PL89138B1 - - Google Patents
Download PDFInfo
- Publication number
- PL89138B1 PL89138B1 PL16265970A PL16265970A PL89138B1 PL 89138 B1 PL89138 B1 PL 89138B1 PL 16265970 A PL16265970 A PL 16265970A PL 16265970 A PL16265970 A PL 16265970A PL 89138 B1 PL89138 B1 PL 89138B1
- Authority
- PL
- Poland
- Prior art keywords
- methyl
- formula
- fluoro
- acid
- indenyl
- Prior art date
Links
- 239000002253 acid Substances 0.000 claims description 11
- 150000001875 compounds Chemical class 0.000 claims description 10
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims description 9
- MLKXDPUZXIRXEP-UHFFFAOYSA-N 2-[6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]-1-indenyl]acetic acid Chemical compound CC1=C(CC(O)=O)C2=CC(F)=CC=C2C1=CC1=CC=C(S(C)=O)C=C1 MLKXDPUZXIRXEP-UHFFFAOYSA-N 0.000 claims description 7
- 238000000034 method Methods 0.000 claims description 7
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 2
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 claims 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 21
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 16
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 12
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 12
- 239000000203 mixture Substances 0.000 description 10
- 239000000243 solution Substances 0.000 description 10
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 229910052757 nitrogen Inorganic materials 0.000 description 8
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 8
- 239000000047 product Substances 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 6
- -1 (1-methylsulfinylbenzylidene) -3-indenyl-acetic acid Chemical compound 0.000 description 5
- JMNVALXGIOSFGW-UHFFFAOYSA-N 2-(3h-inden-1-yl)acetic acid Chemical compound C1=CC=C2C(CC(=O)O)=CCC2=C1 JMNVALXGIOSFGW-UHFFFAOYSA-N 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 230000007062 hydrolysis Effects 0.000 description 5
- 238000006460 hydrolysis reaction Methods 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 235000011054 acetic acid Nutrition 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 238000010561 standard procedure Methods 0.000 description 3
- PTUSXMWNCXRKAX-UHFFFAOYSA-N 2-(1h-inden-1-yl)acetic acid Chemical compound C1=CC=C2C(CC(=O)O)C=CC2=C1 PTUSXMWNCXRKAX-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 2
- 238000006680 Reformatsky reaction Methods 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 2
- NDKBVBUGCNGSJJ-UHFFFAOYSA-M benzyltrimethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)CC1=CC=CC=C1 NDKBVBUGCNGSJJ-UHFFFAOYSA-M 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 238000006114 decarboxylation reaction Methods 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 125000003454 indenyl group Chemical group C1(C=CC2=CC=CC=C12)* 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 230000020477 pH reduction Effects 0.000 description 2
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- KZNICNPSHKQLFF-UHFFFAOYSA-N succinimide Chemical compound O=C1CCC(=O)N1 KZNICNPSHKQLFF-UHFFFAOYSA-N 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- DYLIWHYUXAJDOJ-OWOJBTEDSA-N (e)-4-(6-aminopurin-9-yl)but-2-en-1-ol Chemical compound NC1=NC=NC2=C1N=CN2C\C=C\CO DYLIWHYUXAJDOJ-OWOJBTEDSA-N 0.000 description 1
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Natural products C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 1
- KWRSKZMCJVFUGU-UHFFFAOYSA-N 1h-inden-1-ol Chemical compound C1=CC=C2C(O)C=CC2=C1 KWRSKZMCJVFUGU-UHFFFAOYSA-N 0.000 description 1
- VAABCQVOEKSZNJ-UHFFFAOYSA-N 2-(1H-inden-1-yl)acetonitrile Chemical compound C1(C=CC2=CC=CC=C12)CC#N VAABCQVOEKSZNJ-UHFFFAOYSA-N 0.000 description 1
- ZYJXCZUBMJPBAA-UHFFFAOYSA-N 2-(3-benzylideneinden-1-yl)acetic acid Chemical class C12=CC=CC=C2C(CC(=O)O)=CC1=CC1=CC=CC=C1 ZYJXCZUBMJPBAA-UHFFFAOYSA-N 0.000 description 1
- DTZSHMRZLLJIBE-UHFFFAOYSA-N 2-methyl-1-[(4-methylsulfinylphenyl)methylidene]indene Chemical compound CC=1C(C2=CC=CC=C2C1)=CC1=CC=C(C=C1)S(=O)C DTZSHMRZLLJIBE-UHFFFAOYSA-N 0.000 description 1
- RSHWBWZXFKRCCS-UHFFFAOYSA-N 3-(bromomethyl)-1H-indene Chemical compound C1C=C(C2=CC=CC=C12)CBr RSHWBWZXFKRCCS-UHFFFAOYSA-N 0.000 description 1
