SU545242A3 - Гербицидное средство - Google Patents
Гербицидное средствоInfo
- Publication number
- SU545242A3 SU545242A3 SU2102625A SU2102625A SU545242A3 SU 545242 A3 SU545242 A3 SU 545242A3 SU 2102625 A SU2102625 A SU 2102625A SU 2102625 A SU2102625 A SU 2102625A SU 545242 A3 SU545242 A3 SU 545242A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- diphenyl
- dimethyl
- phenyl
- pyrazolium
- herbicidal
- Prior art date
Links
- 230000002363 herbicidal effect Effects 0.000 title claims description 8
- 239000004009 herbicide Substances 0.000 title claims 3
- 239000004480 active ingredient Substances 0.000 claims description 4
- -1 inorganic acid anion Chemical class 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims 3
- 125000001475 halogen functional group Chemical group 0.000 claims 2
- 239000013543 active substance Substances 0.000 claims 1
- 125000003545 alkoxy group Chemical group 0.000 claims 1
- 125000000217 alkyl group Chemical group 0.000 claims 1
- 239000003795 chemical substances by application Substances 0.000 claims 1
- 229910052736 halogen Inorganic materials 0.000 claims 1
- 150000002367 halogens Chemical class 0.000 claims 1
- 150000002431 hydrogen Chemical class 0.000 claims 1
- 229910052739 hydrogen Inorganic materials 0.000 claims 1
- 239000001257 hydrogen Substances 0.000 claims 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims 1
- 150000003839 salts Chemical class 0.000 claims 1
- 241000196324 Embryophyta Species 0.000 description 8
- 150000001875 compounds Chemical class 0.000 description 3
- WBCZYGZZXCPBAO-UHFFFAOYSA-M 1,2-dimethyl-3,4-diphenylpyrazol-1-ium methyl sulfate Chemical compound S(=O)(=O)(OC)[O-].C[N+]=1N(C(=C(C1)C1=CC=CC=C1)C1=CC=CC=C1)C WBCZYGZZXCPBAO-UHFFFAOYSA-M 0.000 description 2
- 230000006378 damage Effects 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- XQEMNBNCQVQXMO-UHFFFAOYSA-M 1,2-dimethyl-3,5-diphenylpyrazol-1-ium;methyl sulfate Chemical compound COS([O-])(=O)=O.C[N+]=1N(C)C(C=2C=CC=CC=2)=CC=1C1=CC=CC=C1 XQEMNBNCQVQXMO-UHFFFAOYSA-M 0.000 description 1
- FXXPARXNESALDE-UHFFFAOYSA-N 4-bromo-1,2-dimethyl-3,5-diphenyl-3H-pyrazole Chemical compound CN1N(C)C(C=2C=CC=CC=2)C(Br)=C1C1=CC=CC=C1 FXXPARXNESALDE-UHFFFAOYSA-N 0.000 description 1
- ZPISZXWVXQOXPI-UHFFFAOYSA-M 4-bromo-1,2-dimethyl-3,5-diphenylpyrazol-2-ium perchlorate Chemical compound Cl(=O)(=O)(=O)[O-].C[N+]=1N(C(=C(C1C1=CC=CC=C1)Br)C1=CC=CC=C1)C ZPISZXWVXQOXPI-UHFFFAOYSA-M 0.000 description 1
- OHRGUJAZEAVCGX-UHFFFAOYSA-M 4-methoxy-1,2-dimethyl-3,5-diphenylpyrazol-2-ium;methyl sulfate Chemical compound COS([O-])(=O)=O.CN1[N+](C)=C(C=2C=CC=CC=2)C(OC)=C1C1=CC=CC=C1 OHRGUJAZEAVCGX-UHFFFAOYSA-M 0.000 description 1
- 235000007320 Avena fatua Nutrition 0.000 description 1
- 244000075850 Avena orientalis Species 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- 235000005373 Uvularia sessilifolia Nutrition 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 230000031018 biological processes and functions Effects 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- RCFITSMZCAIEOV-UHFFFAOYSA-M methyl sulfate;1,2,4-trimethyl-3,5-diphenylpyrazol-1-ium Chemical compound COS([O-])(=O)=O.CN1[N+](C)=C(C=2C=CC=CC=2)C(C)=C1C1=CC=CC=C1 RCFITSMZCAIEOV-UHFFFAOYSA-M 0.000 description 1
