SU455540A3 - Способ получени тиенилалканпроизводных - Google Patents
Способ получени тиенилалканпроизводныхInfo
- Publication number
- SU455540A3 SU455540A3 SU1702859A SU1702859A SU455540A3 SU 455540 A3 SU455540 A3 SU 455540A3 SU 1702859 A SU1702859 A SU 1702859A SU 1702859 A SU1702859 A SU 1702859A SU 455540 A3 SU455540 A3 SU 455540A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- phenyl
- solution
- hydroxypropyl
- thienyl
- amine
- Prior art date
Links
- 238000000034 method Methods 0.000 title description 8
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 19
- 239000000243 solution Substances 0.000 description 17
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 13
- 239000002585 base Substances 0.000 description 11
- 239000003054 catalyst Substances 0.000 description 11
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 10
- 150000001875 compounds Chemical class 0.000 description 10
- 229910052739 hydrogen Inorganic materials 0.000 description 10
- 239000001257 hydrogen Substances 0.000 description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 6
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 6
- 239000002253 acid Substances 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 235000011121 sodium hydroxide Nutrition 0.000 description 5
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- 230000002378 acidificating effect Effects 0.000 description 4
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- 238000005984 hydrogenation reaction Methods 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 3
- 235000019270 ammonium chloride Nutrition 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 3
- 239000003638 chemical reducing agent Substances 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 229910001392 phosphorus oxide Inorganic materials 0.000 description 3
- LFGREXWGYUGZLY-UHFFFAOYSA-N phosphoryl Chemical class [P]=O LFGREXWGYUGZLY-UHFFFAOYSA-N 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- 235000011164 potassium chloride Nutrition 0.000 description 3
- 239000001103 potassium chloride Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 239000011592 zinc chloride Substances 0.000 description 3
- 235000005074 zinc chloride Nutrition 0.000 description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Natural products OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- -1 for example Substances 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 2
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 2
- 235000011007 phosphoric acid Nutrition 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- PWMWNFMRSKOCEY-UHFFFAOYSA-N 1-Phenyl-1,2-ethanediol Chemical compound OCC(O)C1=CC=CC=C1 PWMWNFMRSKOCEY-UHFFFAOYSA-N 0.000 description 1
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- XCMISAPCWHTVNG-UHFFFAOYSA-N 3-bromothiophene Chemical compound BrC=1C=CSC=1 XCMISAPCWHTVNG-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- MPFRDWDVIGEDKK-UHFFFAOYSA-K [F-].[F-].[F-].[K+].[K+].[K+] Chemical compound [F-].[F-].[F-].[K+].[K+].[K+] MPFRDWDVIGEDKK-UHFFFAOYSA-K 0.000 description 1
- JEDZLBFUGJTJGQ-UHFFFAOYSA-N [Na].COCCO[AlH]OCCOC Chemical compound [Na].COCCO[AlH]OCCOC JEDZLBFUGJTJGQ-UHFFFAOYSA-N 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000003518 caustics Substances 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 150000002168 ethanoic acid esters Chemical class 0.000 description 1
- XTLNYNMNUCLWEZ-UHFFFAOYSA-N ethanol;propan-2-one Chemical compound CCO.CC(C)=O XTLNYNMNUCLWEZ-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- HTJPDOPKPWUNBX-UHFFFAOYSA-M magnesium;2h-thiophen-2-ide;bromide Chemical compound [Mg+2].[Br-].C=1C=[C-]SC=1 HTJPDOPKPWUNBX-UHFFFAOYSA-M 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- MJGFBOZCAJSGQW-UHFFFAOYSA-N mercury sodium Chemical compound [Na].[Hg] MJGFBOZCAJSGQW-UHFFFAOYSA-N 0.000 description 1
