SU549083A3 - Способ получени производных бис(4-(1-хиназолинил-4)-пиперидил)-алканов - Google Patents
Способ получени производных бис(4-(1-хиназолинил-4)-пиперидил)-алкановInfo
- Publication number
- SU549083A3 SU549083A3 SU1959335A SU1959335A SU549083A3 SU 549083 A3 SU549083 A3 SU 549083A3 SU 1959335 A SU1959335 A SU 1959335A SU 1959335 A SU1959335 A SU 1959335A SU 549083 A3 SU549083 A3 SU 549083A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- bis
- piperidyl
- propane
- quinazolinyl
- mixture
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 9
- -1 6,7-ethylenedioxy Chemical group 0.000 claims description 12
- 239000002253 acid Substances 0.000 claims description 9
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 claims description 8
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 claims description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 150000001875 compounds Chemical class 0.000 claims description 6
- 229910000029 sodium carbonate Inorganic materials 0.000 claims description 4
- 229910052799 carbon Inorganic materials 0.000 claims description 3
- 239000011230 binding agent Substances 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 4
- 125000001424 substituent group Chemical group 0.000 claims 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims 3
- 125000000217 alkyl group Chemical group 0.000 claims 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims 3
- 229910052794 bromium Inorganic materials 0.000 claims 3
- 229910052801 chlorine Inorganic materials 0.000 claims 3
- 239000000460 chlorine Substances 0.000 claims 3
- 125000003545 alkoxy group Chemical group 0.000 claims 2
- 125000004414 alkyl thio group Chemical group 0.000 claims 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims 1
- 229910052731 fluorine Inorganic materials 0.000 claims 1
- 239000011737 fluorine Substances 0.000 claims 1
- 229910052739 hydrogen Inorganic materials 0.000 claims 1
- 239000001257 hydrogen Substances 0.000 claims 1
- 230000003993 interaction Effects 0.000 claims 1
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 1
- 239000001294 propane Substances 0.000 description 32
- 239000000203 mixture Substances 0.000 description 21
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N dimethylmethane Natural products CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 19
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 18
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 16
- 238000000354 decomposition reaction Methods 0.000 description 16
- 239000000155 melt Substances 0.000 description 15
- CQVKMVQRSNNAGO-UHFFFAOYSA-N 2-[4-formyl-3-methyl-n-(2-methylsulfonyloxyethyl)anilino]ethyl methanesulfonate Chemical compound CC1=CC(N(CCOS(C)(=O)=O)CCOS(C)(=O)=O)=CC=C1C=O CQVKMVQRSNNAGO-UHFFFAOYSA-N 0.000 description 13
- 238000002360 preparation method Methods 0.000 description 11
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 10
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- 125000005936 piperidyl group Chemical group 0.000 description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Natural products C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical class Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- FOTPSTARXZXRFU-UHFFFAOYSA-N methyl 6-amino-2,3-dihydro-1,4-benzodioxine-7-carboxylate Chemical compound O1CCOC2=C1C=C(C(=O)OC)C(N)=C2 FOTPSTARXZXRFU-UHFFFAOYSA-N 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- KOSFQWDAKWKNJM-UHFFFAOYSA-N 4-chloro-7,8-dihydro-[1,4]dioxino[2,3-g]quinazoline Chemical compound O1CCOC2=C1C=C1N=CN=C(Cl)C1=C2 KOSFQWDAKWKNJM-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- LJOUDGUKJXHDQH-UHFFFAOYSA-N methyl 6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxylate Chemical compound O1CCOC2=C1C=C(C(=O)OC)C([N+]([O-])=O)=C2 LJOUDGUKJXHDQH-UHFFFAOYSA-N 0.000 description 2
