SU605519A3 - Гербицидный состав - Google Patents
Гербицидный составInfo
- Publication number
- SU605519A3 SU605519A3 SU721793620A SU1793620A SU605519A3 SU 605519 A3 SU605519 A3 SU 605519A3 SU 721793620 A SU721793620 A SU 721793620A SU 1793620 A SU1793620 A SU 1793620A SU 605519 A3 SU605519 A3 SU 605519A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- acetanilide
- diethyl
- chlor
- chloro
- methyl
- Prior art date
Links
- 230000002363 herbicidal effect Effects 0.000 title description 12
- 239000004009 herbicide Substances 0.000 title description 6
- 239000000575 pesticide Substances 0.000 claims description 2
- FZERHIULMFGESH-UHFFFAOYSA-N N-phenylacetamide Chemical compound CC(=O)NC1=CC=CC=C1 FZERHIULMFGESH-UHFFFAOYSA-N 0.000 description 18
- 229960001413 acetanilide Drugs 0.000 description 14
- UENGBOCGGKLVJJ-UHFFFAOYSA-N 2-chloro-1-(2,4-difluorophenyl)ethanone Chemical compound FC1=CC=C(C(=O)CCl)C(F)=C1 UENGBOCGGKLVJJ-UHFFFAOYSA-N 0.000 description 9
- 241000196324 Embryophyta Species 0.000 description 8
- 150000001875 compounds Chemical class 0.000 description 8
- -1 (substituted methyl) -acetanilide Chemical class 0.000 description 7
- 239000002689 soil Substances 0.000 description 6
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 239000003814 drug Substances 0.000 description 3
- 229940079593 drug Drugs 0.000 description 3
- 150000002825 nitriles Chemical class 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- VONWPEXRCLHKRJ-UHFFFAOYSA-N 2-chloro-n-phenylacetamide Chemical compound ClCC(=O)NC1=CC=CC=C1 VONWPEXRCLHKRJ-UHFFFAOYSA-N 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 150000003949 imides Chemical class 0.000 description 2
- 230000003993 interaction Effects 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- SMYMJHWAQXWPDB-UHFFFAOYSA-M (2,4,5-trichlorophenoxy)acetate Chemical compound [O-]C(=O)COC1=CC(Cl)=C(Cl)C=C1Cl SMYMJHWAQXWPDB-UHFFFAOYSA-M 0.000 description 1
- BHMLFPOTZYRDKA-IRXDYDNUSA-N (2s)-2-[(s)-(2-iodophenoxy)-phenylmethyl]morpholine Chemical compound IC1=CC=CC=C1O[C@@H](C=1C=CC=CC=1)[C@H]1OCCNC1 BHMLFPOTZYRDKA-IRXDYDNUSA-N 0.000 description 1
- OYFIDALWMSGYLQ-UHFFFAOYSA-N 2-ethyl-n-phenylbutanamide Chemical compound CCC(CC)C(=O)NC1=CC=CC=C1 OYFIDALWMSGYLQ-UHFFFAOYSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- LVZWSLJZHVFIQJ-UHFFFAOYSA-N Cyclopropane Chemical compound C1CC1 LVZWSLJZHVFIQJ-UHFFFAOYSA-N 0.000 description 1
- RSPISYXLHRIGJD-UHFFFAOYSA-N OOOO Chemical compound OOOO RSPISYXLHRIGJD-UHFFFAOYSA-N 0.000 description 1
- KUGRPPRAQNPSQD-UHFFFAOYSA-N OOOOO Chemical compound OOOOO KUGRPPRAQNPSQD-UHFFFAOYSA-N 0.000 description 1
- JLNTWVDSQRNWFU-UHFFFAOYSA-N OOOOOOO Chemical compound OOOOOOO JLNTWVDSQRNWFU-UHFFFAOYSA-N 0.000 description 1
- PXAJQJMDEXJWFB-UHFFFAOYSA-N acetone oxime Chemical compound CC(C)=NO PXAJQJMDEXJWFB-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000005452 alkenyloxyalkyl group Chemical group 0.000 description 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000004849 alkoxymethyl group Chemical group 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000003931 anilides Chemical class 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Chemical group 0.000 description 1
