SE437741B - Sammansatt isolator for hogspenningsluftledningar - Google Patents
Sammansatt isolator for hogspenningsluftledningarInfo
- Publication number
- SE437741B SE437741B SE7706452A SE7706452A SE437741B SE 437741 B SE437741 B SE 437741B SE 7706452 A SE7706452 A SE 7706452A SE 7706452 A SE7706452 A SE 7706452A SE 437741 B SE437741 B SE 437741B
- Authority
- SE
- Sweden
- Prior art keywords
- plates
- rod
- insulator
- intermediate layer
- insulator according
- Prior art date
Links
- 239000000203 mixture Substances 0.000 title description 3
- 239000012212 insulator Substances 0.000 claims description 69
- 229920000642 polymer Polymers 0.000 claims description 15
- 239000000945 filler Substances 0.000 claims description 14
- 239000003365 glass fiber Substances 0.000 claims description 12
- 239000003513 alkali Substances 0.000 claims description 9
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 claims description 9
- 239000003822 epoxy resin Substances 0.000 claims description 8
- 230000009477 glass transition Effects 0.000 claims description 8
- 229920000647 polyepoxide Polymers 0.000 claims description 8
- 229920005989 resin Polymers 0.000 claims description 8
- 239000011347 resin Substances 0.000 claims description 8
- 235000012239 silicon dioxide Nutrition 0.000 claims description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 7
- 239000011521 glass Substances 0.000 claims description 7
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 claims description 6
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 claims description 6
- WNROFYMDJYEPJX-UHFFFAOYSA-K aluminium hydroxide Chemical compound [OH-].[OH-].[OH-].[Al+3] WNROFYMDJYEPJX-UHFFFAOYSA-K 0.000 claims description 5
- 239000004033 plastic Substances 0.000 claims description 5
- 229920003023 plastic Polymers 0.000 claims description 5
- 229920002379 silicone rubber Polymers 0.000 claims description 5
- 229920001971 elastomer Polymers 0.000 claims description 4
- HQQADJVZYDDRJT-UHFFFAOYSA-N ethene;prop-1-ene Chemical group C=C.CC=C HQQADJVZYDDRJT-UHFFFAOYSA-N 0.000 claims description 4
- 239000011152 fibreglass Substances 0.000 claims description 4
- 239000005871 repellent Substances 0.000 claims description 4
- 239000004945 silicone rubber Substances 0.000 claims description 4
- 150000008064 anhydrides Chemical class 0.000 claims description 3
- 150000004984 aromatic diamines Chemical class 0.000 claims description 3
- 229910044991 metal oxide Inorganic materials 0.000 claims description 3
- 150000004706 metal oxides Chemical class 0.000 claims description 3
- 229920001155 polypropylene Polymers 0.000 claims description 3
- 230000002787 reinforcement Effects 0.000 claims description 3
- 150000004756 silanes Chemical class 0.000 claims description 3
- UKRDPEFKFJNXQM-UHFFFAOYSA-N vinylsilane Chemical compound [SiH3]C=C UKRDPEFKFJNXQM-UHFFFAOYSA-N 0.000 claims description 3
- 150000001875 compounds Chemical class 0.000 claims description 2
- 238000004381 surface treatment Methods 0.000 claims description 2
- 125000002777 acetyl group Chemical class [H]C([H])([H])C(*)=O 0.000 claims 1
- 239000004575 stone Substances 0.000 claims 1
- 239000000463 material Substances 0.000 description 33
- 238000012360 testing method Methods 0.000 description 18
- 239000002131 composite material Substances 0.000 description 16
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- 239000011230 binding agent Substances 0.000 description 10
- 238000009835 boiling Methods 0.000 description 9
- 239000004848 polyfunctional curative Substances 0.000 description 8
- 238000010791 quenching Methods 0.000 description 8
- 230000000171 quenching effect Effects 0.000 description 8
- 238000004519 manufacturing process Methods 0.000 description 5
