SE430785B - Nytt forfarande for framstellning av n-substituerade oligoimider i nervaro av ett katalytiskt system - Google Patents
Nytt forfarande for framstellning av n-substituerade oligoimider i nervaro av ett katalytiskt systemInfo
- Publication number
- SE430785B SE430785B SE7900513A SE7900513A SE430785B SE 430785 B SE430785 B SE 430785B SE 7900513 A SE7900513 A SE 7900513A SE 7900513 A SE7900513 A SE 7900513A SE 430785 B SE430785 B SE 430785B
- Authority
- SE
- Sweden
- Prior art keywords
- acid
- carbon atoms
- group
- groups
- salt
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 25
- 230000003197 catalytic effect Effects 0.000 title claims description 13
- 238000002360 preparation method Methods 0.000 title claims description 7
- 239000002253 acid Substances 0.000 claims description 48
- 125000004432 carbon atom Chemical group C* 0.000 claims description 43
- -1 alkyl radical Chemical class 0.000 claims description 25
- 125000003545 alkoxy group Chemical group 0.000 claims description 21
- 238000006243 chemical reaction Methods 0.000 claims description 21
- 125000000217 alkyl group Chemical group 0.000 claims description 20
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 claims description 20
- 150000003839 salts Chemical class 0.000 claims description 19
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 18
- 150000001412 amines Chemical class 0.000 claims description 18
- 150000008064 anhydrides Chemical class 0.000 claims description 18
- 239000011541 reaction mixture Substances 0.000 claims description 17
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical class C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 10
- 150000007513 acids Chemical class 0.000 claims description 10
- 239000002904 solvent Substances 0.000 claims description 10
- 239000005977 Ethylene Substances 0.000 claims description 9
- 125000003342 alkenyl group Chemical group 0.000 claims description 9
- 239000000203 mixture Substances 0.000 claims description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 9
- 150000001408 amides Chemical class 0.000 claims description 8
- 125000003118 aryl group Chemical group 0.000 claims description 8
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 8
- 125000002947 alkylene group Chemical group 0.000 claims description 7
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 7
- 125000000392 cycloalkenyl group Chemical group 0.000 claims description 7
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 7
- 150000004714 phosphonium salts Chemical group 0.000 claims description 7
- 125000001424 substituent group Chemical group 0.000 claims description 7
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 claims description 6
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 6
- 125000002091 cationic group Chemical group 0.000 claims description 6
- 150000001875 compounds Chemical class 0.000 claims description 6
- 125000005843 halogen group Chemical group 0.000 claims description 6
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 claims description 5
- 229910052799 carbon Inorganic materials 0.000 claims description 5
- 125000000524 functional group Chemical group 0.000 claims description 5
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 5
- 239000001301 oxygen Substances 0.000 claims description 5
- 229910052760 oxygen Inorganic materials 0.000 claims description 5
- 239000000126 substance Substances 0.000 claims description 5
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 4
- 125000004450 alkenylene group Chemical group 0.000 claims description 4
- 238000001914 filtration Methods 0.000 claims description 4
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical group O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 claims description 4
- 239000012452 mother liquor Substances 0.000 claims description 4
- 239000002244 precipitate Substances 0.000 claims description 4
- 239000000047 product Substances 0.000 claims description 4
- YBRVSVVVWCFQMG-UHFFFAOYSA-N 4,4'-diaminodiphenylmethane Chemical group C1=CC(N)=CC=C1CC1=CC=C(N)C=C1 YBRVSVVVWCFQMG-UHFFFAOYSA-N 0.000 claims description 3
- HLBLWEWZXPIGSM-UHFFFAOYSA-N 4-Aminophenyl ether Chemical compound C1=CC(N)=CC=C1OC1=CC=C(N)C=C1 HLBLWEWZXPIGSM-UHFFFAOYSA-N 0.000 claims description 3
- 125000002252 acyl group Chemical group 0.000 claims description 3
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 3
- 125000005196 alkyl carbonyloxy group Chemical group 0.000 claims description 3
- 150000001555 benzenes Chemical class 0.000 claims description 3
- 238000009835 boiling Methods 0.000 claims description 3
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 3
- 238000002844 melting Methods 0.000 claims description 3
- 230000008018 melting Effects 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 125000000962 organic group Chemical group 0.000 claims description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 claims description 3
- MQJKPEGWNLWLTK-UHFFFAOYSA-N Dapsone Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=C1 MQJKPEGWNLWLTK-UHFFFAOYSA-N 0.000 claims description 2
- 125000003368 amide group Chemical group 0.000 claims description 2
- 150000005840 aryl radicals Chemical class 0.000 claims description 2
