SU615850A3 - Способ получени замещенной бензоциклоалканкарбоновой кислоты или ее эфира, или амида - Google Patents
Способ получени замещенной бензоциклоалканкарбоновой кислоты или ее эфира, или амидаInfo
- Publication number
- SU615850A3 SU615850A3 SU742057140A SU2057140A SU615850A3 SU 615850 A3 SU615850 A3 SU 615850A3 SU 742057140 A SU742057140 A SU 742057140A SU 2057140 A SU2057140 A SU 2057140A SU 615850 A3 SU615850 A3 SU 615850A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- water
- acid
- mixture
- washed
- indan
- Prior art date
Links
- 150000001408 amides Chemical class 0.000 title claims description 5
- 239000002253 acid Substances 0.000 title description 11
- 238000000034 method Methods 0.000 title description 7
- 150000002148 esters Chemical class 0.000 title description 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 27
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 17
- -1 p-methoxybenzoyl Chemical group 0.000 claims description 14
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 12
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 claims description 12
- 239000000203 mixture Substances 0.000 claims description 11
- 150000001875 compounds Chemical class 0.000 claims description 10
- 239000013078 crystal Substances 0.000 claims description 7
- 229920000137 polyphosphoric acid Polymers 0.000 claims description 7
- 239000002904 solvent Substances 0.000 claims description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 4
- 239000007864 aqueous solution Substances 0.000 claims description 4
- 238000010438 heat treatment Methods 0.000 claims description 4
- 238000002844 melting Methods 0.000 claims description 4
- 230000008018 melting Effects 0.000 claims description 4
- 239000002244 precipitate Substances 0.000 claims description 3
- 239000011541 reaction mixture Substances 0.000 claims description 3
- 238000006243 chemical reaction Methods 0.000 claims description 2
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 claims 2
- BUYSPEFWHYOVKL-UHFFFAOYSA-N 4-(4-methoxybenzoyl)-2,3-dihydro-1h-indene-1-carbonitrile Chemical compound C1=CC(OC)=CC=C1C(=O)C1=CC=CC2=C1CCC2C#N BUYSPEFWHYOVKL-UHFFFAOYSA-N 0.000 claims 1
- PZBRHJQXACDXJX-UHFFFAOYSA-N 4-(4-methylbenzoyl)-2,3-dihydro-1h-indene-1-carboxamide Chemical compound C1=CC(C)=CC=C1C(=O)C1=CC=CC2=C1CCC2C(N)=O PZBRHJQXACDXJX-UHFFFAOYSA-N 0.000 claims 1
- XSCXHSFTHZFPJD-UHFFFAOYSA-N 4-benzoyl-2,3-dihydro-1h-indene-1-carbonitrile Chemical compound C=1C=CC=2C(C#N)CCC=2C=1C(=O)C1=CC=CC=C1 XSCXHSFTHZFPJD-UHFFFAOYSA-N 0.000 claims 1
- GZCHRCOKOCGWHP-UHFFFAOYSA-N 4-benzoyl-2,3-dihydro-1h-indene-1-carboxamide Chemical compound NC(=O)C1CCC2=C1C=CC=C2C(=O)C1=CC=CC=C1 GZCHRCOKOCGWHP-UHFFFAOYSA-N 0.000 claims 1
- 241000538717 Cladocarpus integer Species 0.000 claims 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 claims 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims 1
- 238000000605 extraction Methods 0.000 claims 1
- 238000007747 plating Methods 0.000 claims 1
- 239000000741 silica gel Substances 0.000 claims 1
- 229910002027 silica gel Inorganic materials 0.000 claims 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 claims 1
- 235000017557 sodium bicarbonate Nutrition 0.000 claims 1
- 239000000126 substance Substances 0.000 claims 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 10
- 239000001257 hydrogen Substances 0.000 description 10
- 229910052739 hydrogen Inorganic materials 0.000 description 10
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- 239000003054 catalyst Substances 0.000 description 8
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 4
- 150000002431 hydrogen Chemical group 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- 125000005440 p-toluyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C(*)=O)C([H])([H])[H] 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- 150000001735 carboxylic acids Chemical class 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 125000004093 cyano group Chemical group *C#N 0.000 description 3
- 230000001766 physiological effect Effects 0.000 description 3
