SE411552B - Forfarande for etenpolymerisation medelst en uppburen pi-bunden kromforening samt katalysator for genomforande av forfarandet - Google Patents
Forfarande for etenpolymerisation medelst en uppburen pi-bunden kromforening samt katalysator for genomforande av forfarandetInfo
- Publication number
- SE411552B SE411552B SE7310178A SE7310178A SE411552B SE 411552 B SE411552 B SE 411552B SE 7310178 A SE7310178 A SE 7310178A SE 7310178 A SE7310178 A SE 7310178A SE 411552 B SE411552 B SE 411552B
- Authority
- SE
- Sweden
- Prior art keywords
- catalyst
- chromium
- compound
- polymerization
- temperature
- Prior art date
Links
- 239000003054 catalyst Substances 0.000 title claims description 90
- 238000006116 polymerization reaction Methods 0.000 title claims description 32
- 150000001875 compounds Chemical class 0.000 title claims description 30
- 238000000034 method Methods 0.000 title claims description 27
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 title claims description 25
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical class O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 34
- 239000005977 Ethylene Substances 0.000 claims description 24
- 150000001845 chromium compounds Chemical class 0.000 claims description 22
- 239000011651 chromium Substances 0.000 claims description 17
- 239000000178 monomer Substances 0.000 claims description 15
- 229910052804 chromium Inorganic materials 0.000 claims description 14
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 12
- 229910052809 inorganic oxide Inorganic materials 0.000 claims description 11
- 239000012298 atmosphere Substances 0.000 claims description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims description 9
- TYYBBNOTQFVVKN-UHFFFAOYSA-N chromium(2+);cyclopenta-1,3-diene Chemical compound [Cr+2].C=1C=C[CH-]C=1.C=1C=C[CH-]C=1 TYYBBNOTQFVVKN-UHFFFAOYSA-N 0.000 claims description 9
- 150000002430 hydrocarbons Chemical group 0.000 claims description 8
- 239000003446 ligand Substances 0.000 claims description 7
- 239000002685 polymerization catalyst Substances 0.000 claims description 6
- 125000001424 substituent group Chemical group 0.000 claims description 6
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 3
- 150000004945 aromatic hydrocarbons Chemical class 0.000 claims description 2
- 150000001336 alkenes Chemical class 0.000 claims 2
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 claims 1
- 229920000642 polymer Polymers 0.000 description 61
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 27
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 26
- 238000006243 chemical reaction Methods 0.000 description 20
- 239000002904 solvent Substances 0.000 description 20
- 230000032683 aging Effects 0.000 description 19
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 18
- 239000002002 slurry Substances 0.000 description 17
- 239000000377 silicon dioxide Substances 0.000 description 15
- 229910052786 argon Inorganic materials 0.000 description 13
- 239000007787 solid Substances 0.000 description 10
- 230000000052 comparative effect Effects 0.000 description 9
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 9
- -1 cyclobutadienyl Chemical group 0.000 description 8
- 150000002902 organometallic compounds Chemical class 0.000 description 8
- 238000002360 preparation method Methods 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- 238000000151 deposition Methods 0.000 description 7
- 238000010438 heat treatment Methods 0.000 description 7
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 6
- 238000001035 drying Methods 0.000 description 6
