SU552029A3 - Способ получени производных оксазола - Google Patents
Способ получени производных оксазолаInfo
- Publication number
- SU552029A3 SU552029A3 SU2087389A SU2087389A SU552029A3 SU 552029 A3 SU552029 A3 SU 552029A3 SU 2087389 A SU2087389 A SU 2087389A SU 2087389 A SU2087389 A SU 2087389A SU 552029 A3 SU552029 A3 SU 552029A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- carbon atoms
- methyloxazole
- mmhg
- kip
- general formula
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 17
- 150000007978 oxazole derivatives Chemical class 0.000 title claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 40
- -1 hydroxy- Chemical class 0.000 claims description 19
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 7
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 5
- 125000003342 alkenyl group Chemical group 0.000 claims description 5
- 229910052799 carbon Inorganic materials 0.000 claims description 5
- 150000001875 compounds Chemical class 0.000 claims description 5
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 4
- 150000008064 anhydrides Chemical class 0.000 claims description 4
- 125000004429 atom Chemical group 0.000 claims description 4
- 125000003884 phenylalkyl group Chemical group 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- 125000002971 oxazolyl group Chemical group 0.000 claims description 3
- 239000002253 acid Substances 0.000 claims description 2
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 2
- 125000000304 alkynyl group Chemical group 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 2
- 125000004181 carboxyalkyl group Chemical group 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 239000003960 organic solvent Substances 0.000 claims description 2
- 125000005429 oxyalkyl group Chemical group 0.000 claims description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 2
- 125000001188 haloalkyl group Chemical group 0.000 claims 2
- 239000000460 chlorine Substances 0.000 claims 1
- 150000004820 halides Chemical class 0.000 claims 1
- 239000012433 hydrogen halide Substances 0.000 claims 1
- 229910000039 hydrogen halide Inorganic materials 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- 238000010438 heat treatment Methods 0.000 description 5
- 239000003921 oil Substances 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 4
- PQZVCRPSQXDXJL-UHFFFAOYSA-N butylcyanamide Chemical compound CCCCNC#N PQZVCRPSQXDXJL-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 239000012230 colorless oil Substances 0.000 description 4
- 238000004821 distillation Methods 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 235000011121 sodium hydroxide Nutrition 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical class O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- XZMCDFZZKTWFGF-UHFFFAOYSA-N Cyanamide Chemical compound NC#N XZMCDFZZKTWFGF-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 239000003377 acid catalyst Substances 0.000 description 2
- 125000005041 acyloxyalkyl group Chemical group 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- ATDGTVJJHBUTRL-UHFFFAOYSA-N cyanogen bromide Chemical compound BrC#N ATDGTVJJHBUTRL-UHFFFAOYSA-N 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- KQNPFQTWMSNSAP-UHFFFAOYSA-N isobutyric acid Chemical compound CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 description 2
