SU554817A3 - Композици на основе синтетического полимера - Google Patents
Композици на основе синтетического полимераInfo
- Publication number
- SU554817A3 SU554817A3 SU1744183A SU1744183A SU554817A3 SU 554817 A3 SU554817 A3 SU 554817A3 SU 1744183 A SU1744183 A SU 1744183A SU 1744183 A SU1744183 A SU 1744183A SU 554817 A3 SU554817 A3 SU 554817A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- tetramethyl
- piperidyl
- synthetic polymer
- parts
- bis
- Prior art date
Links
- 229920001059 synthetic polymer Polymers 0.000 title description 12
- 239000000203 mixture Substances 0.000 title description 10
- -1 4-piperidyl Chemical class 0.000 description 29
- 150000001875 compounds Chemical class 0.000 description 8
- HDOWRFHMPULYOA-UHFFFAOYSA-N piperidin-4-ol Chemical class OC1CCNCC1 HDOWRFHMPULYOA-UHFFFAOYSA-N 0.000 description 7
- 239000003381 stabilizer Substances 0.000 description 6
- RKMGAJGJIURJSJ-UHFFFAOYSA-N 2,2,6,6-Tetramethylpiperidine Substances CC1(C)CCCC(C)(C)N1 RKMGAJGJIURJSJ-UHFFFAOYSA-N 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 239000004677 Nylon Substances 0.000 description 3
- 239000004743 Polypropylene Substances 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 230000032683 aging Effects 0.000 description 3
- 125000001931 aliphatic group Chemical group 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 229920001778 nylon Polymers 0.000 description 3
- 229920001155 polypropylene Polymers 0.000 description 3
- 229920002635 polyurethane Polymers 0.000 description 3
- 239000004814 polyurethane Substances 0.000 description 3
- 229920000915 polyvinyl chloride Polymers 0.000 description 3
- 239000004800 polyvinyl chloride Substances 0.000 description 3
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- 239000004952 Polyamide Substances 0.000 description 2
- 229920001328 Polyvinylidene chloride Polymers 0.000 description 2
- 150000001336 alkenes Chemical class 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 229920001519 homopolymer Polymers 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 229920002647 polyamide Polymers 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 239000005033 polyvinylidene chloride Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 125000005591 trimellitate group Chemical group 0.000 description 2
- NIWFXZPNJBOZIT-UHFFFAOYSA-N (1,2,2,6,6-pentamethylpiperidin-4-yl) 2-hydroxybenzoate Chemical compound C1C(C)(C)N(C)C(C)(C)CC1OC(=O)C1=CC=CC=C1O NIWFXZPNJBOZIT-UHFFFAOYSA-N 0.000 description 1
- HVCARXYAMRMPIK-UHFFFAOYSA-N (2,2,6,6-tetramethyl-1,3-dihydropyridin-4-yl) acetate Chemical compound CC1(NC(C)(C)C=C(C1)OC(=O)C)C HVCARXYAMRMPIK-UHFFFAOYSA-N 0.000 description 1
- QGBLZWAPKRIJDN-UHFFFAOYSA-N (2,2,6,6-tetramethylpiperidin-4-yl) 2-hydroxybenzoate Chemical compound C1C(C)(C)NC(C)(C)CC1OC(=O)C1=CC=CC=C1O QGBLZWAPKRIJDN-UHFFFAOYSA-N 0.000 description 1
- DEDIMYAPCFFQIW-UHFFFAOYSA-N (2,2,6,6-tetramethylpiperidin-4-yl) 4-aminobenzoate Chemical compound C1C(C)(C)NC(C)(C)CC1OC(=O)C1=CC=C(N)C=C1 DEDIMYAPCFFQIW-UHFFFAOYSA-N 0.000 description 1
- XLUFLEGPJWJROM-UHFFFAOYSA-N (2,2,6,6-tetramethylpiperidin-4-yl) 4-chlorobenzoate Chemical compound C1C(C)(C)NC(C)(C)CC1OC(=O)C1=CC=C(Cl)C=C1 XLUFLEGPJWJROM-UHFFFAOYSA-N 0.000 description 1
- YEYCMBWKTZNPDH-UHFFFAOYSA-N (2,2,6,6-tetramethylpiperidin-4-yl) benzoate Chemical compound C1C(C)(C)NC(C)(C)CC1OC(=O)C1=CC=CC=C1 YEYCMBWKTZNPDH-UHFFFAOYSA-N 0.000 description 1
- JMUOXOJMXILBTE-UHFFFAOYSA-N (2,2,6,6-tetramethylpiperidin-4-yl) octadecanoate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OC1CC(C)(C)NC(C)(C)C1 JMUOXOJMXILBTE-UHFFFAOYSA-N 0.000 description 1
