)C(OC)=CC=C1C1CNCCC1 GFRXXGINNMABOS-UHFFFAOYSA-N 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 8
- NDVLTYZPCACLMA-UHFFFAOYSA-N silver oxide Chemical compound [O-2].[Ag+].[Ag+] NDVLTYZPCACLMA-UHFFFAOYSA-N 0.000 description 8
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 5
- 239000013078 crystal Substances 0.000 description 5
- 239000003480 eluent Substances 0.000 description 5
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 4
- 229920006395 saturated elastomer Polymers 0.000 description 4
- 229910001923 silver oxide Inorganic materials 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- 239000012280 lithium aluminium hydride Substances 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 235000006408 oxalic acid Nutrition 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- WMTGYPSNYJWFRF-UHFFFAOYSA-N 1-[3-(3,4-dimethoxyphenyl)piperidin-1-yl]ethanone Chemical compound C1=C(OC)C(OC)=CC=C1C1CN(C(C)=O)CCC1 WMTGYPSNYJWFRF-UHFFFAOYSA-N 0.000 description 2
- KFOKBYKTEYEHJB-UHFFFAOYSA-N 1-[3-(3,4-dimethoxyphenyl)piperidin-1-yl]propan-1-one Chemical compound C1N(C(=O)CC)CCCC1C1=CC=C(OC)C(OC)=C1 KFOKBYKTEYEHJB-UHFFFAOYSA-N 0.000 description 2
- GYANLPOOGMZJGJ-UHFFFAOYSA-N 1-benzyl-3-(3,4-dimethoxyphenyl)piperidine Chemical compound C1=C(OC)C(OC)=CC=C1C1CN(CC=2C=CC=CC=2)CCC1 GYANLPOOGMZJGJ-UHFFFAOYSA-N 0.000 description 2
- JTWHHLGZUNBCPX-UHFFFAOYSA-N 3-(3,4-dimethoxyphenyl)-1-ethylpiperidine Chemical compound C1N(CC)CCCC1C1=CC=C(OC)C(OC)=C1 JTWHHLGZUNBCPX-UHFFFAOYSA-N 0.000 description 2
- SLXDHYUDKHEHFK-UHFFFAOYSA-N 3-(3,4-dimethoxyphenyl)-1-methylpiperidine;hydrochloride Chemical compound Cl.C1=C(OC)C(OC)=CC=C1C1CN(C)CCC1 SLXDHYUDKHEHFK-UHFFFAOYSA-N 0.000 description 2
- NZYBILDYPCVNMU-UHFFFAOYSA-N 3-phenylpiperidine Chemical class C1CCNCC1C1=CC=CC=C1 NZYBILDYPCVNMU-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000001530 fumaric acid Substances 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- WLCAJVVSNAVBSM-UHFFFAOYSA-N oxalic acid;piperidine Chemical compound C1CCNCC1.OC(=O)C(O)=O WLCAJVVSNAVBSM-UHFFFAOYSA-N 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 2
- 235000011121 sodium hydroxide Nutrition 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- HFVMEOPYDLEHBR-UHFFFAOYSA-N (2-fluorophenyl)-phenylmethanol Chemical compound C=1C=CC=C(F)C=1C(O)C1=CC=CC=C1 HFVMEOPYDLEHBR-UHFFFAOYSA-N 0.000 description 1
- NPLCDRYJHHBSFQ-BYPYZUCNSA-N (2S)-pyrrolidine-2-carbonyl iodide Chemical compound N1[C@H](C(=O)I)CCC1 NPLCDRYJHHBSFQ-BYPYZUCNSA-N 0.000 description 1
- CCODOIDFURPJTR-WLHGVMLRSA-N (e)-but-2-enedioic acid;piperidine Chemical compound C1CCNCC1.OC(=O)\C=C\C(O)=O CCODOIDFURPJTR-WLHGVMLRSA-N 0.000 description 1
- JOSGMXAISUHTJO-UHFFFAOYSA-N 1-benzyl-3-(3,4-dimethoxyphenyl)piperidin-3-ol Chemical compound C1=C(OC)C(OC)=CC=C1C1(O)CN(CC=2C=CC=CC=2)CCC1 JOSGMXAISUHTJO-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- JZAGFVJZFBADCS-UHFFFAOYSA-N 3-(3,4-dimethoxyphenyl)-1-propan-2-ylpiperidine Chemical compound C1=C(OC)C(OC)=CC=C1C1CN(C(C)C)CCC1 JZAGFVJZFBADCS-UHFFFAOYSA-N 0.000 description 1
- CMNFYRABBDCGJH-UHFFFAOYSA-N 3-(3,4-dimethoxyphenyl)-1-propylpiperidine Chemical compound C1N(CCC)CCCC1C1=CC=C(OC)C(OC)=C1 CMNFYRABBDCGJH-UHFFFAOYSA-N 0.000 description 1
- ROLMZTIHUMKEAI-UHFFFAOYSA-N 4,5-difluoro-2-hydroxybenzonitrile Chemical compound OC1=CC(F)=C(F)C=C1C#N ROLMZTIHUMKEAI-UHFFFAOYSA-N 0.000 description 1
- KBTMGSMZIKLAHN-UHFFFAOYSA-N 4-bromo-1,2-dimethoxybenzene Chemical compound COC1=CC=C(Br)C=C1OC KBTMGSMZIKLAHN-UHFFFAOYSA-N 0.000 description 1
