SE418845B - Forfarande for rening av vatprocessfosforsyra - Google Patents
Forfarande for rening av vatprocessfosforsyraInfo
- Publication number
- SE418845B SE418845B SE7904135A SE7904135A SE418845B SE 418845 B SE418845 B SE 418845B SE 7904135 A SE7904135 A SE 7904135A SE 7904135 A SE7904135 A SE 7904135A SE 418845 B SE418845 B SE 418845B
- Authority
- SE
- Sweden
- Prior art keywords
- phosphoric acid
- alkali
- heavy metals
- added
- process according
- Prior art date
Links
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 title claims abstract description 134
- 229910000147 aluminium phosphate Inorganic materials 0.000 title claims abstract description 67
- 238000000034 method Methods 0.000 title claims abstract description 43
- 238000000746 purification Methods 0.000 title claims description 9
- 229910001385 heavy metal Inorganic materials 0.000 claims abstract description 39
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims abstract description 35
- 229910052793 cadmium Inorganic materials 0.000 claims abstract description 26
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 claims abstract description 21
- 239000003513 alkali Substances 0.000 claims abstract description 19
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 claims abstract description 12
- 229910021653 sulphate ion Inorganic materials 0.000 claims abstract description 12
- 239000002244 precipitate Substances 0.000 claims abstract description 10
- -1 sulphide compound Chemical class 0.000 claims abstract description 9
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 claims abstract description 8
- 238000006386 neutralization reaction Methods 0.000 claims abstract description 4
- 125000004437 phosphorous atom Chemical group 0.000 claims abstract description 4
- 150000003568 thioethers Chemical group 0.000 claims abstract 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M potassium hydroxide Inorganic materials [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims description 11
- 238000001556 precipitation Methods 0.000 claims description 11
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 9
- 229910019142 PO4 Inorganic materials 0.000 claims description 8
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 claims description 8
- 239000010452 phosphate Substances 0.000 claims description 8
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 claims description 4
- 229910052602 gypsum Inorganic materials 0.000 claims description 4
- 239000010440 gypsum Substances 0.000 claims description 4
- 229940043430 calcium compound Drugs 0.000 claims description 3
- 150000001674 calcium compounds Chemical class 0.000 claims description 3
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 claims description 3
- 239000000920 calcium hydroxide Substances 0.000 claims description 3
- 229910001861 calcium hydroxide Inorganic materials 0.000 claims description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 2
- 239000000908 ammonium hydroxide Substances 0.000 claims description 2
- 229910000019 calcium carbonate Inorganic materials 0.000 claims description 2
- 125000002091 cationic group Chemical group 0.000 claims description 2
- 150000001768 cations Chemical class 0.000 claims description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims 1
- 239000001117 sulphuric acid Substances 0.000 abstract 2
- 235000011149 sulphuric acid Nutrition 0.000 abstract 2
- 239000000463 material Substances 0.000 abstract 1
- 230000001376 precipitating effect Effects 0.000 abstract 1
- 235000011007 phosphoric acid Nutrition 0.000 description 56
