PL93734B1 - - Google Patents
Download PDFInfo
- Publication number
- PL93734B1 PL93734B1 PL17452074A PL17452074A PL93734B1 PL 93734 B1 PL93734 B1 PL 93734B1 PL 17452074 A PL17452074 A PL 17452074A PL 17452074 A PL17452074 A PL 17452074A PL 93734 B1 PL93734 B1 PL 93734B1
- Authority
- PL
- Poland
- Prior art keywords
- bromopyrimidine
- general formula
- optionally substituted
- dichloro
- ether
- Prior art date
Links
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 42
- SIKXIUWKPGWBBF-UHFFFAOYSA-N 5-bromo-2,4-dichloropyrimidine Chemical compound ClC1=NC=C(Br)C(Cl)=N1 SIKXIUWKPGWBBF-UHFFFAOYSA-N 0.000 claims description 5
- 150000001412 amines Chemical class 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- 238000006243 chemical reaction Methods 0.000 claims description 4
- 238000000034 method Methods 0.000 claims description 4
- 229940083082 pyrimidine derivative acting on arteriolar smooth muscle Drugs 0.000 claims description 4
- 150000003230 pyrimidines Chemical class 0.000 claims description 4
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- 125000005842 heteroatom Chemical group 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 239000003960 organic solvent Substances 0.000 claims description 2
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 2
- 239000003208 petroleum Substances 0.000 description 8
- 239000000203 mixture Substances 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- HLTVDIWJSHPQLF-UHFFFAOYSA-N 5-bromo-2-chloro-n,n-diethylpyrimidin-4-amine Chemical compound CCN(CC)C1=NC(Cl)=NC=C1Br HLTVDIWJSHPQLF-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- -1 2-chloro-4-piperidyl-5-bromopyrimidine Chemical compound 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000004440 column chromatography Methods 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- HKOAFLAGUQUJQG-UHFFFAOYSA-N 2-pyrimidin-2-ylpyrimidine Chemical compound N1=CC=CN=C1C1=NC=CC=N1 HKOAFLAGUQUJQG-UHFFFAOYSA-N 0.000 description 1
- ROLMZTIHUMKEAI-UHFFFAOYSA-N 4,5-difluoro-2-hydroxybenzonitrile Chemical compound OC1=CC(F)=C(F)C=C1C#N ROLMZTIHUMKEAI-UHFFFAOYSA-N 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 239000010779 crude oil Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 238000010534 nucleophilic substitution reaction Methods 0.000 description 1
- CBPYOHALYYGNOE-UHFFFAOYSA-M potassium;3,5-dinitrobenzoate Chemical compound [K+].[O-]C(=O)C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1 CBPYOHALYYGNOE-UHFFFAOYSA-M 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000010898 silica gel chromatography Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
Landscapes
- Plural Heterocyclic Compounds (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| PL17452074A PL93734B1 (show.php) | 1974-10-02 | 1974-10-02 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| PL17452074A PL93734B1 (show.php) | 1974-10-02 | 1974-10-02 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL93734B1 true PL93734B1 (show.php) | 1977-06-30 |
Family
ID=19969127
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL17452074A PL93734B1 (show.php) | 1974-10-02 | 1974-10-02 |
Country Status (1)
| Country | Link |
|---|---|
| PL (1) | PL93734B1 (show.php) |
-
1974
- 1974-10-02 PL PL17452074A patent/PL93734B1/pl unknown
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0306996B1 (en) | Process for the preparation of 3,5-dioxo cyclohexane carboxylic acid derivatives | |
| DE69526443T2 (de) | 2-silyloxy-tetrahydrothienopyridin, sein salz und verfahren zu seiner herstellung | |
| SU474981A3 (ru) | Способ получени 9(1-замещенный-4пиперидилиден)-тиоксантенов или их солей | |
| CN116655557B (zh) | 苯并噻唑类化合物、其制备方法及应用 | |
| JPS61171470A (ja) | イミダゾール誘導体 | |
| SU900809A3 (ru) | Способ получени N-циано-N - 2-[(4-метил-5-имидазолил)метилтио ЭТИЛ -N -АЛКИНИЛГУАНИДИНОВ ИЛИ ИХ СОЛЕЙ | |
| IL103229A (en) | Imidazolylmethyl-pyridine derivatives their preparation and pharmaceutical compositions containing them | |
| SU747425A3 (ru) | Способ получени производных аминоалкоксибензофуранов | |
| EP3004065B1 (en) | Method for producing pyridazine compound | |
| Timári et al. | Synthesis, alkylation and ring opening of two differently fused pyridoquinazolones | |
| PL93734B1 (show.php) | ||
| Acosta et al. | Rational use of substituted N-allyl and N, N-diallylanilines in the stereoselective synthesis of novel 2-alkenyltetrahydro-1-benzazepines | |
| US4468517A (en) | Synthesis of thiazoles | |
| HRP980175A2 (en) | Process for preparing o-(3-amino-2-hydroxy-propyl)-hydroxymic acid halides | |
| SU1147251A3 (ru) | Способ получени производных бензоилфенилпиперидина | |
| JP3066594B2 (ja) | アニリン誘導体及びその製造法 | |
| EP0062068B1 (en) | N-phthalidyl-5-fluorouracil derivatives | |
| TW399055B (en) | 1, 9-diazabicyclo [4.3.0] nona-3, 8-diene derivatives having cardioprotective activity | |
| SU561513A3 (ru) | Способ получени производных пиперазина или их солей | |
| Nematpour et al. | An Efficient Synthesis of Spiro-Pyrimidines Derivatives Containing a Sulfonyl Scaffold | |
| PL94559B1 (pl) | Sposob wytwarzania nowych pochodnych pirydyny | |
| Lane | 234. Quaternary ammonium nitrates. Part I. Preparation from alkyl nitrates and from αω-polymethylene dinitrates | |
| Adetchessi et al. | Synthesis and rearrangement of cycloalkyl [1, 2-e] oxazolo [3, 2-a] pyrimidin-8/9-ones: an access to cycloalkyl [1, 2-d] oxazolo [3, 2-a] pyrimidin-5-ones | |
| RU2042671C1 (ru) | Производное дикетен-имина в качестве промежуточного продукта для синтеза ранитидина и способ его получения | |
| JPH0216309B2 (show.php) |