PL89267B3 - - Google Patents
Download PDFInfo
- Publication number
- PL89267B3 PL89267B3 PL1971147714A PL14771471A PL89267B3 PL 89267 B3 PL89267 B3 PL 89267B3 PL 1971147714 A PL1971147714 A PL 1971147714A PL 14771471 A PL14771471 A PL 14771471A PL 89267 B3 PL89267 B3 PL 89267B3
- Authority
- PL
- Poland
- Prior art keywords
- bromine
- acid
- carboxylic acid
- ethylene glycol
- tellurium
- Prior art date
Links
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims description 44
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 28
- -1 bromine ions Chemical class 0.000 claims description 28
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 25
- 229910052794 bromium Inorganic materials 0.000 claims description 25
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 18
- 238000006243 chemical reaction Methods 0.000 claims description 17
- 238000000034 method Methods 0.000 claims description 15
- 229910052714 tellurium Inorganic materials 0.000 claims description 14
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 12
- 239000005977 Ethylene Substances 0.000 claims description 11
- 239000000203 mixture Substances 0.000 claims description 11
- PORWMNRCUJJQNO-UHFFFAOYSA-N tellurium atom Chemical compound [Te] PORWMNRCUJJQNO-UHFFFAOYSA-N 0.000 claims description 11
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 9
- 229910052751 metal Inorganic materials 0.000 claims description 9
- 239000002184 metal Substances 0.000 claims description 9
- 229910052760 oxygen Inorganic materials 0.000 claims description 9
- 239000001301 oxygen Substances 0.000 claims description 9
- 150000001735 carboxylic acids Chemical class 0.000 claims description 8
- 150000001875 compounds Chemical class 0.000 claims description 6
- 150000004820 halides Chemical class 0.000 claims description 6
- 229910052736 halogen Inorganic materials 0.000 claims description 6
- 150000002367 halogens Chemical class 0.000 claims description 6
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- 239000012429 reaction media Substances 0.000 claims description 4
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 claims description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 3
- 150000001733 carboxylic acid esters Chemical class 0.000 claims description 3
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 2
- 150000002736 metal compounds Chemical class 0.000 claims description 2
- 229910001513 alkali metal bromide Inorganic materials 0.000 claims 1
- 150000005526 organic bromine compounds Chemical class 0.000 claims 1
- 239000002253 acid Substances 0.000 description 16
- 238000007254 oxidation reaction Methods 0.000 description 12
- JTXMVXSTHSMVQF-UHFFFAOYSA-N 2-acetyloxyethyl acetate Chemical compound CC(=O)OCCOC(C)=O JTXMVXSTHSMVQF-UHFFFAOYSA-N 0.000 description 11
- 230000003647 oxidation Effects 0.000 description 10
- 239000002904 solvent Substances 0.000 description 9
- 150000007513 acids Chemical class 0.000 description 8
- 238000002474 experimental method Methods 0.000 description 8
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Chemical compound [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 description 8
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- 150000003498 tellurium compounds Chemical class 0.000 description 6
- 239000012535 impurity Substances 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 4
- 150000007942 carboxylates Chemical class 0.000 description 4
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 3
- 150000001768 cations Chemical class 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 150000002366 halogen compounds Chemical class 0.000 description 3
