SU490291A3 - Способ получени незамещенного или замещенного ангидрида изатиновой кислоты - Google Patents
Способ получени незамещенного или замещенного ангидрида изатиновой кислотыInfo
- Publication number
- SU490291A3 SU490291A3 SU1972600A SU1972600A SU490291A3 SU 490291 A3 SU490291 A3 SU 490291A3 SU 1972600 A SU1972600 A SU 1972600A SU 1972600 A SU1972600 A SU 1972600A SU 490291 A3 SU490291 A3 SU 490291A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- vol
- acid
- solution
- residue
- sodium
- Prior art date
Links
- 150000008064 anhydrides Chemical class 0.000 title description 5
- 238000000034 method Methods 0.000 title description 4
- 239000000243 solution Substances 0.000 description 24
- 239000000203 mixture Substances 0.000 description 22
- 239000002253 acid Substances 0.000 description 17
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 13
- 239000003054 catalyst Substances 0.000 description 12
- 229910052708 sodium Inorganic materials 0.000 description 12
- 239000011734 sodium Substances 0.000 description 12
- 229910052801 chlorine Inorganic materials 0.000 description 11
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 10
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 10
- 239000000460 chlorine Substances 0.000 description 10
- -1 phthalamide salt Chemical class 0.000 description 10
- 125000004432 carbon atom Chemical group C* 0.000 description 9
- 125000000217 alkyl group Chemical group 0.000 description 8
- 239000007864 aqueous solution Substances 0.000 description 8
- 238000006116 polymerization reaction Methods 0.000 description 8
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 8
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 7
- 125000001931 aliphatic group Chemical group 0.000 description 6
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 6
- 229910052794 bromium Inorganic materials 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- WQYVRQLZKVEZGA-UHFFFAOYSA-N hypochlorite Chemical compound Cl[O-] WQYVRQLZKVEZGA-UHFFFAOYSA-N 0.000 description 6
- 125000004433 nitrogen atom Chemical group N* 0.000 description 6
- 229910052783 alkali metal Inorganic materials 0.000 description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 5
- 239000003112 inhibitor Substances 0.000 description 5
- 150000003839 salts Chemical class 0.000 description 5
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Inorganic materials [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 5
- NVBFHJWHLNUMCV-UHFFFAOYSA-N sulfamide Chemical compound NS(N)(=O)=O NVBFHJWHLNUMCV-UHFFFAOYSA-N 0.000 description 5
- MZLKHPDPHGHSOY-UHFFFAOYSA-N (2,3-dioxoindole-1-carbonyl) 2,3-dioxoindole-1-carboxylate Chemical compound O=C1C(=O)C2=CC=CC=C2N1C(=O)OC(=O)N1C2=CC=CC=C2C(=O)C1=O MZLKHPDPHGHSOY-UHFFFAOYSA-N 0.000 description 4
- LGRFSURHDFAFJT-UHFFFAOYSA-N Phthalic anhydride Natural products C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 4
- 239000003513 alkali Substances 0.000 description 4
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical compound CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 4
- JGJLWPGRMCADHB-UHFFFAOYSA-N hypobromite Chemical compound Br[O-] JGJLWPGRMCADHB-UHFFFAOYSA-N 0.000 description 4
- NAYYNDKKHOIIOD-UHFFFAOYSA-N phthalamide Chemical class NC(=O)C1=CC=CC=C1C(N)=O NAYYNDKKHOIIOD-UHFFFAOYSA-N 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- CYMRPDYINXWJFU-UHFFFAOYSA-N 2-carbamoylbenzoic acid Chemical compound NC(=O)C1=CC=CC=C1C(O)=O CYMRPDYINXWJFU-UHFFFAOYSA-N 0.000 description 3
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 3