- CAFXXESJSIBJBZ-UHFFFAOYSA-N 2,3-dihydro-1h-indene-1-carbonitrile Chemical compound C1=CC=C2C(C#N)CCC2=C1 CAFXXESJSIBJBZ-UHFFFAOYSA-N 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 238000006136 alcoholysis reaction Methods 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical group 0.000 description 2
- 229910000039 hydrogen halide Inorganic materials 0.000 description 2
- 239000012433 hydrogen halide Substances 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- 125000002560 nitrile group Chemical group 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 150000002978 peroxides Chemical class 0.000 description 2
- NFBAXHOPROOJAW-UHFFFAOYSA-N phenindione Chemical class O=C1C2=CC=CC=C2C(=O)C1C1=CC=CC=C1 NFBAXHOPROOJAW-UHFFFAOYSA-N 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 108090000623 proteins and genes Proteins 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 2
- QIVUCLWGARAQIO-OLIXTKCUSA-N (3s)-n-[(3s,5s,6r)-6-methyl-2-oxo-1-(2,2,2-trifluoroethyl)-5-(2,3,6-trifluorophenyl)piperidin-3-yl]-2-oxospiro[1h-pyrrolo[2,3-b]pyridine-3,6'-5,7-dihydrocyclopenta[b]pyridine]-3'-carboxamide Chemical compound C1([C@H]2[C@H](N(C(=O)[C@@H](NC(=O)C=3C=C4C[C@]5(CC4=NC=3)C3=CC=CN=C3NC5=O)C2)CC(F)(F)F)C)=C(F)C=CC(F)=C1F QIVUCLWGARAQIO-OLIXTKCUSA-N 0.000 description 1
- YABTYLPBLUXORV-UHFFFAOYSA-N 1,2,3,4-tetrahydronaphthalene-1-carboxamide Chemical compound C1=CC=C2C(C(=O)N)CCCC2=C1 YABTYLPBLUXORV-UHFFFAOYSA-N 0.000 description 1
- VDLWTJCSPSUGOA-UHFFFAOYSA-N 1,2,3,4-tetrahydronaphthalene-1-carboxylic acid Chemical compound C1=CC=C2C(C(=O)O)CCCC2=C1 VDLWTJCSPSUGOA-UHFFFAOYSA-N 0.000 description 1
- YNJSNEKCXVFDKW-UHFFFAOYSA-N 3-(5-amino-1h-indol-3-yl)-2-azaniumylpropanoate Chemical compound C1=C(N)C=C2C(CC(N)C(O)=O)=CNC2=C1 YNJSNEKCXVFDKW-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- IAGYHZLEUFRMMQ-UHFFFAOYSA-N 4-(4-bromobenzoyl)-2,3-dihydro-1H-indene-1-carbonitrile Chemical compound C1=CC(Br)=CC=C1C(=O)C1=CC=CC2=C1CCC2C#N IAGYHZLEUFRMMQ-UHFFFAOYSA-N 0.000 description 1
- PGKWRXGTZYQQHZ-UHFFFAOYSA-N 4-(4-bromobenzoyl)-2,3-dihydro-1H-indene-1-carboxylic acid Chemical compound OC(=O)C1CCC2=C1C=CC=C2C(=O)C1=CC=C(Br)C=C1 PGKWRXGTZYQQHZ-UHFFFAOYSA-N 0.000 description 1
- VROXKJXBROUSDD-UHFFFAOYSA-N 4-(4-chlorobenzoyl)-2,3-dihydro-1h-indene-1-carbonitrile Chemical compound C1=CC(Cl)=CC=C1C(=O)C1=CC=CC2=C1CCC2C#N VROXKJXBROUSDD-UHFFFAOYSA-N 0.000 description 1
- QGGHTJLHCIDAPM-UHFFFAOYSA-N 4-(4-fluorobenzoyl)-2,3-dihydro-1H-indene-1-carboxylic acid Chemical compound FC1=CC=C(C(=O)C2=C3CCC(C3=CC=C2)C(=O)O)C=C1 QGGHTJLHCIDAPM-UHFFFAOYSA-N 0.000 description 1
- JGVMIAXYBARQQP-UHFFFAOYSA-N 4-(4-methylbenzoyl)-2,3-dihydro-1h-indene-1-carbonitrile Chemical compound C1=CC(C)=CC=C1C(=O)C1=CC=CC2=C1CCC2C#N JGVMIAXYBARQQP-UHFFFAOYSA-N 0.000 description 1
- PAZZYFPGPIDYSS-UHFFFAOYSA-N 4-[(4-chlorophenyl)methyl]-2,3-dihydro-1h-indene-1-carboxylic acid Chemical compound OC(=O)C1CCC2=C1C=CC=C2CC1=CC=C(Cl)C=C1 PAZZYFPGPIDYSS-UHFFFAOYSA-N 0.000 description 1
- FXUBHWHRMVGJOG-UHFFFAOYSA-N 4-benzoyl-2,3-dihydro-1h-indene-1-carboxylic acid Chemical compound OC(=O)C1CCC2=C1C=CC=C2C(=O)C1=CC=CC=C1 FXUBHWHRMVGJOG-UHFFFAOYSA-N 0.000 description 1
- 125000000242 4-chlorobenzoyl group Chemical group ClC1=CC=C(C(=O)*)C=C1 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical class [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- FLZLQOUAQAKEBF-UHFFFAOYSA-N CC1=C(C=CC(=C1)C(=O)C2=CC=CC3=C2CCC3C(=O)O)Cl Chemical compound CC1=C(C=CC(=C1)C(=O)C2=CC=CC3=C2CCC3C(=O)O)Cl FLZLQOUAQAKEBF-UHFFFAOYSA-N 0.000 description 1
- XVZXOLOFWKSDSR-UHFFFAOYSA-N Cc1cc(C)c([C]=O)c(C)c1 Chemical group Cc1cc(C)c([C]=O)c(C)c1 XVZXOLOFWKSDSR-UHFFFAOYSA-N 0.000 description 1
- LELOWRISYMNNSU-UHFFFAOYSA-N Hydrocyanic acid Natural products N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical class [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- IVRMZWNICZWHMI-UHFFFAOYSA-N azide group Chemical group [N-]=[N+]=[N-] IVRMZWNICZWHMI-UHFFFAOYSA-N 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- WIRUZQNBHNAMAB-UHFFFAOYSA-N benzene;cyclohexane Chemical compound C1CCCCC1.C1=CC=CC=C1 WIRUZQNBHNAMAB-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical class I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229910000043 hydrogen iodide Inorganic materials 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- 150000002825 nitriles Chemical group 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000001301 oxygen Chemical group 0.000 description 1