- 239000007791 liquid phase Substances 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- LNETULKMXZVUST-UHFFFAOYSA-N 1-naphthoic acid Chemical compound C1=CC=C2C(C(=O)O)=CC=CC2=C1 LNETULKMXZVUST-UHFFFAOYSA-N 0.000 description 2
- LULAYUGMBFYYEX-UHFFFAOYSA-N 3-chlorobenzoic acid Chemical compound OC(=O)C1=CC=CC(Cl)=C1 LULAYUGMBFYYEX-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical group N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 239000005711 Benzoic acid Substances 0.000 description 2
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 2
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 229910001413 alkali metal ion Inorganic materials 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 229910001420 alkaline earth metal ion Inorganic materials 0.000 description 2
- 235000010233 benzoic acid Nutrition 0.000 description 2
- 150000001649 bromium compounds Chemical class 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- NZNMSOFKMUBTKW-UHFFFAOYSA-N cyclohexanecarboxylic acid Chemical compound OC(=O)C1CCCCC1 NZNMSOFKMUBTKW-UHFFFAOYSA-N 0.000 description 2
- JBDSSBMEKXHSJF-UHFFFAOYSA-N cyclopentanecarboxylic acid Chemical compound OC(=O)C1CCCC1 JBDSSBMEKXHSJF-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- POULHZVOKOAJMA-UHFFFAOYSA-N dodecanoic acid Chemical compound CCCCCCCCCCCC(O)=O POULHZVOKOAJMA-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 229910001509 metal bromide Inorganic materials 0.000 description 2
- SIOXPEMLGUPBBT-UHFFFAOYSA-N picolinic acid Chemical compound OC(=O)C1=CC=CC=N1 SIOXPEMLGUPBBT-UHFFFAOYSA-N 0.000 description 2
- 239000002243 precursor Chemical group 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 239000010936 titanium Substances 0.000 description 2
- PAAZPARNPHGIKF-UHFFFAOYSA-N 1,2-dibromoethane Chemical compound BrCCBr PAAZPARNPHGIKF-UHFFFAOYSA-N 0.000 description 1
- XFDQLDNQZFOAFK-UHFFFAOYSA-N 2-benzoyloxyethyl benzoate Chemical compound C=1C=CC=CC=1C(=O)OCCOC(=O)C1=CC=CC=C1 XFDQLDNQZFOAFK-UHFFFAOYSA-N 0.000 description 1
- LDLCZOVUSADOIV-UHFFFAOYSA-N 2-bromoethanol Chemical compound OCCBr LDLCZOVUSADOIV-UHFFFAOYSA-N 0.000 description 1
- IKCLCGXPQILATA-UHFFFAOYSA-N 2-chlorobenzoic acid Chemical compound OC(=O)C1=CC=CC=C1Cl IKCLCGXPQILATA-UHFFFAOYSA-N 0.000 description 1
- MLIREBYILWEBDM-UHFFFAOYSA-M 2-cyanoacetate Chemical compound [O-]C(=O)CC#N MLIREBYILWEBDM-UHFFFAOYSA-M 0.000 description 1
- SMNDYUVBFMFKNZ-UHFFFAOYSA-N 2-furoic acid Chemical compound OC(=O)C1=CC=CO1 SMNDYUVBFMFKNZ-UHFFFAOYSA-N 0.000 description 1
- SLAMLWHELXOEJZ-UHFFFAOYSA-N 2-nitrobenzoic acid Chemical compound OC(=O)C1=CC=CC=C1[N+]([O-])=O SLAMLWHELXOEJZ-UHFFFAOYSA-N 0.000 description 1
- PVCYPHXUHJFRNZ-UHFFFAOYSA-N 2-pentanoyloxyethyl pentanoate Chemical class CCCCC(=O)OCCOC(=O)CCCC PVCYPHXUHJFRNZ-UHFFFAOYSA-N 0.000 description 1
- DHXNZYCXMFBMHE-UHFFFAOYSA-N 3-bromopropanoic acid Chemical compound OC(=O)CCBr DHXNZYCXMFBMHE-UHFFFAOYSA-N 0.000 description 1
- AFPHTEQTJZKQAQ-UHFFFAOYSA-N 3-nitrobenzoic acid Chemical compound OC(=O)C1=CC=CC([N+]([O-])=O)=C1 AFPHTEQTJZKQAQ-UHFFFAOYSA-N 0.000 description 1
- NNTBDUTXMIMRKK-UHFFFAOYSA-N 5-chlorofuran-2-carboxylic acid Chemical compound OC(=O)C1=CC=C(Cl)O1 NNTBDUTXMIMRKK-UHFFFAOYSA-N 0.000 description 1
- WDJHALXBUFZDSR-UHFFFAOYSA-N Acetoacetic acid Natural products CC(=O)CC(O)=O WDJHALXBUFZDSR-UHFFFAOYSA-N 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 239000005639 Lauric acid Substances 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- 125000002723 alicyclic group Chemical group 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001339 alkali metal compounds Chemical class 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 159000000032 aromatic acids Chemical class 0.000 description 1