- 238000002474 experimental method Methods 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- 239000000155 melt Substances 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N monobenzene Natural products C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- 230000000694 effects Effects 0.000 description 5
- 239000011261 inert gas Substances 0.000 description 5
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 5
- 239000003960 organic solvent Substances 0.000 description 5
- 238000012360 testing method Methods 0.000 description 5
- 229920002554 vinyl polymer Polymers 0.000 description 5
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 4
- 239000012300 argon atmosphere Substances 0.000 description 4
- 125000003118 aryl group Chemical group 0.000 description 4
- 229920001577 copolymer Polymers 0.000 description 4
- QWTDNUCVQCZILF-UHFFFAOYSA-N isopentane Chemical compound CCC(C)C QWTDNUCVQCZILF-UHFFFAOYSA-N 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 239000011148 porous material Substances 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 229920006395 saturated elastomer Polymers 0.000 description 4
- 238000003878 thermal aging Methods 0.000 description 4
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- 238000013019 agitation Methods 0.000 description 3
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 3
- 229920001519 homopolymer Polymers 0.000 description 3
- 229930195733 hydrocarbon Natural products 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000002574 poison Substances 0.000 description 3
- 231100000614 poison Toxicity 0.000 description 3
- 229920000573 polyethylene Polymers 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- 238000012552 review Methods 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 2
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-Butene Chemical compound CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 description 2
- LIKMAJRDDDTEIG-UHFFFAOYSA-N 1-hexene Chemical compound CCCCC=C LIKMAJRDDDTEIG-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- RGSFGYAAUTVSQA-UHFFFAOYSA-N Cyclopentane Chemical compound C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 2
- MCMNRKCIXSYSNV-UHFFFAOYSA-N Zirconium dioxide Chemical compound O=[Zr]=O MCMNRKCIXSYSNV-UHFFFAOYSA-N 0.000 description 2
- 230000004913 activation Effects 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 125000003710 aryl alkyl group Chemical group 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- ZCDOYSPFYFSLEW-UHFFFAOYSA-N chromate(2-) Chemical group [O-][Cr]([O-])(=O)=O ZCDOYSPFYFSLEW-UHFFFAOYSA-N 0.000 description 2
- 239000002131 composite material Substances 0.000 description 2
- 230000001419 dependent effect Effects 0.000 description 2
- 150000001993 dienes Chemical class 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- AFABGHUZZDYHJO-UHFFFAOYSA-N dimethyl butane Natural products CCCC(C)C AFABGHUZZDYHJO-UHFFFAOYSA-N 0.000 description 2
- QWHNJUXXYKPLQM-UHFFFAOYSA-N dimethyl cyclopentane Natural products CC1(C)CCCC1 QWHNJUXXYKPLQM-UHFFFAOYSA-N 0.000 description 2
- 238000010528 free radical solution polymerization reaction Methods 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 150000005673 monoalkenes Chemical class 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- 239000013110 organic ligand Substances 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 2
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 2
- 239000012429 reaction media Substances 0.000 description 2
- 238000001179 sorption measurement Methods 0.000 description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 1
- YCTDZYMMFQCTEO-FNORWQNLSA-N (E)-3-octene Chemical compound CCCC\C=C\CC YCTDZYMMFQCTEO-FNORWQNLSA-N 0.000 description 1
