SU410029A1 - - Google Patents
Info
- Publication number
- SU410029A1 SU410029A1 SU1772072A SU1772072A SU410029A1 SU 410029 A1 SU410029 A1 SU 410029A1 SU 1772072 A SU1772072 A SU 1772072A SU 1772072 A SU1772072 A SU 1772072A SU 410029 A1 SU410029 A1 SU 410029A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- heating
- carried out
- argon
- vinyl phosphonate
- phosphonito
- Prior art date
Links
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 claims description 6
- 238000000034 method Methods 0.000 claims description 6
- 229910052786 argon Inorganic materials 0.000 claims description 3
- ZTWTYVWXUKTLCP-UHFFFAOYSA-L ethenyl-dioxido-oxo-$l^{5}-phosphane Chemical compound [O-]P([O-])(=O)C=C ZTWTYVWXUKTLCP-UHFFFAOYSA-L 0.000 claims description 3
- 238000010438 heat treatment Methods 0.000 claims description 3
- 125000002947 alkylene group Chemical group 0.000 claims description 2
- 239000011261 inert gas Substances 0.000 claims description 2
- 238000002955 isolation Methods 0.000 claims description 2
- XPPKVPWEQAFLFU-UHFFFAOYSA-J diphosphate(4-) Chemical compound [O-]P([O-])(=O)OP([O-])([O-])=O XPPKVPWEQAFLFU-UHFFFAOYSA-J 0.000 claims 1
- 235000011180 diphosphates Nutrition 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- 125000000217 alkyl group Chemical group 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- DREPONDJUKIQLX-UHFFFAOYSA-N 1-[ethenyl(ethoxy)phosphoryl]oxyethane Chemical compound CCOP(=O)(C=C)OCC DREPONDJUKIQLX-UHFFFAOYSA-N 0.000 description 1
- FFNDAWOUEUOJQA-UHFFFAOYSA-N 3,4-diethylhex-3-ene Chemical group CCC(CC)=C(CC)CC FFNDAWOUEUOJQA-UHFFFAOYSA-N 0.000 description 1
- 238000004566 IR spectroscopy Methods 0.000 description 1
- 229910004856 P—O—P Inorganic materials 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000008139 complexing agent Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- RDXABLXNTVBVML-UHFFFAOYSA-N diethoxyphosphanyl diethyl phosphite Chemical compound CCOP(OCC)OP(OCC)OCC RDXABLXNTVBVML-UHFFFAOYSA-N 0.000 description 1
- 230000008034 disappearance Effects 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 238000012544 monitoring process Methods 0.000 description 1
- 150000003018 phosphorus compounds Chemical class 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SU1772072A SU410029A1 (cs) | 1972-04-13 | 1972-04-13 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SU1772072A SU410029A1 (cs) | 1972-04-13 | 1972-04-13 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU410029A1 true SU410029A1 (cs) | 1974-01-05 |
Family
ID=20510430
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1772072A SU410029A1 (cs) | 1972-04-13 | 1972-04-13 |
Country Status (1)
| Country | Link |
|---|---|
| SU (1) | SU410029A1 (cs) |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0023173A1 (fr) * | 1979-07-09 | 1981-01-28 | Societe Nationale Elf Aquitaine (Production) | Nouveaux esters diphosphoniques et triphosphoniques, leurs préparation et applications |
| US4460548A (en) * | 1979-07-09 | 1984-07-17 | Societe Nationale Elf Aquitaine (Production) | Extraction of uranium with diphosphonic compounds |
| US4464346A (en) * | 1979-07-09 | 1984-08-07 | Societe Nationale Elf Aquitaine (Production) | Extraction of uranium with triphosphonic esters |
| US4587034A (en) * | 1979-07-09 | 1986-05-06 | Societe Nationale Elf Aquitaine (Production) | Triphosphonic esters |
| US4631142A (en) * | 1979-07-09 | 1986-12-23 | Societe Nationale Elf Aquitaine (Production) | Diphosphonic extractants |
-
1972
- 1972-04-13 SU SU1772072A patent/SU410029A1/ru active
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0023173A1 (fr) * | 1979-07-09 | 1981-01-28 | Societe Nationale Elf Aquitaine (Production) | Nouveaux esters diphosphoniques et triphosphoniques, leurs préparation et applications |
| US4460548A (en) * | 1979-07-09 | 1984-07-17 | Societe Nationale Elf Aquitaine (Production) | Extraction of uranium with diphosphonic compounds |
| US4464346A (en) * | 1979-07-09 | 1984-08-07 | Societe Nationale Elf Aquitaine (Production) | Extraction of uranium with triphosphonic esters |
| US4587034A (en) * | 1979-07-09 | 1986-05-06 | Societe Nationale Elf Aquitaine (Production) | Triphosphonic esters |
| US4631142A (en) * | 1979-07-09 | 1986-12-23 | Societe Nationale Elf Aquitaine (Production) | Diphosphonic extractants |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPH0569110B2 (cs) | ||
| SU410029A1 (cs) | ||
| Solovyov et al. | Calix [4] arenes bearing α‐amino‐or α‐hydroxyphosphonic acid fragments at the upper rim | |
| Troev et al. | A new synthetic approach to α‐aminophosphonic acids: Synthesis and NMR characterization | |
| SU700519A1 (ru) | Способ получени замещенных оксаазафосфоленов | |
| SU785314A1 (ru) | Способ получени 2,3-бутилен- -бутоксиэтилфосфоната или -тиофосфоната | |
| SU539888A1 (ru) | Способ получени неопентиленалкилфосфонатов | |
| SU392071A1 (ru) | ЮйШЯ ! НАГШЙО-ТЕХЯИЧЕШЯ ! БИБЛИОТЕКА^Л\. Кл. С 071 У/40 С 07f 7/08УДК 547.26'118'128.07 (088.8) | |
| SU386953A1 (ru) | Способ получения ацеталей, содержащих трехкоординированный атом фосфора | |
| SU547451A1 (ru) | Способ получени -фенил- или -бензиламинометилфосфоновых кислот | |
| SU478012A1 (ru) | Способ получени смешанных диалкилфосфитов | |
| SU468923A1 (ru) | Способ получени меркурированных фосфонатов | |
| SU1041546A1 (ru) | Способ получени трис-/аминоалкил/ фосфитов | |
| SU1294809A1 (ru) | Способ получени @ -алкил(диалкоксиметил)алкоксикарбонилфосфинатов | |
| SU403680A1 (ru) | Способ получения | |
| SU394379A1 (ru) | Способ получения фосфорорганических производных карборана | |
| SU439154A1 (ru) | Способ получени кремнийорганических эфиров -диалкилфосфоноалкилфосфонистых кислот | |
| SU435247A1 (ru) | Способ получения диарил-1-окси-2,2,2- трихлорэтилфосфонатов | |
| SU1182045A1 (ru) | Способ получени @ , @ -диалкил(диалкоксиметил)-фосфонитов | |
| SU453410A1 (ru) | Способ получения фосфорорганических соединений | |
| SU1599374A1 (ru) | Способ получени 5-диалкиламинометил-1,4,6,9-тетраокса-5-фосфаспиро [4,4]нонанов | |
| SU407911A1 (ru) | Способ получения тетраалкиловых эфиров изофосфорноватой кислоты | |
| SU289097A1 (ru) | Способ получения диалкоксифосфинов | |
| SU1578132A1 (ru) | Способ получени бис(триметилсилил)фосфита | |
| Ando et al. | The reaction of group V metal alkoxides with sulfur dioxide and selenium dioxide. |