- 150000004702 methyl esters Chemical class 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- PAAZPARNPHGIKF-UHFFFAOYSA-N 1,2-dibromoethane Chemical compound BrCCBr PAAZPARNPHGIKF-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- JWZQJTGQFHIRFQ-UHFFFAOYSA-N 2,3-dihydro-1,4-benzodioxine-6-carboxylic acid Chemical compound O1CCOC2=CC(C(=O)O)=CC=C21 JWZQJTGQFHIRFQ-UHFFFAOYSA-N 0.000 description 1
- DGHKCBSVAZXEPP-UHFFFAOYSA-N 2,4-dichloro-6,7-dimethoxyquinazoline Chemical compound ClC1=NC(Cl)=C2C=C(OC)C(OC)=CC2=N1 DGHKCBSVAZXEPP-UHFFFAOYSA-N 0.000 description 1
- OBDYSGOCSNRPCY-UHFFFAOYSA-N 4,6,7,8-tetramethoxyquinazoline Chemical compound COC1=NC=NC2=C(C(=C(C=C12)OC)OC)OC OBDYSGOCSNRPCY-UHFFFAOYSA-N 0.000 description 1
- KOPFQXSCAPNPHM-UHFFFAOYSA-N 4-benzylsulfanyl-6,7,8-trimethoxyquinazoline Chemical compound COC1=C(OC)C(OC)=C2N=CN=C(SCC3=CC=CC=C3)C2=C1 KOPFQXSCAPNPHM-UHFFFAOYSA-N 0.000 description 1
- LLLHRNQLGUOJHP-UHFFFAOYSA-N 4-chloro-6,7-dimethoxyquinazoline Chemical compound C1=NC(Cl)=C2C=C(OC)C(OC)=CC2=N1 LLLHRNQLGUOJHP-UHFFFAOYSA-N 0.000 description 1
- YBPIZYYGBWSBKO-UHFFFAOYSA-N 5-methyl-2,3-dihydro-1,4-benzodioxine-6-carboxylic acid Chemical compound O1CCOC2=C1C=CC(C(O)=O)=C2C YBPIZYYGBWSBKO-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- SDKJWVJZRKTHDJ-UHFFFAOYSA-N O.O.CS(O)(=O)=O.CS(O)(=O)=O Chemical compound O.O.CS(O)(=O)=O.CS(O)(=O)=O SDKJWVJZRKTHDJ-UHFFFAOYSA-N 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 150000004683 dihydrates Chemical class 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 239000010696 ester oil Substances 0.000 description 1
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 235000011087 fumaric acid Nutrition 0.000 description 1
- QMEZUZOCLYUADC-UHFFFAOYSA-N hydrate;dihydrochloride Chemical compound O.Cl.Cl QMEZUZOCLYUADC-UHFFFAOYSA-N 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 235000011167 hydrochloric acid Nutrition 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- YCTXQIVXFOMZCV-UHFFFAOYSA-N methyl cyclohexa-1,5-diene-1-carboxylate Chemical compound COC(=O)C1=CCCC=C1 YCTXQIVXFOMZCV-UHFFFAOYSA-N 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D491/00—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00
- C07D491/02—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00 in which the condensed system contains two hetero rings
- C07D491/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D319/00—Heterocyclic compounds containing six-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D319/10—1,4-Dioxanes; Hydrogenated 1,4-dioxanes
- C07D319/14—1,4-Dioxanes; Hydrogenated 1,4-dioxanes condensed with carbocyclic rings or ring systems
- C07D319/16—1,4-Dioxanes; Hydrogenated 1,4-dioxanes condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D319/18—Ethylenedioxybenzenes, not substituted on the hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Quinoline Compounds (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US29165272A | 1972-09-25 | 1972-09-25 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU549083A3 true SU549083A3 (ru) | 1977-02-28 |
Family
ID=23121213
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1959335A SU549083A3 (ru) | 1972-09-25 | 1973-09-24 | Способ получени производных бис(4-(1-хиназолинил-4)-пиперидил)-алканов |
Country Status (14)
| Country | Link |
|---|---|
| JP (1) | JPS4969684A (enExample) |
| AT (1) | ATA818273A (enExample) |
| BE (1) | BE805231A (enExample) |
| CA (1) | CA998672A (enExample) |
| CH (1) | CH583225A5 (enExample) |
| DD (1) | DD107043A5 (enExample) |
| DE (1) | DE2347376A1 (enExample) |
| DK (1) | DK132082C (enExample) |
| ES (1) | ES419026A1 (enExample) |
| FR (1) | FR2200008B1 (enExample) |
| GB (1) | GB1438405A (enExample) |
| HU (1) | HU167666B (enExample) |
| NL (1) | NL7312956A (enExample) |
| SU (1) | SU549083A3 (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB8312665D0 (en) * | 1983-05-09 | 1983-06-15 | Ici Plc | 4,4'-alkylenedipiperidine derivatives |