- WJYMPXJVHNDZHD-UHFFFAOYSA-N 1,3,5-triethylbenzene Chemical compound CCC1=CC(CC)=CC(CC)=C1 WJYMPXJVHNDZHD-UHFFFAOYSA-N 0.000 description 1
- PRBHEGAFLDMLAL-UHFFFAOYSA-N 1,5-Hexadiene Natural products CC=CCC=C PRBHEGAFLDMLAL-UHFFFAOYSA-N 0.000 description 1
- 125000004493 2-methylbut-1-yl group Chemical group CC(C*)CC 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- YHQXBTXEYZIYOV-UHFFFAOYSA-N 3-methylbut-1-ene Chemical compound CC(C)C=C YHQXBTXEYZIYOV-UHFFFAOYSA-N 0.000 description 1
- 244000125300 Argania sideroxylon Species 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- NHTMVDHEPJAVLT-UHFFFAOYSA-N Isooctane Chemical compound CC(C)CC(C)(C)C NHTMVDHEPJAVLT-UHFFFAOYSA-N 0.000 description 1
- 241000234295 Musa Species 0.000 description 1
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 1
- 102000007530 Neurofibromin 1 Human genes 0.000 description 1
- 108010085793 Neurofibromin 1 Proteins 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- XBRRNQFYWXFWLR-UHFFFAOYSA-N [Cr].C(CC)C1=CC=CC=C1.C(CC)C1=CC=CC=C1 Chemical compound [Cr].C(CC)C1=CC=CC=C1.C(CC)C1=CC=CC=C1 XBRRNQFYWXFWLR-UHFFFAOYSA-N 0.000 description 1
- 238000002835 absorbance Methods 0.000 description 1
- 230000002745 absorbent Effects 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 125000002723 alicyclic group Chemical group 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 150000004703 alkoxides Chemical group 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- HVURSIGIEONDKB-UHFFFAOYSA-N benzene;chromium Chemical compound [Cr].C1=CC=CC=C1.C1=CC=CC=C1 HVURSIGIEONDKB-UHFFFAOYSA-N 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- 210000000481 breast Anatomy 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000012986 chain transfer agent Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- ZVPMGSFKOIZWBD-UHFFFAOYSA-N chromium 1,3,5-trihexylbenzene Chemical compound [Cr].C(CCCCC)C1=CC(=CC(=C1)CCCCCC)CCCCCC.C(CCCCC)C1=CC(=CC(=C1)CCCCCC)CCCCCC ZVPMGSFKOIZWBD-UHFFFAOYSA-N 0.000 description 1
- WSLXCOCLWSMRQJ-UHFFFAOYSA-N chromium 1,3-dipentylbenzene Chemical compound [Cr].C(CCCC)C1=CC(=CC=C1)CCCCC.C(CCCC)C1=CC(=CC=C1)CCCCC WSLXCOCLWSMRQJ-UHFFFAOYSA-N 0.000 description 1
- LKNFCDNQRJWUPW-UHFFFAOYSA-N chromium 1,4-xylene Chemical compound [Cr].C1(=CC=C(C=C1)C)C.C1(=CC=C(C=C1)C)C LKNFCDNQRJWUPW-UHFFFAOYSA-N 0.000 description 1
- ZQDPLZLEEBJZKY-UHFFFAOYSA-N chromium;1,2-xylene Chemical compound [Cr].CC1=CC=CC=C1C.CC1=CC=CC=C1C ZQDPLZLEEBJZKY-UHFFFAOYSA-N 0.000 description 1
- 230000001143 conditioned effect Effects 0.000 description 1
- 238000007334 copolymerization reaction Methods 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- CHVJITGCYZJHLR-UHFFFAOYSA-N cyclohepta-1,3,5-triene Chemical group C1C=CC=CC=C1 CHVJITGCYZJHLR-UHFFFAOYSA-N 0.000 description 1
- 125000002188 cycloheptatrienyl group Chemical group C1(=CC=CC=CC1)* 0.000 description 1
- 125000000058 cyclopentadienyl group Chemical group C1(=CC=CC1)* 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- JVSWJIKNEAIKJW-UHFFFAOYSA-N dimethyl-hexane Natural products CCCCCC(C)C JVSWJIKNEAIKJW-UHFFFAOYSA-N 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- ZSWFCLXCOIISFI-UHFFFAOYSA-N endo-cyclopentadiene Chemical group C1C=CC=C1 ZSWFCLXCOIISFI-UHFFFAOYSA-N 0.000 description 1
- 229920001038 ethylene copolymer Polymers 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- DMEGYFMYUHOHGS-UHFFFAOYSA-N heptamethylene Natural products C1CCCCCC1 DMEGYFMYUHOHGS-UHFFFAOYSA-N 0.000 description 1
