PL90468B1 - - Google Patents
Download PDFInfo
- Publication number
- PL90468B1 PL90468B1 PL1974170535A PL17053574A PL90468B1 PL 90468 B1 PL90468 B1 PL 90468B1 PL 1974170535 A PL1974170535 A PL 1974170535A PL 17053574 A PL17053574 A PL 17053574A PL 90468 B1 PL90468 B1 PL 90468B1
- Authority
- PL
- Poland
- Prior art keywords
- methyl
- formula
- thiazolyl
- pyridyl
- dioxide
- Prior art date
Links
- -1 methoxy, 2-thiazolyl Chemical group 0.000 claims description 38
- 238000000034 method Methods 0.000 claims description 27
- 229910052739 hydrogen Inorganic materials 0.000 claims description 17
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical group C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims description 16
- BEBCJVAWIBVWNZ-UHFFFAOYSA-N glycinamide Chemical compound NCC(N)=O BEBCJVAWIBVWNZ-UHFFFAOYSA-N 0.000 claims description 11
- 230000008569 process Effects 0.000 claims description 11
- 238000002360 preparation method Methods 0.000 claims description 9
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 8
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 8
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 claims description 7
- 239000002904 solvent Substances 0.000 claims description 7
- 229910052987 metal hydride Inorganic materials 0.000 claims description 6
- 150000004681 metal hydrides Chemical class 0.000 claims description 6
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical group [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 229910000104 sodium hydride Inorganic materials 0.000 claims description 5
- 239000012312 sodium hydride Substances 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 239000012442 inert solvent Substances 0.000 claims description 4
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 claims description 4
- 239000000460 chlorine Substances 0.000 claims description 3
- 229910052731 fluorine Inorganic materials 0.000 claims description 3
- 239000011737 fluorine Substances 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical group FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 2
- 125000001153 fluoro group Chemical group F* 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical group ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims 1
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims 1
- 239000003513 alkali Substances 0.000 claims 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 claims 1
- 150000008046 alkali metal hydrides Chemical class 0.000 claims 1
- 229910052751 metal Inorganic materials 0.000 claims 1
- 239000002184 metal Substances 0.000 claims 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 1
- 229910052799 carbon Inorganic materials 0.000 description 20
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 17
- 150000001875 compounds Chemical class 0.000 description 15
- 239000000047 product Substances 0.000 description 15
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 12
- OCBFFGCSTGGPSQ-UHFFFAOYSA-N [CH2]CC Chemical compound [CH2]CC OCBFFGCSTGGPSQ-UHFFFAOYSA-N 0.000 description 12
- 239000000243 solution Substances 0.000 description 12
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 239000000203 mixture Substances 0.000 description 9
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 8
- 229910052757 nitrogen Inorganic materials 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- HNUALPPJLMYHDK-UHFFFAOYSA-N C[CH]C Chemical compound C[CH]C HNUALPPJLMYHDK-UHFFFAOYSA-N 0.000 description 5
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 5
- 239000000284 extract Substances 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 101100219382 Caenorhabditis elegans cah-2 gene Proteins 0.000 description 4
