SU505370A3 - Способ получени сополимеров изобутилена - Google Patents
Способ получени сополимеров изобутиленаInfo
- Publication number
- SU505370A3 SU505370A3 SU1847810A SU1847810A SU505370A3 SU 505370 A3 SU505370 A3 SU 505370A3 SU 1847810 A SU1847810 A SU 1847810A SU 1847810 A SU1847810 A SU 1847810A SU 505370 A3 SU505370 A3 SU 505370A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- weight
- mmol
- cocatalyst
- experiment
- polymer
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title claims description 7
- 229920001577 copolymer Polymers 0.000 title claims description 4
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 claims description 20
- 229920000642 polymer Polymers 0.000 claims description 20
- 238000000034 method Methods 0.000 claims description 12
- 238000002474 experimental method Methods 0.000 claims description 10
- 229920005549 butyl rubber Polymers 0.000 claims description 7
- 239000003054 catalyst Substances 0.000 claims description 7
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 claims description 7
- 239000002904 solvent Substances 0.000 claims description 7
- 238000007334 copolymerization reaction Methods 0.000 claims description 6
- 239000011541 reaction mixture Substances 0.000 claims description 5
- 239000010936 titanium Substances 0.000 claims description 5
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 claims description 4
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 claims description 4
- 230000003197 catalytic effect Effects 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 229940050176 methyl chloride Drugs 0.000 claims description 4
- 238000006116 polymerization reaction Methods 0.000 claims description 4
- 239000004215 Carbon black (E152) Substances 0.000 claims description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 3
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 3
- 229910052782 aluminium Inorganic materials 0.000 claims description 3
- 150000001875 compounds Chemical class 0.000 claims description 3
- 229930195733 hydrocarbon Natural products 0.000 claims description 3
- 150000002430 hydrocarbons Chemical group 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- 229910052717 sulfur Inorganic materials 0.000 claims description 3
- 239000011593 sulfur Substances 0.000 claims description 3
- 229910052725 zinc Inorganic materials 0.000 claims description 3
- 239000011701 zinc Substances 0.000 claims description 3
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical group [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 claims description 2
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims description 2
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 2
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 2
- 150000001408 amides Chemical class 0.000 claims description 2
- 229910052787 antimony Inorganic materials 0.000 claims description 2
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 229910052797 bismuth Inorganic materials 0.000 claims description 2
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 claims description 2
- 229910052796 boron Inorganic materials 0.000 claims description 2
- 150000002148 esters Chemical class 0.000 claims description 2
- 125000000524 functional group Chemical group 0.000 claims description 2
- 229910052732 germanium Inorganic materials 0.000 claims description 2
- GNPVGFCGXDBREM-UHFFFAOYSA-N germanium atom Chemical compound [Ge] GNPVGFCGXDBREM-UHFFFAOYSA-N 0.000 claims description 2
- 239000001257 hydrogen Chemical group 0.000 claims description 2
- 229910052739 hydrogen Chemical group 0.000 claims description 2
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 claims description 2
- 229910052753 mercury Inorganic materials 0.000 claims description 2
- 229910052750 molybdenum Inorganic materials 0.000 claims description 2
- 239000011733 molybdenum Substances 0.000 claims description 2
- 229910000073 phosphorus hydride Inorganic materials 0.000 claims description 2
- 229910052718 tin Inorganic materials 0.000 claims description 2
- 239000011135 tin Substances 0.000 claims description 2
- 229910052719 titanium Inorganic materials 0.000 claims description 2
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 claims description 2
- 229910052721 tungsten Inorganic materials 0.000 claims description 2
- 239000010937 tungsten Substances 0.000 claims description 2
- 229910052720 vanadium Inorganic materials 0.000 claims description 2
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 claims description 2
- 229910052726 zirconium Inorganic materials 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims 2
