PL94439B1 - Sposob wytwarzania pochodnych 1-alkilo-3-hydroksy-5-chloro-1,2,4-triazolu - Google Patents
Sposob wytwarzania pochodnych 1-alkilo-3-hydroksy-5-chloro-1,2,4-triazolu Download PDFInfo
- Publication number
- PL94439B1 PL94439B1 PL1975181149A PL18114975A PL94439B1 PL 94439 B1 PL94439 B1 PL 94439B1 PL 1975181149 A PL1975181149 A PL 1975181149A PL 18114975 A PL18114975 A PL 18114975A PL 94439 B1 PL94439 B1 PL 94439B1
- Authority
- PL
- Poland
- Prior art keywords
- formula
- hydroxy
- chloro
- alkyl
- alkylhydrazine
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title description 2
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 63
- 238000000034 method Methods 0.000 claims description 27
- 238000006243 chemical reaction Methods 0.000 claims description 15
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 claims description 14
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 10
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 claims description 8
- 239000002253 acid Substances 0.000 claims description 6
- 150000003839 salts Chemical class 0.000 claims description 6
- 239000011230 binding agent Substances 0.000 claims description 4
- SJXIVKQAVJISKW-UHFFFAOYSA-N chloro cyanate Chemical compound ClOC#N SJXIVKQAVJISKW-UHFFFAOYSA-N 0.000 claims description 4
- 238000007363 ring formation reaction Methods 0.000 claims description 4
- 239000011541 reaction mixture Substances 0.000 claims description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 claims description 2
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 claims description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 claims description 2
- 150000001335 aliphatic alkanes Chemical class 0.000 claims description 2
- 229910000272 alkali metal oxide Inorganic materials 0.000 claims description 2
- 150000001340 alkali metals Chemical group 0.000 claims description 2
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 150000003840 hydrochlorides Chemical class 0.000 claims description 2
- 239000012442 inert solvent Substances 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 150000003512 tertiary amines Chemical class 0.000 claims description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 claims 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 21
- 239000000243 solution Substances 0.000 description 17
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- 239000000203 mixture Substances 0.000 description 14
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- VRPHXQGTAUWCFZ-UHFFFAOYSA-N amino(propan-2-yl)cyanamide Chemical compound CC(C)N(N)C#N VRPHXQGTAUWCFZ-UHFFFAOYSA-N 0.000 description 8
- -1 formic acid orthoesters Chemical class 0.000 description 8
- 238000001816 cooling Methods 0.000 description 7
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 6
- 239000012071 phase Substances 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 239000008346 aqueous phase Substances 0.000 description 4
- 150000003014 phosphoric acid esters Chemical class 0.000 description 4
- ZPVFNVKXPPDEOU-UHFFFAOYSA-N 3-chloro-2-propan-2-yl-1h-1,2,4-triazol-5-one Chemical compound CC(C)N1NC(=O)N=C1Cl ZPVFNVKXPPDEOU-UHFFFAOYSA-N 0.000 description 3
- OCWZNCMTDOURRM-UHFFFAOYSA-N 3-chloro-2-propan-2-yl-1h-1,2,4-triazol-5-one;hydrochloride Chemical compound Cl.CC(C)N1N=C(O)N=C1Cl OCWZNCMTDOURRM-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- ILULYDJFTJKQAP-UHFFFAOYSA-N hydron;propan-2-ylhydrazine;chloride Chemical compound [Cl-].CC(C)N[NH3+] ILULYDJFTJKQAP-UHFFFAOYSA-N 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000011347 resin Substances 0.000 description 3
- 229920005989 resin Polymers 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical class CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- 239000001569 carbon dioxide Substances 0.000 description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- QPJDMGCKMHUXFD-UHFFFAOYSA-N cyanogen chloride Chemical compound ClC#N QPJDMGCKMHUXFD-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 150000003852 triazoles Chemical class 0.000 description 2
