SU379084A1 - - Google Patents
Info
- Publication number
- SU379084A1 SU379084A1 SU875702A SU875702A SU379084A1 SU 379084 A1 SU379084 A1 SU 379084A1 SU 875702 A SU875702 A SU 875702A SU 875702 A SU875702 A SU 875702A SU 379084 A1 SU379084 A1 SU 379084A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- carbon atoms
- hydrogen
- parts
- hydrogenolysis
- palladium
- Prior art date
Links
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 238000007327 hydrogenolysis reaction Methods 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 150000002790 naphthalenes Chemical class 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- -1 1-naphthoxy Chemical group 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical class C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 208000019622 heart disease Diseases 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Substances [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 238000011321 prophylaxis Methods 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 238000011282 treatment Methods 0.000 description 1
Priority Applications (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SU1366767A SU379084A3 (enExample) | 1964-01-11 | 1964-01-11 | |
| SU136766A SU375843A3 (enExample) | 1964-01-11 | 1964-01-11 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| SU379084A1 true SU379084A1 (enExample) | |
| SU375843A1 SU375843A1 (ru) | |
| SU322880A1 SU322880A1 (ru) |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU793382A3 (ru) | Способ получени производных трифенилалкенов или их солей | |
| US3723524A (en) | Polar-substituted propanolamines as anti-angina and anti-hypertensive agents | |
| US4598079A (en) | 2-(aryl substitued)piperazinones and nootropic compositions based thereon | |
| DE2238504C3 (de) | l-Phenoxy-S-alkylaminopropan^-ol -Derivate | |
| NL193539C (nl) | Nieuwe fenylaminoguanidinederivaten en een geneesmiddel met antiarrhythmische werking dat een dergelijk derivaat bevat. | |
| SU1151204A3 (ru) | Способ получени замещенных основанием пиридазинов или их сол нокислых солей | |
| US2951092A (en) | Triamine derivatives | |
| SU379084A1 (enExample) | ||
| CH550768A (de) | Verfahren zur herstellung neuer bis((4-hydroxy-3-hydroxymethylphenyl)aethanol)diamin-derivate. | |
| US4604393A (en) | Phenyloxoalkyl piperidines and the pharmaceutical compositions containing them | |
| CH437252A (de) | Verfahren zur Herstellung von Catechol-O-methyltransferase-Inhibitoren | |
| Corrigan et al. | Preparation of N-substituted 1-(p-hydroxyphenyl)-2-aminoethanols1 | |
| Thyrum et al. | p-Amino-N-[2-(substituted amino) ethyl] benzamides. Potential antifibrillatory drugs | |
| DE2303427C3 (de) | Dibenzo-(a,d)-cycloheptadiene und -triene, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE2923817C2 (de) | (3-Alkylamino-2-hydroxyproposy)-furan-2-carbonsäureanilide und deren physiologisch verträgliche Säureadditionssalze und Verfahren zu deren Herstellung sowie Arzneimittel mit einem Gehalt dieser Verbindungen | |
| SU509228A3 (ru) | Способ получени производныхпиперазина | |
| US3629276A (en) | 2-amino-5-spiro-substituted-oxazo compounds | |
| RU938559C (ru) | S-Производные 5-амино-6-меркаптопиримидина, обладающие противоопухолевым и цитостатическим действием | |
| EP0303920A1 (de) | Neue Benzofuranderivate und diese enthaltende therapeutische Mittel | |
| CH499490A (de) | Verfahren zur Herstellung von Derivaten des rechtsdrehenden Propanolamins | |
| CH638189A5 (de) | Pyridazinyl-hydrazone und deren salze, verfahren zu ihrer herstellung und die diese verbindungen enthaltenden arzneimittelpraeparate. | |
| SU506290A3 (ru) | Способ получени диаминобензофенонов | |
| SU296319A1 (enExample) | ||
| CH654575A5 (de) | Antiarhythmisch wirksame phenaethylpiperidin-verbindungen. | |
| US4201790A (en) | Benzophenone derivatives |