- ZSRKUPSCNJJDFH-UHFFFAOYSA-N (2,2,6,6-tetramethylpiperidin-4-yl) octanoate Chemical compound CCCCCCCC(=O)OC1CC(C)(C)NC(C)(C)C1 ZSRKUPSCNJJDFH-UHFFFAOYSA-N 0.000 description 1
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 description 1
- QVVSQLONZBANPD-UHFFFAOYSA-N 2-(trioxidanylcarbonyl)benzoic acid Chemical compound OOOC(=O)C1=CC=CC=C1C(O)=O QVVSQLONZBANPD-UHFFFAOYSA-N 0.000 description 1
- 125000003541 2-chlorobenzoyl group Chemical group ClC1=C(C(=O)*)C=CC=C1 0.000 description 1
- VEGYEXPJDKRKDN-UHFFFAOYSA-N 4-dodecoxy-2,2,6,6-tetramethylpiperidine Chemical compound CCCCCCCCCCCCOC1CC(C)(C)NC(C)(C)C1 VEGYEXPJDKRKDN-UHFFFAOYSA-N 0.000 description 1
- OXMWYCZSUSMSOP-UHFFFAOYSA-N CC1(CC(CC(N1O)(C)C)C2=C(C(=C(C(=C2C(=O)O)C3CC(N(C(C3)(C)C)O)(C)C)C(=O)O)C4CC(N(C(C4)(C)C)O)(C)C)C(=O)O)C Chemical compound CC1(CC(CC(N1O)(C)C)C2=C(C(=C(C(=C2C(=O)O)C3CC(N(C(C3)(C)C)O)(C)C)C(=O)O)C4CC(N(C(C4)(C)C)O)(C)C)C(=O)O)C OXMWYCZSUSMSOP-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 239000002174 Styrene-butadiene Substances 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- 230000002745 absorbent Effects 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- XECAHXYUAAWDEL-UHFFFAOYSA-N acrylonitrile butadiene styrene Chemical compound C=CC=C.C=CC#N.C=CC1=CC=CC=C1 XECAHXYUAAWDEL-UHFFFAOYSA-N 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- WNLRTRBMVRJNCN-UHFFFAOYSA-L adipate(2-) Chemical compound [O-]C(=O)CCCCC([O-])=O WNLRTRBMVRJNCN-UHFFFAOYSA-L 0.000 description 1
- 125000002723 alicyclic group Chemical group 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- AGXUVMPSUKZYDT-UHFFFAOYSA-L barium(2+);octadecanoate Chemical compound [Ba+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O AGXUVMPSUKZYDT-UHFFFAOYSA-L 0.000 description 1
- KVUMTYJLOBKFQU-UHFFFAOYSA-N bis(2,2,6,6-tetramethylpiperidin-4-yl) 2-hydroxybenzene-1,3-dicarboxylate Chemical compound OC1=C(C(=O)OC2CC(NC(C2)(C)C)(C)C)C=CC=C1C(=O)OC1CC(NC(C1)(C)C)(C)C KVUMTYJLOBKFQU-UHFFFAOYSA-N 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- WXCZUWHSJWOTRV-UHFFFAOYSA-N but-1-ene;ethene Chemical compound C=C.CCC=C WXCZUWHSJWOTRV-UHFFFAOYSA-N 0.000 description 1
- DQXBYHZEEUGOBF-UHFFFAOYSA-N but-3-enoic acid;ethene Chemical compound C=C.OC(=O)CC=C DQXBYHZEEUGOBF-UHFFFAOYSA-N 0.000 description 1
- MTAZNLWOLGHBHU-UHFFFAOYSA-N butadiene-styrene rubber Chemical compound C=CC=C.C=CC1=CC=CC=C1 MTAZNLWOLGHBHU-UHFFFAOYSA-N 0.000 description 1
- GWOWVOYJLHSRJJ-UHFFFAOYSA-L cadmium stearate Chemical compound [Cd+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O GWOWVOYJLHSRJJ-UHFFFAOYSA-L 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000005038 ethylene vinyl acetate Substances 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 230000005484 gravity Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229920001903 high density polyethylene Polymers 0.000 description 1
- 239000004700 high-density polyethylene Substances 0.000 description 1
- BHEPBYXIRTUNPN-UHFFFAOYSA-N hydridophosphorus(.) (triplet) Chemical compound [PH] BHEPBYXIRTUNPN-UHFFFAOYSA-N 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- ONUFRYFLRFLSOM-UHFFFAOYSA-N lead;octadecanoic acid Chemical compound [Pb].CCCCCCCCCCCCCCCCCC(O)=O ONUFRYFLRFLSOM-UHFFFAOYSA-N 0.000 description 1
- UMKARVFXJJITLN-UHFFFAOYSA-N lead;phosphorous acid Chemical compound [Pb].OP(O)O UMKARVFXJJITLN-UHFFFAOYSA-N 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 229920001200 poly(ethylene-vinyl acetate) Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920000139 polyethylene terephthalate Polymers 0.000 description 1