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 claims description 2
- 229940092714 benzenesulfonic acid Drugs 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 229940098779 methanesulfonic acid Drugs 0.000 claims description 2
- 229920006395 saturated elastomer Polymers 0.000 claims description 2
- RWSOTUBLDIXVET-UHFFFAOYSA-O sulfonium group Chemical group [SH3+] RWSOTUBLDIXVET-UHFFFAOYSA-O 0.000 claims description 2
- 150000004992 toluidines Chemical class 0.000 claims description 2
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims 1
- 230000015572 biosynthetic process Effects 0.000 claims 1
- 150000001735 carboxylic acids Chemical class 0.000 claims 1
- 229920006015 heat resistant resin Polymers 0.000 claims 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims 1
- 238000003786 synthesis reaction Methods 0.000 claims 1
- KJIFKLIQANRMOU-UHFFFAOYSA-N oxidanium;4-methylbenzenesulfonate Chemical compound O.CC1=CC=C(S(O)(=O)=O)C=C1 KJIFKLIQANRMOU-UHFFFAOYSA-N 0.000 description 10
- UBOXGVDOUJQMTN-UHFFFAOYSA-N 1,1,2-trichloroethane Chemical compound ClCC(Cl)Cl UBOXGVDOUJQMTN-UHFFFAOYSA-N 0.000 description 8
- 238000004821 distillation Methods 0.000 description 8
- 239000000376 reactant Substances 0.000 description 8
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- 229920000768 polyamine Polymers 0.000 description 5
- KCFXNGDHQPMIAQ-UHFFFAOYSA-N 1-(4-methylphenyl)pyrrole-2,5-dione Chemical compound C1=CC(C)=CC=C1N1C(=O)C=CC1=O KCFXNGDHQPMIAQ-UHFFFAOYSA-N 0.000 description 4
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 4
- 125000000129 anionic group Chemical group 0.000 description 4
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 4
- 150000004985 diamines Chemical class 0.000 description 4
- FSQQTNAZHBEJLS-UPHRSURJSA-N maleamic acid Chemical compound NC(=O)\C=C/C(O)=O FSQQTNAZHBEJLS-UPHRSURJSA-N 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- CABCWNXJQSBGCY-UHFFFAOYSA-M 4-methylbenzenesulfonate;methyl(triphenyl)phosphanium Chemical compound CC1=CC=C(S([O-])(=O)=O)C=C1.C=1C=CC=CC=1[P+](C=1C=CC=CC=1)(C)C1=CC=CC=C1 CABCWNXJQSBGCY-UHFFFAOYSA-M 0.000 description 3
- RSWGJHLUYNHPMX-UHFFFAOYSA-N Abietic-Saeure Natural products C12CCC(C(C)C)=CC2=CCC2C1(C)CCCC2(C)C(O)=O RSWGJHLUYNHPMX-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical group ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- KHPCPRHQVVSZAH-HUOMCSJISA-N Rosin Natural products O(C/C=C/c1ccccc1)[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@@H](CO)O1 KHPCPRHQVVSZAH-HUOMCSJISA-N 0.000 description 3
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 3
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 3
- 150000002576 ketones Chemical class 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 3
- 239000012429 reaction media Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- KHPCPRHQVVSZAH-UHFFFAOYSA-N trans-cinnamyl beta-D-glucopyranoside Natural products OC1C(O)C(O)C(CO)OC1OCC=CC1=CC=CC=C1 KHPCPRHQVVSZAH-UHFFFAOYSA-N 0.000 description 3
- VLWFSWMZGGZHGD-SREVYHEPSA-N (z)-4-(4-methylanilino)-4-oxobut-2-enoic acid Chemical compound CC1=CC=C(NC(=O)\C=C/C(O)=O)C=C1 VLWFSWMZGGZHGD-SREVYHEPSA-N 0.000 description 2
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical group ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 2
- XQUPVDVFXZDTLT-UHFFFAOYSA-N 1-[4-[[4-(2,5-dioxopyrrol-1-yl)phenyl]methyl]phenyl]pyrrole-2,5-dione Chemical compound O=C1C=CC(=O)N1C(C=C1)=CC=C1CC1=CC=C(N2C(C=CC2=O)=O)C=C1 XQUPVDVFXZDTLT-UHFFFAOYSA-N 0.000 description 2
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 2
- QQZOPKMRPOGIEB-UHFFFAOYSA-N 2-Oxohexane Chemical compound CCCCC(C)=O QQZOPKMRPOGIEB-UHFFFAOYSA-N 0.000 description 2
- SZNYYWIUQFZLLT-UHFFFAOYSA-N 2-methyl-1-(2-methylpropoxy)propane Chemical compound CC(C)COCC(C)C SZNYYWIUQFZLLT-UHFFFAOYSA-N 0.000 description 2
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 2
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- JSYBAZQQYCNZJE-UHFFFAOYSA-N benzene-1,2,4-triamine Chemical compound NC1=CC=C(N)C(N)=C1 JSYBAZQQYCNZJE-UHFFFAOYSA-N 0.000 description 2
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 239000000470 constituent Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 125000004956 cyclohexylene group Chemical group 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- QEWYKACRFQMRMB-UHFFFAOYSA-N fluoroacetic acid Chemical compound OC(=O)CF QEWYKACRFQMRMB-UHFFFAOYSA-N 0.000 description 2
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 150000003949 imides Chemical class 0.000 description 2
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 2
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- RZXMPPFPUUCRFN-UHFFFAOYSA-N p-toluidine Chemical compound CC1=CC=C(N)C=C1 RZXMPPFPUUCRFN-UHFFFAOYSA-N 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 2
- 238000003969 polarography Methods 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-O pyridinium Chemical compound C1=CC=[NH+]C=C1 JUJWROOIHBZHMG-UHFFFAOYSA-O 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 238000007086 side reaction Methods 0.000 description 2
