SU615841A3 - Способ извлечени двуокиси серы из отход щих газов - Google Patents
Способ извлечени двуокиси серы из отход щих газовInfo
- Publication number
- SU615841A3 SU615841A3 SU721838664A SU1838664A SU615841A3 SU 615841 A3 SU615841 A3 SU 615841A3 SU 721838664 A SU721838664 A SU 721838664A SU 1838664 A SU1838664 A SU 1838664A SU 615841 A3 SU615841 A3 SU 615841A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- solution
- sulfur
- phosphate
- absorption
- concentration
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 19
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 title claims description 12
- 239000007789 gas Substances 0.000 title description 20
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 27
- 229910052717 sulfur Inorganic materials 0.000 claims description 25
- 239000011593 sulfur Substances 0.000 claims description 24
- 238000010521 absorption reaction Methods 0.000 claims description 19
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 claims description 9
- 229910019142 PO4 Inorganic materials 0.000 claims description 8
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 claims description 8
- 239000010452 phosphate Substances 0.000 claims description 8
- 239000002250 absorbent Substances 0.000 claims description 7
- 230000002745 absorbent Effects 0.000 claims description 7
- 230000015572 biosynthetic process Effects 0.000 claims description 7
- 229910000318 alkali metal phosphate Inorganic materials 0.000 claims description 5
- 238000011084 recovery Methods 0.000 claims description 3
- 239000002912 waste gas Substances 0.000 claims description 3
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- 230000009467 reduction Effects 0.000 claims description 2
- 239000000243 solution Substances 0.000 description 37
- 239000006096 absorbing agent Substances 0.000 description 12
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 9
- 238000001914 filtration Methods 0.000 description 7
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 7
- 239000007788 liquid Substances 0.000 description 7
- 235000021317 phosphate Nutrition 0.000 description 7
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 229910021653 sulphate ion Inorganic materials 0.000 description 6
- 230000000694 effects Effects 0.000 description 4
- 239000012530 fluid Substances 0.000 description 4
- 229920006395 saturated elastomer Polymers 0.000 description 4
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 239000011521 glass Substances 0.000 description 3
- 239000001488 sodium phosphate Substances 0.000 description 3
- 229910000162 sodium phosphate Inorganic materials 0.000 description 3
- DHCDFWKWKRSZHF-UHFFFAOYSA-N sulfurothioic S-acid Chemical compound OS(O)(=O)=S DHCDFWKWKRSZHF-UHFFFAOYSA-N 0.000 description 3
- 235000010269 sulphur dioxide Nutrition 0.000 description 3
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 3
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 2
- BFDWBSRJQZPEEB-UHFFFAOYSA-L sodium fluorophosphate Chemical class [Na+].[Na+].[O-]P([O-])(F)=O BFDWBSRJQZPEEB-UHFFFAOYSA-L 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 230000019635 sulfation Effects 0.000 description 2
- 238000005670 sulfation reaction Methods 0.000 description 2
- LWIHDJKSTIGBAC-UHFFFAOYSA-K tripotassium phosphate Chemical compound [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 206010028980 Neoplasm Diseases 0.000 description 1
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical compound OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 229920000388 Polyphosphate Polymers 0.000 description 1
- RYYWUUFWQRZTIU-UHFFFAOYSA-N Thiophosphoric acid Chemical class OP(O)(S)=O RYYWUUFWQRZTIU-UHFFFAOYSA-N 0.000 description 1
- 229910001413 alkali metal ion Inorganic materials 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 210000000988 bone and bone Anatomy 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 201000011510 cancer Diseases 0.000 description 1
- 239000000919 ceramic Substances 0.000 description 1
- 238000009388 chemical precipitation Methods 0.000 description 1
- 238000002485 combustion reaction Methods 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- BUACSMWVFUNQET-UHFFFAOYSA-H dialuminum;trisulfate;hydrate Chemical compound O.[Al+3].[Al+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O BUACSMWVFUNQET-UHFFFAOYSA-H 0.000 description 1