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 4
- 238000010276 construction Methods 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- CBENFWSGALASAD-UHFFFAOYSA-N Ozone Chemical compound [O-][O+]=O CBENFWSGALASAD-UHFFFAOYSA-N 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 230000035515 penetration Effects 0.000 description 3
- 238000007789 sealing Methods 0.000 description 3
- 230000035939 shock Effects 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical group CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- 229920000181 Ethylene propylene rubber Polymers 0.000 description 2
- -1 aliphatic polyols Chemical class 0.000 description 2
- 239000011353 cycloaliphatic epoxy resin Substances 0.000 description 2
- 238000009792 diffusion process Methods 0.000 description 2
- GYZLOYUZLJXAJU-UHFFFAOYSA-N diglycidyl ether Chemical compound C1OC1COCC1CO1 GYZLOYUZLJXAJU-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000000806 elastomer Substances 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- 235000013312 flour Nutrition 0.000 description 2
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 description 2
- 230000002209 hydrophobic effect Effects 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 239000010453 quartz Substances 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 239000004408 titanium dioxide Substances 0.000 description 2
- 229920006337 unsaturated polyester resin Polymers 0.000 description 2
- MUTGBJKUEZFXGO-OLQVQODUSA-N (3as,7ar)-3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione Chemical compound C1CCC[C@@H]2C(=O)OC(=O)[C@@H]21 MUTGBJKUEZFXGO-OLQVQODUSA-N 0.000 description 1
- 229930185605 Bisphenol Natural products 0.000 description 1
- 206010053317 Hydrophobia Diseases 0.000 description 1
- 206010037742 Rabies Diseases 0.000 description 1
- 230000006750 UV protection Effects 0.000 description 1
- UKLDJPRMSDWDSL-UHFFFAOYSA-L [dibutyl(dodecanoyloxy)stannyl] dodecanoate Chemical compound CCCCCCCCCCCC(=O)O[Sn](CCCC)(CCCC)OC(=O)CCCCCCCCCCC UKLDJPRMSDWDSL-UHFFFAOYSA-L 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- XFUOBHWPTSIEOV-UHFFFAOYSA-N bis(oxiran-2-ylmethyl) cyclohexane-1,2-dicarboxylate Chemical compound C1CCCC(C(=O)OCC2OC2)C1C(=O)OCC1CO1 XFUOBHWPTSIEOV-UHFFFAOYSA-N 0.000 description 1
- 229960004424 carbon dioxide Drugs 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 238000005266 casting Methods 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000003431 cross linking reagent Substances 0.000 description 1
- QSAWQNUELGIYBC-UHFFFAOYSA-N cyclohexane-1,2-dicarboxylic acid Chemical compound OC(=O)C1CCCCC1C(O)=O QSAWQNUELGIYBC-UHFFFAOYSA-N 0.000 description 1
- 238000013461 design Methods 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 239000012975 dibutyltin dilaurate Substances 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- 125000005442 diisocyanate group Chemical group 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- KPUWHANPEXNPJT-UHFFFAOYSA-N disiloxane Chemical class [SiH3]O[SiH3] KPUWHANPEXNPJT-UHFFFAOYSA-N 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 150000002118 epoxides Chemical group 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 238000010304 firing Methods 0.000 description 1
- 238000005755 formation reaction Methods 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 239000004519 grease Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 238000001746 injection moulding Methods 0.000 description 1
- 238000009434 installation Methods 0.000 description 1
- 239000012774 insulation material Substances 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 239000012764 mineral filler Substances 0.000 description 1
- 239000012766 organic filler Substances 0.000 description 1