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 4
- 229960000583 acetic acid Drugs 0.000 description 4
- 229910052938 sodium sulfate Inorganic materials 0.000 description 4
- 235000011152 sodium sulphate Nutrition 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- 230000008025 crystallization Effects 0.000 description 3
- 238000000921 elemental analysis Methods 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- LYVNILGFDIBBTE-UHFFFAOYSA-N 2-(benzenesulfonamido)acetamide Chemical class NC(=O)CNS(=O)(=O)C1=CC=CC=C1 LYVNILGFDIBBTE-UHFFFAOYSA-N 0.000 description 2
- 101100005001 Caenorhabditis elegans cah-5 gene Proteins 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- GKQLYSROISKDLL-UHFFFAOYSA-N EEDQ Chemical compound C1=CC=C2N(C(=O)OCC)C(OCC)C=CC2=C1 GKQLYSROISKDLL-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 206010061218 Inflammation Diseases 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 239000000538 analytical sample Substances 0.000 description 2
- 229960001541 benzthiazide Drugs 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 150000002332 glycine derivatives Chemical class 0.000 description 2
- 150000004678 hydrides Chemical class 0.000 description 2
- 230000004054 inflammatory process Effects 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- RWRDLPDLKQPQOW-UHFFFAOYSA-N tetrahydropyrrole Natural products C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 2
- RAIPHJJURHTUIC-UHFFFAOYSA-N 1,3-thiazol-2-amine Chemical compound NC1=NC=CS1 RAIPHJJURHTUIC-UHFFFAOYSA-N 0.000 description 1
- CBWFTZNMONHKNZ-UHFFFAOYSA-N 2-[methyl(phenylmethoxycarbonyl)amino]acetic acid Chemical compound OC(=O)CN(C)C(=O)OCC1=CC=CC=C1 CBWFTZNMONHKNZ-UHFFFAOYSA-N 0.000 description 1
- HEJCAPFLSBIEAR-UHFFFAOYSA-N 2-amino-n-(benzenesulfonyl)acetamide Chemical class NCC(=O)NS(=O)(=O)C1=CC=CC=C1 HEJCAPFLSBIEAR-UHFFFAOYSA-N 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- 241000272517 Anseriformes Species 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 238000005576 amination reaction Methods 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 229940121363 anti-inflammatory agent Drugs 0.000 description 1
- 239000002260 anti-inflammatory agent Substances 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- HQYMUNCIMNFLDT-UHFFFAOYSA-N benzyl n-(2-amino-2-oxoethyl)carbamate Chemical class NC(=O)CNC(=O)OCC1=CC=CC=C1 HQYMUNCIMNFLDT-UHFFFAOYSA-N 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Chemical group 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 239000002274 desiccant Substances 0.000 description 1
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- DYDNPESBYVVLBO-UHFFFAOYSA-N formanilide Chemical compound O=CNC1=CC=CC=C1 DYDNPESBYVVLBO-UHFFFAOYSA-N 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 230000009931 harmful effect Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 229910012375 magnesium hydride Inorganic materials 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- HUNUAFNLLYVTQD-UHFFFAOYSA-N methyl 2-chlorosulfonylbenzoate Chemical compound COC(=O)C1=CC=CC=C1S(Cl)(=O)=O HUNUAFNLLYVTQD-UHFFFAOYSA-N 0.000 description 1
- 230000011987 methylation Effects 0.000 description 1
- 238000007069 methylation reaction Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 125000002524 organometallic group Chemical group 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 150000008039 phosphoramides Chemical class 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- NTTOTNSKUYCDAV-UHFFFAOYSA-N potassium hydride Chemical compound [KH] NTTOTNSKUYCDAV-UHFFFAOYSA-N 0.000 description 1
- 229910000105 potassium hydride Inorganic materials 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 230000028327 secretion Effects 0.000 description 1
