SE404691B - Forfarande for framstellning av karnitinhydroklorid - Google Patents
Forfarande for framstellning av karnitinhydrokloridInfo
- Publication number
- SE404691B SE404691B SE7504782A SE7504782A SE404691B SE 404691 B SE404691 B SE 404691B SE 7504782 A SE7504782 A SE 7504782A SE 7504782 A SE7504782 A SE 7504782A SE 404691 B SE404691 B SE 404691B
- Authority
- SE
- Sweden
- Prior art keywords
- hydrocloride
- carnitine
- procedure
- preparation
- carnitine hydrocloride
- Prior art date
Links
- PHIQHXFUZVPYII-ZCFIWIBFSA-O (R)-carnitinium Chemical compound C[N+](C)(C)C[C@H](O)CC(O)=O PHIQHXFUZVPYII-ZCFIWIBFSA-O 0.000 title 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 title 1
- 229960004203 carnitine Drugs 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C229/00—Compounds containing amino and carboxyl groups bound to the same carbon skeleton
- C07C229/02—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C229/04—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated
- C07C229/22—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated the carbon skeleton being further substituted by oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Respiratory Apparatuses And Protective Means (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH573074A CH589604A5 (esLanguage) | 1974-04-26 | 1974-04-26 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SE7504782L SE7504782L (sv) | 1975-10-27 |
| SE404691B true SE404691B (sv) | 1978-10-23 |
Family
ID=4298393
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7504782A SE404691B (sv) | 1974-04-26 | 1975-04-24 | Forfarande for framstellning av karnitinhydroklorid |
Country Status (25)
| Country | Link |
|---|---|
| US (1) | US3969406A (esLanguage) |
| JP (1) | JPS50148312A (esLanguage) |
| AR (1) | AR207361A1 (esLanguage) |
| AT (1) | AT342792B (esLanguage) |
| BE (1) | BE828456A (esLanguage) |
| BG (1) | BG26371A3 (esLanguage) |
| BR (1) | BR7502510A (esLanguage) |
| CA (1) | CA1034143A (esLanguage) |
| CH (1) | CH589604A5 (esLanguage) |
| DD (1) | DD119575A5 (esLanguage) |
| DE (1) | DE2518813C2 (esLanguage) |
| DK (1) | DK174575A (esLanguage) |
| ES (1) | ES436902A1 (esLanguage) |
| FR (1) | FR2268787B1 (esLanguage) |
| GB (1) | GB1448081A (esLanguage) |
| IE (1) | IE41115B1 (esLanguage) |
| IN (1) | IN144611B (esLanguage) |
| IT (1) | IT1035450B (esLanguage) |
| LU (1) | LU72363A1 (esLanguage) |
| NL (1) | NL7504852A (esLanguage) |
| NO (1) | NO751472L (esLanguage) |
| RO (1) | RO66137A (esLanguage) |
| SE (1) | SE404691B (esLanguage) |
| SU (1) | SU544366A3 (esLanguage) |
| ZA (1) | ZA752563B (esLanguage) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4642290A (en) * | 1982-12-06 | 1987-02-10 | Sih Charles J | Process for preparing a compound for use in the production of L-carnitine |
| IE56322B1 (en) * | 1982-12-06 | 1991-06-19 | Sigma Tau Ind Farmaceuti | Process for preparing l-carnitine and chemical intermediates employed therein |
| US4710468A (en) * | 1983-10-24 | 1987-12-01 | Sigma-Tau Industrie Pharmaceutiche Riunite S.P.A. | Process for preparing L-carnitine and chemical intermediates employed therein |
| IT1190358B (it) * | 1985-05-24 | 1988-02-16 | Sclavo Spa | Procedimento per la preparazione di l-carnitina |
| US4788322A (en) * | 1987-07-31 | 1988-11-29 | Merck & Co., Inc. | Process for preparing ACHPA |
| JPH0678277B2 (ja) * | 1988-02-19 | 1994-10-05 | 高砂香料工業株式会社 | 光学活性アルコールおよびその誘導体の製造方法 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2328021A (en) * | 1940-07-17 | 1943-08-31 | Emuisol Corp | Derivatives of amines |
| US2530627A (en) * | 1946-09-06 | 1950-11-21 | Merck & Co Inc | Production of n-acyl allothreonine esters |
| US2571755A (en) * | 1948-12-09 | 1951-10-16 | Merck & Co Inc | Preparation of threonine and intermediates therefor |
| US3038007A (en) * | 1958-05-23 | 1962-06-05 | Reeve Edward Wilkins | Process for the preparation of dl-threonine |
| US3096368A (en) * | 1958-07-30 | 1963-07-02 | Process for preparing hydrolysis products of gamma-dimethyl amin-beta-hydroxybutyroni | |
| US3135788A (en) * | 1959-09-28 | 1964-06-02 | Nihon Zoki Seiyaku Kabushikika | Preparation of dl-carnitine hydrochloride from trimethylamine hydrochloride and epihalogenohydrin |
| BE661015A (esLanguage) * | 1965-03-12 | 1965-09-13 |
-
1974
- 1974-04-26 CH CH573074A patent/CH589604A5/xx not_active IP Right Cessation
-
1975
- 1975-01-01 AR AR258495A patent/AR207361A1/es active
- 1975-04-16 GB GB1561275A patent/GB1448081A/en not_active Expired
