SE434513B - Sett att framstella nya derivat av 6-((2-oxo-imidazolidin-1-yl)karbonylamino)acetamido)penicillinsyra - Google Patents
Sett att framstella nya derivat av 6-((2-oxo-imidazolidin-1-yl)karbonylamino)acetamido)penicillinsyraInfo
- Publication number
- SE434513B SE434513B SE7513378A SE7513378A SE434513B SE 434513 B SE434513 B SE 434513B SE 7513378 A SE7513378 A SE 7513378A SE 7513378 A SE7513378 A SE 7513378A SE 434513 B SE434513 B SE 434513B
- Authority
- SE
- Sweden
- Prior art keywords
- imidazolidin
- carbonylamino
- acetamido
- oxo
- make new
- Prior art date
Links
- -1 (2-OXO-IMIDAZOLIDIN-1-YL) CARBONYLAMINO Chemical class 0.000 title 2
- WNPVZANXRCPJPW-UHFFFAOYSA-N 5-[isocyano-(4-methylphenyl)sulfonylmethyl]-1,2,3-trimethoxybenzene Chemical compound COC1=C(OC)C(OC)=CC(C([N+]#[C-])S(=O)(=O)C=2C=CC(C)=CC=2)=C1 WNPVZANXRCPJPW-UHFFFAOYSA-N 0.000 title 1
- YCOFRPYSZKIPBQ-UHFFFAOYSA-N penicillic acid Natural products COC1=CC(=O)OC1(O)C(C)=C YCOFRPYSZKIPBQ-UHFFFAOYSA-N 0.000 title 1
- VOUGEZYPVGAPBB-UHFFFAOYSA-N penicillin acid Natural products OC(=O)C=C(OC)C(=O)C(C)=C VOUGEZYPVGAPBB-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D505/00—Heterocyclic compounds containing 5-oxa-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. oxacephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/04—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D233/28—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/30—Oxygen or sulfur atoms
- C07D233/32—One oxygen atom
- C07D233/38—One oxygen atom with acyl radicals or hetero atoms directly attached to ring nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D503/00—Heterocyclic compounds containing 4-oxa-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. oxapenicillins, clavulanic acid derivatives; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Communicable Diseases (AREA)
- Pharmacology & Pharmacy (AREA)
- Oncology (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Cephalosporin Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19742456307 DE2456307A1 (de) | 1974-11-28 | 1974-11-28 | Beta-lactam-antibiotica, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| DE19752512998 DE2512998A1 (de) | 1975-03-25 | 1975-03-25 | Beta-lactam-antibiotica, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| DE19752525541 DE2525541C2 (de) | 1975-06-07 | 1975-06-07 | β-Lactam-Antibiotica, Verfahren zu ihrer Herstellung sowie sie enthaltende Arzneimittel |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SE7513378L SE7513378L (sv) | 1976-05-31 |
| SE434513B true SE434513B (sv) | 1984-07-30 |
Family
ID=27186174
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7513378A SE434513B (sv) | 1974-11-28 | 1975-11-27 | Sett att framstella nya derivat av 6-((2-oxo-imidazolidin-1-yl)karbonylamino)acetamido)penicillinsyra |
Country Status (22)
| Country | Link |
|---|---|
| US (1) | US4147693A (enExample) |
| JP (2) | JPS5182286A (enExample) |
| AR (1) | AR210103A1 (enExample) |
| AT (1) | AT342196B (enExample) |
| AU (1) | AU499337B2 (enExample) |
| CA (1) | CA1064020A (enExample) |
| CH (1) | CH623326A5 (enExample) |
| DD (1) | DD124736A5 (enExample) |
| DK (1) | DK535675A (enExample) |
| ES (1) | ES443008A1 (enExample) |
| FI (1) | FI66004C (enExample) |
| FR (1) | FR2292471A1 (enExample) |
| GB (1) | GB1486349A (enExample) |
| HK (1) | HK19678A (enExample) |
| IE (1) | IE43813B1 (enExample) |
| IL (1) | IL48538A (enExample) |
| LU (1) | LU73873A1 (enExample) |
| NL (1) | NL7513746A (enExample) |
| NO (1) | NO753818L (enExample) |
| NZ (1) | NZ179347A (enExample) |
| RO (1) | RO68146A (enExample) |
| SE (1) | SE434513B (enExample) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4061861A (en) * | 1976-06-21 | 1977-12-06 | Eli Lilly And Company | 7-[α-(2,3-DIHYDRO-2-OXO-1H-benzimidazol-1-ylcarbonyl-amino)arylacetamido]cephalosporins |
| JPS5326143A (en) * | 1976-08-24 | 1978-03-10 | Oki Electric Ind Co Ltd | Coupling method for op tical fiber |