- 239000013049 sediment Substances 0.000 description 1
- 230000003637 steroidlike Effects 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 230000001052 transient effect Effects 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/75—Amino or imino radicals, acylated by carboxylic or carbonic acids, or by sulfur or nitrogen analogues thereof, e.g. carbamates
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C271/00—Derivatives of carbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C271/06—Esters of carbamic acids
- C07C271/08—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms
- C07C271/10—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atoms of the carbamate groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C271/22—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atoms of the carbamate groups bound to hydrogen atoms or to acyclic carbon atoms to carbon atoms of hydrocarbon radicals substituted by carboxyl groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D261/00—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings
- C07D261/02—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings
- C07D261/06—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members
- C07D261/10—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D261/14—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/32—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/38—Nitrogen atoms
- C07D277/44—Acylated amino or imino radicals
- C07D277/46—Acylated amino or imino radicals by carboxylic acids, or sulfur or nitrogen analogues thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen- Or Sulfur-Containing Heterocyclic Ring Compounds With Rings Of Six Or More Members (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Thiazole And Isothizaole Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US00353607A US3853862A (en) | 1973-04-23 | 1973-04-23 | Production of 4-hydroxy-1,2-benzothiazine-3-carboxamides |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL90468B1 true PL90468B1 (enPDFPhase) | 1977-01-31 |
Family
ID=23389837
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1974170535A PL90468B1 (enPDFPhase) | 1973-04-23 | 1974-04-22 |
Country Status (21)
| Country | Link |
|---|---|
| US (3) | US3853862A (enPDFPhase) |
| JP (1) | JPS5760347B2 (enPDFPhase) |
| AR (1) | AR205249A1 (enPDFPhase) |
| AT (1) | AT333777B (enPDFPhase) |
| CA (1) | CA1018525A (enPDFPhase) |
| CH (1) | CH590257A5 (enPDFPhase) |
| CS (1) | CS165311B2 (enPDFPhase) |
| DD (1) | DD111079A5 (enPDFPhase) |
| DK (1) | DK140014B (enPDFPhase) |
| ES (1) | ES425398A1 (enPDFPhase) |
| FI (1) | FI52087C (enPDFPhase) |
| GB (1) | GB1414887A (enPDFPhase) |
| HU (1) | HU170489B (enPDFPhase) |
| IE (1) | IE39119B1 (enPDFPhase) |
| LU (1) | LU69905A1 (enPDFPhase) |
| NL (1) | NL7405413A (enPDFPhase) |
| PL (1) | PL90468B1 (enPDFPhase) |
| RO (1) | RO63727A (enPDFPhase) |
| SE (1) | SE406467B (enPDFPhase) |
| SU (1) | SU552030A3 (enPDFPhase) |
| YU (1) | YU39152B (enPDFPhase) |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3954786A (en) * | 1974-04-19 | 1976-05-04 | Pfizer Inc. | Isoxazole intermediate compounds |
| US3900470A (en) * | 1974-09-23 | 1975-08-19 | Mcneilab Inc | Esters of benzothiazine-1,1-dioxides derivatives |
| US3923801A (en) * | 1974-09-23 | 1975-12-02 | Mcneilab Inc | Oxazinobenzothiazine 6,6-dioxides |
| US3925371A (en) * | 1974-09-23 | 1975-12-09 | Mcneilab Inc | Benzothiazine-1,1-dioxides |
| US3891637A (en) * | 1974-10-01 | 1975-06-24 | Pfizer | Process for the production of carboxamides of oxo-1,2-benzothiazine-1,1-dioxides |
| US3892740A (en) * | 1974-10-15 | 1975-07-01 | Pfizer | Process for the production of carboxamides of oxo-1,2-benzothiazine-1,1-dioxides |
