SU455533A3 - Способ получени производных 4-хлор-5-сульфамоилантраниловой кислоты - Google Patents
Способ получени производных 4-хлор-5-сульфамоилантраниловой кислотыInfo
- Publication number
- SU455533A3 SU455533A3 SU1814329A SU1814329A SU455533A3 SU 455533 A3 SU455533 A3 SU 455533A3 SU 1814329 A SU1814329 A SU 1814329A SU 1814329 A SU1814329 A SU 1814329A SU 455533 A3 SU455533 A3 SU 455533A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- chloro
- acid
- furfuryl
- anthranilic acid
- general formula
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 16
- QQLJBZFXGDHSRU-UHFFFAOYSA-N 2-amino-4-chloro-5-sulfamoylbenzoic acid Chemical class NC1=CC(Cl)=C(S(N)(=O)=O)C=C1C(O)=O QQLJBZFXGDHSRU-UHFFFAOYSA-N 0.000 title claims 2
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 claims description 20
- -1 alkeiyl Chemical group 0.000 claims description 20
- 150000001875 compounds Chemical class 0.000 claims description 14
- 229910052783 alkali metal Inorganic materials 0.000 claims description 6
- 150000003839 salts Chemical class 0.000 claims description 6
- 229910052760 oxygen Inorganic materials 0.000 claims description 5
- 239000001301 oxygen Substances 0.000 claims description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 239000002904 solvent Substances 0.000 claims description 3
- 229910052717 sulfur Chemical group 0.000 claims description 3
- 239000011593 sulfur Chemical group 0.000 claims description 3
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 claims description 2
- ZBJJDYGJCNTNTH-UHFFFAOYSA-N Betahistine mesilate Chemical group CS(O)(=O)=O.CS(O)(=O)=O.CNCCC1=CC=CC=N1 ZBJJDYGJCNTNTH-UHFFFAOYSA-N 0.000 claims description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000000304 alkynyl group Chemical group 0.000 claims description 2
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims 1
- 238000000926 separation method Methods 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 42
- 239000002253 acid Substances 0.000 description 27
- 239000000243 solution Substances 0.000 description 12
- 239000000203 mixture Substances 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- DNJIEGIFACGWOD-UHFFFAOYSA-N ethanethiol Chemical compound CCS DNJIEGIFACGWOD-UHFFFAOYSA-N 0.000 description 9
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 8
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 8
- 239000013078 crystal Substances 0.000 description 8
- 239000002244 precipitate Substances 0.000 description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 7
- 238000006243 chemical reaction Methods 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- XPFVYQJUAUNWIW-UHFFFAOYSA-N furfuryl alcohol Chemical compound OCC1=CC=CO1 XPFVYQJUAUNWIW-UHFFFAOYSA-N 0.000 description 6
- 238000001953 recrystallisation Methods 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- 239000008098 formaldehyde solution Substances 0.000 description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 4
- 229960000583 acetic acid Drugs 0.000 description 4
- 238000004458 analytical method Methods 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 4
- 235000017557 sodium bicarbonate Nutrition 0.000 description 4