- HHVIBTZHLRERCL-UHFFFAOYSA-N sulfonyldimethane Chemical group CS(C)(=O)=O HHVIBTZHLRERCL-UHFFFAOYSA-N 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical group ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- KMOUUZVZFBCRAM-OLQVQODUSA-N (3as,7ar)-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione Chemical compound C1C=CC[C@@H]2C(=O)OC(=O)[C@@H]21 KMOUUZVZFBCRAM-OLQVQODUSA-N 0.000 description 1
- NPSMSOMZCHVSSW-UHFFFAOYSA-N (4-aminophenyl)-(2,4-diaminophenyl)methanone Chemical compound C1=CC(N)=CC=C1C(=O)C1=CC=C(N)C=C1N NPSMSOMZCHVSSW-UHFFFAOYSA-N 0.000 description 1
- VYAXQANIOQMUHV-UHFFFAOYSA-N 1,2,4,6-tetramethylpyridin-1-ium Chemical compound CC1=CC(C)=[N+](C)C(C)=C1 VYAXQANIOQMUHV-UHFFFAOYSA-N 0.000 description 1
- YXZYJZXGFLKZOR-UHFFFAOYSA-N 1,2,4-triazole-3,3-diamine Chemical compound NC1(N)N=CN=N1 YXZYJZXGFLKZOR-UHFFFAOYSA-N 0.000 description 1
- CCXIUFAOVMDXFT-UHFFFAOYSA-N 1,2,5-trimethylpyridin-1-ium Chemical compound CC1=CC=C(C)[N+](C)=C1 CCXIUFAOVMDXFT-UHFFFAOYSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical group ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- 125000001781 1,3,4-oxadiazolyl group Chemical group 0.000 description 1
- JWHFHPWQEFZAFD-UHFFFAOYSA-N 1,3,5-trimethoxypyridin-1-ium Chemical compound COC1=CC(OC)=C[N+](OC)=C1 JWHFHPWQEFZAFD-UHFFFAOYSA-N 0.000 description 1
- WZCQRUWWHSTZEM-UHFFFAOYSA-N 1,3-phenylenediamine Chemical compound NC1=CC=CC(N)=C1 WZCQRUWWHSTZEM-UHFFFAOYSA-N 0.000 description 1
- ZCDUZNFTZFGENR-UHFFFAOYSA-N 1,4-diethylpyridin-1-ium Chemical compound CCC1=CC=[N+](CC)C=C1 ZCDUZNFTZFGENR-UHFFFAOYSA-N 0.000 description 1
- VUHDZBAZSJJBJG-UHFFFAOYSA-N 1,4-dimethoxypyridin-1-ium Chemical compound COC1=CC=[N+](OC)C=C1 VUHDZBAZSJJBJG-UHFFFAOYSA-N 0.000 description 1
- CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical compound NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 description 1
- FDKGIXCUGKPNRB-UHFFFAOYSA-N 1-(1-methylpyridin-1-ium-4-yl)ethanone Chemical compound CC(=O)C1=CC=[N+](C)C=C1 FDKGIXCUGKPNRB-UHFFFAOYSA-N 0.000 description 1
- UXQFFWJWNQOKJZ-UHFFFAOYSA-N 1-[(4-methylphenyl)methyl]pyridin-1-ium Chemical compound C1=CC(C)=CC=C1C[N+]1=CC=CC=C1 UXQFFWJWNQOKJZ-UHFFFAOYSA-N 0.000 description 1
- SIZUXGCKWBAZFG-UHFFFAOYSA-N 1-benzyl-3,5-dimethylpyridin-1-ium Chemical compound CC1=CC(C)=C[N+](CC=2C=CC=CC=2)=C1 SIZUXGCKWBAZFG-UHFFFAOYSA-N 0.000 description 1
- NDZFNTHGIIQMQI-UHFFFAOYSA-N 1-benzylpyridin-1-ium Chemical compound C=1C=CC=C[N+]=1CC1=CC=CC=C1 NDZFNTHGIIQMQI-UHFFFAOYSA-N 0.000 description 1
- AVWFAACIXBQMBF-UHFFFAOYSA-O 1-benzylpyridin-1-ium-3-carboxylic acid Chemical compound OC(=O)C1=CC=C[N+](CC=2C=CC=CC=2)=C1 AVWFAACIXBQMBF-UHFFFAOYSA-O 0.000 description 1
- 125000004973 1-butenyl group Chemical group C(=CCC)* 0.000 description 1
- ZXECUFJGRFMUQS-UHFFFAOYSA-N 1-butyl-2,4-dimethylpyridin-1-ium Chemical compound CCCC[N+]1=CC=C(C)C=C1C ZXECUFJGRFMUQS-UHFFFAOYSA-N 0.000 description 1
- MZQXJATZBSCDKH-UHFFFAOYSA-N 1-butyl-2-ethenylpyridin-1-ium Chemical compound CCCC[N+]1=CC=CC=C1C=C MZQXJATZBSCDKH-UHFFFAOYSA-N 0.000 description 1
- REACWASHYHDPSQ-UHFFFAOYSA-N 1-butylpyridin-1-ium Chemical compound CCCC[N+]1=CC=CC=C1 REACWASHYHDPSQ-UHFFFAOYSA-N 0.000 description 1
- WDRZVZVXHZNSFG-UHFFFAOYSA-N 1-ethenylpyridin-1-ium Chemical compound C=C[N+]1=CC=CC=C1 WDRZVZVXHZNSFG-UHFFFAOYSA-N 0.000 description 1
- NWKXYWPQBWLADL-UHFFFAOYSA-N 1-ethenylquinolin-1-ium Chemical compound C1=CC=C2[N+](C=C)=CC=CC2=C1 NWKXYWPQBWLADL-UHFFFAOYSA-N 0.000 description 1
- OIDIRWZVUWCCCO-UHFFFAOYSA-N 1-ethylpyridin-1-ium Chemical compound CC[N+]1=CC=CC=C1 OIDIRWZVUWCCCO-UHFFFAOYSA-N 0.000 description 1
- CBMDQVNFHVUOIB-UHFFFAOYSA-N 1-ethylquinolin-1-ium Chemical compound C1=CC=C2[N+](CC)=CC=CC2=C1 CBMDQVNFHVUOIB-UHFFFAOYSA-N 0.000 description 1
- NZYLEVMJODSINC-UHFFFAOYSA-N 1-methoxypyridin-1-ium Chemical compound CO[N+]1=CC=CC=C1 NZYLEVMJODSINC-UHFFFAOYSA-N 0.000 description 1
- 125000006021 1-methyl-2-propenyl group Chemical group 0.000 description 1
- NQQUGKKTJLAUHC-UHFFFAOYSA-N 1-methylpyridin-1-ium-4-carbonitrile Chemical compound C[N+]1=CC=C(C#N)C=C1 NQQUGKKTJLAUHC-UHFFFAOYSA-N 0.000 description 1
- RTQPKEOYPPMVGQ-UHFFFAOYSA-N 1-methylquinolin-1-ium Chemical compound C1=CC=C2[N+](C)=CC=CC2=C1 RTQPKEOYPPMVGQ-UHFFFAOYSA-N 0.000 description 1
- FHIWTZOWCILSIC-UHFFFAOYSA-N 1-phenylpyridin-1-ium Chemical compound C1=CC=CC=C1[N+]1=CC=CC=C1 FHIWTZOWCILSIC-UHFFFAOYSA-N 0.000 description 1
- 125000006017 1-propenyl group Chemical group 0.000 description 1
- CRTKBIFIDSNKCN-UHFFFAOYSA-N 1-propylpyridin-1-ium Chemical compound CCC[N+]1=CC=CC=C1 CRTKBIFIDSNKCN-UHFFFAOYSA-N 0.000 description 1
- PVKVAZMIYYZBDG-UHFFFAOYSA-N 2,2-diphenylethanethiol Chemical compound C=1C=CC=CC=1C(CS)C1=CC=CC=C1 PVKVAZMIYYZBDG-UHFFFAOYSA-N 0.000 description 1
- YYDRNPOEMZZTPM-UHFFFAOYSA-N 2,4,6-triaminotoluene Chemical compound CC1=C(N)C=C(N)C=C1N YYDRNPOEMZZTPM-UHFFFAOYSA-N 0.000 description 1
- SBLBKLRRAALOAA-UHFFFAOYSA-N 2,4,6-trimethylbenzene-1,3,5-triamine Chemical compound CC1=C(N)C(C)=C(N)C(C)=C1N SBLBKLRRAALOAA-UHFFFAOYSA-N 0.000 description 1
- SYPXNWGMHMNKMW-UHFFFAOYSA-N 2-ethenyl-1-ethylpyridin-1-ium Chemical compound CC[N+]1=CC=CC=C1C=C SYPXNWGMHMNKMW-UHFFFAOYSA-N 0.000 description 1
- DTJIKSRARSRPBU-UHFFFAOYSA-N 2-ethenyl-1-methylpyridin-1-ium Chemical class C[N+]1=CC=CC=C1C=C DTJIKSRARSRPBU-UHFFFAOYSA-N 0.000 description 1
