SU309484A1 - - Google Patents
Info
- Publication number
- SU309484A1 SU309484A1 SU1371601A SU1371601A SU309484A1 SU 309484 A1 SU309484 A1 SU 309484A1 SU 1371601 A SU1371601 A SU 1371601A SU 1371601 A SU1371601 A SU 1371601A SU 309484 A1 SU309484 A1 SU 309484A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- compounds
- plants
- compound
- formula
- action
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 description 16
- 241000196324 Embryophyta Species 0.000 description 11
- 230000002363 herbicidal effect Effects 0.000 description 6
- 239000004009 herbicide Substances 0.000 description 4
- 241000209094 Oryza Species 0.000 description 3
- 239000002689 soil Substances 0.000 description 3
- 235000007164 Oryza sativa Nutrition 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 230000008635 plant growth Effects 0.000 description 2
- 235000009566 rice Nutrition 0.000 description 2
- OOSBSVDOHPTTCT-UHFFFAOYSA-N (2,4-dichlorophenoxy)-methoxy-methyl-sulfanylidene-$l^{5}-phosphane Chemical group COP(C)(=S)OC1=CC=C(Cl)C=C1Cl OOSBSVDOHPTTCT-UHFFFAOYSA-N 0.000 description 1
- 125000004201 2,4-dichlorophenyl group Chemical group [H]C1=C([H])C(*)=C(Cl)C([H])=C1Cl 0.000 description 1
- -1 2-nitrophenyl Chemical group 0.000 description 1
- 241000861718 Chloris <Aves> Species 0.000 description 1
- 244000223760 Cinnamomum zeylanicum Species 0.000 description 1
- 241000257465 Echinoidea Species 0.000 description 1
- 229930186657 Lat Natural products 0.000 description 1
- 231100000674 Phytotoxicity Toxicity 0.000 description 1
- 244000234609 Portulaca oleracea Species 0.000 description 1
- 235000001855 Portulaca oleracea Nutrition 0.000 description 1
- 241000567250 Zannichellia major Species 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 235000017803 cinnamon Nutrition 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 150000003014 phosphoric acid esters Chemical class 0.000 description 1
- JNCWFFCZGHNDTN-UHFFFAOYSA-N phosphoric acid;propan-2-amine Chemical compound CC(C)N.OP(O)(O)=O JNCWFFCZGHNDTN-UHFFFAOYSA-N 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU309484A1 true SU309484A1 (cs) |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU803845A3 (ru) | Гербицидный состав | |
| SU1428196A3 (ru) | Способ получени 2-замещенных фенил-4,5,6,7-тетрагидро-2Н-изоиндол-1,3-дионов | |
| CZ280917B6 (cs) | Prostředek pro regulaci růstu rostlin | |
| SU728687A3 (ru) | Способ борьбы с сорной растительностью | |
| US3316080A (en) | Method for inhibiting growth of weeds and grasses | |
| US3864491A (en) | Antibacterial and antifungal 4,5-dihalopyrrole-2-carbonitriles | |
| SU309484A1 (cs) | ||
| SU596149A3 (ru) | Гербицидна композици | |
| US3985539A (en) | 4,5-Dihalopyrrole-2-carbonitrile-containing terrestrial and aquatic hebicidal composition | |
| BG51235A3 (bg) | Средство и метод за регулиране растежа на растения | |
| CH616687A5 (cs) | ||
| SU708982A3 (ru) | Фунгицидна композици | |
| SU843696A3 (ru) | Гербицидный состав | |
| RU2043021C1 (ru) | Антидот гербицидов гормонального действия 2,4-дихлорфеноксиуксусной и 4-амино-3,5,6-трихлорпиколиновой кислот | |
| US5648318A (en) | Ketodiacid compounds that inhibit nematode egg hatching | |
| SU519109A3 (ru) | Фунгицидное средство | |
| US3690865A (en) | Method of combating unwanted vegetation in sugar beet fields | |
| RU2776586C1 (ru) | N-арил-3[(цианоацетил)амино]-4,6-диметилтиено[2,3-b]-пиридил-2-карбоксамиды в качестве антидотов 2,4-Д на подсолнечнике | |
| US3647850A (en) | Fluorine substituted benzyl dithiocarbamates and their production and use | |
| RU2185063C2 (ru) | Способ ускорения параметров роста и увеличения урожайности люцерны | |
| US4339268A (en) | Herbicidal nitroalkyl 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoates | |
| DE2624094A1 (de) | N-carbamoyl-n-phenylaminosaeure-derivate, verfahren zu ihrer herstellung und herbizide mittel | |
| US2536751A (en) | Herbicidal compositions | |
| DE2365061B2 (de) | Fungizide Mittel auf der Basis von Alkylphosphit-Derivaten | |
| SU352435A1 (cs) |