- 239000011101 paper laminate Substances 0.000 description 1
- 230000035699 permeability Effects 0.000 description 1
- 229920001225 polyester resin Polymers 0.000 description 1
- 239000004645 polyester resin Substances 0.000 description 1
- 229920005862 polyol Polymers 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 229910052573 porcelain Inorganic materials 0.000 description 1
- 230000008092 positive effect Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000011265 semifinished product Substances 0.000 description 1
- 229920005573 silicon-containing polymer Polymers 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 239000007790 solid phase Substances 0.000 description 1
- 229910052572 stoneware Inorganic materials 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 230000002459 sustained effect Effects 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- 150000004684 trihydrates Chemical class 0.000 description 1
- 229930195735 unsaturated hydrocarbon Natural products 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01B—CABLES; CONDUCTORS; INSULATORS; SELECTION OF MATERIALS FOR THEIR CONDUCTIVE, INSULATING OR DIELECTRIC PROPERTIES
- H01B17/00—Insulators or insulating bodies characterised by their form
- H01B17/32—Single insulators consisting of two or more dissimilar insulating bodies
Landscapes
- Insulators (AREA)
- Insulating Bodies (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2650363A DE2650363C2 (de) | 1976-11-03 | 1976-11-03 | Verbundisolator für Hochspannungsfreiluft-Anwendungen |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SE7706452L SE7706452L (sv) | 1978-05-04 |
| SE437741B true SE437741B (sv) | 1985-03-11 |
Family
ID=5992351
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7706452A SE437741B (sv) | 1976-11-03 | 1977-06-02 | Sammansatt isolator for hogspenningsluftledningar |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4217466A (show.php) |
| AT (1) | AT359576B (show.php) |
| CA (1) | CA1118856A (show.php) |
| CH (1) | CH643676A5 (show.php) |
| DE (1) | DE2650363C2 (show.php) |
| FR (1) | FR2370345A1 (show.php) |
| GB (1) | GB1596659A (show.php) |
| SE (1) | SE437741B (show.php) |
| ZA (1) | ZA775030B (show.php) |
Families Citing this family (35)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2746870C2 (de) * | 1977-10-19 | 1982-08-26 | Rosenthal Technik Ag, 8672 Selb | Verfahren zur Herstellung von Freiluft-Verbundisolatoren |
| FR2412150A1 (fr) * | 1977-12-14 | 1979-07-13 | Ceraver | Isolateur electrique de ligne en matiere organique |
| US4312123A (en) * | 1979-03-12 | 1982-01-26 | Interpace Corporation | Methods of making high voltage electrical insulators and oil-less bushings |
| US4505033A (en) * | 1979-03-12 | 1985-03-19 | Interpace Corporation | Methods of making high voltage resistant members |
| DE2913673A1 (de) * | 1979-04-05 | 1980-10-16 | Felten & Guilleaume Carlswerk | Hochspannungsdurchfuehrung in freiluftausfuehrung |
| US4355200A (en) * | 1980-10-27 | 1982-10-19 | Interpace Corporation | Polymer rod insulator with improved radio noise and corona characteristics |
| DE3172780D1 (en) * | 1981-11-04 | 1985-12-05 | Hoechst Ceram Tec Ag | Composite insulator |
| FR2525021B1 (fr) * | 1982-04-08 | 1985-06-21 | Interpace Corp | Isolateur suspendu a fut massif, en matiere polymere, a caracteristiques anti-corona et anti-pertubatrices ameliorees |
| FR2576655B1 (fr) * | 1985-01-25 | 1990-02-23 | Alsthom Atlantique | Hauban isolant |
| HU194293B (en) * | 1985-05-17 | 1988-01-28 | Villamos Ipari Kutato Intezet | Process and equipment for production of forms from materials based on siliconelastomer and resistant against harms made by birds |
| US4749824A (en) * | 1987-01-30 | 1988-06-07 | Dow Corning Corporation | High voltage insulators |