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- NRZZLYODXDSLEK-UHFFFAOYSA-N (6-ethoxy-6-oxohexyl) 3,5-diacetamido-2,4,6-triiodobenzoate Chemical compound CCOC(=O)CCCCCOC(=O)C1=C(I)C(NC(C)=O)=C(I)C(NC(C)=O)=C1I NRZZLYODXDSLEK-UHFFFAOYSA-N 0.000 description 1
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical class CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 1
- XRQXVMGRJJXKDC-UHFFFAOYSA-N 2-propan-2-yl-1h-1,2,4-triazol-5-one Chemical compound CC(C)N1C=NC(O)=N1 XRQXVMGRJJXKDC-UHFFFAOYSA-N 0.000 description 1
- PGVDDLPNVHAWCK-UHFFFAOYSA-N 3-chloro-2-methyl-1h-1,2,4-triazol-5-one Chemical compound CN1N=C(O)N=C1Cl PGVDDLPNVHAWCK-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 1
- 206010034962 Photopsia Diseases 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- SUHBXOBWBHTFMC-UHFFFAOYSA-N amino(methyl)cyanamide Chemical compound CN(N)C#N SUHBXOBWBHTFMC-UHFFFAOYSA-N 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- VPGUBZVWMHRRSS-UHFFFAOYSA-N butan-2-ylidenehydrazine Chemical compound CCC(C)=NN VPGUBZVWMHRRSS-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 150000001983 dialkylethers Chemical class 0.000 description 1
- IJKVHSBPTUYDLN-UHFFFAOYSA-N dihydroxy(oxo)silane Chemical compound O[Si](O)=O IJKVHSBPTUYDLN-UHFFFAOYSA-N 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 125000001475 halogen functional group Chemical group 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 230000000749 insecticidal effect Effects 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- HDZGCSFEDULWCS-UHFFFAOYSA-N monomethylhydrazine Chemical compound CNN HDZGCSFEDULWCS-UHFFFAOYSA-N 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 229910000065 phosphene Inorganic materials 0.000 description 1
- 239000004476 plant protection product Substances 0.000 description 1
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- DUIOPKIIICUYRZ-UHFFFAOYSA-N semicarbazide Chemical compound NNC(N)=O DUIOPKIIICUYRZ-UHFFFAOYSA-N 0.000 description 1
- 150000007659 semicarbazones Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000006277 sulfonation reaction Methods 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH808874A CH593950A5 (enExample) | 1974-06-13 | 1974-06-13 | |
| CH1624474A CH605842A5 (en) | 1974-12-06 | 1974-12-06 | 1-Alkyl-3-hydroxy-5-chloro-1,2,4-triazoles |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL94439B1 true PL94439B1 (pl) | 1977-08-31 |
Family
ID=25702783
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1975181149A PL94439B1 (pl) | 1974-06-13 | 1975-06-11 | Sposob wytwarzania pochodnych 1-alkilo-3-hydroksy-5-chloro-1,2,4-triazolu |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US3992398A (enExample) |
| JP (1) | JPS5922710B2 (enExample) |
| AT (1) | AT343654B (enExample) |
| BR (1) | BR7503676A (enExample) |
| CA (1) | CA1052383A (enExample) |
| DD (1) | DD118091A5 (enExample) |
| DE (1) | DE2525852A1 (enExample) |
| ES (1) | ES438470A1 (enExample) |
| FR (1) | FR2274615A1 (enExample) |
| GB (1) | GB1505868A (enExample) |
| HU (1) | HU172343B (enExample) |
| IL (1) | IL47457A (enExample) |
| NL (1) | NL7506103A (enExample) |
| PH (1) | PH11837A (enExample) |
| PL (1) | PL94439B1 (enExample) |
| SU (1) | SU682128A3 (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4252965A (en) * | 1979-07-05 | 1981-02-24 | Ciba-Geigy Corporation | Process for the production of 1-substituted-3-hydroxy-5-chloro-1,2,4-triazoles |
| US4404019A (en) * | 1980-12-24 | 1983-09-13 | Sumitomo Chemical Company, Limited | 3-Chloro-1-phenyl-1,2,4-triazolin-5-ones and their use as herbicides |
| EP2362070A1 (de) | 2010-02-19 | 2011-08-31 | Siemens Aktiengesellschaft | Antriebsvorrichtung zum Schwenken von verstellbaren Schaufeln einer Turbomaschine |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3701784A (en) * | 1968-09-04 | 1972-10-31 | Rohm & Haas | 1,2,4-4h-triazole derivatives |
| DE2037610A1 (de) * | 1970-07-29 | 1972-02-03 | Bayer Ag | Neue alpha-substituierte Benzyl-azole, Verfahren zu ihrer Herstellung und ihre Verwendung als Arzneimittel |
| BE792452A (fr) * | 1971-12-10 | 1973-06-08 | Ciba Geigy | Esters triazolyliques d'acides du phosphore et produits pesticides qui en renferment |
| DE2250572A1 (de) * | 1972-10-14 | 1974-04-18 | Bayer Ag | N,n-dimethyl-o-triazolyl-carbaminsaeureester, verfahren zu ihrer herstellung und ihre verwendung als insektizide und akarizide |