- ARXFRBACTHTEIR-UHFFFAOYSA-N 4-chloro-2-(furan-2-ylmethylamino)-5-(methoxymethylsulfamoyl)benzoic acid Chemical compound C(C1=CC=CO1)NC=1C(C(=O)O)=CC(=C(C1)Cl)S(NCOC)(=O)=O ARXFRBACTHTEIR-UHFFFAOYSA-N 0.000 description 3
- 239000012362 glacial acetic acid Substances 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 2
- 238000005481 NMR spectroscopy Methods 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- KYJJBIRFWWKUDB-UHFFFAOYSA-N 4-chloro-2-(cyclohexylamino)-5-(methoxymethylsulfamoyl)benzoic acid Chemical compound C1(CCCCC1)NC=1C(C(=O)O)=CC(=C(C1)Cl)S(NCOC)(=O)=O KYJJBIRFWWKUDB-UHFFFAOYSA-N 0.000 description 1
- JBCBWDYSSJINSH-UHFFFAOYSA-N 5-(butoxymethylsulfamoyl)-4-chloro-2-(furan-2-ylmethylamino)benzoic acid Chemical compound C1=C(Cl)C(S(=O)(=O)NCOCCCC)=CC(C(O)=O)=C1NCC1=CC=CO1 JBCBWDYSSJINSH-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- LUJZOACNZWQNFT-UHFFFAOYSA-N C(C)OCS(=O)(=O)COCC Chemical compound C(C)OCS(=O)(=O)COCC LUJZOACNZWQNFT-UHFFFAOYSA-N 0.000 description 1
- 101100079984 Caenorhabditis elegans nhr-9 gene Proteins 0.000 description 1
- 241000218645 Cedrus Species 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 229930040373 Paraformaldehyde Natural products 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 239000000571 coke Substances 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- RWZYAGGXGHYGMB-UHFFFAOYSA-N o-aminobenzenecarboxylic acid Natural products NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 description 1
- 229920002866 paraformaldehyde Polymers 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 230000001766 physiological effect Effects 0.000 description 1
- SUVIGLJNEAMWEG-UHFFFAOYSA-N propane-1-thiol Chemical compound CCCS SUVIGLJNEAMWEG-UHFFFAOYSA-N 0.000 description 1
- KJRCEJOSASVSRA-UHFFFAOYSA-N propane-2-thiol Chemical compound CC(C)S KJRCEJOSASVSRA-UHFFFAOYSA-N 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 238000000870 ultraviolet spectroscopy Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/52—Radicals substituted by nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C303/00—Preparation of esters or amides of sulfuric acids; Preparation of sulfonic acids or of their esters, halides, anhydrides or amides
- C07C303/36—Preparation of esters or amides of sulfuric acids; Preparation of sulfonic acids or of their esters, halides, anhydrides or amides of amides of sulfonic acids
- C07C303/40—Preparation of esters or amides of sulfuric acids; Preparation of sulfonic acids or of their esters, halides, anhydrides or amides of amides of sulfonic acids by reactions not involving the formation of sulfonamide groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Furan Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IL37345A IL37345A (en) | 1971-07-20 | 1971-07-20 | Derivatives of 4-chloro-5-sulfamoyl-anthranilic acid,their preparation and pharmaceutical compositions comprising them |
| IL38812A IL38812A (en) | 1972-02-22 | 1972-02-22 | Derivatives of n-furfuryl-4-chloro-5-sulfamoylanthranilic acid,their preparation and pharmaceutical compositions containing them |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU455533A3 true SU455533A3 (ru) | 1974-12-30 |
Family
ID=26320464
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1814329A SU455533A3 (ru) | 1971-07-20 | 1972-07-19 | Способ получени производных 4-хлор-5-сульфамоилантраниловой кислоты |