| JPS5331690A (en) * | 1976-09-01 | 1978-03-25 | Shionogi & Co Ltd | Oxadithiacephalosporins |
| GB1584400A (en) * | 1976-12-24 | 1981-02-11 | Bayer Ag | (2-oxo-imidazoliden-1-yl(carbonylamino)-acetamido-cephalosporins and penicillins |
| DE2732283A1 (de) * | 1977-07-16 | 1979-01-25 | Bayer Ag | Beta-lactam-verbindungen |
| JPS5616489A (en) * | 1979-07-20 | 1981-02-17 | Ajinomoto Co Inc | Imidazolecarboxylic acid derivative |
| US4386199A (en) * | 1980-01-03 | 1983-05-31 | E. R. Squibb & Sons, Inc. | Cephalosporins having an imino substituted piperazindioncarbonylamino acyl sidechain |
| US4436904A (en) * | 1981-02-14 | 1984-03-13 | Kanto Ishi Pharmaceutical Co., Ltd. | Cephalosporins |
| DE3137038A1 (de) | 1981-09-17 | 1983-03-24 | Bayer Ag, 5090 Leverkusen | Ss-lactam antibiotika, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| GB8318846D0 (en) * | 1983-07-12 | 1983-08-10 | Fujisawa Pharmaceutical Co | Prophylactic/therapeutic agent against fish diseases |
| CN103360321B (zh) * | 2012-04-05 | 2016-09-21 | 北京勤邦生物技术有限公司 | 呋喃妥因代谢物半抗原及其制备方法和应用 |
| CN111995663B (zh) * | 2020-09-02 | 2023-07-28 | 重庆大学 | 一种含有N-氨基咪唑烷-2-酮结构的Ang-(1-7)多肽类似物 |
Family Cites Families (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH562249A5 (enExample) * | 1970-05-25 | 1975-05-30 | Bayer Ag | |
| US3939149A (en) * | 1970-05-25 | 1976-02-17 | Bayer Aktiengesellschaft | Ureidoacetamido-penicillins |
| US3980792A (en) * | 1970-05-25 | 1976-09-14 | Bayer Aktiengesellschaft | Ureidoacetamido-penicillins |
| US3974140A (en) * | 1970-05-25 | 1976-08-10 | Bayer Aktiengesellschaft | Ureidoacetamido-penicillins |
| CH571524A5 (enExample) * | 1970-05-25 | 1976-01-15 | Bayer Ag | |
| US3732332A (en) * | 1970-10-16 | 1973-05-08 | Allied Chem | Production of low molecular weight polyanhydrides and epoxy compositions derived therefrom |
| BE790441A (fr) * | 1971-10-23 | 1973-04-24 | Bayer Ag | Nouvelles penicillines, leur procede de preparation et medicament les contenant |
| US3974142A (en) * | 1971-10-23 | 1976-08-10 | Bayer Aktiengesellschaft | Penicillins |
| US3972870A (en) * | 1971-10-23 | 1976-08-03 | Bayer Aktiengesellschaft | Penicillins |
| NL175419C (nl) * | 1971-10-23 | 1984-11-01 | Bayer Ag | Werkwijze ter bereiding of vervaardiging van antibiotisch werkzame farmaceutische preparaten, alsmede werkwijze ter bereiding van antibiotisch werkzame alfa-gesubstitueerde 6-(alfa-(3-acylureido)acetylamino) penicillanzuurderivaten. |
| US3974141A (en) * | 1971-10-23 | 1976-08-10 | Bayer Aktiengesellschaft | Penicillins |
| US3983105A (en) * | 1971-10-23 | 1976-09-28 | Bayer Aktiengesellschaft | Penicillins |
| US3978056A (en) * | 1971-10-23 | 1976-08-31 | Bayer Aktiengesellschaft | Penicillins |
| DE2354219A1 (de) * | 1973-10-30 | 1975-05-07 | Bayer Ag | Beta-lactam-antibiotica, ein verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
-
1975
- 1975-10-28 GB GB44296/75A patent/GB1486349A/en not_active Expired
- 1975-11-13 US US05/631,515 patent/US4147693A/en not_active Expired - Lifetime
- 1975-11-14 NO NO753818A patent/NO753818L/no unknown
- 1975-11-18 CA CA239,913A patent/CA1064020A/en not_active Expired
- 1975-11-24 CH CH1523375A patent/CH623326A5/de not_active IP Right Cessation
- 1975-11-25 IL IL48538A patent/IL48538A/xx unknown
- 1975-11-25 NL NL7513746A patent/NL7513746A/xx not_active Application Discontinuation
- 1975-11-25 NZ NZ179347A patent/NZ179347A/xx unknown
- 1975-11-26 RO RO7584030A patent/RO68146A/ro unknown
- 1975-11-26 JP JP50140877A patent/JPS5182286A/ja active Granted
- 1975-11-26 FI FI753333A patent/FI66004C/fi not_active IP Right Cessation
- 1975-11-26 JP JP50140878A patent/JPS6043332B2/ja not_active Expired
- 1975-11-26 LU LU73873A patent/LU73873A1/xx unknown
- 1975-11-26 DD DD189709A patent/DD124736A5/xx unknown
- 1975-11-26 ES ES443008A patent/ES443008A1/es not_active Expired
