SE7512498L - 3,4-dihydrokarbostyrilderivat - Google Patents
3,4-dihydrokarbostyrilderivatInfo
- Publication number
- SE7512498L SE7512498L SE7512498A SE7512498A SE7512498L SE 7512498 L SE7512498 L SE 7512498L SE 7512498 A SE7512498 A SE 7512498A SE 7512498 A SE7512498 A SE 7512498A SE 7512498 L SE7512498 L SE 7512498L
- Authority
- SE
- Sweden
- Prior art keywords
- formula
- represented
- alkyl
- image
- dihydrocarbostyril
- Prior art date
Links
- TZOYXRMEFDYWDQ-UHFFFAOYSA-N 3,4-dihydro-1h-quinolin-2-one Chemical class C1=CC=C2NC(=O)CCC2=C1 TZOYXRMEFDYWDQ-UHFFFAOYSA-N 0.000 title abstract 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 abstract 3
- 125000003710 aryl alkyl group Chemical group 0.000 abstract 2
- FVXYRXMYPXVHNY-UHFFFAOYSA-N 3-propoxy-3,4-dihydro-1H-quinolin-2-one Chemical class C(CC)OC1C(NC2=CC=CC=C2C1)=O FVXYRXMYPXVHNY-UHFFFAOYSA-N 0.000 abstract 1
- 206010002383 Angina Pectoris Diseases 0.000 abstract 1
- 206010020772 Hypertension Diseases 0.000 abstract 1
- 150000003973 alkyl amines Chemical class 0.000 abstract 1
- 230000000903 blocking effect Effects 0.000 abstract 1
- 229910052736 halogen Inorganic materials 0.000 abstract 1
- 150000002367 halogens Chemical group 0.000 abstract 1
- 150000002431 hydrogen Chemical group 0.000 abstract 1
- 229910052739 hydrogen Inorganic materials 0.000 abstract 1
- 239000001257 hydrogen Substances 0.000 abstract 1
- 230000001077 hypotensive effect Effects 0.000 abstract 1
- 230000001788 irregular Effects 0.000 abstract 1
- 210000005036 nerve Anatomy 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
- C07D215/24—Oxygen atoms attached in position 8
- C07D215/26—Alcohols; Ethers thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Quinoline Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP49129386A JPS5156461A (en) | 1974-11-08 | 1974-11-08 | *33 arukiruamino 22 hidorokishi * purohokishi 3*44 jihidorokarubosuchirirujudotaino seizoho |
| JP49129387A JPS5156462A (en) | 1974-11-08 | 1974-11-08 | 55 * 33 arukiruamino 22 hidorokishi * purohokishi 88 hidorokishi 3*44 jihidorokarubosuchiriruno seizoho |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SE7512498L true SE7512498L (sv) | 1976-05-10 |
| SE428015B SE428015B (sv) | 1983-05-30 |
Family
ID=26464802
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7512498A SE428015B (sv) | 1974-11-08 | 1975-11-07 | Forfarande for framstellning av 3.4-dihydrokarbostyrilderivat |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4072683A (xx) |
| AR (1) | AR215578A1 (xx) |
| AT (1) | AT349020B (xx) |
| CH (2) | CH618430A5 (xx) |
| DE (1) | DE2549889C2 (xx) |
| DK (1) | DK144697C (xx) |
| ES (1) | ES442455A1 (xx) |
| FI (1) | FI58329C (xx) |
| FR (2) | FR2290207A1 (xx) |
| GB (2) | GB1505900A (xx) |
| NL (1) | NL181107C (xx) |
| NO (1) | NO145238C (xx) |
| SE (1) | SE428015B (xx) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4210753A (en) * | 1976-03-17 | 1980-07-01 | Otsuka Pharmaceutical Co., Ltd. | Carbostyril compounds |
| CH619453A5 (xx) * | 1976-03-17 | 1980-09-30 | Otsuka Pharma Co Ltd | |
| JPS609713B2 (ja) * | 1976-10-08 | 1985-03-12 | 大塚製薬株式会社 | カルボスチリル誘導体 |
| US4314943A (en) * | 1977-07-13 | 1982-02-09 | Mead Johnson & Company | Heterocyclic substituted aryloxy 3-indolyl-tertiary butylaminopropanols |
| JPS5535019A (en) * | 1978-09-01 | 1980-03-11 | Otsuka Pharmaceut Co Ltd | Carbostyryl derivative |
| US4495352A (en) * | 1979-02-13 | 1985-01-22 | Mead Johnson & Company | Heterocyclic substituted aryloxy 3-indolyl-tertiary butylaminopropanols |
| DE2909035A1 (de) * | 1979-03-08 | 1980-09-18 | Hoechst Ag | 8-oxo-5,6,7,8-tetrahydro-2-chinolon und verfahren zu dessen herstellung |
| US4322425A (en) * | 1980-03-14 | 1982-03-30 | Otsuka Pharmaceutical Co., Ltd. | Compositions for treating glaucoma |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1058822A (en) * | 1963-07-30 | 1967-02-15 | Ici Ltd | 3-amino-2-hydroxypropoxy heterocyclic derivatives |
| NL6400510A (xx) * | 1964-01-23 | 1965-07-26 | ||
| JPS421182Y1 (xx) * | 1964-01-24 | 1967-01-24 | ||
| US3910924A (en) * | 1972-04-13 | 1975-10-07 | Otsuka Pharma Co Ltd | 3,4-Dihydrocarbostyril derivatives and a process for preparing the same |
| JPS48103590A (xx) * | 1972-04-13 | 1973-12-25 | ||
