PL88994B1 - Process for oxidizing phenols to quinones[us3796732a] - Google Patents
Process for oxidizing phenols to quinones[us3796732a] Download PDFInfo
- Publication number
- PL88994B1 PL88994B1 PL1972155443A PL15544372A PL88994B1 PL 88994 B1 PL88994 B1 PL 88994B1 PL 1972155443 A PL1972155443 A PL 1972155443A PL 15544372 A PL15544372 A PL 15544372A PL 88994 B1 PL88994 B1 PL 88994B1
- Authority
- PL
- Poland
- Prior art keywords
- oxygen
- copper
- quinones
- hydrogen
- general formula
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 35
- 150000004053 quinones Chemical class 0.000 title claims abstract description 15
- 230000001590 oxidative effect Effects 0.000 title abstract 2
- 150000002989 phenols Chemical class 0.000 title description 7
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 29
- 239000001301 oxygen Substances 0.000 claims abstract description 29
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 29
- 239000008139 complexing agent Substances 0.000 claims abstract description 15
- -1 halogen ions Chemical class 0.000 claims abstract description 15
- 239000002904 solvent Substances 0.000 claims abstract description 14
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims abstract description 11
- 239000003054 catalyst Substances 0.000 claims abstract description 11
- 229910052802 copper Inorganic materials 0.000 claims abstract description 10
- 239000010949 copper Substances 0.000 claims abstract description 10
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 10
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 8
- 239000001257 hydrogen Substances 0.000 claims abstract description 8
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 8
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims abstract description 7
- 239000000460 chlorine Chemical group 0.000 claims abstract description 7
- 229910052801 chlorine Inorganic materials 0.000 claims abstract description 7
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims abstract description 6
- 229910052794 bromium Inorganic materials 0.000 claims abstract description 6
- 239000002253 acid Substances 0.000 claims abstract description 5
- 239000007789 gas Substances 0.000 claims abstract description 5
- 150000001412 amines Chemical class 0.000 claims abstract description 4
- RBFQJDQYXXHULB-UHFFFAOYSA-N arsane Chemical class [AsH3] RBFQJDQYXXHULB-UHFFFAOYSA-N 0.000 claims abstract description 4
- 229910052740 iodine Chemical group 0.000 claims abstract description 4
- 238000002360 preparation method Methods 0.000 claims abstract description 4
- 230000000737 periodic effect Effects 0.000 claims abstract 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract 2
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 60
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 33
- 239000011541 reaction mixture Substances 0.000 claims description 18
- 230000003647 oxidation Effects 0.000 claims description 17
- 238000007254 oxidation reaction Methods 0.000 claims description 17
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 16
- JPVYNHNXODAKFH-UHFFFAOYSA-N Cu2+ Chemical compound [Cu+2] JPVYNHNXODAKFH-UHFFFAOYSA-N 0.000 claims description 7
- 229910001431 copper ion Inorganic materials 0.000 claims description 7
- QTMDXZNDVAMKGV-UHFFFAOYSA-L copper(ii) bromide Chemical compound [Cu+2].[Br-].[Br-] QTMDXZNDVAMKGV-UHFFFAOYSA-L 0.000 claims description 6
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 claims description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 5
- 150000003839 salts Chemical class 0.000 claims description 5
- 229910021591 Copper(I) chloride Inorganic materials 0.000 claims description 4