- 239000010949 copper Substances 0.000 description 15
- 239000000203 mixture Substances 0.000 description 12
- 239000011734 sodium Substances 0.000 description 12
- 239000002994 raw material Substances 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- 150000004763 sulfides Chemical class 0.000 description 8
- ODINCKMPIJJUCX-UHFFFAOYSA-N calcium oxide Inorganic materials [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 description 7
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 7
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 6
- 235000011941 Tilia x europaea Nutrition 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- 229910052785 arsenic Inorganic materials 0.000 description 6
- 229910052980 cadmium sulfide Inorganic materials 0.000 description 6
- 239000004571 lime Substances 0.000 description 6
- 235000021317 phosphate Nutrition 0.000 description 6
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 5
- CJOBVZJTOIVNNF-UHFFFAOYSA-N cadmium sulfide Chemical compound [Cd]=S CJOBVZJTOIVNNF-UHFFFAOYSA-N 0.000 description 5
- 239000011575 calcium Substances 0.000 description 5
- 239000008267 milk Substances 0.000 description 5
- 210000004080 milk Anatomy 0.000 description 5
- 235000013336 milk Nutrition 0.000 description 5
- 229910052979 sodium sulfide Inorganic materials 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 description 4
- 239000000292 calcium oxide Substances 0.000 description 4
- 229910052802 copper Inorganic materials 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 3
- 150000003016 phosphoric acids Chemical class 0.000 description 3
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 2
- WUPHOULIZUERAE-UHFFFAOYSA-N 3-(oxolan-2-yl)propanoic acid Chemical compound OC(=O)CCC1CCCO1 WUPHOULIZUERAE-UHFFFAOYSA-N 0.000 description 1
- MTJGVAJYTOXFJH-UHFFFAOYSA-N 3-aminonaphthalene-1,5-disulfonic acid Chemical compound C1=CC=C(S(O)(=O)=O)C2=CC(N)=CC(S(O)(=O)=O)=C21 MTJGVAJYTOXFJH-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 239000004135 Bone phosphate Substances 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- ZGSDJMADBJCNPN-UHFFFAOYSA-N [S-][NH3+] Chemical compound [S-][NH3+] ZGSDJMADBJCNPN-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- UYJXRRSPUVSSMN-UHFFFAOYSA-P ammonium sulfide Chemical compound [NH4+].[NH4+].[S-2] UYJXRRSPUVSSMN-UHFFFAOYSA-P 0.000 description 1
- 229910052586 apatite Inorganic materials 0.000 description 1
- 150000001553 barium compounds Chemical class 0.000 description 1
- CJDPJFRMHVXWPT-UHFFFAOYSA-N barium sulfide Chemical compound [S-2].[Ba+2] CJDPJFRMHVXWPT-UHFFFAOYSA-N 0.000 description 1
- 235000019347 bone phosphate Nutrition 0.000 description 1
- FRLJSGOEGLARCA-UHFFFAOYSA-N cadmium sulfide Chemical class [S-2].[Cd+2] FRLJSGOEGLARCA-UHFFFAOYSA-N 0.000 description 1
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- JGIATAMCQXIDNZ-UHFFFAOYSA-N calcium sulfide Chemical compound [Ca]=S JGIATAMCQXIDNZ-UHFFFAOYSA-N 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- BWFPGXWASODCHM-UHFFFAOYSA-N copper monosulfide Chemical compound [Cu]=S BWFPGXWASODCHM-UHFFFAOYSA-N 0.000 description 1
- 150000004683 dihydrates Chemical class 0.000 description 1
- HRKQOINLCJTGBK-UHFFFAOYSA-N dihydroxidosulfur Chemical compound OSO HRKQOINLCJTGBK-UHFFFAOYSA-N 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 210000003734 kidney Anatomy 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 229910052976 metal sulfide Inorganic materials 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- YXJYBPXSEKMEEJ-UHFFFAOYSA-N phosphoric acid;sulfuric acid Chemical compound OP(O)(O)=O.OS(O)(=O)=O YXJYBPXSEKMEEJ-UHFFFAOYSA-N 0.000 description 1