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 3
- 235000011114 ammonium hydroxide Nutrition 0.000 description 3
- 125000000623 heterocyclic group Chemical group 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 3
- 235000019345 sodium thiosulphate Nutrition 0.000 description 3
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 3
- GVTLFGJNTIRUEG-ZHACJKMWSA-N (e)-n-(3-methoxyphenyl)-3-phenylprop-2-enamide Chemical compound COC1=CC=CC(NC(=O)\C=C\C=2C=CC=CC=2)=C1 GVTLFGJNTIRUEG-ZHACJKMWSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- FZERHIULMFGESH-UHFFFAOYSA-N N-phenylacetamide Chemical compound CC(=O)NC1=CC=CC=C1 FZERHIULMFGESH-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 229910052977 alkali metal sulfide Inorganic materials 0.000 description 2
- 125000002947 alkylene group Chemical group 0.000 description 2
- 125000002619 bicyclic group Chemical group 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 125000004093 cyano group Chemical group *C#N 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- AMXOYNBUYSYVKV-UHFFFAOYSA-M lithium bromide Chemical compound [Li+].[Br-] AMXOYNBUYSYVKV-UHFFFAOYSA-M 0.000 description 2
- HSZCZNFXUDYRKD-UHFFFAOYSA-M lithium iodide Chemical compound [Li+].[I-] HSZCZNFXUDYRKD-UHFFFAOYSA-M 0.000 description 2
- 239000000178 monomer Substances 0.000 description 2
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 235000011121 sodium hydroxide Nutrition 0.000 description 2
- 235000009518 sodium iodide Nutrition 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 2
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 description 2
- 125000000542 sulfonic acid group Chemical group 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- RWQNBRDOKXIBIV-UHFFFAOYSA-N thymine Chemical compound CC1=CNC(=O)NC1=O RWQNBRDOKXIBIV-UHFFFAOYSA-N 0.000 description 2
- SRPWOOOHEPICQU-UHFFFAOYSA-N trimellitic anhydride Chemical compound OC(=O)C1=CC=C2C(=O)OC(=O)C2=C1 SRPWOOOHEPICQU-UHFFFAOYSA-N 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- KLWNJUGZTYIXFQ-UHFFFAOYSA-N 2,3-dicarbamoylbenzoic acid Chemical compound NC(=O)C1=CC=CC(C(O)=O)=C1C(N)=O KLWNJUGZTYIXFQ-UHFFFAOYSA-N 0.000 description 1
- MQMWPBBDMIYYMI-UHFFFAOYSA-N 2-aminophenylglyoxylic acid Chemical compound NC1=CC=CC=C1C(=O)C(O)=O MQMWPBBDMIYYMI-UHFFFAOYSA-N 0.000 description 1
- VPRSUPRMCOGILV-UHFFFAOYSA-N 2-carbamoyl-5-chloro-4-propylbenzoic acid Chemical compound CCCC1=CC(C(N)=O)=C(C(O)=O)C=C1Cl VPRSUPRMCOGILV-UHFFFAOYSA-N 0.000 description 1
- HYIPUSUKAXTWME-UHFFFAOYSA-N 2-methyl-2-(sulfamoylamino)propane Chemical compound CC(C)(C)NS(N)(=O)=O HYIPUSUKAXTWME-UHFFFAOYSA-N 0.000 description 1
- WSCBKJKSJZLMQD-UHFFFAOYSA-N 3-chlorobenzene-1,2-dicarboxamide Chemical compound NC(=O)C1=CC=CC(Cl)=C1C(N)=O WSCBKJKSJZLMQD-UHFFFAOYSA-N 0.000 description 1
- KTDBONJJPFEBEL-UHFFFAOYSA-N 4-bromobenzene-1,2-dicarboxamide Chemical compound NC(=O)C1=CC=C(Br)C=C1C(N)=O KTDBONJJPFEBEL-UHFFFAOYSA-N 0.000 description 1
- YIROYDNZEPTFOL-UHFFFAOYSA-N 5,5-Dimethylhydantoin Chemical compound CC1(C)NC(=O)NC1=O YIROYDNZEPTFOL-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- SNGMRKVPBWPPIN-UHFFFAOYSA-N C(C)C=1C=C(C(C(=O)N)=CC1)C(=O)N Chemical compound C(C)C=1C=C(C(C(=O)N)=CC1)C(=O)N SNGMRKVPBWPPIN-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- UNMYWSMUMWPJLR-UHFFFAOYSA-L Calcium iodide Chemical compound [Ca+2].[I-].[I-] UNMYWSMUMWPJLR-UHFFFAOYSA-L 0.000 description 1