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 claims description 4
- 150000001879 copper Chemical class 0.000 claims description 4
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 claims description 4
- 229940045803 cuprous chloride Drugs 0.000 claims description 4
- 150000002431 hydrogen Chemical group 0.000 claims description 4
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical group II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 claims description 4
- 229910021590 Copper(II) bromide Inorganic materials 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 150000001408 amides Chemical class 0.000 claims description 3
- 150000002576 ketones Chemical class 0.000 claims description 3
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 2
- 238000009835 boiling Methods 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 229910001629 magnesium chloride Inorganic materials 0.000 claims description 2
- 150000007522 mineralic acids Chemical class 0.000 claims description 2
- 150000007524 organic acids Chemical class 0.000 claims description 2
- BPLUKJNHPBNVQL-UHFFFAOYSA-N triphenylarsine Chemical compound C1=CC=CC=C1[As](C=1C=CC=CC=1)C1=CC=CC=C1 BPLUKJNHPBNVQL-UHFFFAOYSA-N 0.000 claims description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims 2
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 claims 2
- 150000004820 halides Chemical class 0.000 claims 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 claims 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 claims 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical class Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims 1
- 239000003513 alkali Substances 0.000 claims 1
- 125000000217 alkyl group Chemical group 0.000 claims 1
- 230000009970 fire resistant effect Effects 0.000 claims 1
- 229910000073 phosphorus hydride Inorganic materials 0.000 claims 1
- 239000002994 raw material Substances 0.000 claims 1
- 125000001424 substituent group Chemical group 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 abstract description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 abstract description 2
- 150000003003 phosphines Chemical class 0.000 abstract description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract 2
- 101000653791 Bos taurus Protein S100-A12 Proteins 0.000 abstract 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical group ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 abstract 1
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 24
- QQOMQLYQAXGHSU-UHFFFAOYSA-N 2,3,6-Trimethylphenol Chemical compound CC1=CC=C(C)C(O)=C1C QQOMQLYQAXGHSU-UHFFFAOYSA-N 0.000 description 15
- 229960003280 cupric chloride Drugs 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 10
- 238000002425 crystallisation Methods 0.000 description 10
- 230000008025 crystallization Effects 0.000 description 10
- QIXDHVDGPXBRRD-UHFFFAOYSA-N 2,3,5-trimethylcyclohexa-2,5-diene-1,4-dione Chemical compound CC1=CC(=O)C(C)=C(C)C1=O QIXDHVDGPXBRRD-UHFFFAOYSA-N 0.000 description 9
- 239000000203 mixture Substances 0.000 description 8
- 238000003756 stirring Methods 0.000 description 7
- NXXYKOUNUYWIHA-UHFFFAOYSA-N 2,6-Dimethylphenol Chemical compound CC1=CC=CC(C)=C1O NXXYKOUNUYWIHA-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 239000007795 chemical reaction product Substances 0.000 description 6
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 description 4
- KLAQSPUVCDBEGF-UHFFFAOYSA-N 2,3,5,6-tetramethylphenol Chemical compound CC1=CC(C)=C(C)C(O)=C1C KLAQSPUVCDBEGF-UHFFFAOYSA-N 0.000 description 4
- QWBBPBRQALCEIZ-UHFFFAOYSA-N 2,3-dimethylphenol Chemical compound CC1=CC=CC(O)=C1C QWBBPBRQALCEIZ-UHFFFAOYSA-N 0.000 description 4