- PYGSKMBEVAICCR-UHFFFAOYSA-N hexa-1,5-diene Chemical compound C=CCCC=C PYGSKMBEVAICCR-UHFFFAOYSA-N 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000003350 kerosene Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 230000000379 polymerizing effect Effects 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000005245 sintering Methods 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000000859 sublimation Methods 0.000 description 1
- 230000008022 sublimation Effects 0.000 description 1
- 238000010557 suspension polymerization reaction Methods 0.000 description 1
- 229950011008 tetrachloroethylene Drugs 0.000 description 1
- 238000005979 thermal decomposition reaction Methods 0.000 description 1
- ZCUFMDLYAMJYST-UHFFFAOYSA-N thorium dioxide Chemical compound O=[Th]=O ZCUFMDLYAMJYST-UHFFFAOYSA-N 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 238000007740 vapor deposition Methods 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F10/00—Homopolymers and copolymers of unsaturated aliphatic hydrocarbons having only one carbon-to-carbon double bond
- C08F10/02—Ethene
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Transition And Organic Metals Composition Catalysts For Addition Polymerization (AREA)
- Polymerization Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US00273757A US3806500A (en) | 1972-07-21 | 1972-07-21 | Polymerization with thermally aged catalyst |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SE411552B true SE411552B (sv) | 1980-01-14 |
Family
ID=23045277
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7310178A SE411552B (sv) | 1972-07-21 | 1973-07-20 | Forfarande for etenpolymerisation medelst en uppburen pi-bunden kromforening samt katalysator for genomforande av forfarandet |
| SE7803803A SE415186B (sv) | 1972-07-21 | 1978-04-04 | Forfarande for etenpolymerisation medelst en uppburen pi-bunden kromforening samt katalysator for genomforande av forfarandet |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7803803A SE415186B (sv) | 1972-07-21 | 1978-04-04 | Forfarande for etenpolymerisation medelst en uppburen pi-bunden kromforening samt katalysator for genomforande av forfarandet |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3806500A (en:Method) |
| JP (1) | JPS5231225B2 (en:Method) |
| BE (1) | BE802601A (en:Method) |
| CA (1) | CA1011046A (en:Method) |
| DE (1) | DE2336227C3 (en:Method) |
| FR (1) | FR2193838B1 (en:Method) |
| GB (1) | GB1428538A (en:Method) |
| IT (1) | IT994987B (en:Method) |
| NL (1) | NL171364C (en:Method) |
| SE (2) | SE411552B (en:Method) |
Families Citing this family (33)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3953413A (en) * | 1974-06-13 | 1976-04-27 | Chemplex Company | Supported chromium-containing catalyst and process of polymerizing 1-olefins |
| US4188471A (en) * | 1974-12-04 | 1980-02-12 | Phillips Petroleum Company | Organochromium on titanium-impregnated base as olefin polymerization catalyst |
| US4049896A (en) * | 1975-03-14 | 1977-09-20 | National Petro Chemicals Corporation | Olefin polymerization catalyst |
| US3984351A (en) * | 1975-03-14 | 1976-10-05 | National Petro Chemicals Corporation | Olefin polymerization catalyst |
| US4192775A (en) * | 1975-03-14 | 1980-03-11 | National Petro Chemicals Corporation | Olefin polymerization catalyst |
| US4015059A (en) * | 1975-12-29 | 1977-03-29 | Union Carbide Corporation | Fused ring catalyst and ethylene polymerization process therewith |
| US4041225A (en) * | 1975-12-29 | 1977-08-09 | Chemplex Company | Polymerization catalyst and method |
| US4053437A (en) * | 1976-03-04 | 1977-10-11 | Chemplex Company | Polyolefin catalyst and method for its preparation |
| US4101445A (en) * | 1976-09-22 | 1978-07-18 | Union Carbide Corporation | Preparation of modified and activated chromocene catalysts for ethylene polymerization |