- QISOBCMNUJQOJU-UHFFFAOYSA-N 4-bromo-1h-pyrazole-5-carboxylic acid Chemical compound OC(=O)C=1NN=CC=1Br QISOBCMNUJQOJU-UHFFFAOYSA-N 0.000 description 1
- PXRKCOCTEMYUEG-UHFFFAOYSA-N 5-aminoisoindole-1,3-dione Chemical compound NC1=CC=C2C(=O)NC(=O)C2=C1 PXRKCOCTEMYUEG-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric Acid Chemical compound [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- RNPASIAHUQYGNP-UHFFFAOYSA-N [2-acetyloxy-4-(1-propylpiperidin-3-yl)phenyl] acetate;oxalic acid Chemical compound OC(=O)C(O)=O.C1N(CCC)CCCC1C1=CC=C(OC(C)=O)C(OC(C)=O)=C1 RNPASIAHUQYGNP-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- PWHSBNBWBMQLCH-UHFFFAOYSA-N anisole;hydrobromide Chemical compound Br.COC1=CC=CC=C1 PWHSBNBWBMQLCH-UHFFFAOYSA-N 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 239000003518 caustics Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Substances OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 125000005805 dimethoxy phenyl group Chemical group 0.000 description 1
- TXKMVPPZCYKFAC-UHFFFAOYSA-N disulfur monoxide Inorganic materials O=S=S TXKMVPPZCYKFAC-UHFFFAOYSA-N 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- NLFBCYMMUAKCPC-KQQUZDAGSA-N ethyl (e)-3-[3-amino-2-cyano-1-[(e)-3-ethoxy-3-oxoprop-1-enyl]sulfanyl-3-oxoprop-1-enyl]sulfanylprop-2-enoate Chemical compound CCOC(=O)\C=C\SC(=C(C#N)C(N)=O)S\C=C\C(=O)OCC NLFBCYMMUAKCPC-KQQUZDAGSA-N 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000008098 formaldehyde solution Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 125000004464 hydroxyphenyl group Chemical group 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- FMKOJHQHASLBPH-UHFFFAOYSA-N isopropyl iodide Chemical compound CC(C)I FMKOJHQHASLBPH-UHFFFAOYSA-N 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N methanesulfonic acid Substances CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- PVWOIHVRPOBWPI-UHFFFAOYSA-N n-propyl iodide Chemical compound CCCI PVWOIHVRPOBWPI-UHFFFAOYSA-N 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- VWUIPPFDOFJILD-UHFFFAOYSA-N oxalic acid;hydrobromide Chemical class Br.OC(=O)C(O)=O VWUIPPFDOFJILD-UHFFFAOYSA-N 0.000 description 1
- NXJCBFBQEVOTOW-UHFFFAOYSA-L palladium(2+);dihydroxide Chemical compound O[Pd]O NXJCBFBQEVOTOW-UHFFFAOYSA-L 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- IZWQYPFXJMTLHZ-UHFFFAOYSA-N piperidin-1-ium;hydroxide Chemical compound O.C1CCNCC1 IZWQYPFXJMTLHZ-UHFFFAOYSA-N 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000001384 succinic acid Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- XTQHKBHJIVJGKJ-UHFFFAOYSA-N sulfur monoxide Chemical compound S=O XTQHKBHJIVJGKJ-UHFFFAOYSA-N 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/08—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms
- C07D211/18—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D211/20—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms with hydrocarbon radicals, substituted by singly bound oxygen or sulphur atoms
- C07D211/22—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms with hydrocarbon radicals, substituted by singly bound oxygen or sulphur atoms by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/40—Oxygen atoms
- C07D211/42—Oxygen atoms attached in position 3 or 5
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/68—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D211/70—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F3/00—Compounds containing elements of Groups 2 or 12 of the Periodic Table