| US4100347A (en) * | 1976-06-10 | 1978-07-11 | Pfizer Inc. | 3,4-Dihydro-2-methyl-4-oxo-2H-1,2-benzothiazine-3-carboxylic acid-1,1-dioxide |
| DE2756113A1 (de) * | 1977-12-16 | 1979-06-21 | Thomae Gmbh Dr K | Neue 4-hydroxy-2h-1,2-benzothiazin- 3-carboxamid-1,1-dioxide, verfahren zu ihrer herstellung und diese enthaltende arzneimittel |
| US4217355A (en) * | 1978-04-24 | 1980-08-12 | Pfizer Inc. | Amide therapeutic agents |
| JPS5714589A (en) * | 1980-06-27 | 1982-01-25 | Mitsui Toatsu Chem Inc | Benzothiazine derivative, its preparation and drug composition |
| JPS57140785A (en) * | 1981-02-24 | 1982-08-31 | Mitsui Toatsu Chem Inc | Benzothiazine derivative, its preparation, and pharmaceutical composition containing the same |
| US4289879A (en) * | 1980-09-29 | 1981-09-15 | Pfizer Inc. | Synthetic method and intermediate for piroxicam |
| IN158333B (enPDFPhase) * | 1981-08-03 | 1986-10-18 | Pfizer | |
| GT198276334A (es) * | 1981-08-03 | 1984-01-10 | Procedimiento e inter-medios para la produccion de carboxamidas de benzotiazina. | |
| IN159273B (enPDFPhase) * | 1981-10-05 | 1987-04-25 | Pfizer | |
| SU1306476A3 (ru) * | 1982-06-17 | 1987-04-23 | Пфайзер,Инк (Фирма) | Способ получени 2-метил-3- @ -(2-пиридил)-карбамоил-3,4-дигидро-2 @ -1,2-бензтиазин-1,1-диоксида |
| US4483982A (en) * | 1982-09-02 | 1984-11-20 | Pfizer Inc. | Processes for preparing piroxicam and intermediates leading thereto |
| IT1196307B (it) * | 1984-10-22 | 1988-11-16 | Chiesi Farma Spa | Formulazioni farmaceutiche acquose di piroxicam monoidrato |
| JPS6243434U (enPDFPhase) * | 1985-09-03 | 1987-03-16 | ||
| JPH0629271B2 (ja) * | 1988-03-09 | 1994-04-20 | 株式会社日本ハイポックス | ベンゾチアジン―1,1―ジオキシド誘導体及びそれを含有する医薬組成物 |
| US5741798A (en) * | 1996-06-03 | 1998-04-21 | Boehringer Ingelheim Pharmaceuticals, Inc. | 2-benzyl-4-sulfonyl-4H-isoquinolin-1,3-diones and their use as antiinflammatory agents |
| ATE464292T1 (de) | 2000-10-17 | 2010-04-15 | Merck Serono Sa | Pharmazeutisch aktive sulfonamid-derivate |
| US6865910B2 (en) * | 2001-12-05 | 2005-03-15 | Emhart Glass S.A. | Glass container forming machine |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2676188A (en) * | 1950-12-16 | 1954-04-20 | American Home Prod | Acylated glycinamides |
| US3591584A (en) * | 1968-08-27 | 1971-07-06 | Pfizer | Benzothiazine dioxides |
| US4062861A (en) * | 1973-07-27 | 1977-12-13 | Shionogi & Co., Ltd. | 3-Isoxazolylurea derivatives |
| GB1498884A (en) * | 1975-04-15 | 1978-01-25 | Wyeth John & Brother Ltd | Aminoacetamide-pyridyl-tetrahydropyridyl and-piperidyl derivatives |
-
1973
- 1973-04-23 US US00353607A patent/US3853862A/en not_active Expired - Lifetime
- 1973-10-01 GB GB4586373A patent/GB1414887A/en not_active Expired
-
1974
- 1974-01-01 AR AR253392A patent/AR205249A1/es active
- 1974-04-03 CA CA196,694A patent/CA1018525A/en not_active Expired
- 1974-04-05 IE IE00742/74A patent/IE39119B1/xx unknown
- 1974-04-17 ES ES425398A patent/ES425398A1/es not_active Expired
- 1974-04-19 AT AT327374A patent/AT333777B/de not_active IP Right Cessation
- 1974-04-19 YU YU01121/74A patent/YU39152B/xx unknown
- 1974-04-22 SE SE747405399A patent/SE406467B/xx not_active IP Right Cessation
- 1974-04-22 LU LU69905A patent/LU69905A1/xx unknown
- 1974-04-22 SU SU2022042A patent/SU552030A3/ru active
- 1974-04-22 NL NL7405413A patent/NL7405413A/xx active Search and Examination
- 1974-04-22 CS CS2856A patent/CS165311B2/cs unknown
- 1974-04-22 PL PL1974170535A patent/PL90468B1/pl unknown
- 1974-04-22 HU HUPI416A patent/HU170489B/hu unknown
- 1974-04-22 FI FI741205A patent/FI52087C/fi active
- 1974-04-22 DK DK219274AA patent/DK140014B/da not_active IP Right Cessation
- 1974-04-23 CH CH557074A patent/CH590257A5/xx not_active IP Right Cessation