- MYKLQMNSFPAPLZ-UHFFFAOYSA-N 2,5-dimethylcyclohexa-2,5-diene-1,4-dione Chemical compound CC1=CC(=O)C(C)=CC1=O MYKLQMNSFPAPLZ-UHFFFAOYSA-N 0.000 description 4
- NKTOLZVEWDHZMU-UHFFFAOYSA-N 2,5-xylenol Chemical compound CC1=CC=C(C)C(O)=C1 NKTOLZVEWDHZMU-UHFFFAOYSA-N 0.000 description 4
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 4
- TUAMRELNJMMDMT-UHFFFAOYSA-N 3,5-xylenol Chemical compound CC1=CC(C)=CC(O)=C1 TUAMRELNJMMDMT-UHFFFAOYSA-N 0.000 description 4
- RLSSMJSEOOYNOY-UHFFFAOYSA-N m-cresol Chemical compound CC1=CC=CC(O)=C1 RLSSMJSEOOYNOY-UHFFFAOYSA-N 0.000 description 4
- QWVGKYWNOKOFNN-UHFFFAOYSA-N o-cresol Chemical compound CC1=CC=CC=C1O QWVGKYWNOKOFNN-UHFFFAOYSA-N 0.000 description 4
- 239000007800 oxidant agent Substances 0.000 description 4
- 239000000758 substrate Substances 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- SENUUPBBLQWHMF-UHFFFAOYSA-N 2,6-dimethylcyclohexa-2,5-diene-1,4-dione Chemical compound CC1=CC(=O)C=C(C)C1=O SENUUPBBLQWHMF-UHFFFAOYSA-N 0.000 description 3
- VTWDKFNVVLAELH-UHFFFAOYSA-N 2-methylcyclohexa-2,5-diene-1,4-dione Chemical compound CC1=CC(=O)C=CC1=O VTWDKFNVVLAELH-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 150000002170 ethers Chemical class 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- OGRAOKJKVGDSFR-UHFFFAOYSA-N 2,3,5-trimethylphenol Chemical compound CC1=CC(C)=C(C)C(O)=C1 OGRAOKJKVGDSFR-UHFFFAOYSA-N 0.000 description 2
- AIACLXROWHONEE-UHFFFAOYSA-N 2,3-dimethylcyclohexa-2,5-diene-1,4-dione Chemical compound CC1=C(C)C(=O)C=CC1=O AIACLXROWHONEE-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- ATHHXGZTWNVVOU-UHFFFAOYSA-N N-methylformamide Chemical compound CNC=O ATHHXGZTWNVVOU-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- ODWXUNBKCRECNW-UHFFFAOYSA-M bromocopper(1+) Chemical compound Br[Cu+] ODWXUNBKCRECNW-UHFFFAOYSA-M 0.000 description 2
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 2
- 230000007423 decrease Effects 0.000 description 2
- 229910000464 lead oxide Inorganic materials 0.000 description 2
- 230000001706 oxygenating effect Effects 0.000 description 2
- 239000002798 polar solvent Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000012429 reaction media Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 229930003799 tocopherol Natural products 0.000 description 2
- 239000011732 tocopherol Substances 0.000 description 2
- 235000019149 tocopherols Nutrition 0.000 description 2
- YWWDBCBWQNCYNR-UHFFFAOYSA-N trimethylphosphine Chemical compound CP(C)C YWWDBCBWQNCYNR-UHFFFAOYSA-N 0.000 description 2
- QUEDXNHFTDJVIY-UHFFFAOYSA-N γ-tocopherol Chemical class OC1=C(C)C(C)=C2OC(CCCC(C)CCCC(C)CCCC(C)C)(C)CCC2=C1 QUEDXNHFTDJVIY-UHFFFAOYSA-N 0.000 description 2
- JEFSTMHERNSDBC-UHFFFAOYSA-N 1,2-dimethylcyclohexa-2,4-dien-1-ol Chemical compound CC1=CC=CCC1(C)O JEFSTMHERNSDBC-UHFFFAOYSA-N 0.000 description 1
- 239000005749 Copper compound Substances 0.000 description 1
- 229910021589 Copper(I) bromide Inorganic materials 0.000 description 1
- 229910021595 Copper(I) iodide Inorganic materials 0.000 description 1
- 241000938605 Crocodylia Species 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- LYVWMIHLNQLWAC-UHFFFAOYSA-N [Cl].[Cu] Chemical compound [Cl].[Cu] LYVWMIHLNQLWAC-UHFFFAOYSA-N 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000004020 conductor Substances 0.000 description 1
- 150000001880 copper compounds Chemical class 0.000 description 1
- XTVVROIMIGLXTD-UHFFFAOYSA-N copper(II) nitrate Chemical compound [Cu+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O XTVVROIMIGLXTD-UHFFFAOYSA-N 0.000 description 1