- 239000005020 polyethylene terephthalate Substances 0.000 description 1
- 229920001195 polyisoprene Polymers 0.000 description 1
- 229920000098 polyolefin Polymers 0.000 description 1
- 229920006324 polyoxymethylene Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000011115 styrene butadiene Substances 0.000 description 1
- 229920003048 styrene butadiene rubber Polymers 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- KQTIIICEAUMSDG-UHFFFAOYSA-N tricarballylic acid Chemical compound OC(=O)CC(C(O)=O)CC(O)=O KQTIIICEAUMSDG-UHFFFAOYSA-N 0.000 description 1
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 1
- XCQACDXXJYPIEM-UHFFFAOYSA-N tris(1,2,2,6,6-pentamethylpiperidin-4-yl) phosphate Chemical compound C1C(C)(C)N(C)C(C)(C)CC1OP(=O)(OC1CC(C)(C)N(C)C(C)(C)C1)OC1CC(C)(C)N(C)C(C)(C)C1 XCQACDXXJYPIEM-UHFFFAOYSA-N 0.000 description 1
- MVLBHTXRSXEBSM-UHFFFAOYSA-N tris(2,2,6,6-tetramethylpiperidin-4-yl) borate Chemical compound C1C(C)(C)NC(C)(C)CC1OB(OC1CC(C)(C)NC(C)(C)C1)OC1CC(C)(C)NC(C)(C)C1 MVLBHTXRSXEBSM-UHFFFAOYSA-N 0.000 description 1
- UDODJGSESAIMIH-UHFFFAOYSA-N tris(2,2,6,6-tetramethylpiperidin-4-yl) phosphate Chemical compound C1C(C)(C)NC(C)(C)CC1OP(=O)(OC1CC(C)(C)NC(C)(C)C1)OC1CC(C)(C)NC(C)(C)C1 UDODJGSESAIMIH-UHFFFAOYSA-N 0.000 description 1
- MILPIQHBMVLAAE-UHFFFAOYSA-N tris(2,2,6,6-tetramethylpiperidin-4-yl) phosphite Chemical compound C1C(C)(C)NC(C)(C)CC1OP(OC1CC(C)(C)NC(C)(C)C1)OC1CC(C)(C)NC(C)(C)C1 MILPIQHBMVLAAE-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/40—Oxygen atoms
- C07D211/44—Oxygen atoms attached in position 4
- C07D211/46—Oxygen atoms attached in position 4 having a hydrogen atom as the second substituent in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/92—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with a hetero atom directly attached to the ring nitrogen atom
- C07D211/94—Oxygen atom, e.g. piperidine N-oxide
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D221/00—Heterocyclic compounds containing six-membered rings having one nitrogen atom as the only ring hetero atom, not provided for by groups C07D211/00 - C07D219/00
- C07D221/02—Heterocyclic compounds containing six-membered rings having one nitrogen atom as the only ring hetero atom, not provided for by groups C07D211/00 - C07D219/00 condensed with carbocyclic rings or ring systems
- C07D221/20—Spiro-condensed ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/10—Spiro-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F5/00—Compounds containing elements of Groups 3 or 13 of the Periodic Table
- C07F5/02—Boron compounds
- C07F5/04—Esters of boric acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F7/00—Compounds containing elements of Groups 4 or 14 of the Periodic Table
- C07F7/02—Silicon compounds
- C07F7/04—Esters of silicic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/547—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom
- C07F9/553—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom having one nitrogen atom as the only ring hetero atom
- C07F9/576—Six-membered rings
- C07F9/59—Hydrogenated pyridine rings
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/16—Nitrogen-containing compounds
- C08K5/34—Heterocyclic compounds having nitrogen in the ring
- C08K5/3412—Heterocyclic compounds having nitrogen in the ring having one nitrogen atom in the ring
- C08K5/3432—Six-membered rings
- C08K5/3435—Piperidines
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Life Sciences & Earth Sciences (AREA)
