SE430985B - Forfarande for kontinuerlig framstellning av lauroylperoxid - Google Patents
Forfarande for kontinuerlig framstellning av lauroylperoxidInfo
- Publication number
- SE430985B SE430985B SE8004735A SE8004735A SE430985B SE 430985 B SE430985 B SE 430985B SE 8004735 A SE8004735 A SE 8004735A SE 8004735 A SE8004735 A SE 8004735A SE 430985 B SE430985 B SE 430985B
- Authority
- SE
- Sweden
- Prior art keywords
- reaction
- process according
- reaction mixture
- temperature
- lauroyl peroxide
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 18
- YIVJZNGAASQVEM-UHFFFAOYSA-N Lauroyl peroxide Chemical compound CCCCCCCCCCCC(=O)OOC(=O)CCCCCCCCCCC YIVJZNGAASQVEM-UHFFFAOYSA-N 0.000 title claims description 15
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 45
- 238000006243 chemical reaction Methods 0.000 claims description 24
- 239000011541 reaction mixture Substances 0.000 claims description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 10
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 6
- 239000000460 chlorine Substances 0.000 claims description 6
- 229910052801 chlorine Inorganic materials 0.000 claims description 6
- 238000001816 cooling Methods 0.000 claims description 6
- NQGIJDNPUZEBRU-UHFFFAOYSA-N dodecanoyl chloride Chemical compound CCCCCCCCCCCC(Cl)=O NQGIJDNPUZEBRU-UHFFFAOYSA-N 0.000 claims description 4
- 229910001385 heavy metal Inorganic materials 0.000 claims description 4
- 238000002844 melting Methods 0.000 claims description 4
- 230000008018 melting Effects 0.000 claims description 4
- 150000003839 salts Chemical class 0.000 claims description 4
- 239000011790 ferrous sulphate Substances 0.000 claims description 3
- 235000003891 ferrous sulphate Nutrition 0.000 claims description 3
- 239000003960 organic solvent Substances 0.000 claims description 3
- 238000003756 stirring Methods 0.000 claims description 3
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 claims description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims 6
- 238000010924 continuous production Methods 0.000 claims 2
- 239000000376 reactant Substances 0.000 claims 2
- POULHZVOKOAJMA-UHFFFAOYSA-N dodecanoic acid Chemical compound CCCCCCCCCCCC(O)=O POULHZVOKOAJMA-UHFFFAOYSA-N 0.000 description 8
- 239000002253 acid Substances 0.000 description 7
- 239000002699 waste material Substances 0.000 description 7
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 5
- 239000005639 Lauric acid Substances 0.000 description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- 238000005187 foaming Methods 0.000 description 3
- 159000000014 iron salts Chemical class 0.000 description 3
- 239000012452 mother liquor Substances 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 239000002351 wastewater Substances 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 230000007423 decrease Effects 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 150000001844 chromium Chemical class 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- XEEYBQQBJWHFJM-UHFFFAOYSA-N iron Substances [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- -1 iron ions Chemical class 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 230000007306 turnover Effects 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C409/00—Peroxy compounds
- C07C409/32—Peroxy compounds the —O—O— group being bound between two >C=O groups
- C07C409/34—Peroxy compounds the —O—O— group being bound between two >C=O groups both belonging to carboxylic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C407/00—Preparation of peroxy compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C407/00—Preparation of peroxy compounds
- C07C407/003—Separation; Purification; Stabilisation; Use of additives
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2928020A DE2928020C2 (de) | 1979-07-11 | 1979-07-11 | Verfahren zur kontinuierlichen Herstellung von Lauroylperoxid |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SE8004735L SE8004735L (sv) | 1981-01-12 |
| SE430985B true SE430985B (sv) | 1983-12-27 |
Family
ID=6075453
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE8004735A SE430985B (sv) | 1979-07-11 | 1980-06-26 | Forfarande for kontinuerlig framstellning av lauroylperoxid |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US4782189A (show.php) |
| JP (1) | JPS5649349A (show.php) |
| AU (1) | AU537837B2 (show.php) |
| BE (1) | BE884227A (show.php) |
| BR (1) | BR8004292A (show.php) |
| CA (1) | CA1138001A (show.php) |
| DD (1) | DD151935A5 (show.php) |
| DE (1) | DE2928020C2 (show.php) |
| DK (1) | DK298780A (show.php) |
| ES (1) | ES8104221A1 (show.php) |
| FR (1) | FR2460928A1 (show.php) |
| GB (1) | GB2054583B (show.php) |
| IT (1) | IT1129816B (show.php) |
| NL (1) | NL188903C (show.php) |
| NO (1) | NO152170C (show.php) |
| SE (1) | SE430985B (show.php) |