Country Status (23)
| Country | Link |
|---|---|
| US (1) | US3860582A (enExample) |
| JP (1) | JPS516660B1 (enExample) |
| AR (1) | AR212746A1 (enExample) |
| AT (1) | AT315827B (enExample) |
| AU (1) | AU446727B2 (enExample) |
| BE (1) | BE786432A (enExample) |
| CA (1) | CA1024988A (enExample) |
| CH (1) | CH566972A5 (enExample) |
| CS (1) | CS183664B2 (enExample) |
| DD (1) | DD99572A1 (enExample) |
| DK (1) | DK133503B (enExample) |
| ES (1) | ES404965A1 (enExample) |
| FR (1) | FR2146249B1 (enExample) |
| GB (1) | GB1364366A (enExample) |
| HU (1) | HU164158B (enExample) |
| IE (1) | IE36684B1 (enExample) |
| NL (1) | NL151705B (enExample) |
| NO (1) | NO133892C (enExample) |
| OA (1) | OA04139A (enExample) |
| PH (1) | PH10267A (enExample) |
| RO (1) | RO60274A (enExample) |
| SE (1) | SE384675B (enExample) |
| SU (1) | SU455533A3 (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2334973A1 (de) * | 1973-07-10 | 1975-01-23 | Boehringer Mannheim Gmbh | Neue biphenyl-derivate |
| FR2302101A1 (fr) * | 1975-02-27 | 1976-09-24 | Joullie International Sa | Nouveaux derives de l'acide chloro-4 |
| DE2844266C2 (de) | 1978-10-11 | 1984-10-31 | Giulini Chemie Gmbh, 6700 Ludwigshafen | Hartgips, Verfahren zu seiner Herstellung und seine Verwendung |
| DE3006686A1 (de) * | 1980-02-22 | 1981-08-27 | Hoechst Ag, 6000 Frankfurt | 5-sulfamoyl-orthanilsaeuren, verfahren zu ihrer herstellung und ihre verwendung als heilmittel |
| EP2139852A1 (en) * | 2006-12-19 | 2010-01-06 | Pharmos Corporation | Sulfonamide derivatives with therapeutic indications |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2908716A (en) * | 1957-04-08 | 1959-10-13 | Crown Zellerbach Corp | Preparing organic sulfides |
| US3567714A (en) * | 1965-09-03 | 1971-03-02 | Smith Kline French Lab | N - (oxa- or thiacycloalkyl)methyl-5-sulfamoylanthranilic acid derivatives |
| US3565920A (en) * | 1966-12-29 | 1971-02-23 | Ciba Geigy Corp | 5-sulfamyl-anthranilic acids |
| US3678039A (en) * | 1967-04-27 | 1972-07-18 | Lincoln Harvey Werner | 4-trifluoromethyl-anthranilic acids |
-
1972
- 1972-06-30 GB GB3071172A patent/GB1364366A/en not_active Expired
- 1972-07-04 IE IE941/72A patent/IE36684B1/xx unknown
- 1972-07-06 AU AU44308/72A patent/AU446727B2/en not_active Expired
- 1972-07-06 CA CA146,492A patent/CA1024988A/en not_active Expired
- 1972-07-07 SE SE7209055A patent/SE384675B/xx unknown
- 1972-07-11 FR FR7225075A patent/FR2146249B1/fr not_active Expired
- 1972-07-12 US US271314A patent/US3860582A/en not_active Expired - Lifetime
- 1972-07-17 ES ES404965A patent/ES404965A1/es not_active Expired
- 1972-07-18 DD DD164494A patent/DD99572A1/xx unknown
- 1972-07-18 CS CS7200005097A patent/CS183664B2/cs unknown
- 1972-07-19 HU HU72TE661A patent/HU164158B/hu unknown
- 1972-07-19 NO NO2578/72A patent/NO133892C/no unknown
- 1972-07-19 CH CH1078872A patent/CH566972A5/xx not_active IP Right Cessation
- 1972-07-19 BE BE786432A patent/BE786432A/xx unknown
- 1972-07-19 DK DK358472AA patent/DK133503B/da unknown
- 1972-07-19 AR AR243158A patent/AR212746A1/es active
- 1972-07-19 SU SU1814329A patent/SU455533A3/ru active
- 1972-07-19 AT AT623172A patent/AT315827B/de not_active IP Right Cessation
- 1972-07-20 NL NL727210054A patent/NL151705B/xx unknown
- 1972-07-20 RO RO71689A patent/RO60274A/ro unknown