- 229910052987 metal hydride Inorganic materials 0.000 description 1
- 150000004681 metal hydrides Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- OTYBMLCTZGSZBG-UHFFFAOYSA-L potassium sulfate Chemical compound [K+].[K+].[O-]S([O-])(=O)=O OTYBMLCTZGSZBG-UHFFFAOYSA-L 0.000 description 1
- 229910052939 potassium sulfate Inorganic materials 0.000 description 1
- 239000001120 potassium sulphate Substances 0.000 description 1
- 235000011151 potassium sulphates Nutrition 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 229910052702 rhenium Inorganic materials 0.000 description 1
- HYERJXDYFLQTGF-UHFFFAOYSA-N rhenium Chemical compound [Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re][Re] HYERJXDYFLQTGF-UHFFFAOYSA-N 0.000 description 1
- 229910001023 sodium amalgam Inorganic materials 0.000 description 1
- 239000012419 sodium bis(2-methoxyethoxy)aluminum hydride Substances 0.000 description 1
- NRUVOKMCGYWODZ-UHFFFAOYSA-N sulfanylidenepalladium Chemical compound [Pd]=S NRUVOKMCGYWODZ-UHFFFAOYSA-N 0.000 description 1
- JOKPITBUODAHEN-UHFFFAOYSA-N sulfanylideneplatinum Chemical compound [Pt]=S JOKPITBUODAHEN-UHFFFAOYSA-N 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/14—Radicals substituted by singly bound hetero atoms other than halogen
- C07D333/20—Radicals substituted by singly bound hetero atoms other than halogen by nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| AT927770A AT308089B (de) | 1970-10-14 | 1970-10-14 | Verfahren zur Herstellung von neuen Thienylalkanderivaten und ihren Salzen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU455540A3 true SU455540A3 (ru) | 1974-12-30 |
Family
ID=3612754
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1702859A SU455540A3 (ru) | 1970-10-14 | 1971-10-05 | Способ получени тиенилалканпроизводных |
Country Status (22)
| Country | Link |
|---|---|
| US (1) | US3767675A (enExample) |
| JP (1) | JPS5441592B1 (enExample) |
| AT (1) | AT308089B (enExample) |
| AU (1) | AU453566B2 (enExample) |
| BE (1) | BE773852A (enExample) |
| CA (1) | CA934383A (enExample) |
| CH (2) | CH567500A5 (enExample) |
| CS (1) | CS171163B2 (enExample) |
| DD (1) | DD95393A5 (enExample) |
| DE (1) | DE2150977C3 (enExample) |
| DK (1) | DK131570B (enExample) |
| EG (1) | EG10294A (enExample) |
| ES (1) | ES395947A1 (enExample) |
| FI (1) | FI52581C (enExample) |
| FR (1) | FR2110409B1 (enExample) |
| HU (1) | HU162962B (enExample) |
| NL (1) | NL165163C (enExample) |
| NO (1) | NO132592C (enExample) |
| SE (1) | SE379045B (enExample) |
| SU (1) | SU455540A3 (enExample) |
| TR (1) | TR16828A (enExample) |
| ZA (1) | ZA716654B (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1597591A (en) * | 1977-01-12 | 1981-09-09 | Degussa | Dithienyl alkylamines and alkenylamines and a process for their production |
| BR0313593A (pt) | 2002-08-19 | 2005-07-12 | Pfizer Prod Inc | Terapia de combinação para doenças hiperproliferativas |
-
1970
- 1970-10-14 AT AT927770A patent/AT308089B/de not_active IP Right Cessation
-
1971
- 1971-09-20 NL NL7112892.A patent/NL165163C/xx not_active IP Right Cessation
- 1971-09-20 US US00182192A patent/US3767675A/en not_active Expired - Lifetime
- 1971-09-21 CH CH1269374A patent/CH567500A5/xx not_active IP Right Cessation
- 1971-09-21 CH CH1377571A patent/CH560211A5/xx not_active IP Right Cessation
- 1971-09-27 CS CS6860A patent/CS171163B2/cs unknown
- 1971-09-27 AU AU33901/71A patent/AU453566B2/en not_active Expired
- 1971-10-05 ZA ZA716654A patent/ZA716654B/xx unknown
- 1971-10-05 SU SU1702859A patent/SU455540A3/ru active
- 1971-10-06 EG EG437/71A patent/EG10294A/xx active
- 1971-10-07 FI FI712817A patent/FI52581C/fi active
- 1971-10-08 FR FR7136274A patent/FR2110409B1/fr not_active Expired