- GAVQXSOQTIQDNT-UHFFFAOYSA-N 2-ethoxy-1-ethylpyridin-1-ium Chemical compound CCOC1=CC=CC=[N+]1CC GAVQXSOQTIQDNT-UHFFFAOYSA-N 0.000 description 1
- 125000006040 2-hexenyl group Chemical group 0.000 description 1
- FIEMNCUPUKWJBC-UHFFFAOYSA-N 2-methylprop-1-ene-1-thiol Chemical class CC(C)=CS FIEMNCUPUKWJBC-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- HSTOKWSFWGCZMH-UHFFFAOYSA-N 3,3'-diaminobenzidine Chemical compound C1=C(N)C(N)=CC=C1C1=CC=C(N)C(N)=C1 HSTOKWSFWGCZMH-UHFFFAOYSA-N 0.000 description 1
- HWYQOMOHBPPWSI-UHFFFAOYSA-N 3,5-diamino-n-(4-aminophenyl)benzamide Chemical compound C1=CC(N)=CC=C1NC(=O)C1=CC(N)=CC(N)=C1 HWYQOMOHBPPWSI-UHFFFAOYSA-N 0.000 description 1
- MQQNVOPCVHQBTI-UHFFFAOYSA-N 3-[5-(3-aminophenyl)-4-phenyl-1,2,4-triazol-3-yl]aniline Chemical compound NC1=CC=CC(C=2N(C(C=3C=C(N)C=CC=3)=NN=2)C=2C=CC=CC=2)=C1 MQQNVOPCVHQBTI-UHFFFAOYSA-N 0.000 description 1
- CXJAFLQWMOMYOW-UHFFFAOYSA-N 3-chlorofuran-2,5-dione Chemical compound ClC1=CC(=O)OC1=O CXJAFLQWMOMYOW-UHFFFAOYSA-N 0.000 description 1
- AYKYXWQEBUNJCN-UHFFFAOYSA-N 3-methylfuran-2,5-dione Chemical compound CC1=CC(=O)OC1=O AYKYXWQEBUNJCN-UHFFFAOYSA-N 0.000 description 1
- KQIKKETXZQDHGE-FOCLMDBBSA-N 4,4'-diaminoazobenzene Chemical compound C1=CC(N)=CC=C1\N=N\C1=CC=C(N)C=C1 KQIKKETXZQDHGE-FOCLMDBBSA-N 0.000 description 1
- JKETWUADWJKEKN-UHFFFAOYSA-N 4-(3,4-diaminophenyl)sulfonylbenzene-1,2-diamine Chemical compound C1=C(N)C(N)=CC=C1S(=O)(=O)C1=CC=C(N)C(N)=C1 JKETWUADWJKEKN-UHFFFAOYSA-N 0.000 description 1
- ILPWTQGYOZFLBN-UHFFFAOYSA-N 4-[(3,4-diaminophenyl)methyl]benzene-1,2-diamine Chemical compound C1=C(N)C(N)=CC=C1CC1=CC=C(N)C(N)=C1 ILPWTQGYOZFLBN-UHFFFAOYSA-N 0.000 description 1
- DZIHTWJGPDVSGE-UHFFFAOYSA-N 4-[(4-aminocyclohexyl)methyl]cyclohexan-1-amine Chemical compound C1CC(N)CCC1CC1CCC(N)CC1 DZIHTWJGPDVSGE-UHFFFAOYSA-N 0.000 description 1
- QSSVGISTNVSKKA-UHFFFAOYSA-N 4-[(4-aminophenyl)-methylphosphoryl]aniline Chemical compound C=1C=C(N)C=CC=1P(=O)(C)C1=CC=C(N)C=C1 QSSVGISTNVSKKA-UHFFFAOYSA-N 0.000 description 1
- KTZLSMUPEJXXBO-UHFFFAOYSA-N 4-[(4-aminophenyl)-phenylphosphoryl]aniline Chemical compound C1=CC(N)=CC=C1P(=O)(C=1C=CC(N)=CC=1)C1=CC=CC=C1 KTZLSMUPEJXXBO-UHFFFAOYSA-N 0.000 description 1
- CGEPGDQNCRDJHS-UHFFFAOYSA-N 4-[1-(4-amino-3-methylphenyl)cyclohexyl]-2-methylaniline Chemical compound C1=C(N)C(C)=CC(C2(CCCCC2)C=2C=C(C)C(N)=CC=2)=C1 CGEPGDQNCRDJHS-UHFFFAOYSA-N 0.000 description 1
- CJXRYVQHINFIKO-UHFFFAOYSA-N 4-[1-(4-aminophenyl)-1-phenylethyl]aniline Chemical compound C=1C=C(N)C=CC=1C(C=1C=CC(N)=CC=1)(C)C1=CC=CC=C1 CJXRYVQHINFIKO-UHFFFAOYSA-N 0.000 description 1
- ZSQIQUAKDNTQOI-UHFFFAOYSA-N 4-[1-(4-aminophenyl)cyclohexyl]aniline Chemical compound C1=CC(N)=CC=C1C1(C=2C=CC(N)=CC=2)CCCCC1 ZSQIQUAKDNTQOI-UHFFFAOYSA-N 0.000 description 1
- ZYEDGEXYGKWJPB-UHFFFAOYSA-N 4-[2-(4-aminophenyl)propan-2-yl]aniline Chemical compound C=1C=C(N)C=CC=1C(C)(C)C1=CC=C(N)C=C1 ZYEDGEXYGKWJPB-UHFFFAOYSA-N 0.000 description 1
- AWFMZJOSCOBYOQ-UHFFFAOYSA-N 4-[5-(3,4-diaminophenyl)pyridin-3-yl]benzene-1,2-diamine Chemical compound C1=C(N)C(N)=CC=C1C1=CN=CC(C=2C=C(N)C(N)=CC=2)=C1 AWFMZJOSCOBYOQ-UHFFFAOYSA-N 0.000 description 1
- KNEWZIDQIWYIJY-UHFFFAOYSA-N 4-[5-(4-aminophenyl)pyridin-3-yl]aniline Chemical compound C1=CC(N)=CC=C1C1=CN=CC(C=2C=CC(N)=CC=2)=C1 KNEWZIDQIWYIJY-UHFFFAOYSA-N 0.000 description 1
- ADUMIBSPEHFSLA-UHFFFAOYSA-N 4-[bis(4-aminophenyl)methyl]aniline Chemical compound C1=CC(N)=CC=C1C(C=1C=CC(N)=CC=1)C1=CC=C(N)C=C1 ADUMIBSPEHFSLA-UHFFFAOYSA-N 0.000 description 1
- XPAQFJJCWGSXGJ-UHFFFAOYSA-N 4-amino-n-(4-aminophenyl)benzamide Chemical compound C1=CC(N)=CC=C1NC(=O)C1=CC=C(N)C=C1 XPAQFJJCWGSXGJ-UHFFFAOYSA-N 0.000 description 1
- LGTGOCSQAOUUFP-UHFFFAOYSA-N 4-amino-n-[4-[(4-aminobenzoyl)amino]phenyl]benzamide Chemical compound C1=CC(N)=CC=C1C(=O)NC(C=C1)=CC=C1NC(=O)C1=CC=C(N)C=C1 LGTGOCSQAOUUFP-UHFFFAOYSA-N 0.000 description 1
- DIFAWEFUQZTMRW-UHFFFAOYSA-N 4-bis(4-aminophenyl)phosphorylaniline Chemical compound C1=CC(N)=CC=C1P(=O)(C=1C=CC(N)=CC=1)C1=CC=C(N)C=C1 DIFAWEFUQZTMRW-UHFFFAOYSA-N 0.000 description 1
- UQRONKZLYKUEMO-UHFFFAOYSA-N 4-methyl-1-(2,4,6-trimethylphenyl)pent-4-en-2-one Chemical group CC(=C)CC(=O)Cc1c(C)cc(C)cc1C UQRONKZLYKUEMO-UHFFFAOYSA-N 0.000 description 1
- OVFJVGPVSMMTSA-UHFFFAOYSA-M 4-methylbenzenesulfonate;1-methylpyridin-1-ium Chemical compound C[N+]1=CC=CC=C1.CC1=CC=C(S([O-])(=O)=O)C=C1 OVFJVGPVSMMTSA-UHFFFAOYSA-M 0.000 description 1
- 125000000590 4-methylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- SNLFYGIUTYKKOE-UHFFFAOYSA-N 4-n,4-n-bis(4-aminophenyl)benzene-1,4-diamine Chemical compound C1=CC(N)=CC=C1N(C=1C=CC(N)=CC=1)C1=CC=C(N)C=C1 SNLFYGIUTYKKOE-UHFFFAOYSA-N 0.000 description 1
- LBNFPUAJWZYIOQ-UHFFFAOYSA-N 4-n-(4-aminophenyl)-4-n-methylbenzene-1,4-diamine Chemical compound C=1C=C(N)C=CC=1N(C)C1=CC=C(N)C=C1 LBNFPUAJWZYIOQ-UHFFFAOYSA-N 0.000 description 1
- BYZXAJYUFWGUJG-UHFFFAOYSA-N 4-phenyl-1-propylpyridin-1-ium Chemical compound C1=C[N+](CCC)=CC=C1C1=CC=CC=C1 BYZXAJYUFWGUJG-UHFFFAOYSA-N 0.000 description 1
- YKSWVQYWQSZDPR-UHFFFAOYSA-N 6-(6-aminopyridin-2-yl)pyridin-2-amine Chemical group NC1=CC=CC(C=2N=C(N)C=CC=2)=N1 YKSWVQYWQSZDPR-UHFFFAOYSA-N 0.000 description 1