- 1974-04-23 DD DD178074A patent/DD111079A5/xx unknown
- 1974-04-23 JP JP49045179A patent/JPS5760347B2/ja not_active Expired
- 1974-04-23 RO RO7400078533A patent/RO63727A/ro unknown
-
1976
- 1976-11-30 US US05/746,186 patent/USRE29669E/en not_active Expired - Lifetime
-
1977
- 1977-03-23 US US05/780,312 patent/USRE29668E/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| YU39152B (en) | 1984-06-30 |
| JPS5012094A (enPDFPhase) | 1975-02-07 |
| HU170489B (enPDFPhase) | 1977-06-28 |
| GB1414887A (en) | 1975-11-19 |
| RO63727A (fr) | 1978-12-15 |
| JPS5760347B2 (enPDFPhase) | 1982-12-18 |
| USRE29668E (en) | 1978-06-13 |
| AT333777B (de) | 1976-12-10 |
| DK140014C (enPDFPhase) | 1979-11-05 |
| NL7405413A (enPDFPhase) | 1974-10-25 |
| FI52087B (enPDFPhase) | 1977-02-28 |
| USRE29669E (en) | 1978-06-13 |
| DD111079A5 (enPDFPhase) | 1975-01-20 |
| DK140014B (da) | 1979-06-05 |
| LU69905A1 (enPDFPhase) | 1974-11-21 |
| ATA327374A (de) | 1976-04-15 |
| US3853862A (en) | 1974-12-10 |
| SU552030A3 (ru) | 1977-03-25 |
| CA1018525A (en) | 1977-10-04 |
| IE39119L (en) | 1974-10-23 |
| FI52087C (fi) | 1977-06-10 |
| SE406467B (sv) | 1979-02-12 |
| CH590257A5 (enPDFPhase) | 1977-07-29 |
| ES425398A1 (es) | 1976-05-16 |
| IE39119B1 (en) | 1978-08-02 |
| CS165311B2 (enPDFPhase) | 1975-12-22 |
| YU112174A (en) | 1982-06-30 |
| AR205249A1 (es) | 1976-04-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL90468B1 (enPDFPhase) | ||
| ES2648146T3 (es) | Procedimiento de preparación de un compuesto mediante una novedosa reacción similar a Sandmeyer usando un compuesto de radical nitróxido como catalizador de reacción | |
| Greenberg et al. | Structure and dynamics of Troeger's base and simple derivatives in acidic media | |
| ES2735807T3 (es) | Benzotiazoles sustituidos y sus aplicaciones terapéuticas para el tratamiento de enfermedades humanas | |
| MXPA02003477A (es) | Derivados de indeno-, nafto-, y benzociclohepta-dihidrotiazol, la produccion de los mismos y su uso como medicamentos anorecticos. | |
| SU526292A3 (ru) | Способ получени производных 8-азапурин-6-она | |
| US4218476A (en) | Anti-thrombotic N-alkylthioakylamino benzenesulfonamides | |
| CA2491210A1 (en) | Thiazine and oxazine derivatives as mmp-13 inhibitors for treating arthritis | |
| MXPA05007387A (es) | Proceso de ciclizacion para derivados de benzotiazol sustituidos. | |
| PL80293B1 (en) | Phenyl esters of t-amcha[us3699149a] | |
| UA77478C2 (en) | A process for the preparation of [1,4,5]-oxadiazepine derivatives | |
| US2783240A (en) | Heterocyclic sulfonamides | |
| SU1729293A3 (ru) | Способ получени производных 5-галоидтиеноизотиазол-3(2Н)-он-1,1-диоксидов | |
| US4458074A (en) | Process for the preparation of 5,6,7,7a-tetrahydro-4H-thieno[3,2-c]pyridin-2-ones | |
| Monforte et al. | 4‐Thiazolidinones and 2, 4‐thiazolidinediones from α‐mercaptopropionic acid and carbodiimides | |
| US3268557A (en) | 5, 5-dioxodibenzo [1, 2, 5]-thiadiazepines and intermediates therefor | |
| US2826594A (en) | Sulfamoylsulfanilamides and method of preparing the same | |
| US3971802A (en) | Certain N'-alkyl-N'-(2'-alkoxycarbonylbenzenesulfonyl)-N-(2-thiazolyl)glycineamides | |
| US3954786A (en) | Isoxazole intermediate compounds | |
| FI71140C (fi) | Foerfarande foer framstaellning av nya farmakologiskt vaerdefulla vinylena karboxamider | |
| Ma et al. | Synthesis and Characterization of a New Series of 3-(4-Antipyrinyl)-2-thlohydantoin Derivatives | |
| JPS5944312B2 (ja) | インダゾ−ル誘導体の製法 | |
| US3239526A (en) | 3-phenyl-4-aminocinnolines | |
| Olagbemiro et al. | Alkylation and an unusual reductive ring opening of some thieno [3, 4‐b][1, 5] benzoxazepin‐10‐ones | |
| JPS61260052A (ja) | 新規アミノ酸誘導体および甘味剤 |