| WO1993026015A1 (en) * | 1992-06-12 | 1993-12-23 | Mac Lean-Fogg Company | Weathershed |
| US5406033A (en) * | 1992-09-02 | 1995-04-11 | Maclean-Fogg Company | Insulator structure and method of construction |
| US5374780A (en) * | 1992-09-02 | 1994-12-20 | Maclean Fogg Company | Composite insulator structure and method of construction |
| USD375079S (en) | 1995-02-21 | 1996-10-29 | Maclean-Fogg Company | Power line insulator |
| SE506172C2 (sv) * | 1996-02-29 | 1997-11-17 | Ramkiw Ab | Anordning för isolering av högspänningsledare |
| JP3406776B2 (ja) * | 1996-05-24 | 2003-05-12 | 東レ・ダウコーニング・シリコーン株式会社 | 電気絶縁材料用シリコーンゴム組成物 |
| US5902963A (en) * | 1996-09-18 | 1999-05-11 | Schneider Electric | High voltage insulator |
| US6501029B1 (en) | 1999-12-03 | 2002-12-31 | Electro Composites, Inc. | High-voltage homogeneous co-curing composite insulator |
| CA2349253C (en) | 2000-12-26 | 2009-11-17 | S&C Electric Company | Method and arrangement for providing a gas-tight housing joint |
| US6441310B1 (en) | 2001-03-30 | 2002-08-27 | Hubbell Incorporated | Moisture activated barrier for electrical assemblies |
| US7044458B2 (en) | 2001-04-30 | 2006-05-16 | Maclean-Fogg Company | Stabilizer bar |
| US6831232B2 (en) * | 2002-06-16 | 2004-12-14 | Scott Henricks | Composite insulator |
| US6952154B2 (en) * | 2002-06-16 | 2005-10-04 | Maclean-Fogg Company | Composite insulator for fuse cutout |
| JP2005142106A (ja) * | 2003-11-10 | 2005-06-02 | Ngk Insulators Ltd | 鳥害防止ポリマー碍子 |
| DE102004050128A1 (de) * | 2004-10-14 | 2006-04-20 | Wacker Chemie Ag | Siliconkautschuk Zusammensetzung mit verbesserter Haltbarkeit |
| DE102004050129A1 (de) * | 2004-10-14 | 2006-04-20 | Wacker Chemie Ag | Siliconkautschuk Zusammensetzung enthaltend unbehandeltes Aluminiumhydroxid als Füllstoff |
| US20060157269A1 (en) * | 2005-01-18 | 2006-07-20 | Kopp Alvin B | Methods and apparatus for electric bushing fabrication |
| EP1748449A1 (de) * | 2005-07-25 | 2007-01-31 | Siemens Aktiengesellschaft | Isolator mit erhöhter Isolationsfähigkeit |
| US7646282B2 (en) * | 2007-12-14 | 2010-01-12 | Jiri Pazdirek | Insulator for cutout switch and fuse assembly |
| US8729396B2 (en) | 2010-09-02 | 2014-05-20 | Cooper Technologies Company | Full composite insulator for electrical cutout |
| EP2700079B1 (fr) * | 2011-04-19 | 2018-10-24 | Sediver Société Europeenne d'Isolateurs en Verre et Composite | Procédé de fabrication d'un isolateur composite utilisant une résine à haute performance thermique |
| IL275626B2 (en) * | 2018-01-05 | 2024-07-01 | Fujifilm Electronic Mat Usa Inc | Surface treatment compositions and methods |
| CN108257741B (zh) | 2018-03-27 | 2021-04-23 | 江苏神马电力股份有限公司 | 一种支柱绝缘子及绝缘支柱 |
| EP3591672B1 (en) * | 2018-07-02 | 2023-03-29 | Hitachi Energy Switzerland AG | Insulator with resistivity gradient |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1081223B (de) * | 1958-12-09 | 1960-05-05 | Licentia Gmbh | Verfahren zur Verbesserung der Kriechstromfestigkeit von mit Quarz oder kieselsaeure- bzw. titandioxydhaltigen Fuellmitteln gefuellten Epoxyharzen |
| GB1116197A (en) * | 1966-04-06 | 1968-06-06 | British Insulated Callenders | Improvements in or relating to electric insulators |
| GB1292276A (en) * | 1968-09-04 | 1972-10-11 | Raychem Ltd | Improvements in and relating to insulators |
| DE1921299B2 (de) * | 1969-04-25 | 1974-06-12 | Rheinisch-Westfaelische Isolatorenwerke Gmbh, 5200 Siegburg | Glasfaserverstärkter Kunststoff-Hängeisolator |
| DE2044179C3 (de) * | 1970-09-05 | 1975-01-09 | Rosenthal Technik Ag, 8672 Selb | Verfahren zur Herstellung von Kunststoff-Verbundisolatoren und Vorrichtung zur Durchführung dieses Verfahrens |
| US4001128A (en) * | 1972-07-21 | 1977-01-04 | Raychem Corporation | High voltage insulating materials |