- 1975-11-27 SE SE7513378A patent/SE434513B/xx unknown
- 1975-11-27 DK DK535675A patent/DK535675A/da not_active Application Discontinuation
- 1975-11-27 IE IE2588/75A patent/IE43813B1/en unknown
- 1975-11-28 AU AU87085/75A patent/AU499337B2/en not_active Expired
- 1975-11-28 FR FR7536543A patent/FR2292471A1/fr active Granted
- 1975-11-28 AT AT907275A patent/AT342196B/de not_active IP Right Cessation
- 1975-11-28 AR AR261391A patent/AR210103A1/es active
-
1978
- 1978-04-13 HK HK196/78A patent/HK19678A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| AR210103A1 (es) | 1977-06-30 |
| ES443008A1 (es) | 1977-05-01 |
| JPS6114151B2 (enExample) | 1986-04-17 |
| FR2292471A1 (fr) | 1976-06-25 |
| FI753333A7 (enExample) | 1976-05-29 |
| DD124736A5 (enExample) | 1977-03-09 |
| IE43813B1 (en) | 1981-06-03 |
| CH623326A5 (enExample) | 1981-05-29 |
| LU73873A1 (enExample) | 1976-09-06 |
| FI66004B (fi) | 1984-04-30 |
| NL7513746A (nl) | 1976-06-01 |
| AT342196B (de) | 1978-03-28 |
| AU499337B2 (en) | 1979-04-12 |
| IL48538A0 (en) | 1976-01-30 |
| JPS5182286A (en) | 1976-07-19 |
| IL48538A (en) | 1979-07-25 |
| JPS5176438A (enExample) | 1976-07-02 |
| HK19678A (en) | 1978-04-20 |
| FR2292471B1 (enExample) | 1981-12-31 |
| AU8708575A (en) | 1977-06-02 |
| DK535675A (da) | 1976-05-29 |
| IE43813L (en) | 1976-05-28 |
| US4147693A (en) | 1979-04-03 |
| NZ179347A (en) | 1978-04-28 |
| RO68146A (ro) | 1980-04-15 |
| JPS6043332B2 (ja) | 1985-09-27 |
| SE7513378L (sv) | 1976-05-31 |
| ATA907275A (de) | 1977-07-15 |
| CA1064020A (en) | 1979-10-09 |
| NO753818L (enExample) | 1976-05-31 |
| FI66004C (fi) | 1984-08-10 |
| GB1486349A (en) | 1977-09-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE439485B (sv) | Sett att framstella nya alkyloximderivat av 7-aminotiazolyl-acetamidocefalosporansyra | |
| SE419645B (sv) | Sett att framstella 3-amino-indazolkarbonylsyra derivat | |
| SE440655B (sv) | Sett att framstella nya oximderivat av 7-amino-tiazolyl-acetamido-cefalosporansyra | |
| SE420599B (sv) | Sett att framstella farmakologiskt aktiva derivat av 4-hydroxi-2-pyrrolidon | |
| SE420204B (sv) | Sett att framstella sulfonsyrasalter av s-adenosylmetionin | |
| SE430502B (sv) | Sett att framstella nya substituerade imidazolidiner | |
| SE441528B (sv) | Sett att framstella nya 3-kinolin-karboxylsyraderivat | |
| SE433492B (sv) | Sett att framstella fenylettiksyraderivat | |
| SE431136B (sv) | Sett att styra veggtjockleken vid strengsprutning av rorformad produkt | |
| SE434513B (sv) | Sett att framstella nya derivat av 6-((2-oxo-imidazolidin-1-yl)karbonylamino)acetamido)penicillinsyra | |
| SE385002B (sv) | Sett att resolvera blandningar av 2- (6-metoxi - 2-naftyl) propionsyra genom spaltning med cinkonidin | |
| SE437155B (sv) | Sett att framstella nya derivat av perhydro-aza-heterocykler | |
| SE7802834L (sv) | Sett att framstella nya oximderivat av 7-amino--tiazolyl-acetamidocefalosporansyra | |
| SE413771B (sv) | Sett att framstella nya derivat av 5h-dibebs(b,f)azepin | |
| SE434842B (sv) | Sett att framstella nya 7-amino-tiazolyl-acetamido-cefalosporansyraderivat | |
| SE392723B (sv) | Forfarande for framstellning av nya derivat av 6-aminopenicilliansyra | |
| SE431983B (sv) | Sett att framstella 15-etylendioxiprostansyraderivat | |
| SE432926B (sv) | Sett att framstella disubstituerade fenoletrar av 3-amino-2-hydroxipropan | |
| SE7612886L (sv) | Sett vid framstellning av koncentrerade suspensioner | |
| SE7610890L (sv) | Forfarande for framstellning av cyanursyra | |
| SE414496B (sv) | Saett att framstaella nya derivat av butyramid | |
| SE412233B (sv) | Sett att framstella nya fenotiazinderivat | |
| SE7509793L (sv) | Sett att framstella nya derivat av 3-formylrifamycin sv | |
| SE384675B (sv) | Forfarande for framstellning av derivat av 4-klor-sulfamoyl-antranilsyra | |
| SE419982B (sv) | Sett att framstella nya 5-karboxialkyl-2-iminobarbitur och -2-tioxobarbitursyraderivat |