- 229910052785 arsenic Inorganic materials 0.000 description 1
- 229910001632 barium fluoride Inorganic materials 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 235000011148 calcium chloride Nutrition 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 230000021615 conjugation Effects 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- VZFUCHSFHOYXIS-UHFFFAOYSA-N cycloheptane carboxylic acid Natural products OC(=O)C1CCCCCC1 VZFUCHSFHOYXIS-UHFFFAOYSA-N 0.000 description 1
- YMGUBTXCNDTFJI-UHFFFAOYSA-N cyclopropanecarboxylic acid Chemical group OC(=O)C1CC1 YMGUBTXCNDTFJI-UHFFFAOYSA-N 0.000 description 1
- GHVNFZFCNZKVNT-UHFFFAOYSA-N decanoic acid Chemical compound CCCCCCCCCC(O)=O GHVNFZFCNZKVNT-UHFFFAOYSA-N 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- WOWBFOBYOAGEEA-UHFFFAOYSA-N diafenthiuron Chemical compound CC(C)C1=C(NC(=S)NC(C)(C)C)C(C(C)C)=CC(OC=2C=CC=CC=2)=C1 WOWBFOBYOAGEEA-UHFFFAOYSA-N 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 239000005038 ethylene vinyl acetate Substances 0.000 description 1
- 239000002360 explosive Substances 0.000 description 1
- 229910052733 gallium Inorganic materials 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- GPSDUZXPYCFOSQ-UHFFFAOYSA-N m-toluic acid Chemical compound CC1=CC=CC(C(O)=O)=C1 GPSDUZXPYCFOSQ-UHFFFAOYSA-N 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 229910021645 metal ion Inorganic materials 0.000 description 1
- NBTOZLQBSIZIKS-UHFFFAOYSA-N methoxide Chemical compound [O-]C NBTOZLQBSIZIKS-UHFFFAOYSA-N 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 229960003512 nicotinic acid Drugs 0.000 description 1
- 235000001968 nicotinic acid Nutrition 0.000 description 1
- 239000011664 nicotinic acid Substances 0.000 description 1
- 229910052757 nitrogen Chemical group 0.000 description 1
- GQPLMRYTRLFLPF-UHFFFAOYSA-N nitrous oxide Inorganic materials [O-][N+]#N GQPLMRYTRLFLPF-UHFFFAOYSA-N 0.000 description 1
- ZWLPBLYKEWSWPD-UHFFFAOYSA-N o-toluic acid Chemical compound CC1=CC=CC=C1C(O)=O ZWLPBLYKEWSWPD-UHFFFAOYSA-N 0.000 description 1
- WWZKQHOCKIZLMA-UHFFFAOYSA-N octanoic acid Chemical compound CCCCCCCC(O)=O WWZKQHOCKIZLMA-UHFFFAOYSA-N 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- IPCSVZSSVZVIGE-UHFFFAOYSA-N palmitic acid group Chemical group C(CCCCCCCCCCCCCCC)(=O)O IPCSVZSSVZVIGE-UHFFFAOYSA-N 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 1
- 150000003022 phthalic acids Chemical class 0.000 description 1
- 229940081066 picolinic acid Drugs 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000011593 sulfur Chemical group 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000013589 supplement Substances 0.000 description 1
- LAJZODKXOMJMPK-UHFFFAOYSA-N tellurium dioxide Chemical compound O=[Te]=O LAJZODKXOMJMPK-UHFFFAOYSA-N 0.000 description 1
- YTZKOQUCBOVLHL-UHFFFAOYSA-N tert-butylbenzene Chemical compound CC(C)(C)C1=CC=CC=C1 YTZKOQUCBOVLHL-UHFFFAOYSA-N 0.000 description 1
- QERYCTSHXKAMIS-UHFFFAOYSA-N thiophene-2-carboxylic acid Chemical compound OC(=O)C1=CC=CS1 QERYCTSHXKAMIS-UHFFFAOYSA-N 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
- KOZCZZVUFDCZGG-UHFFFAOYSA-N vinyl benzoate Chemical compound C=COC(=O)C1=CC=CC=C1 KOZCZZVUFDCZGG-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C67/00—Preparation of carboxylic acid esters
- C07C67/04—Preparation of carboxylic acid esters by reacting carboxylic acids or symmetrical anhydrides onto unsaturated carbon-to-carbon bonds
- C07C67/05—Preparation of carboxylic acid esters by reacting carboxylic acids or symmetrical anhydrides onto unsaturated carbon-to-carbon bonds with oxidation
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Indole Compounds (AREA)