- RMBGSBIZBRZJPK-UHFFFAOYSA-N butan-1-amine;2-dodecylbenzenesulfonic acid Chemical compound CCCCN.CCCCCCCCCCCCC1=CC=CC=C1S(O)(=O)=O RMBGSBIZBRZJPK-UHFFFAOYSA-N 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 238000003306 harvesting Methods 0.000 description 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 150000002500 ions Chemical group 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000012544 monitoring process Methods 0.000 description 1
- NUJAPVSRDGSINW-UHFFFAOYSA-N n'-phenylmethanediamine Chemical compound NCNC1=CC=CC=C1 NUJAPVSRDGSINW-UHFFFAOYSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 150000002923 oximes Chemical class 0.000 description 1
- 125000005188 oxoalkyl group Chemical group 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 239000004476 plant protection product Substances 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000002335 preservative effect Effects 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- MFOUDYKPLGXPGO-UHFFFAOYSA-N propachlor Chemical compound ClCC(=O)N(C(C)C)C1=CC=CC=C1 MFOUDYKPLGXPGO-UHFFFAOYSA-N 0.000 description 1
- OVARTBFNCCXQKS-UHFFFAOYSA-N propan-2-one;hydrate Chemical compound O.CC(C)=O OVARTBFNCCXQKS-UHFFFAOYSA-N 0.000 description 1
- 230000007226 seed germination Effects 0.000 description 1
- 238000009331 sowing Methods 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000003784 tall oil Substances 0.000 description 1
- 229910052716 thallium Inorganic materials 0.000 description 1
- BKVIYDNLLOSFOA-UHFFFAOYSA-N thallium Chemical compound [Tl] BKVIYDNLLOSFOA-UHFFFAOYSA-N 0.000 description 1
- 239000004563 wettable powder Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/24—Oxygen or sulfur atoms
- C07D207/26—2-Pyrrolidones
- C07D207/263—2-Pyrrolidones with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms
- C07D207/27—2-Pyrrolidones with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms with substituted hydrocarbon radicals directly attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/04—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to acyclic carbon atoms
- C07C275/06—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to acyclic carbon atoms of an acyclic and saturated carbon skeleton
- C07C275/14—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to acyclic carbon atoms of an acyclic and saturated carbon skeleton being further substituted by nitrogen atoms not being part of nitro or nitroso groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/34—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/36—Oxygen or sulfur atoms
- C07D207/40—2,5-Pyrrolidine-diones
- C07D207/404—2,5-Pyrrolidine-diones with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms, e.g. succinimide
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/34—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/36—Oxygen or sulfur atoms
- C07D207/40—2,5-Pyrrolidine-diones
- C07D207/404—2,5-Pyrrolidine-diones with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms, e.g. succinimide
- C07D207/408—Radicals containing only hydrogen and carbon atoms attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/44—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members
- C07D207/444—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members having two doubly-bound oxygen atoms directly attached in positions 2 and 5
- C07D207/448—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members having two doubly-bound oxygen atoms directly attached in positions 2 and 5 with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms, e.g. maleimide