- KNDQHSIWLOJIGP-UHFFFAOYSA-N 826-62-0 Chemical compound C1C2C3C(=O)OC(=O)C3C1C=C2 KNDQHSIWLOJIGP-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- 229920000877 Melamine resin Polymers 0.000 description 1
- PQBAWAQIRZIWIV-UHFFFAOYSA-N N-methylpyridinium Chemical class C[N+]1=CC=CC=C1 PQBAWAQIRZIWIV-UHFFFAOYSA-N 0.000 description 1
- MRLJSZSVKRZJRG-UHFFFAOYSA-N NC1=C(C2=CC=C(C=C2C=C1N)N)N Chemical compound NC1=C(C2=CC=C(C=C2C=C1N)N)N MRLJSZSVKRZJRG-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- QLZHNIAADXEJJP-UHFFFAOYSA-N Phenylphosphonic acid Chemical compound OP(O)(=O)C1=CC=CC=C1 QLZHNIAADXEJJP-UHFFFAOYSA-N 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- FDLQZKYLHJJBHD-UHFFFAOYSA-N [3-(aminomethyl)phenyl]methanamine Chemical compound NCC1=CC=CC(CN)=C1 FDLQZKYLHJJBHD-UHFFFAOYSA-N 0.000 description 1
- ISKQADXMHQSTHK-UHFFFAOYSA-N [4-(aminomethyl)phenyl]methanamine Chemical compound NCC1=CC=C(CN)C=C1 ISKQADXMHQSTHK-UHFFFAOYSA-N 0.000 description 1
- IKHGUXGNUITLKF-XPULMUKRSA-N acetaldehyde Chemical compound [14CH]([14CH3])=O IKHGUXGNUITLKF-XPULMUKRSA-N 0.000 description 1
- 235000019647 acidic taste Nutrition 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 150000004984 aromatic diamines Chemical class 0.000 description 1
- ANUAIBBBDSEVKN-UHFFFAOYSA-N benzene-1,2,4,5-tetramine Chemical compound NC1=CC(N)=C(N)C=C1N ANUAIBBBDSEVKN-UHFFFAOYSA-N 0.000 description 1
- RPHKINMPYFJSCF-UHFFFAOYSA-N benzene-1,3,5-triamine Chemical compound NC1=CC(N)=CC(N)=C1 RPHKINMPYFJSCF-UHFFFAOYSA-N 0.000 description 1
- HFACYLZERDEVSX-UHFFFAOYSA-N benzidine Chemical compound C1=CC(N)=CC=C1C1=CC=C(N)C=C1 HFACYLZERDEVSX-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- JCZLWVGMPZRUCK-UHFFFAOYSA-N benzyl-ethyl-methyl-phenylphosphanium Chemical compound C=1C=CC=CC=1[P+](C)(CC)CC1=CC=CC=C1 JCZLWVGMPZRUCK-UHFFFAOYSA-N 0.000 description 1
- ZLSMCQSGRWNEGX-UHFFFAOYSA-N bis(4-aminophenyl)methanone Chemical compound C1=CC(N)=CC=C1C(=O)C1=CC=C(N)C=C1 ZLSMCQSGRWNEGX-UHFFFAOYSA-N 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- KVNRLNFWIYMESJ-UHFFFAOYSA-N butyronitrile Chemical compound CCCC#N KVNRLNFWIYMESJ-UHFFFAOYSA-N 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 229920006037 cross link polymer Polymers 0.000 description 1
- 238000006210 cyclodehydration reaction Methods 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- VKIRRGRTJUUZHS-UHFFFAOYSA-N cyclohexane-1,4-diamine Chemical compound NC1CCC(N)CC1 VKIRRGRTJUUZHS-UHFFFAOYSA-N 0.000 description 1
- UKJLNMAFNRKWGR-UHFFFAOYSA-N cyclohexatrienamine Chemical group NC1=CC=C=C[CH]1 UKJLNMAFNRKWGR-UHFFFAOYSA-N 0.000 description 1
- QQCVAMDFYUBOEX-UHFFFAOYSA-N cyclohexyl(dimethyl)sulfanium Chemical compound C[S+](C)C1CCCCC1 QQCVAMDFYUBOEX-UHFFFAOYSA-N 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- RBECNRCKEQGFRU-UHFFFAOYSA-N diethyl(dimethyl)phosphanium Chemical compound CC[P+](C)(C)CC RBECNRCKEQGFRU-UHFFFAOYSA-N 0.000 description 1
- XTWYRDJTWUNXQG-UHFFFAOYSA-N diethyl(diphenyl)phosphanium Chemical compound C=1C=CC=CC=1[P+](CC)(CC)C1=CC=CC=C1 XTWYRDJTWUNXQG-UHFFFAOYSA-N 0.000 description 1
- JMYWXXUTFZSEHR-UHFFFAOYSA-N diethyl(phenyl)sulfanium Chemical compound CC[S+](CC)C1=CC=CC=C1 JMYWXXUTFZSEHR-UHFFFAOYSA-N 0.000 description 1
- BOWMIZJHDCBQGA-UHFFFAOYSA-N diethyl(propyl)sulfanium Chemical compound CCC[S+](CC)CC BOWMIZJHDCBQGA-UHFFFAOYSA-N 0.000 description 1
- OUGDZFRDEZNAOS-UHFFFAOYSA-N diethyl-methyl-phenylphosphanium Chemical compound CC[P+](C)(CC)C1=CC=CC=C1 OUGDZFRDEZNAOS-UHFFFAOYSA-N 0.000 description 1
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 1
- BYGXNRZZNBOSBD-UHFFFAOYSA-N dimethyl(diphenyl)phosphanium Chemical compound C=1C=CC=CC=1[P+](C)(C)C1=CC=CC=C1 BYGXNRZZNBOSBD-UHFFFAOYSA-N 0.000 description 1
- ZZTCPWRAHWXWCH-UHFFFAOYSA-N diphenylmethanediamine Chemical compound C=1C=CC=CC=1C(N)(N)C1=CC=CC=C1 ZZTCPWRAHWXWCH-UHFFFAOYSA-N 0.000 description 1
- ORKZATPRQQSLDT-UHFFFAOYSA-N diphenylmethanethiol Chemical compound C=1C=CC=CC=1C(S)C1=CC=CC=C1 ORKZATPRQQSLDT-UHFFFAOYSA-N 0.000 description 1
- XPPKVPWEQAFLFU-UHFFFAOYSA-N diphosphoric acid Chemical compound OP(O)(=O)OP(O)(O)=O XPPKVPWEQAFLFU-UHFFFAOYSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- HBGZJHZFCQLEGE-UHFFFAOYSA-N ethyl-methyl-phenylsulfanium Chemical compound CC[S+](C)C1=CC=CC=C1 HBGZJHZFCQLEGE-UHFFFAOYSA-N 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000007429 general method Methods 0.000 description 1
- 125000004836 hexamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- SMWDFEZZVXVKRB-UHFFFAOYSA-O hydron;quinoline Chemical compound [NH+]1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-O 0.000 description 1
- 125000005462 imide group Chemical group 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- JDSHMPZPIAZGSV-UHFFFAOYSA-N melamine Chemical compound NC1=NC(N)=NC(N)=N1 JDSHMPZPIAZGSV-UHFFFAOYSA-N 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- KVCZGAVWAROBTJ-UHFFFAOYSA-N methyl-phenyl-dipropylphosphanium Chemical compound CCC[P+](C)(CCC)C1=CC=CC=C1 KVCZGAVWAROBTJ-UHFFFAOYSA-N 0.000 description 1
- YACKEPLHDIMKIO-UHFFFAOYSA-N methylphosphonic acid Chemical compound CP(O)(O)=O YACKEPLHDIMKIO-UHFFFAOYSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- JOJOPWYLFLOFAE-UHFFFAOYSA-N naphthalene-1,3,7-triamine Chemical compound C1=C(N)C=C(N)C2=CC(N)=CC=C21 JOJOPWYLFLOFAE-UHFFFAOYSA-N 0.000 description 1