- YFCWTLFMNAJURT-UHFFFAOYSA-N 3-(bromomethyl)-5-fluoro-2-methyl-1-[(4-methylsulfinylphenyl)methylidene]indene Chemical compound CC1=C(CBr)C2=CC(F)=CC=C2C1=CC1=CC=C(S(C)=O)C=C1 YFCWTLFMNAJURT-UHFFFAOYSA-N 0.000 description 1
- VABIVQHTHCZWPZ-UHFFFAOYSA-N 3-bromo-5-fluoro-2-methyl-1-[(4-methylsulfinylphenyl)methyl]-1H-indene Chemical compound BrC1=C(C(C2=CC=C(C=C12)F)CC1=CC=C(C=C1)S(=O)C)C VABIVQHTHCZWPZ-UHFFFAOYSA-N 0.000 description 1
- JIZWNONYKZOASX-UHFFFAOYSA-N 5-fluoro-2-methyl-1-[(4-methylsulfanylphenyl)methyl]-1h-indene Chemical compound C1=CC(SC)=CC=C1CC1C2=CC=C(F)C=C2C=C1C JIZWNONYKZOASX-UHFFFAOYSA-N 0.000 description 1
- DNLFNKPOQAMIMG-UHFFFAOYSA-N 5-fluoro-2-methyl-1-[(4-methylsulfinylphenyl)methyl]-1h-indene Chemical compound CC1=CC2=CC(F)=CC=C2C1CC1=CC=C(S(C)=O)C=C1 DNLFNKPOQAMIMG-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical class [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- 238000003512 Claisen condensation reaction Methods 0.000 description 1
- ICWAHAPNZJENHX-UHFFFAOYSA-N FC=1C=C2C(=C(C(C2=CC=1)CC1=CC=C(C=C1)S(=O)C)C)CBr Chemical compound FC=1C=C2C(=C(C(C2=CC=1)CC1=CC=C(C=C1)S(=O)C)C)CBr ICWAHAPNZJENHX-UHFFFAOYSA-N 0.000 description 1
- 239000007818 Grignard reagent Substances 0.000 description 1
- 206010061218 Inflammation Diseases 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical class [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- MPJJMYIKKWCCRV-UHFFFAOYSA-N O=C(CC#N)OC1=CCC2=CC=CC=C12 Chemical compound O=C(CC#N)OC1=CCC2=CC=CC=C12 MPJJMYIKKWCCRV-UHFFFAOYSA-N 0.000 description 1
- 206010037660 Pyrexia Diseases 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 238000007239 Wittig reaction Methods 0.000 description 1
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 230000001760 anti-analgesic effect Effects 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 150000003934 aromatic aldehydes Chemical class 0.000 description 1
- 150000003935 benzaldehydes Chemical class 0.000 description 1
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzenecarboxaldehyde Natural products O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- 125000000649 benzylidene group Chemical group [H]C(=[*])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000036760 body temperature Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 150000001649 bromium compounds Chemical group 0.000 description 1
- GUGRBFQNXVKOGR-UHFFFAOYSA-N butyl hypochlorite Chemical group CCCCOCl GUGRBFQNXVKOGR-UHFFFAOYSA-N 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- PDQYDAMNFMHSJS-UHFFFAOYSA-N diethyl propanedioate;sodium Chemical compound [Na].CCOC(=O)CC(=O)OCC PDQYDAMNFMHSJS-UHFFFAOYSA-N 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 150000002168 ethanoic acid esters Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 150000004795 grignard reagents Chemical class 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- QNXSIUBBGPHDDE-UHFFFAOYSA-N indan-1-one Chemical compound C1=CC=C2C(=O)CCC2=C1 QNXSIUBBGPHDDE-UHFFFAOYSA-N 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- NXPHGHWWQRMDIA-UHFFFAOYSA-M magnesium;carbanide;bromide Chemical compound [CH3-].[Mg+2].[Br-] NXPHGHWWQRMDIA-UHFFFAOYSA-M 0.000 description 1
- 239000011259 mixed solution Substances 0.000 description 1
- NSBNSZAXNUGWDJ-UHFFFAOYSA-O monopyridin-1-ium tribromide Chemical compound Br[Br-]Br.C1=CC=[NH+]C=C1 NSBNSZAXNUGWDJ-UHFFFAOYSA-O 0.000 description 1
- 125000002560 nitrile group Chemical group 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- XYFCBTPGUUZFHI-UHFFFAOYSA-O phosphonium Chemical compound [PH4+] XYFCBTPGUUZFHI-UHFFFAOYSA-O 0.000 description 1
- 150000004714 phosphonium salts Chemical class 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- BBFCIBZLAVOLCF-UHFFFAOYSA-N pyridin-1-ium;bromide Chemical compound Br.C1=CC=NC=C1 BBFCIBZLAVOLCF-UHFFFAOYSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 229960002317 succinimide Drugs 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- HFRXJVQOXRXOPP-UHFFFAOYSA-N thionyl bromide Chemical compound BrS(Br)=O HFRXJVQOXRXOPP-UHFFFAOYSA-N 0.000 description 1