- Furan Compounds (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US3126270A | 1970-04-23 | 1970-04-23 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL89267B3 true PL89267B3 (enExample) | 1976-11-30 |
Family
ID=21858484
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1971147714A PL89267B3 (enExample) | 1970-04-23 | 1971-04-22 |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US3668239A (enExample) |
| JP (1) | JPS5525175B1 (enExample) |
| BE (2) | BE766002R (enExample) |
| BR (1) | BR7102421D0 (enExample) |
| CH (1) | CH533592A (enExample) |
| DE (1) | DE2120004C3 (enExample) |
| ES (2) | ES390526A2 (enExample) |
| FR (2) | FR2092924B2 (enExample) |
| GB (1) | GB1351242A (enExample) |
| IE (1) | IE35149B1 (enExample) |
| IT (2) | IT989584B (enExample) |
| LU (1) | LU63021A1 (enExample) |
| NL (1) | NL7105443A (enExample) |
| NO (2) | NO134418C (enExample) |
| PL (1) | PL89267B3 (enExample) |
| RO (1) | RO58098A7 (enExample) |
| SE (1) | SE383336B (enExample) |
| ZA (1) | ZA712642B (enExample) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3859368A (en) * | 1971-09-08 | 1975-01-07 | Halcon International Inc | Method of producing polyhydric compounds such as ethylene glycol by disproportionation of its monoacetate |
| US3968175A (en) * | 1971-09-08 | 1976-07-06 | Halcon International, Inc. | Method of producing polyhydric compounds |
| US3968174A (en) * | 1971-09-08 | 1976-07-06 | Halcon International, Inc. | Method of producing polyhydric compounds |
| US3907874A (en) * | 1972-08-09 | 1975-09-23 | Halcon International Inc | Vicinal glycol ester preparation process |
| US4045477A (en) * | 1975-07-17 | 1977-08-30 | Chem Systems Inc. | Acetoxylation process |
| DE2636669A1 (de) * | 1976-08-14 | 1978-02-23 | Basf Ag | Verfahren zur herstellung von glykolestern |
| US4159989A (en) * | 1977-05-02 | 1979-07-03 | Standard Oil Company (Indiana) | Process for preparing ethylene glycol diacylate |
| US4187153A (en) * | 1977-11-14 | 1980-02-05 | Halcon Research & Development Corporation | Production of alkylene glycols |
| DE2834540A1 (de) * | 1978-08-07 | 1980-02-21 | Basf Ag | Verfahren zur herstellung von carbonsaeureestern vicinaler glykole |
| US4260814A (en) * | 1979-07-23 | 1981-04-07 | Atlantic Richfield Company | Preparation of esters by the thermal decomposition of a bis(2-bromoalkyl)tellurium dicarboxylate compound |
| US4258208A (en) * | 1979-07-23 | 1981-03-24 | Atlantic Richfield Company | Preparation of esters from organic bromo alkyl tellurium compounds |
| US4224301A (en) * | 1979-08-20 | 1980-09-23 | Atlantic Richfield Company | Removal of tellurium from glycol ester solutions |
| US4271090A (en) * | 1979-10-29 | 1981-06-02 | Halcon Research And Development Corp. | Novel 2-bromoethyl tellurium bromides |
| US4238624A (en) * | 1979-11-02 | 1980-12-09 | The Dow Chemical Company | Process for making glycol esters |
| US4528396A (en) * | 1982-09-24 | 1985-07-09 | Texaco Inc. | Dicyclopentadiene derived ester compounds |
| GB9823853D0 (en) | 1998-10-30 | 1998-12-23 | Bp Chem Int Ltd | A process for making n-butyl esters from butadiene |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3479395A (en) * | 1966-05-02 | 1969-11-18 | Celanese Corp | Oxidation of olefins with tellurium compounds |
-
1970
- 1970-04-23 US US31262A patent/US3668239A/en not_active Expired - Lifetime
-
1971
- 1971-04-20 BE BE766002A patent/BE766002R/xx active
- 1971-04-20 BE BE766001A patent/BE766001R/xx active
- 1971-04-20 LU LU63021D patent/LU63021A1/xx unknown
- 1971-04-21 IE IE497/71A patent/IE35149B1/xx unknown
- 1971-04-22 CH CH587571A patent/CH533592A/fr not_active IP Right Cessation
- 1971-04-22 RO RO66661A patent/RO58098A7/ro unknown
- 1971-04-22 GB GB1081871*[A patent/GB1351242A/en not_active Expired