- 241000288673 Chiroptera Species 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 235000019738 Limestone Nutrition 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 229960001413 acetanilide Drugs 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- UYJXRRSPUVSSMN-UHFFFAOYSA-P ammonium sulfide Chemical compound [NH4+].[NH4+].[S-2] UYJXRRSPUVSSMN-UHFFFAOYSA-P 0.000 description 1
- HNYOPLTXPVRDBG-UHFFFAOYSA-N barbituric acid Chemical compound O=C1CC(=O)NC(=O)N1 HNYOPLTXPVRDBG-UHFFFAOYSA-N 0.000 description 1
- ULGKXYNXXWDVON-UHFFFAOYSA-N benzene-1,2-dicarboxamide;sodium Chemical compound [Na].NC(=O)C1=CC=CC=C1C(N)=O ULGKXYNXXWDVON-UHFFFAOYSA-N 0.000 description 1
- OHJMTUPIZMNBFR-UHFFFAOYSA-N biuret Chemical compound NC(=O)NC(N)=O OHJMTUPIZMNBFR-UHFFFAOYSA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 229910001622 calcium bromide Inorganic materials 0.000 description 1
- WGEFECGEFUFIQW-UHFFFAOYSA-L calcium dibromide Chemical compound [Ca+2].[Br-].[Br-] WGEFECGEFUFIQW-UHFFFAOYSA-L 0.000 description 1
- 229910001640 calcium iodide Inorganic materials 0.000 description 1
- 229940046413 calcium iodide Drugs 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 239000003518 caustics Substances 0.000 description 1
- VDQQXEISLMTGAB-UHFFFAOYSA-N chloramine T Chemical compound [Na+].CC1=CC=C(S(=O)(=O)[N-]Cl)C=C1 VDQQXEISLMTGAB-UHFFFAOYSA-N 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 125000006310 cycloalkyl amino group Chemical group 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 159000000011 group IA salts Chemical class 0.000 description 1
- 235000010299 hexamethylene tetramine Nutrition 0.000 description 1
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 1
- 150000003949 imides Chemical class 0.000 description 1
- 150000002484 inorganic compounds Chemical class 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- ZFSLODLOARCGLH-UHFFFAOYSA-N isocyanuric acid Chemical compound OC1=NC(O)=NC(O)=N1 ZFSLODLOARCGLH-UHFFFAOYSA-N 0.000 description 1
- 239000006028 limestone Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- GLNWILHOFOBOFD-UHFFFAOYSA-N lithium sulfide Chemical compound [Li+].[Li+].[S-2] GLNWILHOFOBOFD-UHFFFAOYSA-N 0.000 description 1
- OTCKOJUMXQWKQG-UHFFFAOYSA-L magnesium bromide Chemical compound [Mg+2].[Br-].[Br-] OTCKOJUMXQWKQG-UHFFFAOYSA-L 0.000 description 1
- 229910001623 magnesium bromide Inorganic materials 0.000 description 1
- BLQJIBCZHWBKSL-UHFFFAOYSA-L magnesium iodide Chemical compound [Mg+2].[I-].[I-] BLQJIBCZHWBKSL-UHFFFAOYSA-L 0.000 description 1
- 229910001641 magnesium iodide Inorganic materials 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- DUDRFISLZJPLTJ-UHFFFAOYSA-N methane;phosphoric acid Chemical compound C.OP(O)(O)=O DUDRFISLZJPLTJ-UHFFFAOYSA-N 0.000 description 1
- AGRDPCWQGGNEQL-UHFFFAOYSA-N n-propan-2-ylsulfamoyl chloride Chemical compound CC(C)NS(Cl)(=O)=O AGRDPCWQGGNEQL-UHFFFAOYSA-N 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 125000005499 phosphonyl group Chemical group 0.000 description 1
- KNCYXPMJDCCGSJ-UHFFFAOYSA-N piperidine-2,6-dione Chemical compound O=C1CCCC(=O)N1 KNCYXPMJDCCGSJ-UHFFFAOYSA-N 0.000 description 1
- 229920001021 polysulfide Polymers 0.000 description 1
- 239000005077 polysulfide Substances 0.000 description 1
- 150000008117 polysulfides Polymers 0.000 description 1
- DPLVEEXVKBWGHE-UHFFFAOYSA-N potassium sulfide Chemical compound [S-2].[K+].[K+] DPLVEEXVKBWGHE-UHFFFAOYSA-N 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 238000010526 radical polymerization reaction Methods 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 229910052979 sodium sulfide Inorganic materials 0.000 description 1