- CTFFRAYOKVDFFL-UHFFFAOYSA-M methyl sulfate;3,4,5-tribromo-1,2-dimethylpyrazol-1-ium Chemical compound COS([O-])(=O)=O.CN1C(Br)=C(Br)C(Br)=[N+]1C CTFFRAYOKVDFFL-UHFFFAOYSA-M 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/14—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D231/18—One oxygen or sulfur atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/14—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D231/16—Halogen atoms or nitro radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2404795A DE2404795C2 (de) | 1974-02-01 | 1974-02-01 | 1,2-Dimethyl-3,5-diphenyl-pyrazoliumsalze und deren Verwendung als Herbizid |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU545242A3 true SU545242A3 (ru) | 1977-01-30 |
Family
ID=5906314
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU2102625A SU545242A3 (ru) | 1974-02-01 | 1975-01-30 | Гербицидное средство |
Country Status (23)
| Country | Link |
|---|---|
| JP (1) | JPS5826323B2 (esLanguage) |
| AT (1) | AT340197B (esLanguage) |
| BE (1) | BE825071A (esLanguage) |
| BR (1) | BR7500579A (esLanguage) |
| CA (1) | CA1078394A (esLanguage) |
| CH (1) | CH613605A5 (esLanguage) |
| CS (1) | CS185671B2 (esLanguage) |
| DD (1) | DD117335A5 (esLanguage) |
| DE (1) | DE2404795C2 (esLanguage) |
| DK (1) | DK137423C (esLanguage) |
| ES (1) | ES434312A1 (esLanguage) |
| FR (1) | FR2259828B1 (esLanguage) |
| GB (1) | GB1486984A (esLanguage) |
| HU (1) | HU171225B (esLanguage) |
| IL (1) | IL46490A (esLanguage) |
| IT (1) | IT1044116B (esLanguage) |
| LU (1) | LU71764A1 (esLanguage) |
| NL (1) | NL180008C (esLanguage) |
| NO (1) | NO750266L (esLanguage) |
| PL (1) | PL96751B1 (esLanguage) |
| SE (1) | SE7501113L (esLanguage) |
| SU (1) | SU545242A3 (esLanguage) |
| ZA (1) | ZA75654B (esLanguage) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3963742A (en) | 1974-07-12 | 1976-06-15 | American Cyanamid Company | 1,2-Dialkyl-3,4,5-trisubstituted pyrazolium salts as herbicidal agents |
| US3963741A (en) * | 1975-05-02 | 1976-06-15 | American Cyanamid Company | 4-Alkyl-1,2-dimethyl-3,5-diphenylpyrazolium salts and derivatives thereof as fungicidal agents |
| IL49410A (en) * | 1975-05-02 | 1980-06-30 | American Cyanamid Co | Methods for control of undesirable plant species comprising the use of 3,5-diphenyl pyrazolinium derivatives,certain such derivatives,their preparation and their additional use as fungicides |
| US4041046A (en) | 1975-06-06 | 1977-08-09 | American Cyanamid Company | 1,2-Dialkyl-3,4,5-trisubstituted pyrazole compounds |
| DE2747531A1 (de) * | 1977-10-22 | 1979-04-26 | Basf Ag | Substituierte 3-aminopyrazole |
| JPS61197954U (esLanguage) * | 1985-05-29 | 1986-12-10 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3158620A (en) * | 1962-06-12 | 1964-11-24 | American Cyanamid Co | Pyrazole compounds and process therefor |
| BE792801A (fr) * | 1971-12-17 | 1973-06-15 | American Cyanamid Co | Nouvelles compositions herbicides |
| DE2260485C2 (de) * | 1971-12-17 | 1983-12-29 | American Cyanamid Co., Wayne, N.J. | 1,2-Dialkyl-3,5-diphenylpyrazoliumsalze und diese enthaltende herbizide Mittel |
| FR2179559A1 (en) * | 1972-04-12 | 1973-11-23 | Cetrane Laboratoire | Antiglycemiant compsns - contg 1,2-dialkyl-3-or4-aryl-3-pyrazolines |
-
1974
- 1974-02-01 DE DE2404795A patent/DE2404795C2/de not_active Expired
-
1975
- 1975-01-17 JP JP50007177A patent/JPS5826323B2/ja not_active Expired
- 1975-01-22 IL IL46490A patent/IL46490A/xx unknown
- 1975-01-28 CA CA218,846A patent/CA1078394A/en not_active Expired
- 1975-01-29 FR FR7502715A patent/FR2259828B1/fr not_active Expired
- 1975-01-29 NL NLAANVRAGE7501049,A patent/NL180008C/xx not_active IP Right Cessation
- 1975-01-29 CS CS7500000583A patent/CS185671B2/cs unknown
- 1975-01-29 BR BR579/75A patent/BR7500579A/pt unknown