- C07F3/02—Magnesium compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Hydrogenated Pyridines (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7515382A FR2310762A1 (fr) | 1975-05-16 | 1975-05-16 | Nouveaux derives n-substitues de la phenyl piperidine et leurs sels, procede de preparation et application a titre de medicaments |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU633474A3 true SU633474A3 (ru) | 1978-11-15 |
Family
ID=9155352
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU762355260A SU633474A3 (ru) | 1975-05-16 | 1976-05-11 | Способ получени -замещенных производных 3(фенил) пиперидина или их солей |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US4072685A (enExample) |
| JP (1) | JPS51141878A (enExample) |
| AU (1) | AU499668B2 (enExample) |
| BE (1) | BE841794A (enExample) |
| CA (1) | CA1087191A (enExample) |
| CH (1) | CH617923A5 (enExample) |
| DD (1) | DD125203A5 (enExample) |
| DE (1) | DE2621536A1 (enExample) |
| DK (1) | DK209176A (enExample) |
| ES (1) | ES447922A1 (enExample) |
| FR (1) | FR2310762A1 (enExample) |
| GB (1) | GB1490048A (enExample) |
| IE (1) | IE43847B1 (enExample) |
| IL (1) | IL49569A (enExample) |
| LU (1) | LU74940A1 (enExample) |
| NL (1) | NL7605272A (enExample) |
| SE (1) | SE7605361L (enExample) |
| SU (1) | SU633474A3 (enExample) |
| ZA (1) | ZA762889B (enExample) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4248876A (en) * | 1977-01-08 | 1981-02-03 | John Wyeth & Brother Ltd. | Piperidine derivatives |
| US4387229A (en) | 1977-09-13 | 1983-06-07 | Pfizer Inc. | 3-[2-Hydroxy-4-(substituted)phenyl]azacycloalkanols and derivatives thereof |
| WO1981001552A1 (en) * | 1979-12-05 | 1981-06-11 | Astra Laekemedel Ab | New phenyl-azacycloalkanes |
| FR2496099A1 (fr) * | 1980-12-15 | 1982-06-18 | Roussel Uclaf | Nouveaux derives de l'hydroxyphenyl tetrahydropyridine, leurs sels, procede et intermediaires de preparation, application a titre de medicaments et compositions les renfermant |
| FR2518093A2 (fr) * | 1980-12-15 | 1983-06-17 | Roussel Uclaf | Nouveaux derives de l'hydroxyphenyl tetrahydropyridine, leurs sels, procede et intermediaires de preparation, application a titre de medicaments et compositions les renfermant |
| ZA821887B (en) * | 1981-04-01 | 1983-01-26 | Haessle Ab | New phenyl-perhydroazepines |
| ZA821888B (en) * | 1981-04-01 | 1983-02-23 | Haessle Ab | Novel phenyl-piperidines |
| US4593037A (en) * | 1984-07-26 | 1986-06-03 | Pfizer Inc. | 1,3-disubstituted piperidine compounds as neuroleptic agents |
| US4623728A (en) | 1984-07-26 | 1986-11-18 | Pfizer Inc. | Intermediates for 1,3-disubstituted piperidine compounds as neuroleptic agents |
| US5153206A (en) * | 1988-12-02 | 1992-10-06 | Pfizer Inc. | Arylpiperidine derivatives |
| MX9100517A (es) * | 1990-08-06 | 1992-04-01 | Smith Kline French Lab | Compuestos |
| US5136040A (en) * | 1991-02-26 | 1992-08-04 | Eli Lilly And Company | Preparation of substituted tetrahydropyridines |
| DE102004036349A1 (de) * | 2004-07-27 | 2006-03-23 | Grünenthal GmbH | Substituierte 3-Phenylpiperidin-Derivate |
-
1975
- 1975-05-16 FR FR7515382A patent/FR2310762A1/fr active Granted
-
1976
- 1976-05-11 SE SE7605361A patent/SE7605361L/xx not_active Application Discontinuation
- 1976-05-11 SU SU762355260A patent/SU633474A3/ru active
- 1976-05-12 IL IL49569A patent/IL49569A/xx unknown
- 1976-05-12 DK DK209176A patent/DK209176A/da not_active Application Discontinuation
- 1976-05-13 US US05/686,090 patent/US4072685A/en not_active Expired - Lifetime
- 1976-05-13 LU LU74940A patent/LU74940A1/xx unknown
- 1976-05-13 CA CA252,503A patent/CA1087191A/fr not_active Expired