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- KZNICNPSHKQLFF-UHFFFAOYSA-N succinimide Chemical compound O=C1CCC(=O)N1 KZNICNPSHKQLFF-UHFFFAOYSA-N 0.000 description 1
- 229960002317 succinimide Drugs 0.000 description 1
- XTHPWXDJESJLNJ-UHFFFAOYSA-N sulfurochloridic acid Chemical compound OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 229940113082 thymine Drugs 0.000 description 1
- YXFVVABEGXRONW-UHFFFAOYSA-N toluene Substances CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D265/00—Heterocyclic compounds containing six-membered rings having one nitrogen atom and one oxygen atom as the only ring hetero atoms
- C07D265/04—1,3-Oxazines; Hydrogenated 1,3-oxazines
- C07D265/12—1,3-Oxazines; Hydrogenated 1,3-oxazines condensed with carbocyclic rings or ring systems
- C07D265/14—1,3-Oxazines; Hydrogenated 1,3-oxazines condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D265/24—1,3-Oxazines; Hydrogenated 1,3-oxazines condensed with carbocyclic rings or ring systems condensed with one six-membered ring with hetero atoms directly attached in positions 2 and 4
- C07D265/26—Two oxygen atoms, e.g. isatoic anhydride
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Indole Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19722258150 DE2258150C2 (de) | 1972-11-28 | 1972-11-28 | Verfahren zur Herstellung von Isatosäureanhydriden |
| DE19732346308 DE2346308A1 (de) | 1973-09-14 | 1973-09-14 | Verfahren zur herstellung von unsubstituiertem oder substituiertem isatosaeureanhydrid |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU490291A3 true SU490291A3 (ru) | 1975-10-30 |
Family
ID=25764148
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1972600A SU490291A3 (ru) | 1972-11-28 | 1973-11-27 | Способ получени незамещенного или замещенного ангидрида изатиновой кислоты |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3984406A (enExample) |
| JP (1) | JPS5827272B2 (enExample) |
| CA (1) | CA989402A (enExample) |
| CH (1) | CH592073A5 (enExample) |
| DD (1) | DD108298A5 (enExample) |
| FR (1) | FR2207919B1 (enExample) |
| GB (1) | GB1442386A (enExample) |
| IT (1) | IT1003157B (enExample) |
| NL (1) | NL7316217A (enExample) |
| SU (1) | SU490291A3 (enExample) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2902978A1 (de) * | 1979-01-26 | 1980-08-07 | Basf Ag | Verfahren zur kontinuierlichen herstellung von isatosaeureanhydrid |
| DE2925175A1 (de) * | 1979-06-22 | 1981-01-08 | Basf Ag | Verfahren zur herstellung von isatosaeureanhydriden |
| GB8803113D0 (en) * | 1988-02-11 | 1988-03-09 | Bp Chem Int Ltd | Anhydrides in detergent compositions |
| US7087589B2 (en) * | 2000-01-14 | 2006-08-08 | The United States Of America As Represented By The Department Of Health And Human Services | Methanocarba cycloakyl nucleoside analogues |
| US8518957B2 (en) | 2009-12-02 | 2013-08-27 | The United States Of America, As Represented By The Secretary, Department Of Health And Human Services | Methanocarba adenosine derivatives, pharmaceutical compositions, and method of reducing intraocular pressure |
| CN114588935A (zh) * | 2022-03-04 | 2022-06-07 | 浙江大学 | 一种用于邻苯二甲酸酐酯化的磺酸型负载催化剂的制备 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1287580B (de) * | 1960-04-19 | 1969-01-23 | Maumee Chemical Company | Verfahren zur Herstellung von 1, 2-Dihydro-4H-2, 4-dioxo-3, 1-benzoxazinen |
| US3122538A (en) * | 1961-11-14 | 1964-02-25 | Geigy Chem Corp | Pyrido-oxazine derivatives and a process for their preparation |
| US3324119A (en) * | 1963-12-23 | 1967-06-06 | Maumee Chemical Company | Production of isatoic anhydride and certain halo derivatives thereof |