- C07D207/452—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members having two doubly-bound oxygen atoms directly attached in positions 2 and 5 with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms, e.g. maleimide with hydrocarbon radicals, substituted by hetero atoms, directly attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/44—Iso-indoles; Hydrogenated iso-indoles
- C07D209/48—Iso-indoles; Hydrogenated iso-indoles with oxygen atoms in positions 1 and 3, e.g. phthalimide
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/79—Acids; Esters
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pyridine Compounds (AREA)
- Pyrrole Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US14889271A | 1971-06-01 | 1971-06-01 | |
| US00148893A US3830841A (en) | 1971-06-01 | 1971-06-01 | Herbicidal anilides |
| US00148894A US3830829A (en) | 1971-06-01 | 1971-06-01 | Chlorophenoxyalkyl anilides |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU605519A3 true SU605519A3 (ru) | 1978-04-30 |
Family
ID=27386757
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU721793620A SU605519A3 (ru) | 1971-06-01 | 1972-05-31 | Гербицидный состав |
Country Status (17)
| Country | Link |
|---|---|
| JP (1) | JPS5542961B1 (cg-RX-API-DMAC7.html) |
| BE (1) | BE784212A (cg-RX-API-DMAC7.html) |
| BG (1) | BG26654A3 (cg-RX-API-DMAC7.html) |
| BR (1) | BR7203495D0 (cg-RX-API-DMAC7.html) |
| CA (1) | CA1048518A (cg-RX-API-DMAC7.html) |
| CH (1) | CH580909A5 (cg-RX-API-DMAC7.html) |
| CS (1) | CS191164B2 (cg-RX-API-DMAC7.html) |
| DD (1) | DD104174A5 (cg-RX-API-DMAC7.html) |
| DE (1) | DE2226593C3 (cg-RX-API-DMAC7.html) |
| FR (1) | FR2140134B1 (cg-RX-API-DMAC7.html) |
| GB (1) | GB1380436A (cg-RX-API-DMAC7.html) |
| HU (1) | HU166275B (cg-RX-API-DMAC7.html) |
| IL (1) | IL39562A (cg-RX-API-DMAC7.html) |
| IT (1) | IT956065B (cg-RX-API-DMAC7.html) |
| NL (1) | NL150775B (cg-RX-API-DMAC7.html) |
| PL (1) | PL84702B1 (cg-RX-API-DMAC7.html) |
| SU (1) | SU605519A3 (cg-RX-API-DMAC7.html) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2744396A1 (de) * | 1977-10-03 | 1979-04-12 | Basf Ag | Acetanilide |
| DE3130302A1 (de) * | 1981-07-31 | 1983-02-17 | Basf Ag, 6700 Ludwigshafen | N-carbamoylmethyl-haogenacetanilide, verfahren zu ihrer herstellung und diese enthaltende herbizide |
| ZA861041B (en) * | 1985-02-13 | 1987-09-30 | Monsanto Co | Method for the regulation of the natural growth of turf grass |
| EP0192628A1 (en) * | 1985-02-13 | 1986-08-27 | Monsanto Company | Novel acetanilides and their use in the regulation of the natural growth or development of turf grass |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BR6677387D0 (pt) * | 1965-10-14 | 1973-12-26 | Monsanto Co | Composicao fitotoxica bem como processo para a preparacao de alfa-haloacetaniladas usadas como ingredientes ativos na dita composicao |
-
1972
- 1972-05-29 IL IL39562A patent/IL39562A/en unknown
- 1972-05-29 NL NL727207261A patent/NL150775B/xx not_active IP Right Cessation
- 1972-05-31 DD DD163323A patent/DD104174A5/xx unknown
- 1972-05-31 CS CS723753A patent/CS191164B2/cs unknown
- 1972-05-31 GB GB2536372A patent/GB1380436A/en not_active Expired
- 1972-05-31 SU SU721793620A patent/SU605519A3/ru active
- 1972-05-31 DE DE2226593A patent/DE2226593C3/de not_active Expired