- QVLTXCYWHPZMCA-UHFFFAOYSA-N po4-po4 Chemical compound OP(O)(O)=O.OP(O)(O)=O QVLTXCYWHPZMCA-UHFFFAOYSA-N 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- DPLVEEXVKBWGHE-UHFFFAOYSA-N potassium sulfide Chemical compound [S-2].[K+].[K+] DPLVEEXVKBWGHE-UHFFFAOYSA-N 0.000 description 1
- 229910052713 technetium Inorganic materials 0.000 description 1
- GKLVYJBZJHMRIY-UHFFFAOYSA-N technetium atom Chemical compound [Tc] GKLVYJBZJHMRIY-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B25/00—Phosphorus; Compounds thereof
- C01B25/16—Oxyacids of phosphorus; Salts thereof
- C01B25/18—Phosphoric acid
- C01B25/234—Purification; Stabilisation; Concentration
- C01B25/237—Selective elimination of impurities
- C01B25/238—Cationic impurities, e.g. arsenic compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Removal Of Specific Substances (AREA)
- Solid-Sorbent Or Filter-Aiding Compositions (AREA)
- Processing Of Solid Wastes (AREA)
Priority Applications (10)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SE7904135A SE418845B (sv) | 1979-05-10 | 1979-05-10 | Forfarande for rening av vatprocessfosforsyra |
| JP55501082A JPH021086B2 (enExample) | 1979-05-10 | 1980-05-08 | |
| EP80850070A EP0023195B2 (en) | 1979-05-10 | 1980-05-08 | A method of purifying phosphoric acid of cadmium |
| US06/220,060 US4378340A (en) | 1979-05-10 | 1980-05-08 | Method of purifying phosphoric acid of heavy metals |
| PCT/SE1980/000134 WO1980002418A1 (en) | 1979-05-10 | 1980-05-08 | A method of purifying phosphoric acid of heavy metals |
| DE8080850070T DE3066353D1 (en) | 1979-05-10 | 1980-05-08 | A method of purifying phosphoric acid of heavy metal |
| AT80850070T ATE6050T1 (de) | 1979-05-10 | 1980-05-08 | Verfahren zur reinigung von phosphorsaeure von schwermetallen. |
| FI801521A FI66162C (fi) | 1979-05-10 | 1980-05-09 | Foerfarande foer rening av fosforsyra med avseende pao tungmetaller |
| DK547780A DK151216C (da) | 1979-05-10 | 1980-12-22 | Fremgangsmaade til fjernelse af tunge metaller, isaer cadmium, fra phosphorsyre fremstillet ved den vaade metode |
| NO810039A NO152505C (no) | 1979-05-10 | 1981-01-07 | Fremgangsmaate for aa fjrne tungmetaller fra vaatprosessfosforsyre. |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SE7904135A SE418845B (sv) | 1979-05-10 | 1979-05-10 | Forfarande for rening av vatprocessfosforsyra |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SE7904135L SE7904135L (sv) | 1980-11-11 |
| SE418845B true SE418845B (sv) | 1981-06-29 |
Family
ID=20338025
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7904135A SE418845B (sv) | 1979-05-10 | 1979-05-10 | Forfarande for rening av vatprocessfosforsyra |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4378340A (enExample) |
| EP (1) | EP0023195B2 (enExample) |
| JP (1) | JPH021086B2 (enExample) |
| AT (1) | ATE6050T1 (enExample) |
| DE (1) | DE3066353D1 (enExample) |
| DK (1) | DK151216C (enExample) |
| FI (1) | FI66162C (enExample) |
| NO (1) | NO152505C (enExample) |
| SE (1) | SE418845B (enExample) |
| WO (1) | WO1980002418A1 (enExample) |
Families Citing this family (31)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3134847A1 (de) * | 1981-09-03 | 1983-03-17 | Hoechst Ag, 6000 Frankfurt | "verfahren zur gewinnung cadmium-freier rohphosphorsaeure" |
| FR2520342A1 (fr) * | 1982-01-25 | 1983-07-29 | Rhone Poulenc Chim Base | Procede de purification d'acide phosphorique de voie humide |