- KQSABULTKYLFEV-UHFFFAOYSA-N naphthalene-1,5-diamine Chemical compound C1=CC=C2C(N)=CC=CC2=C1N KQSABULTKYLFEV-UHFFFAOYSA-N 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 150000002790 naphthalenes Chemical class 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- SFLGSKRGOWRGBR-UHFFFAOYSA-N phthalane Chemical compound C1=CC=C2COCC2=C1 SFLGSKRGOWRGBR-UHFFFAOYSA-N 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 1
- VHNQIURBCCNWDN-UHFFFAOYSA-N pyridine-2,6-diamine Chemical compound NC1=CC=CC(N)=N1 VHNQIURBCCNWDN-UHFFFAOYSA-N 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- 229940005657 pyrophosphoric acid Drugs 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- BJQWBACJIAKDTJ-UHFFFAOYSA-N tetrabutylphosphanium Chemical compound CCCC[P+](CCCC)(CCCC)CCCC BJQWBACJIAKDTJ-UHFFFAOYSA-N 0.000 description 1
- IYQPZLDVRMRYGL-UHFFFAOYSA-N tetrakis(chloromethyl)phosphanium Chemical compound ClC[P+](CCl)(CCl)CCl IYQPZLDVRMRYGL-UHFFFAOYSA-N 0.000 description 1
- USFPINLPPFWTJW-UHFFFAOYSA-N tetraphenylphosphonium Chemical compound C1=CC=CC=C1[P+](C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 USFPINLPPFWTJW-UHFFFAOYSA-N 0.000 description 1
- XOGCTUKDUDAZKA-UHFFFAOYSA-N tetrapropylphosphanium Chemical compound CCC[P+](CCC)(CCC)CCC XOGCTUKDUDAZKA-UHFFFAOYSA-N 0.000 description 1
- 229920001187 thermosetting polymer Polymers 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 150000003918 triazines Chemical class 0.000 description 1
- XDQXIEKWEFUDFK-UHFFFAOYSA-N tributylsulfanium Chemical class CCCC[S+](CCCC)CCCC XDQXIEKWEFUDFK-UHFFFAOYSA-N 0.000 description 1
- WCZKTXKOKMXREO-UHFFFAOYSA-N triethylsulfanium Chemical class CC[S+](CC)CC WCZKTXKOKMXREO-UHFFFAOYSA-N 0.000 description 1
- NRZWQKGABZFFKE-UHFFFAOYSA-N trimethylsulfonium Chemical class C[S+](C)C NRZWQKGABZFFKE-UHFFFAOYSA-N 0.000 description 1
- WLOQLWBIJZDHET-UHFFFAOYSA-N triphenylsulfonium Chemical class C1=CC=CC=C1[S+](C=1C=CC=CC=1)C1=CC=CC=C1 WLOQLWBIJZDHET-UHFFFAOYSA-N 0.000 description 1
- 239000012953 triphenylsulfonium Chemical class 0.000 description 1
- OOLZXLYYPCOPQZ-UHFFFAOYSA-N tripropylsulfanium Chemical class CCC[S+](CCC)CCC OOLZXLYYPCOPQZ-UHFFFAOYSA-N 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
- 125000005023 xylyl group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/44—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members
- C07D207/444—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members having two doubly-bound oxygen atoms directly attached in positions 2 and 5
- C07D207/448—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members having two doubly-bound oxygen atoms directly attached in positions 2 and 5 with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms, e.g. maleimide
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/44—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members
- C07D207/444—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members having two doubly-bound oxygen atoms directly attached in positions 2 and 5
- C07D207/456—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members having two doubly-bound oxygen atoms directly attached in positions 2 and 5 with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to other ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/44—Iso-indoles; Hydrogenated iso-indoles
- C07D209/48—Iso-indoles; Hydrogenated iso-indoles with oxygen atoms in positions 1 and 3, e.g. phthalimide
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/56—Ring systems containing three or more rings
- C07D209/58—[b]- or [c]-condensed
- C07D209/72—4,7-Endo-alkylene-iso-indoles
- C07D209/76—4,7-Endo-alkylene-iso-indoles with oxygen atoms in positions 1 and 3
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G73/00—Macromolecular compounds obtained by reactions forming a linkage containing nitrogen with or without oxygen or carbon in the main chain of the macromolecule, not provided for in groups C08G12/00 - C08G71/00
- C08G73/06—Polycondensates having nitrogen-containing heterocyclic rings in the main chain of the macromolecule
- C08G73/10—Polyimides; Polyester-imides; Polyamide-imides; Polyamide acids or similar polyimide precursors
- C08G73/1003—Preparatory processes
- C08G73/1007—Preparatory processes from tetracarboxylic acids or derivatives and diamines
- C08G73/1021—Preparatory processes from tetracarboxylic acids or derivatives and diamines characterised by the catalyst used
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Indole Compounds (AREA)
- Macromolecular Compounds Obtained By Forming Nitrogen-Containing Linkages In General (AREA)
- Polymers With Sulfur, Phosphorus Or Metals In The Main Chain (AREA)
- Pyrrole Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Catalysts (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7836383A FR2444667A2 (fr) | 1978-12-19 | 1978-12-19 | Preparation d'oligoimides |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SE7900513L SE7900513L (sv) | 1980-06-20 |
| SE430785B true SE430785B (sv) | 1983-12-12 |
Family
ID=9216540
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7900513A SE430785B (sv) | 1978-12-19 | 1979-01-19 | Nytt forfarande for framstellning av n-substituerade oligoimider i nervaro av ett katalytiskt system |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4225497A (cs) |
