SU420556A1 - - Google Patents
Info
- Publication number
- SU420556A1 SU420556A1 SU1493336A SU1493336A SU420556A1 SU 420556 A1 SU420556 A1 SU 420556A1 SU 1493336 A SU1493336 A SU 1493336A SU 1493336 A SU1493336 A SU 1493336A SU 420556 A1 SU420556 A1 SU 420556A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- phosphoric acid
- calcium sulfate
- sulfate hemihydrate
- hemihydrate
- calcium
- Prior art date
Links
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 48
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 24
- ZOMBKNNSYQHRCA-UHFFFAOYSA-J calcium sulfate hemihydrate Chemical compound O.[Ca+2].[Ca+2].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O ZOMBKNNSYQHRCA-UHFFFAOYSA-J 0.000 claims description 21
- 238000000034 method Methods 0.000 claims description 13
- 238000000354 decomposition reaction Methods 0.000 claims description 9
- 229910019142 PO4 Inorganic materials 0.000 claims description 8
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 8
- 238000001914 filtration Methods 0.000 claims description 8
- 235000021317 phosphate Nutrition 0.000 claims description 8
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 claims description 7
- 235000011132 calcium sulphate Nutrition 0.000 claims description 6
- 239000000725 suspension Substances 0.000 claims description 5
- 239000010452 phosphate Substances 0.000 claims description 4
- 150000003013 phosphoric acid derivatives Chemical group 0.000 claims description 4
- 238000005406 washing Methods 0.000 claims description 4
- 230000006641 stabilisation Effects 0.000 claims description 3
- 238000011105 stabilization Methods 0.000 claims description 3
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 claims description 2
- 239000002002 slurry Substances 0.000 claims description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- PASHVRUKOFIRIK-UHFFFAOYSA-L calcium sulfate dihydrate Chemical compound O.O.[Ca+2].[O-]S([O-])(=O)=O PASHVRUKOFIRIK-UHFFFAOYSA-L 0.000 description 6
- 239000013078 crystal Substances 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000010802 sludge Substances 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical class [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical class C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 150000002823 nitrates Chemical class 0.000 description 2
- 238000005191 phase separation Methods 0.000 description 2
- 125000002467 phosphate group Chemical group [H]OP(=O)(O[H])O[*] 0.000 description 2
- YXJYBPXSEKMEEJ-UHFFFAOYSA-N phosphoric acid;sulfuric acid Chemical compound OP(O)(O)=O.OS(O)(=O)=O YXJYBPXSEKMEEJ-UHFFFAOYSA-N 0.000 description 2
- 239000011734 sodium Chemical class 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 235000002639 sodium chloride Nutrition 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical class [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical class [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 150000003841 chloride salts Chemical class 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 150000004683 dihydrates Chemical class 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000010440 gypsum Substances 0.000 description 1
- 229910052602 gypsum Inorganic materials 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000011591 potassium Chemical class 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000002351 wastewater Substances 0.000 description 1
Landscapes
- Fertilizers (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SU1493336A SU420556A1 (enrdf_load_stackoverflow) | 1970-11-12 | 1970-11-12 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SU1493336A SU420556A1 (enrdf_load_stackoverflow) | 1970-11-12 | 1970-11-12 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU420556A1 true SU420556A1 (enrdf_load_stackoverflow) | 1974-03-25 |
Family
ID=20460052
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1493336A SU420556A1 (enrdf_load_stackoverflow) | 1970-11-12 | 1970-11-12 |
Country Status (1)
| Country | Link |
|---|---|
| SU (1) | SU420556A1 (enrdf_load_stackoverflow) |
-
1970
- 1970-11-12 SU SU1493336A patent/SU420556A1/ru active
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3551332A (en) | Purification of fluorine-containing industrial waste waters | |
| PL155815B1 (pl) | Sposób wydzielania lantanowców z fosfogipsu | |
| US3418077A (en) | Phosphoric acid | |
| US2320635A (en) | Manufacture of high test bleach | |
| IL26076A (en) | Method for the manufacture of phosphoric acid and calcium sulphate hemihydrate | |
| US3600154A (en) | Process for the continuous preparation of nitrophosphate fertilizers | |
| US4504458A (en) | Gypsum conversion | |
| SU420556A1 (enrdf_load_stackoverflow) | ||
| SU1223838A3 (ru) | Способ получени фосфорной кислоты | |
| US4994248A (en) | P2 O5 recovery and phosphoric acid purification | |
| US3726660A (en) | Nitrophosphate fertilizer production | |
| SU551248A1 (ru) | Способ получени фосфорной кислоты | |
| SU1654259A1 (ru) | Способ получени экстракционной фосфорной кислоты | |
| US4324774A (en) | Method for the manufacture of defluorinated phosphatic products | |
| US2025756A (en) | Method of producing sodium sulphate and the like | |
| SU1673508A1 (ru) | Способ получени фосфорной кислоты | |
| SU1171419A1 (ru) | Способ получени фосфорной кислоты | |
| SU945076A1 (ru) | Способ очистки фосфогипса | |
| RU2094365C1 (ru) | Способ получения фосфорной кислоты | |
| US4177053A (en) | Method for the production of phosphoric acid with high contents of fertilizer-nutrients | |
| SU1167150A1 (ru) | Способ получени фосфорной кислоты | |
| DE610786C (de) | Verfahren zur kontinuierlichen Verarbeitung von Calciumsulfat und Ammoncarbonat zu Ammonsulfat | |
| US2242507A (en) | Manufacture of sodium sulphate | |
| SU185856A1 (ru) | Способ получения фосфорной кислоты | |
| SU1654260A1 (ru) | Способ получени фосфорной кислоты |