-
1975
- 1975-05-22 GB GB22346/75A patent/GB1505868A/en not_active Expired
- 1975-05-23 PH PH17189A patent/PH11837A/en unknown
- 1975-05-23 NL NL7506103A patent/NL7506103A/xx not_active Application Discontinuation
- 1975-06-03 US US05/583,377 patent/US3992398A/en not_active Expired - Lifetime
- 1975-06-10 DE DE19752525852 patent/DE2525852A1/de active Granted
- 1975-06-11 PL PL1975181149A patent/PL94439B1/pl unknown
- 1975-06-11 IL IL47457A patent/IL47457A/xx unknown
- 1975-06-11 CA CA229,120A patent/CA1052383A/en not_active Expired
- 1975-06-11 BR BR4716/75D patent/BR7503676A/pt unknown
- 1975-06-11 DD DD186578A patent/DD118091A5/xx unknown
- 1975-06-12 FR FR7518355A patent/FR2274615A1/fr active Granted
- 1975-06-12 ES ES438470A patent/ES438470A1/es not_active Expired
- 1975-06-12 AT AT452075A patent/AT343654B/de not_active IP Right Cessation
- 1975-06-12 HU HU75CI00001589A patent/HU172343B/hu unknown
- 1975-06-13 SU SU752144968A patent/SU682128A3/ru active
- 1975-06-13 JP JP50071859A patent/JPS5922710B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DD118091A5 (enExample) | 1976-02-12 |
| CA1052383A (en) | 1979-04-10 |
| FR2274615B1 (enExample) | 1977-07-22 |
| US3992398A (en) | 1976-11-16 |
| NL7506103A (nl) | 1975-12-16 |
| SU682128A3 (ru) | 1979-08-25 |
| BR7503676A (pt) | 1976-06-29 |
| ATA452075A (de) | 1977-10-15 |
| AT343654B (de) | 1978-06-12 |
| ES438470A1 (es) | 1977-05-16 |
| FR2274615A1 (fr) | 1976-01-09 |
| IL47457A (en) | 1979-07-25 |
| JPS5922710B2 (ja) | 1984-05-28 |
| PH11837A (en) | 1978-07-21 |
| IL47457A0 (en) | 1976-03-31 |
| DE2525852A1 (de) | 1976-01-02 |
| DE2525852C2 (enExample) | 1989-03-09 |
| JPS5111769A (en) | 1976-01-30 |
| GB1505868A (en) | 1978-03-30 |
| HU172343B (hu) | 1978-08-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR100549091B1 (ko) | 트리아졸린티온 유도체의 제조방법 | |
| WO1999003818A1 (en) | New chemical compound suitable for use as an explosive, intermediate and method for preparing the compound | |
| US4346097A (en) | Method for treating convulsions with pyrazole-4-carboxamide derivatives | |
| PL94439B1 (pl) | Sposob wytwarzania pochodnych 1-alkilo-3-hydroksy-5-chloro-1,2,4-triazolu | |
| US2969373A (en) | Trifluoromethylpyrazoloindenone derivatives | |
| CA1161443A (en) | Process for the preparation of pyrazole | |
| US4632999A (en) | Process for the preparation of oxiranes | |
| US5047551A (en) | Preparation of 4-chloropyrazoles | |
| HU190105B (en) | Process for production of pirazolyl-methyl-ergolin- derivatives and their acid additional salts | |
| Stephanidou‐Stephanatou | Oxidation of bis‐aroylhydrazones of 3, 3‐dimethylpentane‐2, 4‐dione and thermal decomposition of the oxidation products | |
| US5688963A (en) | Intermediates for the preparation of triazolinones | |
| EP2137136A2 (en) | Process for preparing substituted phenylhydrazines | |
| US4540794A (en) | Method for preparing 5-mercapto-1,2,3-thiadiazole salts | |
| SU1147251A3 (ru) | Способ получени производных бензоилфенилпиперидина | |
| US2917545A (en) | Preparation of n-substituted hydrazine derivatives | |
| EP0033214A2 (en) | Process for preparing therapeutically active triazoles | |
| SI9600165A (en) | Process for preparation of biological active derivative of 1,2,4- triazole and intermediates useful in this process | |
| EP0131472A2 (en) | 5-Mercapto-1,2,3-thiadiazoles composition and process for preparing the same | |
| US4388465A (en) | Preparation of phenoxy-azolyl-butanone derivatives | |
| GB2050373A (en) | Antibotrytical pyrazol-triazol-triones | |
| EP0023358A1 (en) | Process for the preparation of pyridazine derivatives | |
| NZ240958A (en) | Preparation of mono-acylated hydrazines | |
| Peseke et al. | A new approach to C‐branched monosaccharides by the stereoselective hydrodesulfurization of methyl 4, 6‐O‐benzylidene‐3‐[bis (methylthio)‐methylene]‐3‐deoxy‐α‐d‐erythro‐hexopyranosid‐2‐ulose | |
| US4438092A (en) | 5-Amino-N-(3-chloro- 2-methyl-, or 2-fluorophenyl)-1,3-dimethyl-1H-pyrazole-4-carboxamides and use as an anti-convulsant | |
| KR800000047B1 (ko) | 치환된 6-아릴-4H-S-트리아졸로-[3,4c]-티에노-[2,3e]-1,4-디아제핀의 제조방법 |