SU369131A1 - - Google Patents
Info
- Publication number
- SU369131A1 SU369131A1 SU1377271A SU1377271A SU369131A1 SU 369131 A1 SU369131 A1 SU 369131A1 SU 1377271 A SU1377271 A SU 1377271A SU 1377271 A SU1377271 A SU 1377271A SU 369131 A1 SU369131 A1 SU 369131A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- rubber
- salts
- hours
- elastomers
- results
- Prior art date
Links
- 229920001971 elastomer Polymers 0.000 description 16
- 239000005060 rubber Substances 0.000 description 10
- 239000000203 mixture Substances 0.000 description 8
- 239000000806 elastomer Substances 0.000 description 6
- 238000000034 method Methods 0.000 description 5
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- 150000000703 Cerium Chemical class 0.000 description 3
- KPUWHANPEXNPJT-UHFFFAOYSA-N disiloxane Chemical class [SiH3]O[SiH3] KPUWHANPEXNPJT-UHFFFAOYSA-N 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- 229910052684 Cerium Inorganic materials 0.000 description 2
- 230000032683 aging Effects 0.000 description 2
- 150000001447 alkali salts Chemical class 0.000 description 2
- -1 cerium salts Chemical class 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 239000004071 soot Substances 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- 239000003017 thermal stabilizer Substances 0.000 description 2
- XMNIXWIUMCBBBL-UHFFFAOYSA-N 2-(2-phenylpropan-2-ylperoxy)propan-2-ylbenzene Chemical compound C=1C=CC=CC=1C(C)(C)OOC(C)(C)C1=CC=CC=C1 XMNIXWIUMCBBBL-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000012760 heat stabilizer Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 229910052747 lanthanoid Inorganic materials 0.000 description 1
- 150000002602 lanthanoids Chemical class 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229910052761 rare earth metal Inorganic materials 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- CCEKAJIANROZEO-UHFFFAOYSA-N sulfluramid Chemical group CCNS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F CCEKAJIANROZEO-UHFFFAOYSA-N 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Landscapes
- Compositions Of Macromolecular Compounds (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SU1377271A SU369131A1 (cg-RX-API-DMAC10.html) | 1969-11-12 | 1969-11-12 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SU1377271A SU369131A1 (cg-RX-API-DMAC10.html) | 1969-11-12 | 1969-11-12 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU369131A1 true SU369131A1 (cg-RX-API-DMAC10.html) | 1973-02-08 |
Family
ID=20448201
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1377271A SU369131A1 (cg-RX-API-DMAC10.html) | 1969-11-12 | 1969-11-12 |
Country Status (1)
| Country | Link |
|---|---|
| SU (1) | SU369131A1 (cg-RX-API-DMAC10.html) |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1998037016A1 (en) * | 1997-02-24 | 1998-08-27 | Dow Corning Corporation | Method for making hydrophobic silica gels under neutral conditions |
| WO1998037015A1 (en) * | 1997-02-24 | 1998-08-27 | Dow Corning Corporation | Hydrophobic organosilicate-modified silica gels |
| WO1998037020A1 (en) * | 1997-02-24 | 1998-08-27 | Dow Corning Corporation | Hydrophobic silica gels with reduced surface area |
| WO1998037021A1 (en) * | 1997-02-24 | 1998-08-27 | Dow Corning Corporation | Method for making hydrophobic organosilicate-modified silica gels under neutral conditions |
| WO1998037018A1 (en) * | 1997-02-24 | 1998-08-27 | Dow Corning Corporation | Method for preparing hydrophobic silica gels with improved heat stability |
| WO1998037017A1 (en) * | 1997-02-20 | 1998-08-27 | Dow Corning Corporation | Neutral-aged hydrophobic organosilicate-modified silica gels |
-
1969
- 1969-11-12 SU SU1377271A patent/SU369131A1/ru active
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1998037017A1 (en) * | 1997-02-20 | 1998-08-27 | Dow Corning Corporation | Neutral-aged hydrophobic organosilicate-modified silica gels |
| WO1998037016A1 (en) * | 1997-02-24 | 1998-08-27 | Dow Corning Corporation | Method for making hydrophobic silica gels under neutral conditions |
| WO1998037015A1 (en) * | 1997-02-24 | 1998-08-27 | Dow Corning Corporation | Hydrophobic organosilicate-modified silica gels |
| WO1998037020A1 (en) * | 1997-02-24 | 1998-08-27 | Dow Corning Corporation | Hydrophobic silica gels with reduced surface area |
| WO1998037021A1 (en) * | 1997-02-24 | 1998-08-27 | Dow Corning Corporation | Method for making hydrophobic organosilicate-modified silica gels under neutral conditions |
| WO1998037018A1 (en) * | 1997-02-24 | 1998-08-27 | Dow Corning Corporation | Method for preparing hydrophobic silica gels with improved heat stability |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3142655A (en) | Organopolysiloxane compositions incorporating heat-age resistant rare earth compounds | |
| SU369131A1 (cg-RX-API-DMAC10.html) | ||
| DE2308595C2 (de) | Hitzehärtbare Polysiloxanformmassen mit verbesserter Feuerbeständigkeit | |
| DE2117027B2 (de) | Bei -20 Grad C lagerfähige, bei normalen atmosphärischen Bedingungen zu Elastomeren härtende Organopolysiloxanformmassen | |
| US3839266A (en) | Organopolysiloxane compositions convertible to elastomers | |
| US2838472A (en) | Vulcanization of silicone rubber | |
| US2214904A (en) | Heat insulation material | |
| US2875172A (en) | Process for compounding alkyl aryl vinyl silicone elastomer with filler and silanediol, and product obtained thereby | |
| SU471726A3 (ru) | Полимерна композици | |
| JPS5650948A (en) | Low-temperature resistant rubber composition | |
| DE2007002C3 (de) | Verbesserung der Standfestigkeit von bei Raumtemperatur zu Elastomeren härtenden Organopolysiloxanmassen | |
| US1372038A (en) | Dye assistant | |
| CA1138143A (en) | Siloxane elastomers containing manganous oxide | |
| SU139435A1 (ru) | Способ радиационной вулканизации | |
| US1731487A (en) | Composition of matter | |
| DE2617434A1 (de) | Elastomerbildende siloxanzubereitung und verfahren zu ihrer herstellung | |
| SU378400A1 (ru) | Резиновая смесь на основе силоксанового каучука | |
| SU400599A1 (ru) | Вулканизуемая смесь на основе ненасыщенных каучуков | |
| SU681075A1 (ru) | Резинова смесь на основе каучука со сложноэфирными группами | |
| SU1171481A1 (ru) | Резинова смесь на основе хлорбутилкаучука | |
| SU759551A1 (ru) | Вулканизуемая резиновая смесь 1 | |
| DE603399C (de) | Verfahren zur Abscheidung schwacher Saeuren aus Gasgemischen | |
| SU810734A1 (ru) | Состав дл диффузионной стабили-зАции пОлиАМидОВ | |
| SU614106A1 (ru) | 1,4-Бис-/3 (5 ) -метилпиразолилметилен- 1 /-пиперазин в качестве вулканизующего агента фторкаучука | |
| SU302014A1 (ru) | Способ стабилизации полиорганосилоксанов против термоокислительного старени |