- Biochemistry (AREA)
- General Health & Medical Sciences (AREA)
- Molecular Biology (AREA)
- Hydrogenated Pyridines (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP316571A JPS5632308B1 (enExample) | 1971-01-29 | 1971-01-29 | |
| CA133,553A CA985831A (en) | 1971-01-29 | 1972-01-31 | Process for preparing acid esters of 4-piperidinol derivatives and their use as stabilizers |
| AT725673A AT320992B (de) | 1971-01-29 | 1972-01-31 | Stabilisierte Zusammensetzung |
| CA237,404A CA997353A (en) | 1971-01-29 | 1975-10-10 | Process for preparing acid esters of 4-piperidinol derivatives and their use as stabilizers |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU554817A3 true SU554817A3 (ru) | 1977-04-15 |
Family
ID=45065548
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1809480A SU470112A3 (ru) | 1971-01-29 | 1972-01-28 | Способ получени производных 4-пиперидинола |
| SU1744183A SU554817A3 (ru) | 1971-01-29 | 1972-01-28 | Композици на основе синтетического полимера |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1809480A SU470112A3 (ru) | 1971-01-29 | 1972-01-28 | Способ получени производных 4-пиперидинола |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US3840494A (enExample) |
| AT (2) | AT317213B (enExample) |
| AU (1) | AU470423B2 (enExample) |
| BE (1) | BE778676A (enExample) |
| BR (1) | BR7200471D0 (enExample) |
| CA (2) | CA985831A (enExample) |
| CH (1) | CH562792A5 (enExample) |
| DD (1) | DD99994A5 (enExample) |
| ES (1) | ES399325A1 (enExample) |
| FR (1) | FR2123501B1 (enExample) |
| GB (2) | GB1390252A (enExample) |
| IT (1) | IT954877B (enExample) |
| NL (2) | NL154241B (enExample) |
| SU (2) | SU470112A3 (enExample) |
| ZA (1) | ZA72574B (enExample) |
Families Citing this family (81)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4021432A (en) * | 1971-11-30 | 1977-05-03 | Ciba-Geigy Corporation | Piperidine derivatives |
| US4110305A (en) * | 1971-11-30 | 1978-08-29 | Ciba-Geigy Corporation | Polymers stabilized by esters of piperidinols |
| US4049647A (en) * | 1971-11-30 | 1977-09-20 | Ciba-Geigy Corporation | Bis piperidyl carboxylates |
| BE792043A (fr) * | 1971-11-30 | 1973-05-29 | Ciba Geigy | Derives de la piperidine utilisables pour stabiliser des matieres organiques |
| JPS554133B2 (enExample) * | 1972-07-27 | 1980-01-29 | ||
| JPS5147738B2 (enExample) * | 1973-11-27 | 1976-12-16 | ||
| CH589056A5 (enExample) * | 1973-12-10 | 1977-06-30 | Ciba Geigy Ag | |
| US4056507A (en) * | 1973-12-28 | 1977-11-01 | Ciba-Geigy Corporation | Hindered piperidine carboxylic acids, metal salts thereof and stabilized compositions |
| US3920661A (en) * | 1973-12-28 | 1975-11-18 | Ciba Geigy Corp | Hindered piperidine carboxylic acids, metal salts thereof and stabilized compositions |
| US3939163A (en) * | 1973-12-28 | 1976-02-17 | Ciba-Geigy Corporation | Metal salts of hindered piperidine carboxylic acids and stabilized compositions |
| NO146433C (no) * | 1975-03-21 | 1982-09-29 | Montefibre Spa | Stabilisert polyolefinmateriale inneholdende et polyamin som stabilisator |
| US4210578A (en) * | 1975-05-28 | 1980-07-01 | Ciba-Geigy Corporation | 4-Siloxy derivatives of polyalkylated piperidines |
| JPS5848580B2 (ja) * | 1975-05-28 | 1983-10-29 | 三共株式会社 | ゴウセイコウブンシザイリヨウヨウアンテイザイ |
| GB1496844A (en) * | 1975-05-28 | 1978-01-05 | Ciba Geigy Ag | Stabilization of polymers |
| US4177186A (en) * | 1975-05-28 | 1979-12-04 | Ciba-Geigy Corporation | Stabilization of light-sensitive polymers |