- 1972-07-20 OA OA54646A patent/OA04139A/xx unknown
- 1972-07-20 JP JP47073330A patent/JPS516660B1/ja active Pending
- 1972-08-19 PH PH13727A patent/PH10267A/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| ES404965A1 (es) | 1976-04-01 |
| PH10267A (en) | 1976-10-20 |
| DK133503B (da) | 1976-05-31 |
| OA04139A (fr) | 1979-11-30 |
| NL7210054A (enExample) | 1973-01-23 |
| GB1364366A (en) | 1974-08-21 |
| CS183664B2 (en) | 1978-07-31 |
| AT315827B (de) | 1974-06-10 |
| SE384675B (sv) | 1976-05-17 |
| CA1024988A (en) | 1978-01-24 |
| AR212746A1 (es) | 1978-09-29 |
| FR2146249A1 (enExample) | 1973-03-02 |
| RO60274A (enExample) | 1976-09-15 |
| NO133892B (enExample) | 1976-04-05 |
| AU4430872A (en) | 1974-02-21 |
| JPS516660B1 (enExample) | 1976-03-01 |
| NL151705B (nl) | 1976-12-15 |
| FR2146249B1 (enExample) | 1975-10-17 |
| US3860582A (en) | 1975-01-14 |
| IE36684B1 (en) | 1977-02-02 |
| DK133503C (enExample) | 1976-10-18 |
| IE36684L (en) | 1973-01-20 |
| CH566972A5 (enExample) | 1975-09-30 |
| AU446727B2 (en) | 1974-03-28 |
| DD99572A1 (enExample) | 1973-08-20 |
| NO133892C (enExample) | 1976-07-14 |
| DE2235400A1 (de) | 1973-02-01 |
| DE2235400B2 (de) | 1977-06-30 |
| BE786432A (fr) | 1972-11-16 |
| HU164158B (enExample) | 1973-12-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Fargher et al. | XXVI.—Nitro-, arylazo-, and amino-glyoxalines | |
| US2734904A (en) | Xcxnhxc-nh | |
| SU455533A3 (ru) | Способ получени производных 4-хлор-5-сульфамоилантраниловой кислоты | |
| Angier et al. | Pteroic acid derivatives. VI. Unequivocal syntheses of some isomeric glutamic acid peptides | |
| SU1340585A3 (ru) | Способ получени производных тетразола | |
| JPS62161766A (ja) | イミダゾ−ルn−オキサイド化合物およびその製造法 | |
| SU522791A3 (ru) | Способ получени производных 3-алкил-4-сульфамоиланилина | |
| US3120523A (en) | Heterocyclic estess of j-amino-quinazo- | |
| US2894977A (en) | Process of preparing phenoxycinnamic acid derivatives | |
| SU564809A3 (ru) | Способ получени 6-аза-1,2дигидро-3н-1,4-бензодиазепинов или их солей | |
| SU733517A3 (ru) | Способ получени триазинонов | |
| US3901934A (en) | Substituted salicylonitriles | |
| JPH01502026A (ja) | 抗潰瘍作用を有する化合物の製法 | |
| SU507567A1 (ru) | Способ получени замещенных дитиокарбаматов | |
| US2748120A (en) | 2-amino-6-aryl-5, 6-dihydro-4-hydroxy-pyrimidines | |
| US2439302A (en) | Preparation of benzotetronic acid | |
| SU113692A1 (ru) | Способ получени родацианиновых красителей | |
| Ingold et al. | XVI.—Experiments on the elimination of the carbethoxyl group from tautomeric systems. Part I. Derivatives of indene | |
| SU415872A3 (ru) | Способ получения производных 4-имино-1,4- дигидропиридинов | |
| US707812A (en) | Alkoxy-caffein and process of making same. | |
| SU640658A3 (ru) | Способ получени производных 2-амино индана или их кислых солей | |
| SU368258A1 (ru) | Способ получения 1,4-диарил-2-карбоксиметил- 3-оксопиперазинов | |
| DE69728703T2 (de) | Verfahren zur Herstellung von 1,1-disubstituierten-1H-Benz[e]indol Derivaten und Hydroxyl-substituierte 1,1-disubstituierte-1H-Benz[e]indol Derivate | |
| SU467076A1 (ru) | Способ получени 3-карбоксиалкилтиазолидинтион-2-тиосемикарбазонов-4 | |
| US4125728A (en) | Method for preparing 2,3,7,8-tetraazaspiro[4,4]nona-2,7-diene |