| JP (1) | JPS5583745A (cs) |
| BE (1) | BE873813R (cs) |
| BR (1) | BR7900488A (cs) |
| CH (1) | CH637638A5 (cs) |
| DE (1) | DE2903498A1 (cs) |
| DK (1) | DK162438C (cs) |
| FR (1) | FR2444667A2 (cs) |
| GB (1) | GB2037274B (cs) |
| IE (1) | IE48060B1 (cs) |
| IT (1) | IT1166593B (cs) |
| LU (1) | LU80844A1 (cs) |
| NL (1) | NL188159C (cs) |
| SE (1) | SE430785B (cs) |
Families Citing this family (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4418181A (en) * | 1981-05-26 | 1983-11-29 | Plastics Engineering Company | Polyimides having bis-maleimide terminal groups |
| US4332944A (en) * | 1981-07-09 | 1982-06-01 | Zoecon Corporation | Compositions and use |
| US4532332A (en) * | 1981-08-17 | 1985-07-30 | Ciba-Geigy Corporation | N-(hydroxypolyoxaalkylene)phthalimides and succinimides and acrylate esters thereof |
| US5693741A (en) | 1988-03-15 | 1997-12-02 | The Boeing Company | Liquid molding compounds |
| US5550204A (en) * | 1981-11-13 | 1996-08-27 | The Boeing Company | Ether and ester oligomers with multidimensional morphology |
| US5969079A (en) | 1985-09-05 | 1999-10-19 | The Boeing Company | Oligomers with multiple chemically functional end caps |
| US5516876A (en) | 1983-09-27 | 1996-05-14 | The Boeing Company | Polyimide oligomers and blends |
| US5512676A (en) | 1987-09-03 | 1996-04-30 | The Boeing Company | Extended amideimide hub for multidimensional oligomers |
| US5705598A (en) | 1985-04-23 | 1998-01-06 | The Boeing Company | Polyester sulfone oligomers and blends |
| US5210213A (en) | 1983-06-17 | 1993-05-11 | The Boeing Company | Dimensional, crosslinkable oligomers |
| US5521014A (en) * | 1981-11-13 | 1996-05-28 | The Boeing Company | Extended multidimensional ether or ester oligomers |
| JPS5912931A (ja) * | 1982-07-13 | 1984-01-23 | Mitsubishi Petrochem Co Ltd | ポリマレイミドの製造方法 |
| DE3321157A1 (de) * | 1983-06-11 | 1984-12-13 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von 1h-pyrrol-2,5-dionen |
| US5227461A (en) * | 1983-06-17 | 1993-07-13 | The Boeing Company | Extended difunctional end-cap monomers |
| US4739030A (en) * | 1983-06-17 | 1988-04-19 | The Boeing Company | Difunctional end-cap monomers |
| US5175233A (en) * | 1983-06-17 | 1992-12-29 | The Boeing Company | Multidimensional ester or ether oligomers with pyrimidinyl end caps |
| US4578470A (en) * | 1983-06-20 | 1986-03-25 | General Electric Company | Bis-imides containing heterocyclic aromatic rings |
| US4550177A (en) * | 1984-04-11 | 1985-10-29 | The United States Of America As Represented By The Administrator Of The National Aeronautics And Space Administration | Maleimido substituted aromatic cyclotriphosphazenes |
| US4623734A (en) * | 1984-06-18 | 1986-11-18 | Nippon Shokubai Kagaku Kogyo Co., Ltd. | Method for production of maleimides |
| US5618907A (en) | 1985-04-23 | 1997-04-08 | The Boeing Company | Thallium catalyzed multidimensional ester oligomers |
| US5610317A (en) | 1985-09-05 | 1997-03-11 | The Boeing Company | Multiple chemically functional end cap monomers |
| US4658036A (en) * | 1985-10-03 | 1987-04-14 | Westvaco Corporation | Invert emulsifiers for oil-base drilling muds |
| EP0220137B1 (de) * | 1985-10-25 | 1991-06-19 | Ciba-Geigy Ag | Trisimide von allyl- oder methallyl-substituierten Bicyclo[2.2.1]hept-5-en-2,3-dicarbonsäureimiden und deren Verwendung |
| US5817744A (en) | 1988-03-14 | 1998-10-06 | The Boeing Company | Phenylethynyl capped imides |
| US5114612A (en) * | 1990-04-04 | 1992-05-19 | The United States Of America As Represented By The Department Of Energy | Liquid crystal polyester thermosets |
| US6939940B2 (en) * | 2000-09-13 | 2005-09-06 | The United States Of America As Represented By The Administrator Of The National Aeronautics And Space Administration | Liquid crystalline thermosets from ester, ester-imide, and ester-amide oligomers |
| CN118271605B (zh) * | 2022-12-30 | 2025-11-04 | 比亚迪股份有限公司 | 用于合成聚酰亚胺的催化剂及其制备方法和应用 |
Family Cites Families (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2686774A (en) * | 1951-08-31 | 1954-08-17 | Koppers Co Inc | Polymers and copolymers of nu-(dialkylamino aryl) imide of maleic and citraconic acids |
| US3025300A (en) * | 1955-12-14 | 1962-03-13 | Ciba Pharm Prod Inc | New phthalimides and methods for their preparation |
| SE316011B (cs) * | 1964-11-13 | 1969-10-13 | Rhodiaceta | |
| DE1250676B (de) * | 1965-08-02 | 1967-09-21 | The Lubiizol Corporation, Cleveland, Ohio (V. St A) | Kraftstoffe vom Benzinsiedebereich fur Verbrennungskraftmaschinen |
| FR1537135A (fr) * | 1967-07-12 | 1968-08-23 | Rhone Poulenc Sa | Nouveaux polyimides réticulés |
| DE1954878B2 (de) * | 1968-11-05 | 1972-03-02 | Toray Industries, Ine , Tokio | Verfahren zur herstellung von formkoerpern auf der basis von imidgruppen enthaltenden polykondensaten |
| US3732189A (en) * | 1970-03-27 | 1973-05-08 | Gen Electric | Method for making polyimides and products produced thereby |
| US3732188A (en) * | 1970-04-06 | 1973-05-08 | Gen Electric | Process for making polyimide prepolymer and product produced thereby |
| US3868351A (en) * | 1970-12-02 | 1975-02-25 | Gen Electric | Solution process for the preparation of polyimdies from diamines and anhydrides |