- 125000005595 acetylacetonate group Chemical group 0.000 claims 1
- 230000015572 biosynthetic process Effects 0.000 claims 1
- 230000009193 crawling Effects 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 description 6
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 239000000178 monomer Substances 0.000 description 3
- 238000004073 vulcanization Methods 0.000 description 3
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 150000002367 halogens Chemical group 0.000 description 2
- QWTDNUCVQCZILF-UHFFFAOYSA-N isopentane Chemical compound CCC(C)C QWTDNUCVQCZILF-UHFFFAOYSA-N 0.000 description 2
- 239000012429 reaction media Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- BSPCSKHALVHRSR-UHFFFAOYSA-N 2-chlorobutane Chemical compound CCC(C)Cl BSPCSKHALVHRSR-UHFFFAOYSA-N 0.000 description 1
- DFWCPLGXFMSUCW-UHFFFAOYSA-N 3-(dimethylamino)propyl carbamimidothioate;hydron;dichloride Chemical compound Cl.Cl.CN(C)CCCSC(N)=N DFWCPLGXFMSUCW-UHFFFAOYSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- YRKCREAYFQTBPV-UHFFFAOYSA-N acetylacetone Chemical group CC(=O)CC(C)=O YRKCREAYFQTBPV-UHFFFAOYSA-N 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 230000003078 antioxidant effect Effects 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 229910052785 arsenic Inorganic materials 0.000 description 1
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 1
- AFZSMODLJJCVPP-UHFFFAOYSA-N dibenzothiazol-2-yl disulfide Chemical compound C1=CC=C2SC(SSC=3SC4=CC=CC=C4N=3)=NC2=C1 AFZSMODLJJCVPP-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- AFABGHUZZDYHJO-UHFFFAOYSA-N dimethyl butane Natural products CCCC(C)C AFABGHUZZDYHJO-UHFFFAOYSA-N 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 229960003750 ethyl chloride Drugs 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 229940073584 methylene chloride Drugs 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- -1 organometallic aluminum compound Chemical class 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000011949 solid catalyst Substances 0.000 description 1
- 239000004071 soot Substances 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- WIDQNNDDTXUPAN-UHFFFAOYSA-I tungsten(v) chloride Chemical compound Cl[W](Cl)(Cl)(Cl)Cl WIDQNNDDTXUPAN-UHFFFAOYSA-I 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F10/00—Homopolymers and copolymers of unsaturated aliphatic hydrocarbons having only one carbon-to-carbon double bond
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Polymerization Catalysts (AREA)
- Transition And Organic Metals Composition Catalysts For Addition Polymerization (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT31725/71A IT946101B (it) | 1971-11-26 | 1971-11-26 | Procedimento per la produzione di polimeri e copolimeri dell isobu tilene |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU505370A3 true SU505370A3 (ru) | 1976-02-28 |
Family
ID=11234273
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1847810A SU505370A3 (ru) | 1971-11-26 | 1972-11-22 | Способ получени сополимеров изобутилена |
Country Status (20)
| Country | Link |
|---|---|
| JP (1) | JPS5336511B2 (enExample) |
| AT (1) | AT318234B (enExample) |
| BE (1) | BE791406A (enExample) |
| CA (1) | CA994949A (enExample) |
| CH (1) | CH562268A5 (enExample) |
| CS (1) | CS181228B2 (enExample) |
| DD (1) | DD103008A5 (enExample) |
| DE (1) | DE2257480C3 (enExample) |
| ES (1) | ES409025A1 (enExample) |
| FR (1) | FR2160850B1 (enExample) |
| GB (1) | GB1407418A (enExample) |
| HU (1) | HU167046B (enExample) |
| IT (1) | IT946101B (enExample) |
| LU (1) | LU66534A1 (enExample) |
| NL (1) | NL153889B (enExample) |
| PL (1) | PL91689B1 (enExample) |
| RO (1) | RO63619A (enExample) |
| SU (1) | SU505370A3 (enExample) |
| TR (1) | TR17238A (enExample) |
| ZA (1) | ZA727775B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2685409C2 (ru) * | 2014-11-25 | 2019-04-18 | ВЕРСАЛИС С.п.А. | Фосфиновый комплекс ванадия, каталитическая система, содержащая указанный фосфиновый комплекс ванадия, и способ (со)полимеризации сопряженных диенов |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0472741B1 (en) * | 1990-03-16 | 1995-06-21 | Tonen Corporation | Olefin polymerization catalyst |
| NL1004004C2 (nl) * | 1996-09-11 | 1998-03-12 | Dsm Nv | Werkwijze voor de polymerisatie van 2-gesubstitueerde 1-alkenen. |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL95675C (enExample) * | 1955-07-11 |
-
0
- BE BE791406D patent/BE791406A/xx unknown
-
1971
- 1971-11-26 IT IT31725/71A patent/IT946101B/it active
-
1972
- 1972-10-27 CS CS7200007256A patent/CS181228B2/cs unknown