- 1971-10-12 BE BE773852A patent/BE773852A/xx not_active IP Right Cessation
- 1971-10-12 NO NO3741/71A patent/NO132592C/no unknown
- 1971-10-13 ES ES395947A patent/ES395947A1/es not_active Expired
- 1971-10-13 HU HUDE765A patent/HU162962B/hu unknown
- 1971-10-13 DE DE2150977A patent/DE2150977C3/de not_active Expired
- 1971-10-13 DD DD158268A patent/DD95393A5/xx unknown
- 1971-10-13 SE SE7112984A patent/SE379045B/xx unknown
- 1971-10-13 DK DK496571AA patent/DK131570B/da not_active IP Right Cessation
- 1971-10-13 TR TR16828A patent/TR16828A/xx unknown
- 1971-10-14 CA CA125155A patent/CA934383A/en not_active Expired
- 1971-10-14 JP JP8128471A patent/JPS5441592B1/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| DK131570C (enExample) | 1975-12-29 |
| EG10294A (en) | 1976-08-31 |
| FI52581C (fi) | 1977-10-10 |
| DE2150977A1 (de) | 1972-04-20 |
| AU453566B2 (en) | 1974-10-03 |
| NL7112892A (enExample) | 1972-04-18 |
| FI52581B (enExample) | 1977-06-30 |
| FR2110409A1 (enExample) | 1972-06-02 |
| SE379045B (enExample) | 1975-09-22 |
| US3767675A (en) | 1973-10-23 |
| CH567500A5 (enExample) | 1975-10-15 |
| ZA716654B (en) | 1972-07-26 |
| NO132592B (enExample) | 1975-08-25 |
| CH560211A5 (enExample) | 1975-03-27 |
| NO132592C (enExample) | 1975-12-03 |
| CA934383A (en) | 1973-09-25 |
| NL165163B (nl) | 1980-10-15 |
| JPS5441592B1 (enExample) | 1979-12-08 |
| AU3390171A (en) | 1973-04-05 |
| BE773852A (fr) | 1972-01-31 |
| DK131570B (da) | 1975-08-04 |
| HU162962B (enExample) | 1973-05-28 |
| FR2110409B1 (enExample) | 1975-02-07 |
| ES395947A1 (es) | 1974-09-01 |
| CS171163B2 (enExample) | 1976-10-29 |
| TR16828A (tr) | 1973-07-01 |
| NL165163C (nl) | 1981-03-16 |
| DD95393A5 (enExample) | 1973-02-05 |
| AT308089B (de) | 1973-06-25 |
| DE2150977C3 (de) | 1978-11-16 |
| DE2150977B2 (de) | 1978-03-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Stork et al. | The Stereochemistry of the SN2'Reaction. II1 | |
| US2441069A (en) | 2-amino-methyl-indenes and their production | |
| US2861072A (en) | Preparation of piperazine derivatives | |
| NO122789B (enExample) | ||
| SU464997A3 (ru) | Способ получени -арил-4замещенных пиперидино-алканольных производных | |
| SU455540A3 (ru) | Способ получени тиенилалканпроизводных | |
| DE1595920A1 (de) | 4-(omega-Piperazinoalkyl)-pyrazole,ihre Salze und Verfahren zu ihrer Herstellung | |
| US2746959A (en) | Diphenylethylenediamine-penicillin salt | |
| US3433804A (en) | Basic-substituted dithienylmethyl- and thienylphenylmethyl ethers and a process of making same | |
| SU457221A3 (ru) | Способ получени дитиенильных производных | |
| DE1543777B2 (de) | Verfahren zur Herstellung von alpha niedrig Alkyl beta (4 hydroxy phenyl) alaninen | |
| US2502423A (en) | 4-carbalkoxy-3-keto-2-substituted tetrahydrothiophene oximes | |
| DE1802297C3 (de) | Isopropylaminderivate und Verfahren zu ihrer Herstellung | |
| Hayes et al. | Some Furan Antihistaminic Agents | |
| Marei et al. | 534. The synthesis of amino-acids from furfurylamine | |
| US2928843A (en) | Basic esters and salts thereof | |
| US2948722A (en) | 1-(1, 2, 3, 4-tetrahydroisoquinolino)-omega-amino-3-ethinyl-3-hydroxy alkanes | |
| US2466232A (en) | Synthesis of biotin intermediates | |
| Kaye et al. | N, N-Dimethyl-N'-benzohydryl-N'-(2-pyridyl)-ethylenediamine and Related Compounds as Histamine Antagonists | |
| DE2217420A1 (de) | N-thienylmethyl-heterocyclen, deren saeureadditionssalze sowie verfahren zu deren herstellung | |
| US3637675A (en) | Piperidyl and pyridyl compounds | |
| DE855115C (de) | Verfahren zur Herstellung von 1-Azabicycloalkanol-Derivaten | |
| HU186528B (en) | Process for producing tetronnoic acid | |
| SU400101A1 (ru) | Способ получения производных р-тиенила | |
| US2684368A (en) | Basic esters of substituted thienyl acetic acids |