- NKNDPYCGAZPOFS-UHFFFAOYSA-M copper(i) bromide Chemical compound Br[Cu] NKNDPYCGAZPOFS-UHFFFAOYSA-M 0.000 description 1
- LSXDOTMGLUJQCM-UHFFFAOYSA-M copper(i) iodide Chemical compound I[Cu] LSXDOTMGLUJQCM-UHFFFAOYSA-M 0.000 description 1
- OPQARKPSCNTWTJ-UHFFFAOYSA-L copper(ii) acetate Chemical compound [Cu+2].CC([O-])=O.CC([O-])=O OPQARKPSCNTWTJ-UHFFFAOYSA-L 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 235000019441 ethanol Nutrition 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- AMWRITDGCCNYAT-UHFFFAOYSA-L manganese oxide Inorganic materials [Mn].O[Mn]=O.O[Mn]=O AMWRITDGCCNYAT-UHFFFAOYSA-L 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- YEXPOXQUZXUXJW-UHFFFAOYSA-N oxolead Chemical compound [Pb]=O YEXPOXQUZXUXJW-UHFFFAOYSA-N 0.000 description 1
- 238000006213 oxygenation reaction Methods 0.000 description 1
- 229920013636 polyphenyl ether polymer Polymers 0.000 description 1
- 239000012286 potassium permanganate Substances 0.000 description 1
- OVARTBFNCCXQKS-UHFFFAOYSA-N propan-2-one;hydrate Chemical compound O.CC(C)=O OVARTBFNCCXQKS-UHFFFAOYSA-N 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C50/00—Quinones
- C07C50/02—Quinones with monocyclic quinoid structure
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C46/00—Preparation of quinones
- C07C46/02—Preparation of quinones by oxidation giving rise to quinoid structures
- C07C46/06—Preparation of quinones by oxidation giving rise to quinoid structures of at least one hydroxy group on a six-membered aromatic ring
- C07C46/08—Preparation of quinones by oxidation giving rise to quinoid structures of at least one hydroxy group on a six-membered aromatic ring with molecular oxygen
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH722871A CH566280A5 (en) | 1971-05-17 | 1971-05-17 | Methyl-substd quinones prepn - by oxidn of phenols with oxygen in the presence of copper and halide ions |
| CH1843471 | 1971-12-17 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL88994B1 true PL88994B1 (en) | 1976-10-30 |
Family
ID=25700988
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1972155443A PL88994B1 (en) | 1971-05-17 | 1972-05-17 | Process for oxidizing phenols to quinones[us3796732a] |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US3796732A (enExample) |
| JP (1) | JPS5317585B1 (enExample) |
| BE (1) | BE783512A (enExample) |
| CA (1) | CA961498A (enExample) |
| CS (1) | CS161656B2 (enExample) |
| DD (1) | DD98906A5 (enExample) |
| DE (1) | DE2221624C3 (enExample) |
| DK (1) | DK134316B (enExample) |
| FR (1) | FR2138030B1 (enExample) |
| GB (1) | GB1364796A (enExample) |
| HU (1) | HU163555B (enExample) |
| IE (1) | IE36360B1 (enExample) |
| IL (1) | IL39225A (enExample) |
| NL (1) | NL159083B (enExample) |
| PL (1) | PL88994B1 (enExample) |
| RO (1) | RO68938A (enExample) |
| SE (1) | SE396070B (enExample) |
Families Citing this family (30)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA967976A (en) * | 1972-06-27 | 1975-05-20 | Tetuo Miyazaki | Process for producing trimethyl-p-benzoquinone |
| US3870731A (en) * | 1973-09-28 | 1975-03-11 | Goodyear Tire & Rubber | Oxidation of phenols and alkyl substituted phenols to their corresponding para-benzoquinone |
| US3859317A (en) * | 1973-09-28 | 1975-01-07 | Goodyear Tire & Rubber | Process of preparing p-benzoquinone |
| GB1455753A (en) * | 1974-01-08 | 1976-11-17 | Shell Int Research | Process for de preparation of p-quinones |
| US3933681A (en) * | 1974-03-13 | 1976-01-20 | The Goodyear Tire & Rubber Company | Activation of copper salt phenol oxidation catalysts |
| US3987068A (en) * | 1975-07-28 | 1976-10-19 | E. I. Du Pont De Nemours And Company | Oxidation of monohydroxy aryl compounds to 1,4-quinones |