- 235000011180 diphosphates Nutrition 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 230000004907 flux Effects 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000009413 insulation Methods 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 238000005192 partition Methods 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000001205 polyphosphate Substances 0.000 description 1
- 235000011176 polyphosphates Nutrition 0.000 description 1
- 229910000160 potassium phosphate Inorganic materials 0.000 description 1
- 235000011009 potassium phosphates Nutrition 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000003134 recirculating effect Effects 0.000 description 1
- 229910052701 rubidium Inorganic materials 0.000 description 1
- IGLNJRXAVVLDKE-UHFFFAOYSA-N rubidium atom Chemical compound [Rb] IGLNJRXAVVLDKE-UHFFFAOYSA-N 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 239000010802 sludge Substances 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910001415 sodium ion Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- CPWJKGIJFGMVPL-UHFFFAOYSA-K tricesium;phosphate Chemical class [Cs+].[Cs+].[Cs+].[O-]P([O-])([O-])=O CPWJKGIJFGMVPL-UHFFFAOYSA-K 0.000 description 1
- RIFYBBXGYKFBFC-UHFFFAOYSA-K trisodium;thiophosphate Chemical class [Na+].[Na+].[Na+].[O-]P([O-])([O-])=S RIFYBBXGYKFBFC-UHFFFAOYSA-K 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Landscapes
- Treating Waste Gases (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US19000071A | 1971-10-18 | 1971-10-18 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU615841A3 true SU615841A3 (ru) | 1978-07-15 |
Family
ID=22699652
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU721838664A SU615841A3 (ru) | 1971-10-18 | 1972-10-17 | Способ извлечени двуокиси серы из отход щих газов |
Country Status (2)
| Country | Link |
|---|---|
| JP (1) | JPS5590B2 (OSRAM) |
| SU (1) | SU615841A3 (OSRAM) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA1039030A (en) * | 1973-07-11 | 1978-09-26 | Wayne J. Balfanz | Method for removal of sulfur dioxide from gases |
| US3983225A (en) * | 1974-04-24 | 1976-09-28 | Stauffer Chemical Company | Recovery of sulfur from sulfur dioxide rich aqueous absorbents |
| JPS58148638U (ja) * | 1982-03-31 | 1983-10-05 | 防衛庁技術研究本部長 | 測温抵抗体 |
| JPS63112403A (ja) * | 1986-10-29 | 1988-05-17 | Idemitsu Kosan Co Ltd | 硫化水素の処理方法 |
-
1972
- 1972-10-17 SU SU721838664A patent/SU615841A3/ru active
- 1972-10-18 JP JP10433072A patent/JPS5590B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| JPS4849696A (OSRAM) | 1973-07-13 |
| JPS5590B2 (OSRAM) | 1980-01-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3928537A (en) | Method of removing sulfur dioxide from combustion exhaust gas | |
| DE2250959A1 (de) | Verfahren zur gewinnung von schwefel aus so tief 2 enthaltenden gasen | |
| CA1072724A (en) | Method for oxidation of so2 scrubber sludge | |
| KR20010031417A (ko) | 정제처리수 및 폐수 스트림으로부터의 셀레늄 제거 방법 | |
| CA1088724A (en) | Fluoride-free phosphate reactions | |
| JPH1170316A (ja) | 排ガスの脱硫方法 | |
| SU615841A3 (ru) | Способ извлечени двуокиси серы из отход щих газов | |
| KR0174794B1 (ko) | 배기가스의 탈황방법 | |
| US3761569A (en) | Method of removing hydrogen sulfide from gases | |
| DE2516861A1 (de) | Verfahren zur abtrennung und gewinnung von schwefel aus einer schwefeldioxyd enthaltenden fluessigkeit | |
| US4167578A (en) | Method for removing sulfur and nitrogen compounds from a gas mixture | |
| SU1586509A3 (ru) | Способ получени элементарной серы из газов | |
| US3793436A (en) | Closed pond system for wet process phosphate plants | |
| SU551248A1 (ru) | Способ получени фосфорной кислоты | |
| US3081151A (en) | Manufacture of alkali orthophosphates | |
| SU1085619A1 (ru) | Способ очистки фторсодержащих дымовых газов | |
| RU2145571C1 (ru) | Способ получения фосфорной кислоты | |
| US2241709A (en) | Removal of thionates from solution | |
| US2140605A (en) | Recovery of hydrocyanic acid | |
| JPS60125230A (ja) | 排ガス中の亜硫酸ガスを吸収除去する湿式脱硫方法 | |
| SU592748A1 (ru) | Способ получени сульфида мышь ка и серы | |
| SU691401A1 (ru) | Способ получени карбоната кальци | |
| SU833517A1 (ru) | Способ получени растворов нитрата кали | |
| SU882921A1 (ru) | Способ получени фосфорной кислоты | |
| SU988772A1 (ru) | Способ получени углекислого кальци |