| US4284527A (en) * | 1978-06-19 | 1981-08-18 | Chemplex Company | Polymerization catalyst |
| US4260706A (en) * | 1979-06-21 | 1981-04-07 | National Petro Chemicals Corp. | Olefin polymerization catalyst |
| US4303770A (en) * | 1979-10-24 | 1981-12-01 | Chemplex Company | Method of making polymers and copolymers of 1-olefins |
| DE3030055A1 (de) * | 1980-08-08 | 1982-03-25 | Basf Ag, 6700 Ludwigshafen | Verfahren zum herstellen von ethylen-homopolymerisaten sowie ethylen-copolymerisaten mit (alpha) -monoolefinen |
| US4444968A (en) * | 1980-12-31 | 1984-04-24 | Phillips Petroleum Company | Olefin polymerization with phosphate supported zerovalent chromium |
| US4364841A (en) * | 1980-12-31 | 1982-12-21 | Phillips Petroleum Company | Phosphate containing support with zerovalent chromium |
| US4398004A (en) * | 1980-12-31 | 1983-08-09 | Phillips Petroleum Company | Olefin polymerization with phosphated silica-chromium catalyst with boron-containing cocatalyst |
| US4364840A (en) * | 1980-12-31 | 1982-12-21 | Phillips Petroleum Company | Phosphated silica-chromium catalyst with boron-containing cocatalyst |
| US4424139A (en) | 1982-03-30 | 1984-01-03 | Phillips Petroleum Company | Catalyst comprising a phosphate and with a bis-(cyclopentadienyl)chromium(II) compound |
| US4803253A (en) * | 1982-03-30 | 1989-02-07 | Phillips Petroleum Company | Ethylene polymer produced using a catalyst comprising a phosphate and with a bis-(cyclopentadienyl)chromium(II) compound |
| US4690990A (en) * | 1982-03-30 | 1987-09-01 | Phillips Petroleum Company | Polymerization process using a catalyst comprising a phosphate and with a bis-(cyclopentadienyl)chromium(II) compound |
| US4619980A (en) * | 1985-04-01 | 1986-10-28 | Phillips Petroleum Company | Polymerization catalyst, method of making and use therefor |
| US4681866A (en) * | 1985-04-01 | 1987-07-21 | Phillips Petroleum Company | Polymerization catalyst, method of making and use therefor |
| JPH0247291U (en:Method) * | 1988-09-26 | 1990-03-30 | ||
| GB8919925D0 (en) * | 1989-09-04 | 1989-10-18 | Bp Chem Int Ltd | Chromium-containing complex polymerisation catalyst |
| GB8919924D0 (en) * | 1989-09-04 | 1989-10-18 | Bp Chem Int Ltd | Chromium-containing complex polymerisation catalyst |
| GB8919926D0 (en) * | 1989-09-04 | 1989-10-18 | Bp Chem Int Ltd | Chromium-containing complex polymerisation catalyst |
| DE4323192A1 (de) * | 1993-07-10 | 1995-01-12 | Basf Ag | Verfahren zur Herstellung von Homo- und Copolymerisaten von Alk-1-enen |
| US5401816A (en) * | 1993-09-27 | 1995-03-28 | Phillips Petroleum Company | Transition metal catalyst, method of preparing catalyst, polymerization process employing catalyst, and polymer produced |
| US5543376A (en) * | 1994-02-25 | 1996-08-06 | Phillips Petroleum Company | Process for producing polyolefins |
| DE19645939A1 (de) * | 1996-11-07 | 1998-05-14 | Buna Sow Leuna Olefinverb Gmbh | Verfahren zur Herstellung von ultrahochmolekularem Polyethylen und Methode zur Aktivierung des Katalysatorträgers |
| US7151073B2 (en) * | 2004-01-16 | 2006-12-19 | Exxonmobil Chemical Patents Inc. | Mesoporous catalyst support, a catalyst system, and method of making and using same for olefin polymerization |
| US8183173B2 (en) * | 2007-12-21 | 2012-05-22 | Chevron Phillips Chemical Company Lp | Fast activating catalyst |
| US9376511B2 (en) | 2013-03-13 | 2016-06-28 | Chevron Phillips Chemical Company Lp | Polymerization catalysts and polymers |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA930496A (en) * | 1968-10-14 | 1973-07-17 | L. Karapinka George | POLYMERIZATION OF OLEFINS USING SUPPORTED .pi. ARENECHROMIUM TRICARBONYL CATALYSTS |