- FIQMHBFVRAXMOP-UHFFFAOYSA-N triphenylphosphane oxide Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)(=O)C1=CC=CC=C1 FIQMHBFVRAXMOP-UHFFFAOYSA-N 0.000 description 1
Landscapes
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US3397170A | 1970-05-01 | 1970-05-01 | |
| US3389070A | 1970-05-01 | 1970-05-01 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL89138B1 true PL89138B1 (online.php) | 1976-10-30 |
Family
ID=26710281
Family Applications (6)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL16266070A PL89135B1 (online.php) | 1970-05-01 | 1970-11-18 | |
| PL16266370A PL89109B1 (online.php) | 1970-05-01 | 1970-11-18 | |
| PL16265970A PL89138B1 (online.php) | 1970-05-01 | 1970-11-18 | |
| PL16266570A PL89119B1 (online.php) | 1970-05-01 | 1970-11-18 | |
| PL16265870A PL89242B1 (online.php) | 1970-05-01 | 1970-11-18 | |
| PL16266470A PL89129B1 (online.php) | 1970-05-01 | 1970-11-18 |
Family Applications Before (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL16266070A PL89135B1 (online.php) | 1970-05-01 | 1970-11-18 | |
| PL16266370A PL89109B1 (online.php) | 1970-05-01 | 1970-11-18 |
Family Applications After (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL16266570A PL89119B1 (online.php) | 1970-05-01 | 1970-11-18 | |
| PL16265870A PL89242B1 (online.php) | 1970-05-01 | 1970-11-18 | |
| PL16266470A PL89129B1 (online.php) | 1970-05-01 | 1970-11-18 |
Country Status (1)
| Country | Link |
|---|---|
| PL (6) | PL89135B1 (online.php) |
-
1970
- 1970-11-18 PL PL16266070A patent/PL89135B1/pl unknown
- 1970-11-18 PL PL16266370A patent/PL89109B1/pl unknown
- 1970-11-18 PL PL16265970A patent/PL89138B1/pl unknown
- 1970-11-18 PL PL16266570A patent/PL89119B1/pl unknown
- 1970-11-18 PL PL16265870A patent/PL89242B1/pl unknown
- 1970-11-18 PL PL16266470A patent/PL89129B1/pl unknown
Also Published As
| Publication number | Publication date |
|---|---|
| PL89119B1 (online.php) | 1976-10-30 |
| PL89242B1 (online.php) | 1976-11-30 |
| PL89135B1 (online.php) | 1976-10-30 |
| PL89129B1 (online.php) | 1976-10-30 |
| PL89109B1 (online.php) | 1976-10-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3647858A (en) | Process for preparing 1-benzylidene-3-indenyl acetic acids | |
| US4070539A (en) | [1-Oxo-2-halo(or hydrogen) indanyloxy]-alkanoic acid | |
| US3509184A (en) | Anthracyclidine-acetic acid derivatives | |
| US4081476A (en) | 1-Aryl-1-lower alkyl-1-buten-3-ols and ester derivatives | |
| CA1127165A (en) | Dibenzothiepin derivatives and a process for producing the same | |
| DE2224655A1 (de) | Tricyclische Verbindungen und Verfahren zu deren Herstellung | |
| NO134337B (online.php) | ||
| US4017517A (en) | 2-(Trisubstituted benzoyl)-propionic acid and a method for the production thereof | |
| PL89138B1 (online.php) | ||
| EP0024807A1 (en) | Benzocycloheptapyrrolealkanoic acids and their derivatives, processes for their preparation and pharmaceutical compositions containing them | |
| US4393008A (en) | 2-Cyano-2-(3-phenoxy-phenyl)-propionic acid amide and preparation thereof | |
| US4264773A (en) | Preparation of 2-chloro-thioxanthone | |
| GB1562943A (en) | Pyrazole derivatives and their manufacture and use | |
| JPH10226683A (ja) | 2−(10,11−ジヒドロ−10−オキソジベンゾ[b,f]チエピン−2−イル)プロピオン酸の製造方法、及びその中間体化合物 | |
| US2565300A (en) | Unsymmetrical dichloro-dihydroxybenzophenones and a method for their production | |
| US4775691A (en) | 4H-benzo[4,5]cyclohepta[1,2-b]thiophene derivatives | |
| US3450698A (en) | Phenthiazine derivatives | |
| US4690945A (en) | Process for the preparation of 5'-substituted 2-(3'-thienyl)propionic acids | |
| US4232039A (en) | Phenyl- or cycloalkyl-benzo-oxacyclic compounds | |
| US3691231A (en) | New process for the preparation of 1-indancarboxylic acids | |
| US3062834A (en) | Process for preparing thiophencarboxylic acids and their esters | |
| US3524862A (en) | (isoxazolyl)(amino)-methyl-tetrahydroanthracenes | |
| GONCALVES et al. | PREPARATION OF THIOPHANTHRENEQUINONES. II. THENOYLNITROBENZOIC ACIDS AND NITROTHIOPHANTHRENEQUINONES1 | |
| US4029699A (en) | 3,(2,4,5-Trisubstituted benzoyl)-propionic acid and the salts thereof | |
| PL89134B1 (online.php) |