- 1972-11-01 ZA ZA727775A patent/ZA727775B/xx unknown
- 1972-11-14 FR FR7240269A patent/FR2160850B1/fr not_active Expired
- 1972-11-20 RO RO7200072863A patent/RO63619A/ro unknown
- 1972-11-20 CH CH1684472A patent/CH562268A5/xx not_active IP Right Cessation
- 1972-11-20 ES ES409025A patent/ES409025A1/es not_active Expired
- 1972-11-21 TR TR17238A patent/TR17238A/xx unknown
- 1972-11-22 SU SU1847810A patent/SU505370A3/ru active
- 1972-11-23 DE DE2257480A patent/DE2257480C3/de not_active Expired
- 1972-11-24 PL PL1972159065A patent/PL91689B1/pl unknown
- 1972-11-24 AT AT1005672A patent/AT318234B/de not_active IP Right Cessation
- 1972-11-24 DD DD167135A patent/DD103008A5/xx unknown
- 1972-11-24 NL NL727215941A patent/NL153889B/xx unknown
- 1972-11-24 HU HUSA2428A patent/HU167046B/hu unknown
- 1972-11-24 LU LU66534A patent/LU66534A1/xx unknown
- 1972-11-24 GB GB5452772A patent/GB1407418A/en not_active Expired
- 1972-11-27 CA CA157,683A patent/CA994949A/en not_active Expired
- 1972-11-27 JP JP11813172A patent/JPS5336511B2/ja not_active Expired
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2685409C2 (ru) * | 2014-11-25 | 2019-04-18 | ВЕРСАЛИС С.п.А. | Фосфиновый комплекс ванадия, каталитическая система, содержащая указанный фосфиновый комплекс ванадия, и способ (со)полимеризации сопряженных диенов |
Also Published As
| Publication number | Publication date |
|---|---|
| AT318234B (de) | 1974-10-10 |
| ZA727775B (en) | 1973-07-25 |
| TR17238A (tr) | 1976-08-03 |
| GB1407418A (en) | 1975-09-24 |
| BE791406A (fr) | 1973-03-01 |
| AU4788272A (en) | 1974-04-26 |
| JPS5336511B2 (enExample) | 1978-10-03 |
| RO63619A (fr) | 1978-08-15 |
| ES409025A1 (es) | 1975-10-16 |
| HU167046B (enExample) | 1975-07-28 |
| LU66534A1 (enExample) | 1973-02-01 |
| CS181228B2 (en) | 1978-03-31 |
| CH562268A5 (enExample) | 1975-05-30 |
| CA994949A (en) | 1976-08-10 |
| DD103008A5 (enExample) | 1974-01-05 |
| JPS4864174A (enExample) | 1973-09-05 |
| DE2257480B2 (de) | 1978-07-20 |
| PL91689B1 (enExample) | 1977-03-31 |
| IT946101B (it) | 1973-05-21 |
| FR2160850B1 (enExample) | 1976-04-23 |
| NL153889B (nl) | 1977-07-15 |
| DE2257480C3 (de) | 1979-03-15 |
| DE2257480A1 (de) | 1973-05-30 |
| NL7215941A (enExample) | 1973-05-29 |
| FR2160850A1 (enExample) | 1973-07-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US6444768B1 (en) | Production of polyisobutylene copolymers | |
| US2920062A (en) | Process for the polymerization of alpha-olefins | |
| US3328372A (en) | Soluble high molecular weight polymers of cyclopentadiene | |
| US4105585A (en) | Polymerization catalyst | |
| US3926925A (en) | Novel polymers of olefins and polar monomers | |
| US3549607A (en) | High cis polypentenamers | |
| US20060014910A1 (en) | Synthesis method for polydimethylketene by friedel - craft cationic polymerization of dimethylketene | |
| US3457244A (en) | Process for preparing a polymer | |
| SU505370A3 (ru) | Способ получени сополимеров изобутилена | |
| CA2493729A1 (en) | Process for polymerizing cationically polymerizable monomers | |
| US3326870A (en) | Copolymers of olefins and acrylonitrile and a process for producing the same | |
| EP0400844A1 (en) | Process for the manufacture of new polymers containing chains derived from a polybutene | |
| US4031300A (en) | High molecular weight, high unsaturation isobutylene-cyclopentadiene copolymers | |
| US3088940A (en) | Hompolymerization of acrylonitrile with catalyst compositions comprising organo tin hydride and metal halide complexes | |
| US3378539A (en) | Process and catalyst for production of solid polymers | |
| US3887531A (en) | Interpolymers of 5,8-dimethyl-1,4,9-decatriene and/or 4,8-dimethyl-1,4,9-decatriene with at least one alphaolefin containing 2 to 6 carbon atoms | |
| US3527739A (en) | Vulcanizable copolymers of ethylene,higher alpha-olefins and a 5-alkadienyl-2-norbornene,and process for producing same | |
| US3313787A (en) | Unsaturated hydrocarbon copolymers comprising at least one alpha-olefin and an alkenyl substituted acetylene and process for preparing same | |
| PL93286B1 (enExample) | ||
| WO2000020474A1 (en) | Random isomonoolefin/allyl styrene copolymers and functionalized derivatives thereof | |
| US3781259A (en) | Polymerization of acenaphthylene and indene | |
| US3470142A (en) | Terpolymers of ethylene,higher alpha-olefins and cycloalkadienonorbornenes | |
| US3686155A (en) | Novel process for copolymerization of alpha olefins and ethylene | |
| US3702840A (en) | Reduction of polymer build-up in ethylene copolymerization | |
| US3631007A (en) | Removal of vanadium residues from ethylene copolymers |