- WMMBRZLIZYJMJY-UHFFFAOYSA-N n-butan-2-yl-4-methyl-1,3-oxazol-2-amine Chemical compound CCC(C)NC1=NC(C)=CO1 WMMBRZLIZYJMJY-UHFFFAOYSA-N 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- FXBMDTJNJYRHOY-UHFFFAOYSA-N 1-butyl-2-fluorobenzene Chemical compound CCCCC1=CC=CC=C1F FXBMDTJNJYRHOY-UHFFFAOYSA-N 0.000 description 1
- NYSXWUPVOCFRSE-UHFFFAOYSA-N 1-phenyl-ethene-1,2-diol Natural products OC=C(O)C1=CC=CC=C1 NYSXWUPVOCFRSE-UHFFFAOYSA-N 0.000 description 1
- ZWVHTXAYIKBMEE-UHFFFAOYSA-N 2-hydroxyacetophenone Chemical compound OCC(=O)C1=CC=CC=C1 ZWVHTXAYIKBMEE-UHFFFAOYSA-N 0.000 description 1
- ZCHCHJQEWYIJDQ-UHFFFAOYSA-N 2-methyl-1,3-oxazole Chemical compound CC1=NC=CO1 ZCHCHJQEWYIJDQ-UHFFFAOYSA-N 0.000 description 1
- DGMOBVGABMBZSB-UHFFFAOYSA-N 2-methylpropanoyl chloride Chemical compound CC(C)C(Cl)=O DGMOBVGABMBZSB-UHFFFAOYSA-N 0.000 description 1
- 125000006180 3-methyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C(=C1[H])C([H])([H])[H])C([H])([H])* 0.000 description 1
- XYVMOLOUBJBNBF-UHFFFAOYSA-N 3h-1,3-oxazol-2-one Chemical class OC1=NC=CO1 XYVMOLOUBJBNBF-UHFFFAOYSA-N 0.000 description 1
- YVORRVFKHZLJGZ-UHFFFAOYSA-N 4,5-Dimethyloxazole Chemical compound CC=1N=COC=1C YVORRVFKHZLJGZ-UHFFFAOYSA-N 0.000 description 1
- WEQPBCSPRXFQQS-UHFFFAOYSA-N 4,5-dihydro-1,2-oxazole Chemical compound C1CC=NO1 WEQPBCSPRXFQQS-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 240000003801 Sigesbeckia orientalis Species 0.000 description 1
- 235000003407 Sigesbeckia orientalis Nutrition 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- 125000006309 butyl amino group Chemical group 0.000 description 1
- 125000005518 carboxamido group Chemical group 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 150000001912 cyanamides Chemical class 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- HHLFWLYXYJOTON-UHFFFAOYSA-N glyoxylic acid Chemical compound OC(=O)C=O HHLFWLYXYJOTON-UHFFFAOYSA-N 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- XLSMFKSTNGKWQX-UHFFFAOYSA-N hydroxyacetone Chemical compound CC(=O)CO XLSMFKSTNGKWQX-UHFFFAOYSA-N 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- MYWUZJCMWCOHBA-VIFPVBQESA-N methamphetamine Chemical compound CN[C@@H](C)CC1=CC=CC=C1 MYWUZJCMWCOHBA-VIFPVBQESA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- FAKPUWHQHACLID-UHFFFAOYSA-N n-(2-methoxyethyl)-4-methyl-1,3-oxazol-2-amine Chemical compound COCCNC1=NC(C)=CO1 FAKPUWHQHACLID-UHFFFAOYSA-N 0.000 description 1
- XGWURFNBXJXEEU-UHFFFAOYSA-N n-(4-methyl-1,3-oxazol-2-yl)-n-pentylbenzamide Chemical compound N=1C(C)=COC=1N(CCCCC)C(=O)C1=CC=CC=C1 XGWURFNBXJXEEU-UHFFFAOYSA-N 0.000 description 1
- VEFUOOZJTBIWTC-UHFFFAOYSA-N n-(4-methyl-1,3-oxazol-2-yl)-n-propylhexanamide Chemical compound CCCCCC(=O)N(CCC)C1=NC(C)=CO1 VEFUOOZJTBIWTC-UHFFFAOYSA-N 0.000 description 1
- ACFAUWMDCOCTAD-UHFFFAOYSA-N n-benzyl-n-(4-methyl-1,3-oxazol-2-yl)butanamide Chemical compound N=1C(C)=COC=1N(C(=O)CCC)CC1=CC=CC=C1 ACFAUWMDCOCTAD-UHFFFAOYSA-N 0.000 description 1
- GYXSQMOZYFUKNC-UHFFFAOYSA-N n-benzyl-n-(4-methyl-1,3-oxazol-2-yl)pentanamide Chemical compound N=1C(C)=COC=1N(C(=O)CCCC)CC1=CC=CC=C1 GYXSQMOZYFUKNC-UHFFFAOYSA-N 0.000 description 1
- OJPLOCHZOYBEIG-UHFFFAOYSA-N n-butyl-2-ethyl-n-(4-methyl-1,3-oxazol-2-yl)butanamide Chemical compound CCCCN(C(=O)C(CC)CC)C1=NC(C)=CO1 OJPLOCHZOYBEIG-UHFFFAOYSA-N 0.000 description 1
- BXGIGCLJUGBLPJ-UHFFFAOYSA-N n-butyl-2-methyl-n-(1,3-oxazol-2-yl)propanamide Chemical compound CCCCN(C(=O)C(C)C)C1=NC=CO1 BXGIGCLJUGBLPJ-UHFFFAOYSA-N 0.000 description 1