| DE3202658A1 (de) * | 1982-01-28 | 1983-08-04 | Hoechst Ag, 6230 Frankfurt | Verfahren zur entfernung von schwermetallionen aus nassverfahrensphosphorsaeure |
| EP0087065B1 (de) * | 1982-02-12 | 1985-09-25 | Hoechst Aktiengesellschaft | Verfahren zur Verminderung des Schwermetallgehaltes im Rohphosphat |
| DE3218599A1 (de) * | 1982-05-18 | 1983-12-01 | Chemische Fabrik Budenheim Rudolf A. Oetker, 6501 Budenheim | Verfahren zum entfernen von cadmium aus sauren, insbesondere p(pfeil abwaerts)2(pfeil abwaerts)0(pfeil abwaerts)5(pfeil abwaerts)-haltigen loesungen |
| DE3604483A1 (de) * | 1986-02-13 | 1987-08-20 | Hoechst Ag | Verfahren zum entfernen von schwermetallen aus mineralsaeuren |
| DE3604920A1 (de) * | 1986-02-17 | 1987-08-20 | Hoechst Ag | Verfahren zur herstellung von rohphosphorsaeure |
| DE3622597A1 (de) * | 1986-07-04 | 1988-01-07 | Budenheim Rud A Oetker Chemie | Verfahren zur faellung und abtrennung von cadmiumsulfid aus den raffinaten der phosphorsaeurereinigung |
| NL8601846A (nl) * | 1986-07-15 | 1988-02-01 | Stamicarbon | Werkwijze voor het verwijderen van zware metalen uit zure fosfaathoudende waterige media. |
| DE3631290A1 (de) * | 1986-09-13 | 1988-03-24 | Budenheim Rud A Oetker Chemie | Verfahren zur behandlung von nassverfahrensphosphorsaeure |
| NO164768C (no) * | 1988-03-04 | 1990-11-14 | Norsk Hydro As | Fremgangsmaate for fjerning av tungmetaller, spesielt kadmium, fra fosforsyreholdige loesninger. |
| DE4327401A1 (de) * | 1993-08-14 | 1995-02-16 | Hoechst Ag | Verfahren zur Entfernung von Blei und Cadmium aus Phosphorsäure |
| US20040179984A1 (en) * | 2003-03-13 | 2004-09-16 | Nagaraj D. R. | Process for removing metal impurities from wet process phosphoric acid and compositions thereof |
| TW200944535A (en) * | 2008-03-20 | 2009-11-01 | Sigma Aldrich Co | Purification and preparation of phosphorus-containing compounds |
| KR101690403B1 (ko) * | 2012-06-21 | 2016-12-27 | 오토텍 (핀랜드) 오와이 | 인함유 출발 물질로부터 중금속을 분리하는 방법 및 플랜트 |
| DE102014006278B3 (de) * | 2014-05-02 | 2015-02-26 | Remondis Aqua Gmbh & Co. Kg | Verfahren zur Reinigung von Roh-Phosphorsäure (z.B. MGA-Säure) durch Zugabe von Aschen aus Abfall-Verbrennungsanlagen umfassend die Gewinnung von reiner Phosphorsäure, Kalziumsulfat, wasserlöslichen Kalziumhydrogenphosphaten und Metallsalz-Lösung |
| FR3039830B1 (fr) * | 2015-08-03 | 2018-09-07 | Ocp Sa | Procede de fabrication d'un engrais a base de phosphate d'ammonium presentant une teneur reduite en cadmium |
| WO2019071108A2 (en) | 2017-10-08 | 2019-04-11 | Cytec Industries Inc. | COMPOSITIONS AND METHODS FOR REMOVING HEAVY METALS FROM PHOSPHORIC ACID SOURCES |
| EP4164985B1 (en) | 2020-06-16 | 2024-06-26 | Yara International ASA | Process for the removal of heavy metals from a phosphoric acid containing composition using an ionic polymeric surfactant and use of said surfactant in the precipitation of heavy metals in a phosphoric acid containing composition |
| EP3964477A1 (en) | 2020-09-08 | 2022-03-09 | Yara International ASA | Process for the removal of heavy metals from a phosphoric acid containing composition using an ionic polymeric surfactant |
| EP3964476A1 (en) | 2020-09-08 | 2022-03-09 | Yara International ASA | Process for the removal of heavy metals from a phosphoric acid containing composition using a flocculating agent |
| EP3925710A1 (en) | 2020-06-16 | 2021-12-22 | Yara International ASA | Method for treating solid hazardous heavy metal-containing compositions |
| WO2021255065A1 (en) | 2020-06-16 | 2021-12-23 | Yara International Asa | Process for the removal of heavy metals from a phosphoric acid containing composition |