| US4141883A (en) * | 1975-05-28 | 1979-02-27 | Sankyo Company, Limited | Stabilization of synthetic polymers by penta-or-hexa-substituted 4-piperidinol derivatives |
| US4191829A (en) * | 1975-06-30 | 1980-03-04 | Ciba-Geigy Corporation | Hindered piperidine carboxylic acids and metal salts thereof |
| US4052351A (en) * | 1975-08-04 | 1977-10-04 | Phillips Petroleum Company | Stabilization of olefin polymers |
| US4035323A (en) * | 1975-08-06 | 1977-07-12 | Phillips Petroleum Company | Stabilization of olefin polymers |
| DE2545646A1 (de) * | 1975-10-11 | 1977-04-21 | Bayer Ag | Cyanamide |
| JPS5263183A (en) * | 1975-11-19 | 1977-05-25 | Adeka Argus Chem Co Ltd | Stabilizer for organic materials |
| JPS5266551A (en) * | 1975-12-01 | 1977-06-02 | Adeka Argus Chem Co Ltd | Stabilizer for plastics |
| JPS52100543A (en) * | 1976-02-18 | 1977-08-23 | Adeka Argus Chem Co Ltd | Stabilized synthetic resin compositions |
| US4069196A (en) * | 1976-04-13 | 1978-01-17 | Ciba-Geigy Corporation | Piperidyl esters of higher di-tri-, and polybasic aliphatic carboxylic acids as stabilizers for polymeric materials |
| CH623066A5 (enExample) * | 1976-05-11 | 1981-05-15 | Ciba Geigy Ag | |
| CH626109A5 (enExample) * | 1976-05-11 | 1981-10-30 | Ciba Geigy Ag | |
| JPS52140555A (en) * | 1976-05-19 | 1977-11-24 | Adeka Argus Chem Co Ltd | Stabilized synthetic resin composition |
| JPS537748A (en) * | 1976-07-12 | 1978-01-24 | Toray Ind Inc | Synthetic resin composition having improved light resistance and gas-stain resistance |
| US4101508A (en) * | 1976-10-26 | 1978-07-18 | Argus Chemical Corporation | 2,2,6,6-Tetramethyl-4-piperidyl bicyclic heptane and octane carboxylic acid esters as stabilizers for synthetic polymers |
| JPS5373241A (en) * | 1976-12-10 | 1978-06-29 | Adeka Argus Chem Co Ltd | Stabilized synthetic resin compositions |
| JPS5379935A (en) * | 1976-12-24 | 1978-07-14 | Adeka Argus Chem Co Ltd | Stabilized synthetic resin composition |
| BE854444A (fr) * | 1977-05-10 | 1977-11-10 | Argus Chem | Stabilisants de resines synthetiques contenant des derives de piperidine |
| US4111901A (en) * | 1977-06-06 | 1978-09-05 | Borg-Warner Corporation | Hindered five-membered nitrogen rings as polyolefin stabilizers |
| JPS5429400A (en) * | 1977-08-08 | 1979-03-05 | Sankyo Co Ltd | Polymer comprising polyalkylpiperidine and its use as stabilizers |
| JPS5466996A (en) * | 1977-11-08 | 1979-05-29 | Sankyo Co Ltd | Polymer substituted by polyalkylpiperidine side chain, its preparation and its use as stabilizer |
| US4166803A (en) * | 1978-01-09 | 1979-09-04 | Eastman Kodak Company | Heterocyclic benzoate ultraviolet stabilizers and their use in organic compositions |
| US4141884A (en) * | 1978-01-09 | 1979-02-27 | Eastman Kodak Company | Heterocyclic ester ultraviolet stabilizers and their use in organic compositions |
| US4164480A (en) * | 1978-01-09 | 1979-08-14 | Eastman Kodak Company | Polychromophoric ultraviolet stabilizers and their use in organic compositions |
| US4194989A (en) * | 1978-11-27 | 1980-03-25 | Eastman Kodak Company | Piperidinyl hydrogen 2-hydroxyalkyl phosphates and metal salts thereof which compounds are useful as ultraviolet stabilizers for organic compositions |
| US4250268A (en) * | 1978-11-28 | 1981-02-10 | Ciba-Geigy Corporation | Polysilylesters having a polyalkylpiperidine as part of the polymer useful as light stabilizers for plastics |
| US4234699A (en) * | 1978-11-29 | 1980-11-18 | Ciba-Geigy Corporation | Polymeric light stabilizers for plastics |
| US4234700A (en) * | 1978-12-04 | 1980-11-18 | Ciba-Geigy Corporation | Polymeric light stabilizers for plastics |