| US3383415A (en) * | 1964-08-17 | 1968-05-14 | Sterling Drug Inc | 2-tertiary-aminomethyl-nu-(loweralkyl) anilines |
| DE1277851B (de) * | 1966-04-20 | 1968-09-19 | Bayer Ag | Verfahren zur Herstellung von 2-Chlorcarbonylphenylisocyanaten |
| DE1770458C3 (de) * | 1968-05-20 | 1981-11-05 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von Isatosäureanhydrid |
-
1973
- 1973-10-30 IT IT30722/73A patent/IT1003157B/it active
- 1973-11-23 CH CH1653173A patent/CH592073A5/xx not_active IP Right Cessation
- 1973-11-26 DD DD174887A patent/DD108298A5/xx unknown
- 1973-11-26 FR FR7342035A patent/FR2207919B1/fr not_active Expired
- 1973-11-27 US US05/419,411 patent/US3984406A/en not_active Expired - Lifetime
- 1973-11-27 GB GB5486273A patent/GB1442386A/en not_active Expired
- 1973-11-27 CA CA186,758A patent/CA989402A/en not_active Expired
- 1973-11-27 SU SU1972600A patent/SU490291A3/ru active
- 1973-11-27 NL NL7316217A patent/NL7316217A/xx unknown
- 1973-11-28 JP JP48132826A patent/JPS5827272B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| IT1003157B (it) | 1976-06-10 |
| DD108298A5 (enExample) | 1974-09-12 |
| GB1442386A (en) | 1976-07-14 |
| CH592073A5 (enExample) | 1977-10-14 |
| JPS5827272B2 (ja) | 1983-06-08 |
| US3984406A (en) | 1976-10-05 |
| CA989402A (en) | 1976-05-18 |
| FR2207919B1 (enExample) | 1978-09-08 |
| FR2207919A1 (enExample) | 1974-06-21 |
| JPS4982674A (enExample) | 1974-08-08 |
| NL7316217A (enExample) | 1974-05-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Hoggarth | 250. Compounds related to thiosemicarbazide. Part I. 3-Phenyl-1: 2: 4-triazole derivatives | |
| SU490291A3 (ru) | Способ получени незамещенного или замещенного ангидрида изатиновой кислоты | |
| US3035057A (en) | Dichloroisocyanurate process and products | |
| US4082749A (en) | Process for the production of amines | |
| US2977372A (en) | Process for preparing substituted tetrazoles | |
| US3072654A (en) | Dichloroisocyanurate process | |
| US4328339A (en) | Continuous preparation of isatoic anhydride | |
| US4515940A (en) | Process for the preparation of aryldiazosulfonates | |
| US3712891A (en) | Chlorination of cyanuric acid | |
| US4353830A (en) | Process for the preparation of substituted amidines | |
| US4276433A (en) | Continuous preparation of anthranilic acid | |
| Bartulín et al. | Synthesis and prototropic tautomerism of 1‐n‐alkyl‐3‐methyl‐4‐nitroso‐5‐pyrazolones | |
| Eberly et al. | On the formation and reactions of the substituted thiazolidones. IV | |
| US4007221A (en) | Manufacture of nuclear-iodinated iodine compounds of aromatic character | |
| IE56017B1 (en) | Process for the nucleophilic substitution of unactivated aromatic and heteroaromatic substrates | |
| US2374934A (en) | Process for preparing capillary active substances | |
| US2417999A (en) | Preparation of n, n'-methylene bis hydantoins | |
| US4252942A (en) | Process for the preparation of the benzothiazole-sulfenamides | |
| US4518781A (en) | Process for the preparation of 3-hydroxymethyl-6-chlorobenzoxazolone | |
| Grimmel et al. | Reaction of diazo compounds with sulfamic acid | |
| Joshua et al. | Synthesis of 1, 3, 5-risubstituted 2, 4-dithiobiurets: Their conversion into 4-Alkyl-3, 5-di (substituted imino)-l, 2, 4-dithiazolidines and to related benzothiazolylthioureas | |
| US4075094A (en) | Sodium hypochlorite treatment for removal of cyanurate compounds from aqueous waste streams | |
| US3094525A (en) | Dichlorocyanurate complex | |
| US3115493A (en) | Dichlorocyanurate complex | |
| US2938032A (en) | pasotted jx |