| EP3964478A1 (en) | 2020-09-08 | 2022-03-09 | Yara International ASA | Process for the removal of heavy metals from a phosphoric acid containing composition |
| CA3180313A1 (en) | 2020-06-16 | 2021-12-23 | Yara International Asa | Process for the removal of heavy metals from a phosphoric acid containing composition using a flocculating agent |
| EP4015452A1 (en) | 2020-12-21 | 2022-06-22 | Técnicas Reunidas, S.A. | Process for producing technical grade phosphoric acid from sewage sludge ash |
| IL319056A (en) | 2022-09-02 | 2025-04-01 | Cytec Ind Inc | Reagents and processes for removing heavy metals from phosphoric acid solutions |
| PL442462A1 (pl) * | 2022-10-07 | 2024-04-08 | Politechnika Wrocławska | Sposób oczyszczania surowców fosforowych przez kalcynację z dodatkiem soli nieorganicznych |
| EP4619341A1 (en) | 2022-11-17 | 2025-09-24 | Cytec Industries Inc. | Compositions and processes for removing heavy metals from phosphoric acid containing streams |
| CN121311439A (zh) | 2023-06-15 | 2026-01-09 | 塞特工业公司 | 从含磷酸的流中去除重金属 |
| WO2025219513A1 (en) | 2024-04-19 | 2025-10-23 | Cytec Industries Inc. | Compositions and processes for removing heavy metals from acid-containing streams |
Family Cites Families (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE37857C1 (enExample) | 1914-11-18 | |||
| SE190035C1 (enExample) | 1964-01-01 | |||
| US935337A (en) * | 1908-07-08 | 1909-09-28 | John Herbert Thwaites | Wet method of separating metallic compounds. |
| US1473641A (en) * | 1921-08-24 | 1923-11-13 | Pohl Otto | Process of dry distilling and carbonizing crude peat |
| US1783757A (en) * | 1927-12-14 | 1930-12-02 | Ig Farbenindustrie Ag | Dehydration of moist fuels |
| US1787192A (en) * | 1928-08-11 | 1930-12-30 | Rumford Chemical Works | Method of purifying phosphoric acid and the like |
| US2183924A (en) * | 1938-04-13 | 1939-12-19 | Eugene P Schoch | Lignite and process of producing the same |
| DE817590C (de) | 1948-10-02 | 1951-10-18 | Paul Hoppe | Verfahren zum Herstellen von hochwertigem Brennstoff |
| BE791820Q (fr) * | 1961-04-20 | 1973-03-16 | Rhone Progil | Fabrication de l'acide phosphorique |
| US3205589A (en) * | 1961-09-27 | 1965-09-14 | West Wood Proc Corp | Process of drying wood by oil immersion and vacuum treatment to selected moisture content with oil recovery |
| US3685964A (en) * | 1970-12-09 | 1972-08-22 | Fmc Corp | Purification of alkali phosphate solution |
| SE393676B (sv) | 1972-02-22 | 1977-05-16 | B O Heger | Forfarande for torkning av tre och andra liknande fiberprodukter |
| JPS5018388A (enExample) * | 1973-06-21 | 1975-02-26 | ||
| JPS5651123B2 (enExample) * | 1973-11-07 | 1981-12-03 | ||
| DE2447390C3 (de) | 1974-10-04 | 1983-11-17 | Hoechst Ag, 6230 Frankfurt | Verfahren zur Reinigung von Naßphosphorsäure |
| DE2608029C2 (de) * | 1976-02-27 | 1984-02-23 | Hoechst Ag, 6230 Frankfurt | Verfahren zur Herstellung einer Alkaliphosphatlösung aus Naßverfahrensphosphorsäuren |
| JPS5375196A (en) * | 1976-12-15 | 1978-07-04 | Central Glass Co Ltd | Removing method for heavy metals from phosphoric acid solution |
-
1979
- 1979-05-10 SE SE7904135A patent/SE418845B/sv not_active IP Right Cessation
-
1980
- 1980-05-08 US US06/220,060 patent/US4378340A/en not_active Expired - Fee Related
- 1980-05-08 WO PCT/SE1980/000134 patent/WO1980002418A1/en not_active Ceased
- 1980-05-08 JP JP55501082A patent/JPH021086B2/ja not_active Expired - Lifetime
- 1980-05-08 EP EP80850070A patent/EP0023195B2/en not_active Expired
- 1980-05-08 DE DE8080850070T patent/DE3066353D1/de not_active Expired