- VMBNXRJYPJRJIU-UHFFFAOYSA-N n-butyl-2-methyl-n-(4-methyl-1,3-oxazol-2-yl)propanamide Chemical compound CCCCN(C(=O)C(C)C)C1=NC(C)=CO1 VMBNXRJYPJRJIU-UHFFFAOYSA-N 0.000 description 1
- OYSBQIYYPMWEGL-UHFFFAOYSA-N n-butyl-2-methyl-n-(5-methyl-1,3-oxazol-2-yl)propanamide Chemical compound CCCCN(C(=O)C(C)C)C1=NC=C(C)O1 OYSBQIYYPMWEGL-UHFFFAOYSA-N 0.000 description 1
- QMUQVROTWKQGLZ-UHFFFAOYSA-N n-butyl-n-(5-hydroxy-4-methyl-1,3-oxazol-2-yl)-2-methylpropanamide Chemical compound CCCCN(C(=O)C(C)C)C1=NC(C)=C(O)O1 QMUQVROTWKQGLZ-UHFFFAOYSA-N 0.000 description 1
- CVUYHUHTOHGTME-UHFFFAOYSA-N n-cyclopentyl-2-methyl-n-(4-methyl-1,3-oxazol-2-yl)propanamide Chemical compound N=1C(C)=COC=1N(C(=O)C(C)C)C1CCCC1 CVUYHUHTOHGTME-UHFFFAOYSA-N 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/02—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings
- C07D263/30—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D263/34—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D263/48—Nitrogen atoms not forming part of a nitro radical
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB58351/73A GB1497536A (en) | 1973-12-17 | 1973-12-17 | 2-acylaminooxazoles methods for their preparation and their use |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU552029A3 true SU552029A3 (ru) | 1977-03-25 |
Family
ID=10481393
Family Applications (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU2087389A SU552029A3 (ru) | 1973-12-17 | 1974-12-16 | Способ получени производных оксазола |
| SU752189819A SU623518A3 (ru) | 1973-12-17 | 1975-11-18 | Способ получени производных оксазола |
| SU752189818A SU609466A3 (ru) | 1973-12-17 | 1975-11-18 | Способ получени производных оксазола |
Family Applications After (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU752189819A SU623518A3 (ru) | 1973-12-17 | 1975-11-18 | Способ получени производных оксазола |
| SU752189818A SU609466A3 (ru) | 1973-12-17 | 1975-11-18 | Способ получени производных оксазола |
Country Status (29)
| Country | Link |
|---|---|
| US (1) | US4122183A (enExample) |
| JP (1) | JPS5093968A (enExample) |
| AR (4) | AR214714A1 (enExample) |
| AT (1) | AT341521B (enExample) |
| BE (1) | BE823424A (enExample) |
| BG (3) | BG26530A4 (enExample) |
| CA (1) | CA1060440A (enExample) |
| CH (3) | CH605862A5 (enExample) |
| DD (1) | DD115676A5 (enExample) |
| DE (1) | DE2459380A1 (enExample) |
| DK (1) | DK655074A (enExample) |
| EG (1) | EG11873A (enExample) |
| ES (2) | ES433018A1 (enExample) |
| FI (1) | FI363374A7 (enExample) |
| FR (1) | FR2254338B1 (enExample) |
| GB (1) | GB1497536A (enExample) |
| HU (1) | HU170454B (enExample) |
| IE (1) | IE40308B1 (enExample) |
| IL (2) | IL46250A (enExample) |
| LU (1) | LU71499A1 (enExample) |
| NL (1) | NL7416389A (enExample) |
| NO (1) | NO142303C (enExample) |
| OA (1) | OA04946A (enExample) |
| PH (1) | PH13466A (enExample) |
| PL (2) | PL97985B1 (enExample) |
| RO (1) | RO70772A (enExample) |
| SE (1) | SE420604B (enExample) |
| SU (3) | SU552029A3 (enExample) |
| ZA (1) | ZA748013B (enExample) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1497536A (en) * | 1973-12-17 | 1978-01-12 | Lilly Industries Ltd | 2-acylaminooxazoles methods for their preparation and their use |
| US4150143A (en) | 1973-12-17 | 1979-04-17 | Lilly Industries Limited | N-Substituted-acylamino-oxazoles as antiasthma agents |
| GB1547564A (en) | 1975-06-05 | 1979-06-20 | Lilly Industries Ltd | Acylated amino-heteroaryl compounds |