- 1971-04-22 PL PL1971147714A patent/PL89267B3/pl unknown
- 1971-04-22 IT IT49900/71A patent/IT989584B/it active
- 1971-04-22 FR FR717114279A patent/FR2092924B2/fr not_active Expired
- 1971-04-22 NL NL7105443A patent/NL7105443A/xx unknown
- 1971-04-22 FR FR717114278A patent/FR2092923B2/fr not_active Expired
- 1971-04-22 IT IT49899/71A patent/IT994014B/it active
- 1971-04-22 SE SE7105219A patent/SE383336B/xx unknown
- 1971-04-23 NO NO1526/71A patent/NO134418C/no unknown
- 1971-04-23 ES ES390526A patent/ES390526A2/es not_active Expired
- 1971-04-23 ES ES390527A patent/ES390527A2/es not_active Expired
- 1971-04-23 NO NO1527/71A patent/NO133754C/no unknown
- 1971-04-23 DE DE2120004A patent/DE2120004C3/de not_active Expired
- 1971-04-23 ZA ZA712642A patent/ZA712642B/xx unknown
- 1971-04-23 BR BR2421/71A patent/BR7102421D0/pt unknown
- 1971-04-23 JP JP2614571A patent/JPS5525175B1/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| IT989584B (it) | 1975-06-10 |
| CH533592A (fr) | 1973-02-15 |
| BR7102421D0 (pt) | 1973-03-15 |
| NO133754C (enExample) | 1976-06-23 |
| IE35149B1 (en) | 1975-11-26 |
| FR2092924B2 (enExample) | 1973-06-08 |
| GB1351242A (en) | 1974-04-24 |
| ES390527A2 (es) | 1974-08-16 |
| RO58098A7 (enExample) | 1975-07-15 |
| NO133754B (enExample) | 1976-03-15 |
| BE766002R (fr) | 1971-10-20 |
| DE2120004A1 (enExample) | 1971-11-04 |
| NO134418C (enExample) | 1976-10-06 |
| FR2092924A2 (enExample) | 1972-01-28 |
| ZA712642B (en) | 1972-11-29 |
| JPS5525175B1 (enExample) | 1980-07-04 |
| NL7105443A (enExample) | 1971-10-26 |
| DE2120004B2 (enExample) | 1974-10-17 |
| BE766001R (fr) | 1971-10-20 |
| US3668239A (en) | 1972-06-06 |
| SE383336B (sv) | 1976-03-08 |
| FR2092923B2 (enExample) | 1973-06-08 |
| DE2120004C3 (de) | 1975-06-05 |
| IT994014B (it) | 1975-10-20 |
| ES390526A2 (es) | 1974-05-01 |
| NO134418B (enExample) | 1976-06-28 |
| FR2092923A2 (enExample) | 1972-01-28 |
| LU63021A1 (enExample) | 1972-12-11 |
| IE35149L (en) | 1971-10-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL89267B3 (enExample) | ||
| US4551566A (en) | Process for the production of alkylene glycols | |
| JPS6230179B2 (enExample) | ||
| US3715389A (en) | Process for preparing glycol esters from olefinically unsaturated compounds | |
| EP0019483B1 (en) | Method of producing biphenyltetracarboxylic esters | |
| US4045477A (en) | Acetoxylation process | |
| EP0097978A1 (en) | A process for the co-production of carboxylic acids | |
| US4464303A (en) | Manufacture of higher aryl esters cross-reference to related applications | |
| US3715388A (en) | Process for preparing glycol esters from ethylene and propylene | |
| US4044041A (en) | Preparation of esters of unsaturated alcohols | |
| US3778468A (en) | Process for preparing ethylene glycol esters | |
| US4052442A (en) | Process for preparing glycol esters | |
| US4112241A (en) | Process for producing alkylene glycol esters | |
| US4061868A (en) | Process for the manufacture of glycols and glycol nono-esters | |
| US4144396A (en) | Process for producing alkylene glycol esters | |
| US4316046A (en) | Process for the preparation of aryl carboxylates | |
| EP0070665A1 (en) | Process for oxidising phenol to P-benzoquinone | |
| US3459796A (en) | Production of acetic acid | |
| US4209650A (en) | Process for producing ethylene glycol | |
| JPS6112647A (ja) | カルボニル化合物の製造法 | |
| EP0330203B1 (en) | Catalytic process for preparing ethylene-tetracarboxylic esters | |
| SU441702A1 (ru) | Способ получени сложных эфиров этиленгликол | |
| JP4385879B2 (ja) | ビフェニル類の製造方法、及び製造用触媒 | |
| SU910595A1 (ru) | Способ получени пропиленгликол и его ацетатов | |
| EP0083914B1 (en) | Metal and acid catalysis in sorbic acid preparation |