| US3898372A (en) * | 1974-02-11 | 1975-08-05 | Ohio Brass Co | Insulator with resin-bonded fiber rod and elastomeric weathersheds, and method of making same |
| DE2425076A1 (de) * | 1974-05-24 | 1975-11-27 | Rhein Westfael Isolatoren | Verfahren zur herstellung von kunststoffisolatoren |
-
1976
- 1976-11-03 DE DE2650363A patent/DE2650363C2/de not_active Expired
-
1977
- 1977-06-02 SE SE7706452A patent/SE437741B/sv not_active IP Right Cessation
- 1977-06-06 AT AT398477A patent/AT359576B/de not_active IP Right Cessation
- 1977-08-08 CH CH971377A patent/CH643676A5/de not_active IP Right Cessation
- 1977-08-19 ZA ZA00775030A patent/ZA775030B/xx unknown
- 1977-11-02 GB GB45499/77A patent/GB1596659A/en not_active Expired
- 1977-11-03 FR FR7733033A patent/FR2370345A1/fr active Granted
- 1977-11-03 CA CA000290138A patent/CA1118856A/en not_active Expired
- 1977-11-03 US US05/848,297 patent/US4217466A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| ATA398477A (de) | 1980-04-15 |
| FR2370345B1 (show.php) | 1982-12-10 |
| SE7706452L (sv) | 1978-05-04 |
| FR2370345A1 (fr) | 1978-06-02 |
| ZA775030B (en) | 1978-07-26 |
| CH643676A5 (de) | 1984-06-15 |
| CA1118856A (en) | 1982-02-23 |
| DE2650363C2 (de) | 1985-10-10 |
| US4217466A (en) | 1980-08-12 |
| AT359576B (de) | 1980-11-25 |
| GB1596659A (en) | 1981-08-26 |
| DE2650363A1 (de) | 1977-11-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE437741B (sv) | Sammansatt isolator for hogspenningsluftledningar | |
| US4312123A (en) | Methods of making high voltage electrical insulators and oil-less bushings | |
| US4505033A (en) | Methods of making high voltage resistant members | |
| US4373113A (en) | High-voltage polymeric insulator with sheath of elastic and rigid segments and method of making same | |
| US3177902A (en) | Reinforced pipe and method of making | |
| EP0364288B1 (en) | Optical fiber composite insulator and method of producing the same | |
| SE446572B (sv) | Isolator samt sett att framstella en isolator | |
| BRPI0615368A2 (pt) | processo para a fabricação de partes do pólo do comutador para instalações de comutação de tensão baixa, média e alta, assim como da própria parte do pólo do comutador | |
| US4343966A (en) | Electric line insulator made of organic material and having an inner semi-conductive part extending between end anchor fittings | |
| US7989704B2 (en) | Electric insulator and a method for the production thereof | |
| SE526713C2 (sv) | Genomföring samt förfarande för tillverkning av genomföringen | |
| EP0676448B1 (en) | Epoxy resin composition and resin molding using the same | |
| US3952848A (en) | Section insulators of electric traction systems | |
| US20140054063A1 (en) | Method of manufacturing a composite insulator using a resin with high thermal performance | |
| US4952342A (en) | Dual cure method for making a rotted electrical/mechanical device | |
| US2930011A (en) | Transformers with molded containers | |
| EP1632538B1 (en) | Cryogenetic insulation | |
| CN109524185B (zh) | 站用复合绝缘子及其生产工艺 | |
| US4190736A (en) | Electrical insulator and method of making same | |
| Hermann et al. | Effect of specimen geometry on selected physical and mechanical properties of epoxy-based building materials | |
| EP0229464B1 (en) | Frangible housing for an electrical component | |
| US3218288A (en) | Methyl nadic and hexahydrophthalic anhydride as curing agents for epoxidized novolac resins | |
| SU855744A1 (ru) | Электрический изол тор | |
| RU2107349C1 (ru) | Опорно-изоляционная конструкция | |
| JP3621119B2 (ja) | 樹脂モールド品 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NAL | Patent in force |
Ref document number: 7706452-5 Format of ref document f/p: F |
|
| NUG | Patent has lapsed |
Ref document number: 7706452-5 Format of ref document f/p: F |