| CS229069B1 (en) * | 1981-09-23 | 1984-05-14 | Julius Durmis | Composition for stabilizing polymers and method of preparing same |
| EP0078603A1 (en) * | 1981-10-12 | 1983-05-11 | Imperial Chemical Industries Plc | Polyolefin compositions and articles sterilisable by irradiation |
| IT1176167B (it) * | 1984-05-22 | 1987-08-18 | Montedison Spa | Derivati della quattro idrossi metil piperidina alchil sostituita e loro impiego come stabilizzanti |
| JPS6136339A (ja) * | 1984-07-27 | 1986-02-21 | Polyplastics Co | 耐候性ポリアセタ−ル樹脂組成物 |
| JPS6147744A (ja) * | 1984-08-15 | 1986-03-08 | Polyplastics Co | 耐候性ポリアセタ−ル樹脂組成物 |
| JPH0621211B2 (ja) * | 1985-08-13 | 1994-03-23 | 旭電化工業株式会社 | 塩化ビニル樹脂組成物 |
| US4762872A (en) * | 1985-11-01 | 1988-08-09 | The B. F. Goodrich Company | Oligomeric light stabilizers with substituted piperidine ends |
| DE3750994D1 (de) * | 1986-03-10 | 1995-03-02 | Ciba Geigy Ag | Stabilisierte Hart-PVC-Zusammensetzungen. |
| US4822833A (en) * | 1986-03-10 | 1989-04-18 | Ciba-Geigy Corporation | Stabilized rigid polyvinyl chloride compositions |
| EP0243319A3 (de) * | 1986-04-25 | 1989-02-15 | Ciba-Geigy Ag | Gegen Lichteinwirkung stabilisierte Thermoplasten |
| US4874391A (en) * | 1986-07-29 | 1989-10-17 | Ciba-Geigy Corporation | Process for photochemical stabilization of polyamide fiber material and mixtures thereof with other fibers: water-soluble copper complex dye and light-stabilizer |
| DE3738736A1 (de) * | 1987-11-14 | 1989-05-24 | Basf Ag | 4-formylaminopiperidinderivate und deren verwendung als stabilisatoren |
| ES2050274T3 (es) * | 1988-06-14 | 1994-05-16 | Ciba Geigy Ag | Procedimiento para la estabilizacion fotoquimica de fibras de polipropileno sin teñir y teñidas. |
| KR910700007A (ko) * | 1988-12-22 | 1991-03-13 | 윌리암 피. 블레이크 | 열 및 빛에 대하여 안정한 방염성 및 열가소성 폴리올레핀 및 폴리스티렌 조성물 |
| US5030243A (en) * | 1989-01-05 | 1991-07-09 | Ciba-Geigy Corporation | Process for the photochemical stabilization of undyed and dyeable artificial leather with a sterically hindered amine |
| DE69012616T2 (de) * | 1989-03-21 | 1995-01-26 | Ciba Geigy Ag | Stabilisatoren mit N-hydroxy-substituierter, gehinderter Aminogruppe und ihre Herstellung durch Michael-Addition. |
| IT1247977B (it) * | 1991-06-04 | 1995-01-05 | Ciba Geigy Spa | Stabilizzazione di materiali organici polimerici mediante l`impiego dimiscele sinergiche costituite da ammine cicliche stericamente impeditee derivati del 3-pirazolidinone o del 1,2,4,-triazolidin-3,5,-dione |
| IT1247978B (it) * | 1991-06-04 | 1995-01-05 | Ciba Geigy Spa | Composti piperidinici contenenti l'anello tetraidrofuranico atti all'impiego come stabilizzanti per materiali organici |
| US5169949A (en) * | 1991-09-30 | 1992-12-08 | Himont Incorporated | Monomeric hindered amine esters of monocarboxylic resin acid having 20 carbon atoms |
| US5444111A (en) * | 1993-01-15 | 1995-08-22 | Morton International, Inc. | Ammonium chloride as a PVC co-stabilizer |
| IT1264946B1 (it) * | 1993-07-16 | 1996-10-17 | Ciba Geigy Spa | Derivati del 2,2,6,6-tetrametil-4-piperidinolo utili come stabilizzanti alla luce ed all'ossidazione per materiali organici. |
| IT1264817B1 (it) * | 1993-07-28 | 1996-10-10 | Ciba Geigy Spa | Derivati di polialchil-4-piperidinoli atti all'impderivati di polialchil-4-piperidinoli atti all'impiego come stabilizzanti per materiali organici iego come stabilizzanti per materiali organici |
| DE69408935T2 (de) * | 1993-10-29 | 1998-07-30 | Montell North America Inc | Piperidinylphosphitzusammensetzungen und Polyolefinzusammensetzungen die diese enthalten |