-
1972
- 1972-07-21 US US00273757A patent/US3806500A/en not_active Expired - Lifetime
-
1973
- 1973-06-25 CA CA174,832A patent/CA1011046A/en not_active Expired
- 1973-07-17 DE DE2336227A patent/DE2336227C3/de not_active Expired
- 1973-07-20 JP JP48080737A patent/JPS5231225B2/ja not_active Expired
- 1973-07-20 GB GB3462473A patent/GB1428538A/en not_active Expired
- 1973-07-20 BE BE133696A patent/BE802601A/xx not_active IP Right Cessation
- 1973-07-20 SE SE7310178A patent/SE411552B/sv unknown
- 1973-07-20 NL NLAANVRAGE7310149,A patent/NL171364C/xx not_active IP Right Cessation
- 1973-07-20 FR FR7326749A patent/FR2193838B1/fr not_active Expired
- 1973-07-20 IT IT26858/73A patent/IT994987B/it active
-
1978
- 1978-04-04 SE SE7803803A patent/SE415186B/sv not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| GB1428538A (en) | 1976-03-17 |
| DE2336227A1 (de) | 1974-01-31 |
| AU5827773A (en) | 1975-01-23 |
| DE2336227B2 (de) | 1980-06-12 |
| NL7310149A (en:Method) | 1974-01-23 |
| JPS4945189A (en:Method) | 1974-04-30 |
| NL171364B (nl) | 1982-10-18 |
| CA1011046A (en) | 1977-05-24 |
| FR2193838B1 (en:Method) | 1976-06-18 |
| SE415186B (sv) | 1980-09-15 |
| FR2193838A1 (en:Method) | 1974-02-22 |
| IT994987B (it) | 1975-10-20 |
| DE2336227C3 (de) | 1981-04-16 |
| SE7803803L (sv) | 1978-04-04 |
| NL171364C (nl) | 1983-03-16 |
| US3806500A (en) | 1974-04-23 |
| BE802601A (fr) | 1974-01-21 |
| JPS5231225B2 (en:Method) | 1977-08-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE411552B (sv) | Forfarande for etenpolymerisation medelst en uppburen pi-bunden kromforening samt katalysator for genomforande av forfarandet | |
| US3704287A (en) | High temperature reduced catalyst and process | |
| US5624877A (en) | Process for producing polyolefins | |
| US4015059A (en) | Fused ring catalyst and ethylene polymerization process therewith | |
| EP0018108B1 (en) | Process and catalyst for polymerising olefins and products therefrom | |
| US4333851A (en) | Olefin polymerization catalyst, process and polyolefin product | |
| SE445460B (sv) | Forfarande for framstellning av etenpolymerisationskatalysator innehallande titan och krom, den sa framstellda katalysatorn och anvendning derav | |
| SE407412B (sv) | Sett och katalysatorsystem for lagtryckspolymerisation av eten enbart eller tillsammans med alfa-olefiner med 3-6 kolatomer | |
| US4105585A (en) | Polymerization catalyst | |
| US4396533A (en) | Polymerization catalyst | |
| CN1135240C (zh) | 具有高耐环境开裂性能的乙烯聚合物以及其制备中所用的催化剂 | |
| EP0003836A1 (en) | Catalytic polymerization of ethylene with chromium(II) catalyst in the presence of a phenolic antioxidant and product obtained | |
| US4454242A (en) | Catalyst for polymerization of olefins | |
| US4031298A (en) | Polymerization catalyst and method | |
| US4065612A (en) | Phenol modified polymerization catalyst and polymerization process | |
| US4434083A (en) | Process of preparing a catalyst component and polymerization of α-olefins with such a catalyst component | |
| GB1582287A (en) | Process catalyst and catalyst component for the manufacture of homopolymers and copolymers of a-monoolefins | |
| EP0008528B1 (en) | Process for polymerising 1-olefins and polymers produced therefrom | |
| US3941761A (en) | Method of polymerizing olefins | |
| EP0255296A2 (en) | Chromium-containing bimetallic complex catalysts | |
| US4211671A (en) | Olefin polymerization catalyst | |
| EP0501672B1 (en) | Polymerization catalyst and process | |
| US4020092A (en) | Compounds bis(tributyltin)chromate and bis(triphenyltin)chromate | |
| KR20050055769A (ko) | 가스상 올레핀 중합을 위한 담지 촉매 | |
| JPS64969B2 (en:Method) |