| FR2401896A1 (fr) * | 1977-09-05 | 1979-03-30 | Rhone Poulenc Ind | Procede de preparation de para-benzoquinone |
| FR2449667A1 (fr) * | 1979-02-21 | 1980-09-19 | Rhone Poulenc Ind | Procede de preparation de para-benzoquinones |
| JPS56108733A (en) * | 1980-01-31 | 1981-08-28 | Konishiroku Photo Ind Co Ltd | Preparation of p-and o-benzoquinone derivative and its preparation |
| JPS56140946A (en) * | 1980-03-11 | 1981-11-04 | Hoffmann La Roche | Manufacture of 2,3,5-trimethylbenzoquinone |
| EP0035635B2 (de) * | 1980-03-11 | 1988-04-06 | F. HOFFMANN-LA ROCHE & CO. Aktiengesellschaft | Verfahren zur Herstellung von Trimethylbenzochinon |
| DE3215095A1 (de) * | 1982-04-23 | 1983-10-27 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von 2,3,5-trimethyl-l-p-benzochinon |
| US4522757A (en) * | 1982-10-25 | 1985-06-11 | Sun Tech, Inc. | Process for oxidizing a phenol to a p-benzoquinone |
| US4545937A (en) * | 1983-04-18 | 1985-10-08 | University Of Delaware | Binucleating ligand-metal complexes as oxidation catalysts |
| JPS59225137A (ja) * | 1983-06-06 | 1984-12-18 | Mitsubishi Gas Chem Co Inc | 2,3,5−トリメチルベンゾキノンの製造方法 |
| US4828762A (en) * | 1983-06-06 | 1989-05-09 | Mitsubishi Gas Chemical Company, Inc. | Process for the production of 2,3,5-trimethylbenzoquinone |
| JPS63280040A (ja) * | 1987-05-13 | 1988-11-17 | Eisai Co Ltd | 2,3,5−トリメチルベンゾキノンの製造方法 |
| DE3908768A1 (de) * | 1989-03-17 | 1990-09-20 | Basf Ag | Verfahren zur herstellung von 2,3,5-trimethyl-p-benzochinon |
| US5075462A (en) * | 1990-10-05 | 1991-12-24 | Eastman Kodak Company | Process for the preparation of quinones |
| US5075463A (en) * | 1990-10-05 | 1991-12-24 | Eastman Kodak Company | Preparation of quinones |
| DE19846003A1 (de) * | 1998-10-06 | 2000-04-13 | Basf Ag | Verfahren zur Reinigung und Isolierung von 2,3,5-Trimethyl-p-benzochinon |
| US7045666B2 (en) * | 2003-01-16 | 2006-05-16 | General Electric Company | Bromination of hydroxyaromatic compounds and further conversion to dihydroxyaromatic compounds |
| US6815565B2 (en) * | 2003-04-04 | 2004-11-09 | General Electric Company | Method for preparing hydroquinones and dihydroxybiphenyl compounds from mixtures of bromophenols and benzoquinones |
| US6693221B1 (en) * | 2003-04-04 | 2004-02-17 | General Electric Company | Method of preparing mixtures of bromophenols and benzoquinones |
| CN101781179B (zh) * | 2009-01-20 | 2014-01-29 | 凯惠药业(上海)有限公司 | 一种1,2-萘醌类化合物的制备方法 |
| WO2015000762A1 (de) | 2013-07-02 | 2015-01-08 | Basf Se | Verfahren zur herstellung von 3-heptanol aus einer mischung enthaltend 2-ehthylhexanala und 3-heptylformiat |
| KR20160029021A (ko) | 2013-07-02 | 2016-03-14 | 바스프 에스이 | 2,3,6-트리메틸페놀의 산화에 의한 2,3,5-트리메틸 벤조퀴논의 제조 방법 |
| EA035035B1 (ru) * | 2014-05-09 | 2020-04-20 | ДСМ АйПи АССЕТС Б.В. | Способ получения 2,6-диметилбензохинона |
| WO2021122437A1 (en) | 2019-12-19 | 2021-06-24 | Dsm Ip Assets B.V. | Formation of 2,3,5-trimethylhydroquinone from 2,3,6-trimethylphenol |
| WO2025114165A1 (en) * | 2023-12-01 | 2025-06-05 | Dsm Ip Assets B.V. | Method for producing 2,3,5-trimethyl benzoquinone by oxidation of 2,3,6-trimethyl phenol |
-
1972
- 1972-04-14 IL IL39225A patent/IL39225A/xx unknown
- 1972-04-18 CS CS2615A patent/CS161656B2/cs unknown
- 1972-04-24 NL NL7205525.A patent/NL159083B/xx not_active IP Right Cessation
- 1972-05-03 DE DE2221624A patent/DE2221624C3/de not_active Expired
- 1972-05-08 DD DD162800A patent/DD98906A5/xx unknown
- 1972-05-08 US US00250886A patent/US3796732A/en not_active Expired - Lifetime
- 1972-05-12 IE IE637/72A patent/IE36360B1/xx unknown
- 1972-05-15 SE SE7206333A patent/SE396070B/xx unknown