| TW358110B (en) * | 1996-05-28 | 1999-05-11 | Ciba Sc Holding Ag | Mixture of polyalkylpiperidin-4-yl dicarboxylic acid esters as stabilizers for organic materials |
| US6414155B1 (en) | 2000-11-03 | 2002-07-02 | Cytec Technology Corp. | Oligomeric hindered amine light stabilizers based on multi-functional carbonyl compounds and methods of making same |
| US6492521B2 (en) | 2000-11-03 | 2002-12-10 | Cytec Technology Corp. | Hindered amine light stabilizers based on multi-functional carbonyl compounds and methods of making same |
| US6727300B2 (en) | 2000-11-03 | 2004-04-27 | Cytec Technology Corp. | Polymeric articles containing hindered amine light stabilizers based on multi-functional carbonyl compounds |
| US6545156B1 (en) | 2000-11-03 | 2003-04-08 | Cytec Technology Corp. | Oligomeric hindered amine light stabilizers based on multi-functional carbonyl compounds and methods of making same |
| US6525131B1 (en) * | 2001-09-18 | 2003-02-25 | Crompton Corporation | Aromatic diamine polyurethane curatives with improved stability |
| US20100305327A1 (en) * | 2005-12-27 | 2010-12-02 | Adeka Corporation | Nitroxyl compound, and polymerization inhibitor and polymerization inhibitor composition using same |
| ITMI20080747A1 (it) | 2008-04-24 | 2009-10-25 | 3V Sigma Spa | Miscele di ammine stericamente impedite per la stabilizzazione di polimeri |
| FR2943676B1 (fr) * | 2009-03-26 | 2017-03-24 | Univ De Provence | Composes biradicalaires de type dinitroxyde optimises pour la polarisation dynamique nucleaire (pdn) |
| IT1399477B1 (it) | 2010-03-15 | 2013-04-19 | 3V Sigma Spa | Miscele di ammine stericamente impedite per la stabilizzazione di polimeri |
| ITMI20110802A1 (it) | 2011-05-10 | 2012-11-11 | 3V Sigma Spa | Miscele di ammine stericamente impedite per la stabilizzazione di polimeri |
| JP6375887B2 (ja) | 2014-05-26 | 2018-08-22 | Jnc株式会社 | 液晶組成物および液晶表示素子 |
| JP6435874B2 (ja) | 2014-07-29 | 2018-12-12 | Jnc株式会社 | 液晶組成物および液晶表示素子 |
| IT201700073726A1 (it) | 2017-06-30 | 2018-12-30 | 3V Sigma Spa | Ammine impedite polimeriche |
| IT201700078234A1 (it) | 2017-07-11 | 2019-01-11 | 3V Sigma Spa | Ammine impedite |
| CN115322223A (zh) * | 2022-07-29 | 2022-11-11 | 宿迁盛瑞新材料有限公司 | 一种新型磷酸酯类阻燃防老化助剂及其制备方法 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3640928A (en) * | 1968-06-12 | 1972-02-08 | Sankyo Co | Stabilization of synthetic polymers |
-
0
- NL NL154241D patent/NL154241C/xx active
-
1972
- 1972-01-25 US US00220706A patent/US3840494A/en not_active Expired - Lifetime
- 1972-01-28 BE BE778676A patent/BE778676A/xx not_active IP Right Cessation
- 1972-01-28 FR FR7202835A patent/FR2123501B1/fr not_active Expired
- 1972-01-28 CH CH126972A patent/CH562792A5/xx not_active IP Right Cessation
- 1972-01-28 ZA ZA720574A patent/ZA72574B/xx unknown
- 1972-01-28 SU SU1809480A patent/SU470112A3/ru active
- 1972-01-28 BR BR471/72A patent/BR7200471D0/pt unknown
- 1972-01-28 SU SU1744183A patent/SU554817A3/ru active
- 1972-01-29 ES ES399325A patent/ES399325A1/es not_active Expired
- 1972-01-29 IT IT19974/72A patent/IT954877B/it active
- 1972-01-31 CA CA133,553A patent/CA985831A/en not_active Expired
- 1972-01-31 AT AT75972A patent/AT317213B/de not_active IP Right Cessation
- 1972-01-31 DD DD164431A patent/DD99994A5/xx unknown
- 1972-01-31 NL NL727201259A patent/NL154241B/xx not_active IP Right Cessation
- 1972-01-31 GB GB2722174A patent/GB1390252A/en not_active Expired
- 1972-01-31 GB GB433372A patent/GB1390251A/en not_active Expired
- 1972-01-31 AT AT725673A patent/AT320992B/de not_active IP Right Cessation