- 1975-04-21 ZA ZA00752563A patent/ZA752563B/xx unknown
- 1975-04-21 IE IE892/75A patent/IE41115B1/xx unknown
- 1975-04-23 DK DK174575A patent/DK174575A/da not_active Application Discontinuation
- 1975-04-24 NO NO751472A patent/NO751472L/no unknown
- 1975-04-24 IT IT49276/75A patent/IT1035450B/it active
- 1975-04-24 BG BG029774A patent/BG26371A3/xx unknown
- 1975-04-24 ES ES436902A patent/ES436902A1/es not_active Expired
- 1975-04-24 NL NL7504852A patent/NL7504852A/xx not_active Application Discontinuation
- 1975-04-24 JP JP50051258A patent/JPS50148312A/ja active Pending
- 1975-04-24 BR BR3188/75D patent/BR7502510A/pt unknown
- 1975-04-24 SE SE7504782A patent/SE404691B/xx unknown
- 1975-04-25 SU SU2127884A patent/SU544366A3/ru active
- 1975-04-25 RO RO7582091A patent/RO66137A/ro unknown
- 1975-04-25 DD DD185713A patent/DD119575A5/xx unknown
- 1975-04-25 LU LU72363A patent/LU72363A1/xx unknown
- 1975-04-25 AT AT320575A patent/AT342792B/de not_active IP Right Cessation
- 1975-04-25 FR FR7513098A patent/FR2268787B1/fr not_active Expired
- 1975-04-25 BE BE155838A patent/BE828456A/xx unknown
- 1975-04-28 DE DE2518813A patent/DE2518813C2/de not_active Expired
- 1975-04-28 US US05/572,316 patent/US3969406A/en not_active Expired - Lifetime
- 1975-04-28 CA CA225,629A patent/CA1034143A/en not_active Expired
- 1975-06-13 IN IN1172/CAL/75A patent/IN144611B/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IT1035450B (it) | 1979-10-20 |
| ATA320575A (de) | 1977-08-15 |
| US3969406A (en) | 1976-07-13 |
| DK174575A (da) | 1975-10-27 |
| BE828456A (fr) | 1975-10-27 |
| IE41115B1 (en) | 1979-10-24 |
| DE2518813C2 (de) | 1983-09-15 |
| FR2268787B1 (esLanguage) | 1980-05-09 |
| BG26371A3 (bg) | 1979-03-15 |
| AR207361A1 (es) | 1976-09-30 |
| CA1034143A (en) | 1978-07-04 |
| CH589604A5 (esLanguage) | 1977-07-15 |
| NO751472L (esLanguage) | 1975-10-28 |
| ES436902A1 (es) | 1977-01-01 |
| AT342792B (de) | 1978-04-25 |
| AU8042675A (en) | 1976-10-28 |
| JPS50148312A (esLanguage) | 1975-11-27 |
| DE2518813A1 (de) | 1975-11-06 |
| NL7504852A (nl) | 1975-10-28 |
| SE7504782L (sv) | 1975-10-27 |
| BR7502510A (pt) | 1976-03-03 |
| FR2268787A1 (esLanguage) | 1975-11-21 |
| LU72363A1 (esLanguage) | 1977-02-03 |
| SU544366A3 (ru) | 1977-01-25 |
| RO66137A (ro) | 1980-02-15 |
| DD119575A5 (esLanguage) | 1976-05-05 |
| IE41115L (en) | 1975-10-26 |
| GB1448081A (en) | 1976-09-02 |
| IN144611B (esLanguage) | 1978-05-20 |
| ZA752563B (en) | 1976-03-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO145075C (no) | Kontinuerlig fremgangsmaate til fremstilling av alkoksysilaner | |
| SE7513085L (sv) | Forfarande for framstellning av etrar | |
| SE412401B (sv) | Forfarande for framstellning av polyvinylpyrroliden-jod | |
| SE421209B (sv) | Analogiforfarande for framstellning av tienobensodiazepiner | |
| IT1035919B (it) | Procedimento di preparazione di anidridi alchenilsucchiniche | |
| SE7506160L (sv) | Forfarande for framstellning av n-cykloalkylmetyldekahydroisokinoline | |
| SE409452B (sv) | Forfarande for framstellning av stilbenderivat | |
| IT1027469B (it) | Procedimento per lapreparazione di solfonil semicarbazidi | |
| SE7506237L (sv) | Forfarande for framstellning av dekahydroisokinolinderivat | |
| NO146199C (no) | Fremgangsmaate for fremstilling av alfa-6-deoksy-5-hydroksytetracyklin-hydroklorid | |
| SE411453B (sv) | Forfarande for framstellning av 3-fluorcefalosporiner | |
| SE403477B (sv) | Forfarande for famstellning av substituerade indoleniner | |
| SE425790B (sv) | Forfarande for framstellning av polylaurinlactam | |
| NO143625C (no) | Analogifremgangsmaate for fremstilling av 2-metoksy-benzamider | |
| DK135378C (da) | Analogifremgangsmade til fremstilling af 7alfa-hydroxylerede 17alfa-ethinylostradioler | |
| SE431207B (sv) | Forfarande for framstellning av tiazolidinderivat | |
| SE7506827L (sv) | Forfarande for framstellning av nitrilhaltig polymer | |
| SE404691B (sv) | Forfarande for framstellning av karnitinhydroklorid | |
| SE404926B (sv) | Analogiforfarande for framstellning av 3-piperazin-isokinoliner | |
| SE7513739L (sv) | Forfarande for framstellning av 2-scyl-4-oxo-pyrazino-isokonolin-derivat | |
| SE7511801L (sv) | Forfarande for framstellning av ympsampolymerisat | |
| SE7506196L (sv) | Forfarande for framstellning av amidin-hydrazon-derivat | |
| SE388854B (sv) | Forfarande for framstellning av fenylpyridylaminderivat | |
| SE7512039L (sv) | Forfarande for framstellning av jodforer | |
| SE418395B (sv) | Forfarande for framstellning av indanettiksyror |