PL88592B1 - - Google Patents
Download PDFInfo
- Publication number
- PL88592B1 PL88592B1 PL1974168473A PL16847374A PL88592B1 PL 88592 B1 PL88592 B1 PL 88592B1 PL 1974168473 A PL1974168473 A PL 1974168473A PL 16847374 A PL16847374 A PL 16847374A PL 88592 B1 PL88592 B1 PL 88592B1
- Authority
- PL
- Poland
- Prior art keywords
- formula
- compounds
- piperazinyl
- carbon atoms
- acid
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 31
- -1 4-methyl-1-piperazinyl Chemical group 0.000 claims description 27
- 239000002253 acid Substances 0.000 claims description 26
- 125000004432 carbon atom Chemical group C* 0.000 claims description 19
- QOJMQILDLLFGEE-UHFFFAOYSA-N 2-butyl-1,3-thiazole Chemical compound CCCCC1=NC=CS1 QOJMQILDLLFGEE-UHFFFAOYSA-N 0.000 claims description 16
- 150000003839 salts Chemical class 0.000 claims description 15
- 150000002148 esters Chemical class 0.000 claims description 12
- 238000000034 method Methods 0.000 claims description 11
- 239000000203 mixture Substances 0.000 claims description 10
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 8
- 150000001298 alcohols Chemical class 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- QFACSDPLAUCZBD-UHFFFAOYSA-N 4-methylpiperazine-1-carbothioamide Chemical compound CN1CCN(C(N)=S)CC1 QFACSDPLAUCZBD-UHFFFAOYSA-N 0.000 claims description 3
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 150000003585 thioureas Chemical class 0.000 claims description 3
- ULSAJQMHTGKPIY-UHFFFAOYSA-N 1-chloro-3,3-dimethylbutan-2-one Chemical compound CC(C)(C)C(=O)CCl ULSAJQMHTGKPIY-UHFFFAOYSA-N 0.000 claims description 2
- WQFWIVTXNKRNJZ-UHFFFAOYSA-N 2-piperazin-1-yl-1,3-thiazole Chemical class C1CNCCN1C1=NC=CS1 WQFWIVTXNKRNJZ-UHFFFAOYSA-N 0.000 claims description 2
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 101100276976 Drosophila melanogaster Drak gene Proteins 0.000 claims 1
- 125000001589 carboacyl group Chemical group 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 36
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 21
- 239000000243 solution Substances 0.000 description 21
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 18
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 15
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 9
- 238000010992 reflux Methods 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 235000011167 hydrochloric acid Nutrition 0.000 description 7
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- 238000002844 melting Methods 0.000 description 6
- 230000008018 melting Effects 0.000 description 6
- 238000001953 recrystallisation Methods 0.000 description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
- 241001465754 Metazoa Species 0.000 description 5
- 150000007513 acids Chemical class 0.000 description 5
- 125000002252 acyl group Chemical group 0.000 description 5
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 5
- 239000000155 melt Substances 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- SAIRZMWXVJEBMO-UHFFFAOYSA-N 1-bromo-3,3-dimethylbutan-2-one Chemical compound CC(C)(C)C(=O)CBr SAIRZMWXVJEBMO-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 241000700159 Rattus Species 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 150000004678 hydrides Chemical class 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 3
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 2
- FCMSADORJFIRBT-UHFFFAOYSA-N 2-butyl-5-methyl-1,3-thiazole Chemical compound CCCCC1=NC=C(C)S1 FCMSADORJFIRBT-UHFFFAOYSA-N 0.000 description 2
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 2
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 229920002261 Corn starch Polymers 0.000 description 2
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000008120 corn starch Substances 0.000 description 2
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- QZAYGJVTTNCVMB-UHFFFAOYSA-N serotonin Chemical compound C1=C(O)C=C2C(CCN)=CNC2=C1 QZAYGJVTTNCVMB-UHFFFAOYSA-N 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- ODIGIKRIUKFKHP-UHFFFAOYSA-N (n-propan-2-yloxycarbonylanilino) acetate Chemical compound CC(C)OC(=O)N(OC(C)=O)C1=CC=CC=C1 ODIGIKRIUKFKHP-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- WPWHSFAFEBZWBB-UHFFFAOYSA-N 1-butyl radical Chemical compound [CH2]CCC WPWHSFAFEBZWBB-UHFFFAOYSA-N 0.000 description 1