- 1972-02-01 AU AU38481/72A patent/AU470423B2/en not_active Expired
-
1975
- 1975-10-10 CA CA237,404A patent/CA997353A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| NL154241B (nl) | 1977-08-15 |
| CH562792A5 (enExample) | 1975-06-13 |
| ES399325A1 (es) | 1975-06-01 |
| BR7200471D0 (pt) | 1973-05-24 |
| SU470112A3 (ru) | 1975-05-05 |
| NL154241C (enExample) | 1900-01-01 |
| DD99994A5 (enExample) | 1973-09-05 |
| CA997353A (en) | 1976-09-21 |
| DE2204659A1 (de) | 1972-08-10 |
| DE2204659B2 (de) | 1975-09-04 |
| CA985831A (en) | 1976-03-16 |
| AU470423B2 (en) | 1973-08-02 |
| AT320992B (de) | 1975-03-10 |
| FR2123501B1 (enExample) | 1976-03-05 |
| US3840494A (en) | 1974-10-08 |
| AT317213B (de) | 1974-08-26 |
| AU3848172A (en) | 1973-08-02 |
| GB1390251A (en) | 1975-04-09 |
| GB1390252A (en) | 1975-04-09 |
| BE778676A (fr) | 1972-07-28 |
| NL7201259A (enExample) | 1972-08-01 |
| IT954877B (it) | 1973-09-15 |
| ZA72574B (en) | 1972-10-25 |
| FR2123501A1 (enExample) | 1972-09-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU554817A3 (ru) | Композици на основе синтетического полимера | |
| US4096114A (en) | 2,2,6,6-Tetramethyl piperidyl-4-phosphites as stabilizers for organic polymeric materials | |
| SU455547A3 (ru) | Композици на основе синтетического полимера | |
| US4397977A (en) | Tetrahalophthalates as flame retardant plasticizers for halogenated resins | |
| US3542729A (en) | Stabilization of synthetic polymers | |
| US4525503A (en) | Piperidine derivatives which are stabilizers for synthetic polymers | |
| US3436362A (en) | Halogen-containing polymers and polyolefins stabilized with uracils | |
| CA2179191C (en) | Stabilised vinyl chloride composition | |
| US4136081A (en) | 2,2,6,6-tetramethyl-4-piperidyl carboxylic acid esters of aliphatic tetracarboxylic acids as stabilizers for synthetic polymers | |
| US4118369A (en) | 2,2,6,6-Tetrasubstituted-4-piperidyl carboxy heterocyclic compounds as stabilizers for synthetic polymers | |
| SU539537A3 (ru) | Стабилизированна композици на основе синтетического полимера | |
| SU484694A3 (ru) | Композици на основе синтетического полимера | |
| US4102858A (en) | 2,2,6,6-tetramethyl-4-piperidyl thiocarboxylates and aminocarboxylates and synthetic resin compositions containing the same | |
| US3975462A (en) | Piperidine-spiro-hydantoin derivatives and their use as stabilizers | |
| US4105625A (en) | 2,2,6,6-tetramethyl-4-piperidyl carboxylic acid esters of hydroxy aliphatic di- and tri-carboxylic acids as light stabilizers for synthetic polymers | |
| US4128608A (en) | 2,2,6,6-Tetramethyl-4-piperidyl spiro aliphatic ethers as stabilizers for synthetic polymers | |
| EP0023330B1 (en) | 2,2,6,6-tetraalkyl-4-piperidyl alcohol esters of tetradecylene polycarboxylic acids as light stabilizers for synthetic polymers and stabilized compositions | |
| US3431233A (en) | Novel piperidine n-oxide polyolefin stabilizers | |
| US4116927A (en) | 2,2,6,6-Tetramethyl-4-piperidyl carboxylic acid esters of butane or butene tri carboxylic acids as stabilizers for synthetic polymers | |
| US4101508A (en) | 2,2,6,6-Tetramethyl-4-piperidyl bicyclic heptane and octane carboxylic acid esters as stabilizers for synthetic polymers | |
| US3210312A (en) | Anti-electrostatic imidazoline salts for resin compositions | |
| US4378443A (en) | 2,2,6,6-Tetraalkyl-4-piperidyl-bix-spiro-ethers as light stabilizers for synthetic polymers | |
| US3431232A (en) | Piperidine n-oxide polyolefin stabilizers | |
| US4451400A (en) | Phosphazenes useful as stabilizers in polymers | |
| SU423308A3 (enExample) |