- 1980-05-08 AT AT80850070T patent/ATE6050T1/de not_active IP Right Cessation
- 1980-05-09 FI FI801521A patent/FI66162C/fi not_active IP Right Cessation
- 1980-12-22 DK DK547780A patent/DK151216C/da not_active IP Right Cessation
-
1981
- 1981-01-07 NO NO810039A patent/NO152505C/no unknown
Also Published As
| Publication number | Publication date |
|---|---|
| WO1980002418A1 (en) | 1980-11-13 |
| EP0023195A2 (en) | 1981-01-28 |
| EP0023195B1 (en) | 1984-02-01 |
| SE7904135L (sv) | 1980-11-11 |
| NO152505C (no) | 1985-10-09 |
| DK151216B (da) | 1987-11-16 |
| DK151216C (da) | 1988-07-18 |
| NO810039L (no) | 1981-01-07 |
| JPH021086B2 (enExample) | 1990-01-10 |
| NO152505B (no) | 1985-07-01 |
| EP0023195B2 (en) | 1988-09-21 |
| ATE6050T1 (de) | 1984-02-15 |
| JPS56500492A (enExample) | 1981-04-16 |
| EP0023195A3 (en) | 1981-09-09 |
| FI66162C (fi) | 1984-09-10 |
| DK547780A (da) | 1980-12-22 |
| FI66162B (fi) | 1984-05-31 |
| DE3066353D1 (en) | 1984-03-08 |
| US4378340A (en) | 1983-03-29 |
| FI801521A7 (fi) | 1980-11-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE418845B (sv) | Forfarande for rening av vatprocessfosforsyra | |
| US4986970A (en) | Method for removal of heavy metals, especially cadmium, from phosphoric acid containing solutions | |
| US20040179984A1 (en) | Process for removing metal impurities from wet process phosphoric acid and compositions thereof | |
| EP0482335A1 (de) | Verfahren zur Behandlung von Flugstäuben | |
| EP0175315A2 (de) | 4-Dimethylamino-1-hydroxybutan-1,1-diphosphonsäure, deren wasserlösliche Salze, Verfahren zu ihrer Herstellung sowie ihre Verwendung | |
| EP0179242B1 (de) | Verfahren zur Reinigung von Phosphorsäure | |
| EP0035027A1 (de) | Neue säuren des phosphors und deren derivate. | |
| JPS61174998A (ja) | 湿潤燐酸から重金属を除去する際に生じる重金属含有残留物を堆積可能の固体生成物に変化させる方法 | |
| DE2447390C3 (de) | Verfahren zur Reinigung von Naßphosphorsäure | |
| US3317040A (en) | Flotation process with reagent composition | |
| DE3209183A1 (de) | Verfahren zur abtrennung von schwermetallverbindungen aus zwischenprodukten der fabrikation von phosphorduengemitteln | |
| NO141887B (no) | Fremgangsmaate til fremstilling av alkalifosfatopploesninger med lavt innhold av vanadium | |
| EP0253454A1 (en) | Process for the removal of heavy metals from acid, phosphate-containing aqueous media | |
| CA1261115A (en) | Process for dearsenifying phosphoric acid solutions | |
| CA1156427A (en) | Method of purifying phosphoric acid of heavy metals | |
| EP0354338A3 (de) | Verfahren zur Aufarbeitung von Stäuben, die bei der elektrothermischen Phosphorherstellung anfallen | |
| SE417814B (sv) | Forfarande for rening av fosforsyra med avseende pa magnesium | |
| DE3725583A1 (de) | Verfahren zur herstellung einer eisen- und arsenarmen phosphorigsaeure-loesung | |
| CA1141939A (en) | Production of alkali metal phosphate solutions free from zinc | |
| US4684512A (en) | Phosphate recovery from wet phosphoric acid purification process | |
| SU1281513A1 (ru) | Способ извлечени фосфата цинка из фосфатного шлама | |
| DE4040474A1 (de) | Neue dithiophosphorsaeureester und deren verwendung zur faellung und flotation von schwermetallen aus mineralsaeuren | |
| DD216465A1 (de) | Verfahren zur herstellung substituierter alkanphosphonsaeuren | |
| DE3920869A1 (de) | Verfahren zur aufbereitung von altoel | |
| RU2008257C1 (ru) | Способ получения триполифосфата натрия |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NUG | Patent has lapsed |
Ref document number: 7904135-6 Effective date: 19911209 Format of ref document f/p: F |