| US3729510A (en) * | 1971-04-19 | 1973-04-24 | Sun Oil Co | Process for hydroxyalkyl arylamides and imides |
| US3855239A (en) * | 1971-07-16 | 1974-12-17 | Gen Electric | Polyimides |
| US3767671A (en) * | 1971-09-01 | 1973-10-23 | Gen Electric | Trimellitimide derivatives |
| US3996203A (en) * | 1972-09-13 | 1976-12-07 | General Electric Company | Solution process for the preparation of polyimides from diamines and anhydrides |
| US3862129A (en) * | 1973-01-12 | 1975-01-21 | Union Carbide Corp | Novel haloaromatic etheramines |
| JPS52946B2 (cs) * | 1973-05-29 | 1977-01-11 | ||
| JPS50107137A (cs) * | 1974-02-05 | 1975-08-23 | ||
| AT333156B (de) * | 1974-02-27 | 1976-11-10 | Koeflach Sportgeraete Gmbh | Verfahren und vorrichtung zum verbinden der sohle mit dem schaft eines schuhes |
| US4118392A (en) * | 1975-03-14 | 1978-10-03 | Institut Francais Du Petrole | Dicarboxylic compounds and polyesters derived therefrom |
| US4125535A (en) * | 1976-06-04 | 1978-11-14 | Cities Service Company | Process for preparing bisimides and bisimides prepared thereby |
| JPS52156924A (en) * | 1976-06-22 | 1977-12-27 | Ihara Chem Ind Co Ltd | Repellent for aquatic life |
-
1978
- 1978-12-19 FR FR7836383A patent/FR2444667A2/fr active Granted
-
1979
- 1979-01-09 CH CH17579A patent/CH637638A5/fr not_active IP Right Cessation
- 1979-01-19 SE SE7900513A patent/SE430785B/sv not_active IP Right Cessation
- 1979-01-24 NL NLAANVRAGE7900566,A patent/NL188159C/xx not_active IP Right Cessation
- 1979-01-25 IT IT19611/79A patent/IT1166593B/it active
- 1979-01-26 BR BR7900488A patent/BR7900488A/pt unknown
- 1979-01-29 LU LU80844A patent/LU80844A1/fr unknown
- 1979-01-30 DE DE19792903498 patent/DE2903498A1/de active Granted
- 1979-01-30 BE BE0/193164A patent/BE873813R/xx not_active IP Right Cessation
- 1979-01-30 IE IE169/79A patent/IE48060B1/en unknown
- 1979-01-30 DK DK037879A patent/DK162438C/da not_active IP Right Cessation
- 1979-01-30 JP JP879979A patent/JPS5583745A/ja active Pending
- 1979-01-30 GB GB7903163A patent/GB2037274B/en not_active Expired
- 1979-01-31 US US06/008,053 patent/US4225497A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| DK162438B (da) | 1991-10-28 |
| NL188159B (nl) | 1991-11-18 |
| DK162438C (da) | 1992-03-23 |
| NL188159C (nl) | 1992-04-16 |
| FR2444667A2 (fr) | 1980-07-18 |
| CH637638A5 (fr) | 1983-08-15 |
| NL7900566A (nl) | 1980-06-23 |
| IT1166593B (it) | 1987-05-05 |
| BR7900488A (pt) | 1980-09-09 |
| JPS5583745A (en) | 1980-06-24 |
| BE873813R (fr) | 1979-07-30 |
| LU80844A1 (fr) | 1980-02-14 |
| DK37879A (da) | 1980-06-20 |
| DE2903498A1 (de) | 1980-07-10 |
| IT7919611A0 (it) | 1979-01-25 |
| SE7900513L (sv) | 1980-06-20 |
| FR2444667B2 (cs) | 1981-07-03 |
| US4225497A (en) | 1980-09-30 |
| GB2037274B (en) | 1983-04-13 |
| IE48060B1 (en) | 1984-09-19 |
| GB2037274A (en) | 1980-07-09 |
| DE2903498C2 (cs) | 1987-11-26 |
| IE790169L (en) | 1980-06-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE430785B (sv) | Nytt forfarande for framstellning av n-substituerade oligoimider i nervaro av ett katalytiskt system | |
| SE429860B (sv) | Forfarande for framstellning av oligomider genom omsettning av aminer med anhydrider av dikarboxylsyror i nervaro av ett katalytiskt system | |
| Smith et al. | Structure-making with 3, 5-dimitrosalicylic acid. I. The proton transfer compounds of 3, 5-dinitrosalicylic acid with a series of aliphatic amines | |
| EP0142835B1 (en) | Bis-aminopyridinium salts and their use as phase transfer catalysts for aromatic ether imide preparation | |
| EP0141692A1 (en) | Bis-quaternary salts as phase transfer catalysts for aromatic ether imide preparation | |
| US4113737A (en) | Polyamines with imide groups | |
| US3998904A (en) | Polyamines with imide groups | |
| Kausar et al. | Novel aromatic and aromatic–aliphatic poly (thiourea‐amide) s for the extraction of toxic heavy metal ions | |
| JPS62108861A (ja) | 8〜15個の炭素原子を有するラクタムの製造法 | |
| US3789055A (en) | Aliphatically unsaturated imides and method for making same | |
| EP0107542A1 (en) | Method for making aromatic bis(etherimide)s | |
| US5112989A (en) | Process for producing unsaturated mono and dicarboxylic acid imide compound | |
| JPH0676353B2 (ja) | ビス(p−アミノクミル)ベンゼン類の製造方法 | |
| US3689457A (en) | Novel polyamides having an amine function | |
| EP0172298A2 (en) | Method for making thioether(bisphthalimide)s | |
| US3454570A (en) | Process for preparing epoxyalkyl derivatives | |
| CN107417535B (zh) | 一种高选择性(E)-β-硝基苯乙烯衍生物的一锅合成方法 | |
| JPH0774195B2 (ja) | N−置換−α,β−不飽和ジカルボン酸環状イミドの製造方法 | |
| Kumar | Structure of aromatic polyimides | |
| EP1599438B1 (en) | Preparation of substituted phthalic anhydride, especially 4-chlorophtalic anhydride | |
| CA1117954A (fr) | Preparation d'oligoimides | |
| JPS61229863A (ja) | 芳香族ビスマレイミドの製造法 | |
| JPS6341456A (ja) | 新規ビスマレイミド化合物およびその製造方法 | |
| US4503231A (en) | Hydrolysis of nitriles to amides with quaternary ammonium hydroxide | |
| CN116120548A (zh) | 一种聚乙烯亚胺型铵盐离子液体及其制备方法和应用 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NAL | Patent in force |
Ref document number: 7900513-8 Format of ref document f/p: F |
|
| NUG | Patent has lapsed |
Ref document number: 7900513-8 Format of ref document f/p: F |