- 1972-05-31 PL PL1972155706A patent/PL84702B1/pl unknown
- 1972-05-31 BG BG020618A patent/BG26654A3/xx unknown
- 1972-05-31 HU HUMO836A patent/HU166275B/hu unknown
- 1972-05-31 IT IT25147/72A patent/IT956065B/it active
- 1972-05-31 BR BR3495/72A patent/BR7203495D0/pt unknown
- 1972-05-31 CA CA72143810A patent/CA1048518A/en not_active Expired
- 1972-05-31 BE BE784212A patent/BE784212A/xx not_active IP Right Cessation
- 1972-05-31 JP JP5349972A patent/JPS5542961B1/ja active Pending
- 1972-05-31 FR FR7219542A patent/FR2140134B1/fr not_active Expired
- 1972-05-31 CH CH801772A patent/CH580909A5/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| DE2226593A1 (de) | 1972-12-14 |
| DE2226593B2 (de) | 1977-09-01 |
| HU166275B (cg-RX-API-DMAC7.html) | 1975-02-28 |
| BR7203495D0 (pt) | 1973-09-18 |
| DD104174A5 (cg-RX-API-DMAC7.html) | 1974-03-05 |
| PL84702B1 (en) | 1976-04-30 |
| DE2226593C3 (de) | 1978-04-27 |
| IL39562A (en) | 1977-10-31 |
| CA1048518A (en) | 1979-02-13 |
| CS191164B2 (en) | 1979-06-29 |
| NL150775B (nl) | 1976-09-15 |
| IL39562A0 (en) | 1972-07-26 |
| BG26654A3 (bg) | 1979-05-15 |
| BE784212A (fr) | 1972-11-30 |
| GB1380436A (en) | 1975-01-15 |
| NL7207261A (cg-RX-API-DMAC7.html) | 1972-12-05 |
| FR2140134B1 (cg-RX-API-DMAC7.html) | 1979-09-07 |
| IT956065B (it) | 1973-10-10 |
| JPS5542961B1 (cg-RX-API-DMAC7.html) | 1980-11-04 |
| CH580909A5 (cg-RX-API-DMAC7.html) | 1976-10-29 |
| FR2140134A1 (cg-RX-API-DMAC7.html) | 1973-01-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2515091C2 (de) | N-Acyl-N-phenyl-alaninderivate und -glycinderivate, Verfahren zu deren Herstellung und diese Verbindungen enthaltende fungizide Mittel | |
| SU1428196A3 (ru) | Способ получени 2-замещенных фенил-4,5,6,7-тетрагидро-2Н-изоиндол-1,3-дионов | |
| US4032657A (en) | Haloacetanilides as microbicidal active substances | |
| CA1071226A (en) | Carbamates | |
| DK150848B (da) | N-substituerede sulfonylglycolsyreanilider med fungicid virkning mod fytopatogene svampe samt anvendelse deraf til bekaempelse af fytopatogene svampe | |
| SU605519A3 (ru) | Гербицидный состав | |
| DE2515113C2 (cg-RX-API-DMAC7.html) | ||
| SU1574161A3 (ru) | Гербицидна композици | |
| DE2643403C2 (de) | Thiocarbonsäurederivate, Verfahren zu deren Herstellung und diese enthaltende Mittel | |
| US3766172A (en) | Substituted dichlorosulfenamides and their manufacture | |
| US3959330A (en) | Substituted dichloromethyl thiocyanates and their manufacture | |
| SU576892A3 (ru) | Гербицидный состав | |
| US3996043A (en) | Triazine--antidote compositions and methods of use for cotton | |
| US4275079A (en) | Fungicidal N-alkynylanilides | |
| SU860675A3 (ru) | Гербицидный состав | |
| US3681406A (en) | N-alkoxyalkylidenesulfonamide compounds | |
| SU843696A3 (ru) | Гербицидный состав | |
| US3435043A (en) | Pf5 adducts of certain substituted acetamides | |
| US3303015A (en) | Herbicidal composition and method | |
| EP0084253B1 (en) | Antidotes for pyrrolidone herbicides and herbicide antidote compositions | |
| HU184201B (en) | Fungicide compositions containing anilides of cyclopropane-carboxylic acid and process for producing these compounds | |
| CA1097359A (en) | Amidines | |
| KR800001633B1 (ko) | 아미드옥심 유도체의 제조 방법 | |
| US3873300A (en) | Dithiocarbamate hydrochloride salts as herbicides | |
| US3372210A (en) | O, o-diloweralkylphosphorodithiomethyl-(poly) chlorophenoxyacetates |