- 1972-05-16 BE BE783512A patent/BE783512A/xx not_active IP Right Cessation
- 1972-05-16 JP JP4778372A patent/JPS5317585B1/ja active Pending
- 1972-05-16 CA CA142,244A patent/CA961498A/en not_active Expired
- 1972-05-16 DK DK244372AA patent/DK134316B/da not_active IP Right Cessation
- 1972-05-16 HU HUHO1483A patent/HU163555B/hu unknown
- 1972-05-17 FR FR727217643A patent/FR2138030B1/fr not_active Expired
- 1972-05-17 PL PL1972155443A patent/PL88994B1/pl unknown
- 1972-05-17 GB GB2311972A patent/GB1364796A/en not_active Expired
-
1976
- 1976-05-11 RO RO7670857A patent/RO68938A/ro unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FR2138030B1 (enExample) | 1974-07-05 |
| IE36360L (en) | 1972-11-17 |
| DE2221624C3 (de) | 1980-01-17 |
| RO68938A (ro) | 1982-02-01 |
| NL7205525A (enExample) | 1972-11-21 |
| GB1364796A (en) | 1974-08-29 |
| IE36360B1 (en) | 1976-10-13 |
| CS161656B2 (enExample) | 1975-06-10 |
| DE2221624B2 (de) | 1979-05-23 |
| US3796732A (en) | 1974-03-12 |
| DE2221624A1 (de) | 1972-11-30 |
| DK134316B (da) | 1976-10-18 |
| HU163555B (enExample) | 1973-09-27 |
| NL159083B (nl) | 1979-01-15 |
| CA961498A (en) | 1975-01-21 |
| IL39225A (en) | 1975-07-28 |
| SE396070B (sv) | 1977-09-05 |
| DK134316C (enExample) | 1977-03-14 |
| FR2138030A1 (enExample) | 1972-12-29 |
| DD98906A5 (enExample) | 1973-07-12 |
| JPS5317585B1 (enExample) | 1978-06-09 |
| BE783512A (fr) | 1972-11-16 |
| IL39225A0 (en) | 1972-06-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL88994B1 (en) | Process for oxidizing phenols to quinones[us3796732a] | |
| Campbell | Synthesis of thioethers. Amide solvent-promoted nucleophilic displacement of halide by thiolate ion | |
| US3952064A (en) | Process for producing mercaptophenols | |
| EP0015104A1 (en) | Preparation of biphenol by the oxidative coupling of alkylphenols | |
| US3048624A (en) | Stabilization of peracids | |
| DeTar et al. | The Willgerodt Reaction. II. A Study of Reaction Conditions with Acetophenone and Other Ketones1, 2 | |
| GB1579383A (en) | Process for the manufacture of substituted benzaldehydes | |
| EP0233432B1 (fr) | Composés polyfluoroalkylthio-méthyliques, leurs procédés de préparation et leurs applications comme agents tensio-actifs ou précurseurs de ces derniers | |
| US3794668A (en) | Vapor phase oxidation of phenols | |
| EP0076721A1 (en) | Process for the carbonylation of secondary benzyl halides | |
| US3887615A (en) | Novel butanoic acid derivatives | |
| CS209925B2 (en) | Method of producing the arylglyoxyle acids | |
| EP0057047B1 (en) | Process for the preparation of 2-(2,4-dichlorophenoxy) phenylacetic acid | |
| US4486599A (en) | Process for preparing the 2',4'-difluoro-4-hydroxy-(1,1'-diphenyl)-3-carboxylic acid | |
| US4298530A (en) | Process for production of 3-hydroxy-3-methylphthalide or the nuclearly substituted derivatives thereof | |
| US2698329A (en) | Trimethylenedioxybenzene and certain derivatives thereof | |
| US3678081A (en) | Oxidation of hydroxylated aromatic compositions | |
| US4157352A (en) | Process for the manufacture of a cyclopentenedione | |
| US4014898A (en) | N,N-dialkylaminoethoxyethylphthalimidomalonates | |
| EP0100120A1 (en) | Improvement in the process for preparing biaryl compounds via coupling of an arylamine with an arene | |
| US3506724A (en) | Preparation of ortho- and para-nitrophenols | |
| EP0167240B1 (en) | Purification of 4-fluoro-4'-hydroxy-benzophenone | |
| EP0150169B1 (en) | A process for preparing substituted benzotrichloride compounds | |
| US5149849A (en) | Process for the preparation of quinhydrones | |
| US3418361A (en) | Preparation of aromatic hydroxy compounds and their esters |