| GB1552125A (en) * | 1975-06-07 | 1979-09-05 | Lilly Industries Ltd | 2-acylamino oxazoles |
| IT1099996B (it) * | 1978-10-17 | 1985-09-28 | Anic Spa | Derivati del 4,5-difenil-ossazolo 2-ammino o 2-tio sostituiti e procedimento per il loro ottenimento |
| US4666502A (en) * | 1982-02-09 | 1987-05-19 | Sandoz Ltd. | Herbicidal N-thienyl-chloroacetamides |
| CH655312A5 (de) * | 1982-02-09 | 1986-04-15 | Sandoz Ag | Chloracetamide. |
| US4500343A (en) * | 1982-09-30 | 1985-02-19 | Eli Lilly And Company | Oxazolyl and thiazolyl amides as herbicides |
| GB2127816B (en) * | 1982-09-30 | 1986-05-08 | Lilly Co Eli | Herbicidal 1-heterocyclic-2-pyrrolidinone derivatives |
| US6228871B1 (en) | 1995-07-10 | 2001-05-08 | Merck & Co., Inc. | Angiogenesis inhibitors |
| CA2336848A1 (en) * | 1998-07-10 | 2000-01-20 | Merck & Co., Inc. | Novel angiogenesis inhibitors |
| TW200503994A (en) * | 2003-01-24 | 2005-02-01 | Novartis Ag | Organic compounds |
| EP3040336B1 (en) | 2012-03-02 | 2020-04-08 | Sareum Limited | Compounds for use in treating tyk2 kinase mediated conditions |
| MX369974B (es) * | 2013-09-03 | 2019-11-27 | Sareum Ltd | Compuestos farmaceuticos. |
| GB201617871D0 (en) | 2016-10-21 | 2016-12-07 | Sareum Limited | Pharmaceutical compounds |
| GB201816369D0 (en) | 2018-10-08 | 2018-11-28 | Sareum Ltd | Pharmaceutical compounds |
| GB202005114D0 (en) | 2020-04-07 | 2020-05-20 | Sareum Ltd | Crystalline Forms of a Pharmaceutical Compound |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2401522A (en) * | 1942-04-17 | 1946-06-04 | Firm Sandoz Ltd | Aromatic carboxylic acid amides and a process for their manufacture |
| US3152136A (en) * | 1958-10-30 | 1964-10-06 | Dow Chemical Co | Dinitroaroyl-nu-pyridyl amides |
| US3682954A (en) * | 1970-02-04 | 1972-08-08 | Upjohn Co | Bis (3-pyrazolidone) compounds |
| DE2045049A1 (de) * | 1970-09-11 | 1972-03-23 | Dr Karl Thomae GmbH, 7950 Biberach | Neue Nitrofurandenvate und Ver fahren zu ihrer Herstellung |
| GB1264258A (enExample) * | 1970-10-10 | 1972-02-16 | ||
| BE791087A (fr) * | 1971-11-15 | 1973-03-01 | Lepetit Spa | Oxazoles 2,4,5-trisubstitues et leur preparation |
| GB1497536A (en) * | 1973-12-17 | 1978-01-12 | Lilly Industries Ltd | 2-acylaminooxazoles methods for their preparation and their use |
-
1973
- 1973-12-17 GB GB58351/73A patent/GB1497536A/en not_active Expired
-
1974
- 1974-12-16 SU SU2087389A patent/SU552029A3/ru active
- 1974-12-16 IL IL46250A patent/IL46250A/xx unknown
- 1974-12-16 NL NL7416389A patent/NL7416389A/xx not_active Application Discontinuation
- 1974-12-16 AT AT1000074A patent/AT341521B/de not_active IP Right Cessation
- 1974-12-16 NO NO744532A patent/NO142303C/no unknown
- 1974-12-16 DD DD183072A patent/DD115676A5/xx unknown
- 1974-12-16 CH CH763777A patent/CH605862A5/xx not_active IP Right Cessation
- 1974-12-16 SE SE7415778A patent/SE420604B/xx unknown
- 1974-12-16 PL PL1974190307A patent/PL97985B1/pl unknown
- 1974-12-16 BG BG034443A patent/BG26530A4/xx unknown
- 1974-12-16 RO RO7480812A patent/RO70772A/ro unknown
- 1974-12-16 BG BG028456A patent/BG25992A3/xx unknown
- 1974-12-16 BG BG034444A patent/BG26669A4/xx unknown
- 1974-12-16 BE BE6044859A patent/BE823424A/xx unknown
- 1974-12-16 FR FR7441288A patent/FR2254338B1/fr not_active Expired
- 1974-12-16 CH CH1672074A patent/CH605861A5/xx not_active IP Right Cessation
- 1974-12-16 DE DE19742459380 patent/DE2459380A1/de not_active Ceased