| JPH09165385A (ja) * | 1994-08-26 | 1997-06-24 | Kyowa Hakko Kogyo Co Ltd | キナゾリン誘導体 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1199768A (en) * | 1966-10-31 | 1970-07-22 | Pfizer & Co C | Nitrogen Heterocycles and process for their preparation |
-
1973
- 1973-09-14 CH CH1327973A patent/CH583225A5/xx not_active IP Right Cessation
- 1973-09-17 DK DK508473A patent/DK132082C/da active
- 1973-09-20 GB GB4411473A patent/GB1438405A/en not_active Expired
- 1973-09-20 NL NL7312956A patent/NL7312956A/xx not_active Application Discontinuation
- 1973-09-20 HU HUSA002535 patent/HU167666B/hu unknown
- 1973-09-20 DE DE19732347376 patent/DE2347376A1/de active Pending
- 1973-09-21 JP JP10605373A patent/JPS4969684A/ja active Pending
- 1973-09-21 DD DD17361473A patent/DD107043A5/xx unknown
- 1973-09-24 AT AT818273A patent/ATA818273A/de not_active Application Discontinuation
- 1973-09-24 BE BE135972A patent/BE805231A/xx unknown
- 1973-09-24 ES ES419026A patent/ES419026A1/es not_active Expired
- 1973-09-24 SU SU1959335A patent/SU549083A3/ru active
- 1973-09-24 CA CA181,758A patent/CA998672A/en not_active Expired
- 1973-09-25 FR FR7334349A patent/FR2200008B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DK132082C (da) | 1976-03-15 |
| GB1438405A (en) | 1976-06-09 |
| BE805231A (fr) | 1974-03-25 |
| DK132082B (da) | 1975-10-20 |
| CA998672A (en) | 1976-10-19 |
| JPS4969684A (enExample) | 1974-07-05 |
| FR2200008B1 (enExample) | 1977-01-28 |
| AU6063973A (en) | 1975-03-27 |
| ATA818273A (de) | 1977-12-15 |
| CH583225A5 (enExample) | 1976-12-31 |
| HU167666B (enExample) | 1975-11-28 |
| NL7312956A (enExample) | 1974-03-27 |
| DD107043A5 (enExample) | 1974-07-12 |
| DE2347376A1 (de) | 1974-04-04 |
| FR2200008A1 (enExample) | 1974-04-19 |
| ES419026A1 (es) | 1976-07-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP3163281B2 (ja) | 療法において有用なキノリンおよびキナゾリン | |
| Althuis et al. | Development of ethyl 3, 4-dihydro-4-oxopyrimido [4, 5-b] quinoline-2-carboxylate, a new prototype with oral antiallergy activity | |
| PT726899E (pt) | Novos derivados de pirazinocarboxamida sua preparacao e sua utilizacao em medicamentos | |
| EP2045243A1 (en) | Tetrahydro isoquinoline derivatives, preparation methods and medicinal uses thereof | |
| NO151287B (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive 9-hydrazono-6,7,8,9-tetrahydro-4h-pyrido(1,2-a)-pyrimidinderivater | |
| WO2003066602A1 (en) | Process for producing 4-aminoquinazoline compound | |
| SU549083A3 (ru) | Способ получени производных бис(4-(1-хиназолинил-4)-пиперидил)-алканов | |
| US4841051A (en) | Phenylpiperazine derivatives | |
| US4124587A (en) | 4-Hydroxy-3-sulfinyl-quinolin-2(1H)-ones | |
| US4127574A (en) | 4-Hydroxy-3-sulfonyl-quinolin-2(1H)-ones | |
| US4183932A (en) | Fused quinazolinones and preparation thereof | |
| KR100272471B1 (ko) | 신규의 피리미딘 유도체 및 그의 제조방법 | |
| FI73673C (fi) | Foerfarande foer framstaellning av farmakologiskt vaerdefulla 1,5-difenylpyrazolin-3-on-foereningar. | |
| NO140012B (no) | Analogifremgangsmaate for fremstilling av nye terapeutisk aktive derivater av naftyridin | |
| CN104586842A (zh) | 一种抗癌活性吲哚衍生物、合成方法及其用途 | |
| US4192876A (en) | 4-Hydroxy-3-nitro-quinoline-2(1H)-ones | |
| US6680326B2 (en) | Polycyclic compounds | |
| US4011323A (en) | Bi-4-[1-(quinazolinyl-4)piperidyls] and bis{4-[1-(quinazolinyl-4)piperidyl]alkanes} | |
| US3790581A (en) | N-(1-(3-cyano-3,3-bis(optionally substituted phenyl)propyl)-4-phenylpiperidine-4-carbonyloxy)succinimides | |
| US3983126A (en) | Aryloxy pyridine carboxylic-4-acids | |
| US4347362A (en) | 1-Alkyl-4-amino-3-(3-aminotriazolo)-1,8 naphthyridine-2-ones | |
| CN115611901B (zh) | 一种氮杂䓬类化合物或其药学上可接受的盐及其制备方法和应用 | |
| KR100187475B1 (ko) | 1-아릴-4-옥소 피롤로(3,2-c)퀴놀린 유도체의 제조방법 | |
| US4124588A (en) | 4-Hydroxy-quinolin-2-one-3-phosphonic acid esters | |
| DK141626B (da) | Fremgangsmåde til fremstilling af quinazoliner. |