- 1976-05-13 BE BE166999A patent/BE841794A/xx not_active IP Right Cessation
- 1976-05-14 ZA ZA762889A patent/ZA762889B/xx unknown
- 1976-05-14 DE DE19762621536 patent/DE2621536A1/de not_active Withdrawn
- 1976-05-14 AU AU13960/76A patent/AU499668B2/en not_active Expired
- 1976-05-14 ES ES447922A patent/ES447922A1/es not_active Expired
- 1976-05-14 JP JP51054479A patent/JPS51141878A/ja active Pending
- 1976-05-14 CH CH608876A patent/CH617923A5/fr not_active IP Right Cessation
- 1976-05-17 GB GB20309/76A patent/GB1490048A/en not_active Expired
- 1976-05-17 IE IE1046/76A patent/IE43847B1/en unknown
- 1976-05-17 DD DD192883A patent/DD125203A5/xx unknown
- 1976-05-17 NL NL7605272A patent/NL7605272A/xx not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| BE841794A (fr) | 1976-11-16 |
| DD125203A5 (enExample) | 1977-04-06 |
| SE7605361L (sv) | 1976-11-17 |
| IE43847B1 (en) | 1981-06-17 |
| ES447922A1 (es) | 1977-06-16 |
| ZA762889B (en) | 1977-06-29 |
| FR2310762A1 (fr) | 1976-12-10 |
| NL7605272A (nl) | 1976-11-18 |
| IE43847L (en) | 1976-11-16 |
| AU499668B2 (en) | 1979-04-26 |
| JPS51141878A (en) | 1976-12-07 |
| AU1396076A (en) | 1977-11-17 |
| CH617923A5 (enExample) | 1980-06-30 |
| GB1490048A (en) | 1977-10-26 |
| IL49569A (en) | 1979-11-30 |
| IL49569A0 (en) | 1976-07-30 |
| US4072685A (en) | 1978-02-07 |
| DE2621536A1 (de) | 1976-11-25 |
| CA1087191A (fr) | 1980-10-07 |
| LU74940A1 (enExample) | 1977-02-11 |
| DK209176A (da) | 1976-11-17 |
| FR2310762B1 (enExample) | 1982-02-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU633474A3 (ru) | Способ получени -замещенных производных 3(фенил) пиперидина или их солей | |
| SU694070A3 (ru) | Способ получени карбоксиалкилациламинокислотных соединений или их солей | |
| SU629875A3 (ru) | Способ получени 1,3,4-тризамещенных 4-арилпиперидинов или их солей | |
| CA1057767A (en) | Amino acid esters | |
| NZ195357A (en) | Quinoline derivatives and pharmaceutical compositions | |
| US2826588A (en) | J-di-substituted pyrrolidine compounds | |
| IL22302A (en) | Phenylcyclopropane derivatives | |
| US2723276A (en) | Coumarin derivatives and process for the manufacture thereof | |
| KR930011485B1 (ko) | 비대칭 1,4-디히드로피리딘-3,5-디카르복실산 디에스테르의 제조방법 | |
| US4381305A (en) | Ethylenediamine derivatives and pharmaceutical compositions containing same | |
| US3037986A (en) | 2-(para-methoxyphenylcarbinol)-1-(phenylalkyl) piperidinium hydrobromide | |
| SU497764A3 (ru) | Способ получени производных норборнана | |
| JPH02172956A (ja) | エリスロ―3―(3,4―ジヒドロキシフェニル)セリン誘導体の新規製造法 | |
| Bauer et al. | Synthesis of 1‐hydroxyxanthines | |
| SU563915A3 (ru) | Способ получени 2-оксиметил3-фенил-4/3н/-хиназолинона или его соли | |
| CA1273932A (en) | Process for production of dihydropyridine compound or salts thereof | |
| YAMAMOTO et al. | 1-Acylindoles. IV. Novel Syntheses of 1-Benzoylindole-3-aliphatic Acids | |
| NO135092B (enExample) | ||
| US3429884A (en) | Novel quinolizidine derivatives or salts thereof and process for preparing the same | |
| GB2036723A (en) | Mercaptoacylpiperazine carboxylic acid compounds | |
| IL31398A (en) | Piperidine derivatives,their preparation and pharmaceutical compositions containing them | |
| US3423415A (en) | 4 - (n - (3,3 - diphenyl - propyl) - amino) - 1-methyl-3-phenyl-piperidine and intermediates thereto | |
| KR800001450B1 (ko) | 1, 3, 5-트리치환 벤젠 유도체의 제조방법 | |
| EP0087654B1 (de) | Verfahren zur Herstellung von 1-(4-Chlorbenzoyl)-5-methoxy-2-methyl-3-indolacetoxyessigsäure | |
| US4727183A (en) | Process for the asymmetric synthesis of chiral α-hydroxy-2-nitrobenzenepropanoic acid |