| AR207554A1 (es) * | 1972-12-02 | 1976-10-15 | Otsuka Pharma Co Ltd | Procedimiento para producir derivados de 3-alquil-5-((3,4-dihidro-5-carbostiril)oximetil)-oxazolidinona-(2) |
| JPS5239035B2 (xx) * | 1972-12-14 | 1977-10-03 |
-
1975
- 1975-11-05 FI FI753097A patent/FI58329C/fi not_active IP Right Cessation
- 1975-11-06 DE DE2549889A patent/DE2549889C2/de not_active Expired
- 1975-11-07 AT AT850975A patent/AT349020B/de not_active IP Right Cessation
- 1975-11-07 NO NO753739A patent/NO145238C/no unknown
- 1975-11-07 AR AR261112A patent/AR215578A1/es active
- 1975-11-07 SE SE7512498A patent/SE428015B/xx not_active IP Right Cessation
- 1975-11-07 DK DK502575A patent/DK144697C/da not_active IP Right Cessation
- 1975-11-07 FR FR7534056A patent/FR2290207A1/fr active Granted
- 1975-11-07 GB GB36139/77A patent/GB1505900A/en not_active Expired
- 1975-11-07 NL NLAANVRAGE7513098,A patent/NL181107C/xx not_active IP Right Cessation
- 1975-11-07 GB GB46233/75A patent/GB1505899A/en not_active Expired
- 1975-11-07 ES ES442455A patent/ES442455A1/es not_active Expired
- 1975-11-07 CH CH1445975A patent/CH618430A5/de not_active IP Right Cessation
- 1975-11-10 US US05/630,631 patent/US4072683A/en not_active Expired - Lifetime
-
1976
- 1976-05-26 FR FR7615953A patent/FR2303801A1/fr active Granted
-
1980
- 1980-07-23 CH CH563880A patent/CH624673A5/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| ATA850975A (de) | 1978-08-15 |
| DK502575A (da) | 1976-05-09 |
| NL181107B (nl) | 1987-01-16 |
| FR2303801B1 (xx) | 1978-05-19 |
| DE2549889C2 (de) | 1985-06-05 |
| FR2290207A1 (fr) | 1976-06-04 |
| CH624673A5 (xx) | 1981-08-14 |
| DK144697C (da) | 1982-11-08 |
| DK144697B (da) | 1982-05-17 |
| NL7513098A (nl) | 1976-05-11 |
| CH618430A5 (xx) | 1980-07-31 |
| FI58329C (fi) | 1981-01-12 |
| NL181107C (nl) | 1987-06-16 |
| ES442455A1 (es) | 1977-07-16 |
| NO753739L (xx) | 1976-05-11 |
| US4072683A (en) | 1978-02-07 |
| NO145238B (no) | 1981-11-02 |
| DE2549889A1 (de) | 1976-05-20 |
| FR2303801A1 (fr) | 1976-10-08 |
| AT349020B (de) | 1979-03-12 |
| FI58329B (fi) | 1980-09-30 |
| NO145238C (no) | 1982-02-10 |
| FR2290207B1 (xx) | 1978-09-22 |
| GB1505899A (en) | 1978-03-30 |
| SE428015B (sv) | 1983-05-30 |
| AU8647675A (en) | 1977-05-19 |
| AR215578A1 (es) | 1979-10-31 |
| GB1505900A (en) | 1978-03-30 |
| FI753097A7 (xx) | 1976-05-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IE35034L (en) | Thiochroman derivatives | |
| DK345989D0 (da) | Quinolinderivater | |
| SE7512498L (sv) | 3,4-dihydrokarbostyrilderivat | |
| KR860004049A (ko) | 퀴놀론카복실산 유도체의 제조방법 | |
| FI881950A0 (fi) | Hyönteisten ja punkkien karkoitteet | |
| DK464885A (da) | Tetrahydronaphthalenderivater | |
| FI870973A0 (fi) | Heteroaryl-oxi- -karbolinderivat, deras framstaellning och deras anvaendning som laekemedel. | |
| ES399786A1 (es) | Procedimiento para la preparacion de ureas n, n, n',-tetra-sustituidas. | |
| SE8001818L (sv) | Merkaptoacyldihydropyrazolkarboxylsyraderivat | |
| GB1378127A (en) | Scopolamine derivatives | |
| GB1019784A (en) | New benzene-sulphonyl-semicarbazides | |
| ES395380A1 (es) | Un procedimiento para la produccion de un compuesto de car-bamato. | |
| ES363655A1 (es) | Procedimiento de preparacion de (p-fluoro butiro fenonil)-1piperazinas. | |
| GB1509005A (en) | 2-phenoxymethylene-1,4-benzodioxan derivatives | |
| KR870005989A (ko) | 신규 이소인돌린 유도체 및 그의 제조법 | |
| GB1156781A (en) | New Heterocyclic Compounds | |
| KR840009282A (ko) | 스티렌 유도체의 제조방법 | |
| GB1316364A (en) | 5h-dibenz-b,f-azepine derivatives and the preparation thereof | |
| KR870007908A (ko) | 인덴류 화합물의 제조방법 | |
| HUP9702411A2 (hu) | Fenoxi-alkil-amin-származékok és a vegyületeket tartalmazó antiaritmiás hatású gyógyszerkészítmények | |
| JPS5430180A (en) | 3,4-dihydrocarbostyril derivative | |
| KR860007222A (ko) | 벤조[a]페나진 유도체의 제조방법 | |
| TW264466B (xx) | ||
| GB1271571A (en) | Basic monoazo dyes, their production and use | |
| ES334297A1 (es) | Un procedimiento para la preparacion de benzodiacepina. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NAL | Patent in force |
Ref document number: 7512498-2 Format of ref document f/p: F |
|
| NUG | Patent has lapsed |
Ref document number: 7512498-2 Format of ref document f/p: F |