- 1975-01-29 NO NO750266A patent/NO750266L/no unknown
- 1975-01-30 SU SU2102625A patent/SU545242A3/ru active
- 1975-01-30 CH CH108575A patent/CH613605A5/xx not_active IP Right Cessation
- 1975-01-30 HU HU75BA00003198A patent/HU171225B/hu unknown
- 1975-01-30 LU LU71764A patent/LU71764A1/xx unknown
- 1975-01-31 AT AT71875A patent/AT340197B/de not_active IP Right Cessation
- 1975-01-31 BE BE152959A patent/BE825071A/xx not_active IP Right Cessation
- 1975-01-31 GB GB4266/75A patent/GB1486984A/en not_active Expired
- 1975-01-31 ZA ZA00750654A patent/ZA75654B/xx unknown
- 1975-01-31 DK DK33575A patent/DK137423C/da not_active IP Right Cessation
- 1975-01-31 SE SE7501113A patent/SE7501113L/xx unknown
- 1975-01-31 PL PL1975177717A patent/PL96751B1/pl unknown
- 1975-01-31 ES ES434312A patent/ES434312A1/es not_active Expired
- 1975-02-03 DD DD183972A patent/DD117335A5/xx unknown
- 1975-10-23 IT IT47953/75A patent/IT1044116B/it active
Also Published As
| Publication number | Publication date |
|---|---|
| GB1486984A (en) | 1977-09-28 |
| CS185671B2 (en) | 1978-10-31 |
| IL46490A (en) | 1978-09-29 |
| HU171225B (hu) | 1977-12-28 |
| NO750266L (esLanguage) | 1975-08-25 |
| IL46490A0 (en) | 1975-04-25 |
| DK33575A (esLanguage) | 1975-10-06 |
| ZA75654B (en) | 1976-02-25 |
| AT340197B (de) | 1977-11-25 |
| NL7501049A (nl) | 1975-08-05 |
| CH613605A5 (en) | 1979-10-15 |
| DD117335A5 (esLanguage) | 1976-01-12 |
| NL180008B (nl) | 1986-07-16 |
| FR2259828A1 (esLanguage) | 1975-08-29 |
| BR7500579A (pt) | 1975-11-18 |
| BE825071A (fr) | 1975-07-31 |
| LU71764A1 (esLanguage) | 1975-06-24 |
| CA1078394A (en) | 1980-05-27 |
| DE2404795C2 (de) | 1983-03-24 |
| DK137423C (da) | 1978-08-14 |
| SE7501113L (esLanguage) | 1975-08-04 |
| AU7760775A (en) | 1976-07-29 |
| IT1044116B (it) | 1980-03-20 |
| ES434312A1 (es) | 1976-11-16 |
| JPS5826323B2 (ja) | 1983-06-02 |
| FR2259828B1 (esLanguage) | 1979-05-25 |
| PL96751B1 (pl) | 1978-01-31 |
| JPS50116642A (esLanguage) | 1975-09-12 |
| DK137423B (da) | 1978-03-06 |
| NL180008C (nl) | 1986-12-16 |
| ATA71875A (de) | 1977-03-15 |
| DE2404795A1 (de) | 1975-08-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU654145A3 (ru) | Способ борьбы с грибками | |
| JPS62175441A (ja) | アクリル酸エステル及び該化合物を含有する殺菌剤 | |
| GB1173753A (en) | Novel m-(Carbamoyloxy) Compounds | |
| FR2356424A1 (fr) | Compositions pharmaceutiques a base d'acide phophono-formique utiles pour lutter contre les infections virales | |
| GR3004114T3 (esLanguage) | ||
| KR100192717B1 (ko) | 상승작용성 제초 조성물 | |
| SU545242A3 (ru) | Гербицидное средство | |
| US3412149A (en) | Phenyl-mercaptomethane-sulfonamide | |
| GB1274578A (en) | Agents for the regulation of plant growth | |
| SU708977A3 (ru) | Гербицидное средство | |
| SU523626A3 (ru) | Гербицидный состав | |
| SU552010A3 (ru) | Гербицидное средство | |
| SU673135A3 (ru) | Гербицидный состав | |
| CS233739B2 (en) | Fungicide agent and processing of effective component | |
| SU651640A3 (ru) | Гирбицидна композици | |
| US3862330A (en) | N-(c{hd 8{b -c{hd 12 {b alkyl) diaralkylamines used to combat plant fungi | |
| SU540551A3 (ru) | Гербицидный состав | |
| SU576893A3 (ru) | Способ борьбы с сорн ками | |
| SU503483A3 (ru) | Гербицидна смесь | |
| JPS5735515A (en) | Immunoregulating agent | |
| SU589884A3 (ru) | Гербицидный состав | |
| SU579845A3 (ru) | Гербицидное средство | |
| US4256482A (en) | Herbicidal composition | |
| SU576892A3 (ru) | Гербицидный состав | |
| SU843696A3 (ru) | Гербицидный состав |