- 229910052760 oxygen Chemical group 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 235000011118 potassium hydroxide Nutrition 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 235000011121 sodium hydroxide Nutrition 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical group [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N urea group Chemical group NC(=O)N XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
Landscapes
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP9837173A JPS5613703B2 (cg-RX-API-DMAC7.html) | 1973-09-01 | 1973-09-01 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU615850A3 true SU615850A3 (ru) | 1978-07-15 |
Family
ID=14218007
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU742057140A SU615850A3 (ru) | 1973-09-01 | 1974-08-11 | Способ получени замещенной бензоциклоалканкарбоновой кислоты или ее эфира, или амида |
Country Status (3)
| Country | Link |
|---|---|
| JP (1) | JPS5613703B2 (cg-RX-API-DMAC7.html) |
| AT (1) | AT340911B (cg-RX-API-DMAC7.html) |
| SU (1) | SU615850A3 (cg-RX-API-DMAC7.html) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2515838A1 (fr) * | 1981-10-30 | 1983-05-06 | Omega Brandt & Freres Sa Louis | Piece d'horlogerie comportant un dispositif d'orientation |
-
1973
- 1973-09-01 JP JP9837173A patent/JPS5613703B2/ja not_active Expired
-
1974
- 1974-08-09 AT AT653774A patent/AT340911B/de not_active IP Right Cessation
- 1974-08-11 SU SU742057140A patent/SU615850A3/ru active
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5049265A (cg-RX-API-DMAC7.html) | 1975-05-01 |
| ATA653774A (de) | 1977-05-15 |
| AT340911B (de) | 1978-01-10 |
| JPS5613703B2 (cg-RX-API-DMAC7.html) | 1981-03-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI66368B (fi) | Foerfarande foer framstaellning av terapeutiskt anvaendbara 6,1-dihydro-11-oxodibens(b,e)oxepin-2-aettiksyraderivat | |
| HU207841B (en) | Process for producing biphenyl-carbonitrils | |
| US4073933A (en) | Novel bicycloheptene derivatives | |
| JPS5922711B2 (ja) | ベンゾオキサゾリノン誘導体の製造法 | |
| SU615850A3 (ru) | Способ получени замещенной бензоциклоалканкарбоновой кислоты или ее эфира, или амида | |
| US3919261A (en) | Preparation of 2,5-dimethylfuran-3-carboxylic esters | |
| US6031103A (en) | Process for manufacturing 1-[3-cyclopentyl -2(R)-[1(R)-hydroxycarbamoyl)-2-(3, 4, 4-trimethyl -2, 5-D ioxo-1-imidazolidinyl) ethyl] propionyl] piperidine | |
| US4025537A (en) | Preparation of 3-carboalkoxy or 3-alkanoyl furans | |
| US3019252A (en) | Process for the preparation of novel derivatives of cyclopentanonaphthalene and products obtained thereby | |
| US4704472A (en) | Preparation of an enantiomer of a substituted fluorenyloxyacetic acid | |
| US3655667A (en) | 1-(2-benzoylcyclopropylmethyl)-4-phenylpiperazines | |
| US3828053A (en) | Lower-alkyl-beta-oxo-4-piperidine-n-benzoylpropionates | |
| US8129570B2 (en) | Process for the preparation of 1,4-dialkyl-2,3-diol-1,4-butanedione | |
| JP2612161B2 (ja) | ジベンゾチエピン誘導体の製造法 | |
| US3166568A (en) | Therapeutic compositions containing | |
| US4891433A (en) | Process for the preparation of dibenzothiepin derivative | |
| JP2549997B2 (ja) | 新規ハロケタール化合物 | |
| US3595878A (en) | Methoxyphenyl- and phenyl-dialkyl-alpha-pyrone nitriles | |
| US4213905A (en) | Preparation of 5-aroyl-1-loweralkylpyrrole-2-acetic acid salts | |
| JPH0692950A (ja) | エポキシ化合物の製造方法 | |
| GB2030136A (en) | 1-phthalazone derivatives and acid addition salts their preparation and compositions containing them | |
| US2821540A (en) | Preparation of hindered 4-acylamido-benzoates | |
| US4895996A (en) | Synthesis of alkenes from enamines via hydroboration | |
| US4249015A (en) | Preparation of organic acids and/or esters | |
| JPH04247052A (ja) | ビシクロ〔4,1,0〕ヘプタン−2,4−ジオン誘導体、その製造法 |