| ZA (1) | ZA803674B (show.php) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP3224244B1 (de) * | 2014-11-28 | 2019-01-30 | United Initiators Gmbh | Verfahren zur herstellung von pulverförmigem lauroylperoxid |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DD38072A (show.php) * | ||||
| US2771492A (en) * | 1953-08-07 | 1956-11-20 | Ici Ltd | Production of dodecanoyl peroxide |
| FR1329593A (fr) * | 1960-10-31 | 1963-06-14 | Montedison Spa | Procédé de préparation des diacylperoxydes |
| DE1290545B (de) * | 1965-10-20 | 1969-03-13 | Elektrochem Werke Muenchen Ag | Verfahren und Vorrichtung zur Trocknung fester, zersetzlicher Diacylperoxyde |
| DE1643599B1 (de) * | 1967-10-17 | 1972-09-21 | Argus Chem | Verfahren zur Isolierung und Reinigung von bei Raumtemperatur festen Diacylperoxyden |
| DE1793327A1 (de) * | 1968-09-02 | 1972-05-18 | Peroxid Chemie Gmbh | Verfahren zur Herstellung von Diacylperoxyden |
| DE1935297A1 (de) * | 1969-07-11 | 1971-01-14 | Degussa | Verfahren zur Herstellung von Diaroyl- und Diacylperoxiden |
-
1979
- 1979-07-11 DE DE2928020A patent/DE2928020C2/de not_active Expired
-
1980
- 1980-06-11 CA CA000353755A patent/CA1138001A/en not_active Expired
- 1980-06-19 ZA ZA00803674A patent/ZA803674B/xx unknown
- 1980-06-20 NL NLAANVRAGE8003574,A patent/NL188903C/xx not_active IP Right Cessation
- 1980-06-26 SE SE8004735A patent/SE430985B/sv unknown
- 1980-07-03 AU AU60065/80A patent/AU537837B2/en not_active Ceased
- 1980-07-07 DD DD80222457A patent/DD151935A5/de unknown
- 1980-07-07 GB GB8022207A patent/GB2054583B/en not_active Expired
- 1980-07-09 FR FR8015336A patent/FR2460928A1/fr active Granted
- 1980-07-09 BE BE1/9891A patent/BE884227A/fr not_active IP Right Cessation
- 1980-07-09 JP JP9282780A patent/JPS5649349A/ja active Pending
- 1980-07-10 IT IT68098/80A patent/IT1129816B/it active
- 1980-07-10 NO NO802070A patent/NO152170C/no unknown
- 1980-07-10 BR BR8004292A patent/BR8004292A/pt unknown
- 1980-07-10 ES ES493289A patent/ES8104221A1/es not_active Expired
- 1980-07-10 DK DK298780A patent/DK298780A/da not_active Application Discontinuation
-
1987
- 1987-09-15 US US07/096,851 patent/US4782189A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| US4782189A (en) | 1988-11-01 |
| AU6006580A (en) | 1981-01-15 |
| BR8004292A (pt) | 1981-01-27 |
| IT1129816B (it) | 1986-06-11 |
| DE2928020C2 (de) | 1985-01-10 |
| ES493289A0 (es) | 1981-04-16 |
| NO152170C (no) | 1985-08-14 |
| AU537837B2 (en) | 1984-07-12 |
| NL188903B (nl) | 1992-06-01 |
| NO802070L (no) | 1981-01-12 |
| DK298780A (da) | 1981-01-12 |
| IT8068098A0 (it) | 1980-07-10 |
| DE2928020A1 (de) | 1981-01-29 |
| NL8003574A (nl) | 1981-01-13 |
| GB2054583A (en) | 1981-02-18 |
| ES8104221A1 (es) | 1981-04-16 |
| CA1138001A (en) | 1982-12-21 |
| ZA803674B (en) | 1981-07-29 |
| NL188903C (nl) | 1992-11-02 |
| JPS5649349A (en) | 1981-05-02 |
| DD151935A5 (de) | 1981-11-11 |
| FR2460928A1 (fr) | 1981-01-30 |
| NO152170B (no) | 1985-05-06 |
| SE8004735L (sv) | 1981-01-12 |
| GB2054583B (en) | 1983-03-02 |
| FR2460928B1 (show.php) | 1983-01-21 |
| BE884227A (fr) | 1981-01-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL171431B1 (pl) | Sposób oczyszczania zanieczyszczonych fluorowanych kwasów karboksylowych PL PL | |
| EA025514B1 (ru) | Способ получения фосфорной кислоты дигидратного/полугидратного типа | |
| US8454929B2 (en) | Continuous process for preparation of calcium thiosulfate liquid solution | |
| US4337344A (en) | Process for the preparation of dibenzothiazyl disulfide | |
| SU1706384A3 (ru) | Способ очистки расплава или раствора нитрата кальци | |
| SE430985B (sv) | Forfarande for kontinuerlig framstellning av lauroylperoxid | |
| US2356183A (en) | Purification of nickel salts | |
| EP0085277B1 (en) | Process for the production of ethylenediamine tetraacetic acid | |
| US4026955A (en) | Preparation of pentachloronitrobenzene | |
| US4299965A (en) | Preparation of benzotriazole | |
| US4670594A (en) | Continuous process for the preparation of dimethyldiallylammonium chloride | |
| EP1492728B1 (en) | Method for producing a halide brine | |
| US3987096A (en) | Process for chlorination of acetaldoxime | |
| JPH0418062A (ja) | 塩酸、硫酸およびそのヒドロキシルアンモニウム塩およびアンモニウム塩を含む水性母液の処理法 | |
| CA1331626C (en) | Process for the preparation of 2,4,6-triiodo-5-amino-n-alkylisophthalamic acid | |
| SU1054302A1 (ru) | Способ извлечени марганца | |
| RU2305066C2 (ru) | Способ получения йодата и йодида калия | |
| JPS6296687A (ja) | 硫酸と酢酸の痕跡量を使用するｄｎｓのｄａｓへのベシヤン還元 | |
| RU2042643C1 (ru) | Способ очистки кислых и щелочных сточных вод от меди | |
| US3758463A (en) | Dichloroisocyanurate manufacture | |
| US1891888A (en) | Recovering bromine from sea water and the like | |
| JPH0114213B2 (show.php) | ||
| US4377535A (en) | Process for the preparation of nitro-T-acid (8-nitro-naphthalene-1,3,6-trisulphonic acid) | |
| EP0010443B1 (en) | Process for preparing sodium-m-nitrobenzenesulfonate | |
| US4419515A (en) | Two stage process for preparing 2,6-pyridinedicarboxylic acid |