- 1974-12-16 DK DK655074A patent/DK655074A/da not_active Application Discontinuation
- 1974-12-16 FI FI3633/74A patent/FI363374A7/fi unknown
- 1974-12-16 PH PH16633A patent/PH13466A/en unknown
- 1974-12-16 CH CH763877A patent/CH605931A5/xx not_active IP Right Cessation
- 1974-12-16 IE IE2579/74A patent/IE40308B1/xx unknown
- 1974-12-16 PL PL1974176503A patent/PL94117B1/pl unknown
- 1974-12-16 CA CA216,066A patent/CA1060440A/en not_active Expired
- 1974-12-17 OA OA55367A patent/OA04946A/xx unknown
- 1974-12-17 EG EG569A patent/EG11873A/xx active
- 1974-12-17 LU LU71499A patent/LU71499A1/xx unknown
- 1974-12-17 HU HULI270A patent/HU170454B/hu unknown
- 1974-12-17 JP JP49144924A patent/JPS5093968A/ja active Pending
- 1974-12-17 ZA ZA00748013A patent/ZA748013B/xx unknown
- 1974-12-17 ES ES433018A patent/ES433018A1/es not_active Expired
-
1975
- 1975-11-18 SU SU752189819A patent/SU623518A3/ru active
- 1975-11-18 SU SU752189818A patent/SU609466A3/ru active
- 1975-12-19 AR AR261703A patent/AR214714A1/es active
-
1976
- 1976-08-27 ES ES451058A patent/ES451058A1/es not_active Expired
- 1976-12-16 AR AR256912A patent/AR209919A1/es active
-
1977
- 1977-02-09 US US05/767,088 patent/US4122183A/en not_active Expired - Lifetime
- 1977-07-20 AR AR268494A patent/AR212547A1/es active
- 1977-07-20 AR AR268493A patent/AR215640A1/es active
- 1977-08-12 IL IL52719A patent/IL52719A0/xx unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU552029A3 (ru) | Способ получени производных оксазола | |
| US3544584A (en) | Certain 5-alkyl-3-hydroxyisoxazoles | |
| US6657074B1 (en) | Process for the preparation of acylated 1,3-dicarbonyl compounds | |
| US2964538A (en) | Nu-(3-chloro-methylallyl)-benzene-sulfonanilides | |
| EP0091022B1 (de) | 5-Trichlormethylisoxazol, ein Verfahren zu seiner Herstellung und seine Verwendung | |
| KLAGER | THE CHEMISTRY OF ALIPHATIC DINITRO COMPOUNDS. II. METHYL δ-HYDROXY-γ, γ-DINITROVALERATE1 | |
| EP0089485B1 (de) | Verfahren zur Herstellung von 5-Chlor-1H-tetrazol-1-carbonsäureestern sowie Verfahren zur Herstellung der erforderlichen Dichlorisonitril-carbonsäureester | |
| US2257980A (en) | Manufacture of aliphatic ijnsatu- | |
| US4120868A (en) | Cyclic 2-methyl-2,4-dialkoxy-3-buten-1-al-acetals, their preparation and use | |
| US4968836A (en) | Process for the preparation of substituted cyclopropanecarbaldehydes | |
| US2791604A (en) | Production of alpha-nitroesters | |
| Postma et al. | Chemistry of acetylenic ethers XX. Note on the preparation of secondary ethoxyethynylcarbinols | |
| SU899558A1 (ru) | Способ получени 2-замещенных-4-алкокси(арокси)метил- @ -бутиролактонов | |
| US2419865A (en) | Carbalkoxylation of phenylacetates | |
| US4377531A (en) | Method for the alkylation of phenylacetonitriles | |
| US2654760A (en) | Preparation of 4-methyl-5-(beta-hydroxyethyl)-thiazole | |
| JPH04247052A (ja) | ビシクロ〔4,1,0〕ヘプタン−2,4−ジオン誘導体、その製造法 | |
| SU1205756A3 (ru) | Способ получени 1,1-дихлор-4-метилпентадиенов | |
| SU568648A1 (ru) | Способ получени 3-фенил- 3-бутенолидов | |
| SU150504A1 (ru) | Способ получени бета,бета,бета-триарилпропионовых кислот или их эфиров | |
| SU959621A3 (ru) | Способ получени производных циклобутанона | |
| SU505356A3 (ru) | Способ получени сульфонатов | |
| US5118834A (en) | Process for the preparation of butyl 2-phenylcyclopropanecarboxylates | |
| SU262726A1 (ru) | СПОСОБ ПОЛУЧЕНИЯ N-n-СУЛЬФАМИДО-ФЕНИЛ- ХРОМОН-2-КАРБОНАМИДОВ | |
| US5256815A (en) | Bisulfite adducts of 2,4-dihalobutraldehyde |