- POMJGYGECRNWEK-UHFFFAOYSA-N 2-(4-methylpiperazin-1-yl)-4-propan-2-yl-1,3-thiazole;dihydrochloride Chemical compound Cl.Cl.CC(C)C1=CSC(N2CCN(C)CC2)=N1 POMJGYGECRNWEK-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- SDFYSFFQVDSUAT-UHFFFAOYSA-N 2-[4-(4-cyclopentyl-1,3-thiazol-2-yl)piperazin-1-yl]ethanol Chemical compound C1CN(CCO)CCN1C1=NC(C2CCCC2)=CS1 SDFYSFFQVDSUAT-UHFFFAOYSA-N 0.000 description 1
- XQRGPXLSPCQVBC-UHFFFAOYSA-N 2-chloro-1-cyclohexylethanone Chemical compound ClCC(=O)C1CCCCC1 XQRGPXLSPCQVBC-UHFFFAOYSA-N 0.000 description 1
- ZKYWWOXZNCTARW-UHFFFAOYSA-N 2-chloro-1-cyclopentylethanone Chemical compound ClCC(=O)C1CCCC1 ZKYWWOXZNCTARW-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical compound [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 description 1
- ZBNQVYYPSOUTOC-UHFFFAOYSA-N 4-benzylpiperazine-1-carbothioamide Chemical compound C1CN(C(=S)N)CCN1CC1=CC=CC=C1 ZBNQVYYPSOUTOC-UHFFFAOYSA-N 0.000 description 1
- AVYQKJMCSGDSRP-UHFFFAOYSA-N 4-cyclohexyl-2-(4-methylpiperazin-1-yl)-1,3-thiazole Chemical compound C1CN(C)CCN1C1=NC(C2CCCCC2)=CS1 AVYQKJMCSGDSRP-UHFFFAOYSA-N 0.000 description 1
- NUYKXHPDFCEPDX-UHFFFAOYSA-N 4-prop-2-enylpiperazine-1-carbothioamide Chemical compound NC(=S)N1CCN(CC=C)CC1 NUYKXHPDFCEPDX-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- 241001428016 Glaucosciadium clade Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 240000006240 Linum usitatissimum Species 0.000 description 1
- 235000004431 Linum usitatissimum Nutrition 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 208000019695 Migraine disease Diseases 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 239000004677 Nylon Substances 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 208000008589 Obesity Diseases 0.000 description 1
- 206010030124 Oedema peripheral Diseases 0.000 description 1
- 206010062519 Poor quality sleep Diseases 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 241000534944 Thia Species 0.000 description 1
- OCBFFGCSTGGPSQ-UHFFFAOYSA-N [CH2]CC Chemical compound [CH2]CC OCBFFGCSTGGPSQ-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 230000003042 antagnostic effect Effects 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- 230000003542 behavioural effect Effects 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 125000000837 carbohydrate group Chemical group 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- VEXZGXHMUGYJMC-IGMARMGPSA-N chlorine-35 Chemical compound [35ClH] VEXZGXHMUGYJMC-IGMARMGPSA-N 0.000 description 1
- 208000012696 congenital leptin deficiency Diseases 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 230000001186 cumulative effect Effects 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- XXTZHYXQVWRADW-UHFFFAOYSA-N diazomethanone Chemical compound [N]N=C=O XXTZHYXQVWRADW-UHFFFAOYSA-N 0.000 description 1
- 125000003963 dichloro group Chemical group Cl* 0.000 description 1
- PXJJSXABGXMUSU-UHFFFAOYSA-N disulfur dichloride Chemical compound ClSSCl PXJJSXABGXMUSU-UHFFFAOYSA-N 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 125000006232 ethoxy propyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- 125000005448 ethoxyethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- QUPDWYMUPZLYJZ-UHFFFAOYSA-N ethyl Chemical compound C[CH2] QUPDWYMUPZLYJZ-UHFFFAOYSA-N 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 230000002934 lysing effect Effects 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- CYEBJEDOHLIWNP-UHFFFAOYSA-N methanethioamide Chemical compound NC=S CYEBJEDOHLIWNP-UHFFFAOYSA-N 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 229910000096 monohydride Inorganic materials 0.000 description 1
- 208000001022 morbid obesity Diseases 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
- 239000002420 orchard Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 125000001148 pentyloxycarbonyl group Chemical group 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 150000004885 piperazines Chemical class 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 125000006233 propoxy propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])OC([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000006225 propoxyethyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- 125000004742 propyloxycarbonyl group Chemical group 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000001603 reducing effect Effects 0.000 description 1
- 229940076279 serotonin Drugs 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- JBJWASZNUJCEKT-UHFFFAOYSA-M sodium;hydroxide;hydrate Chemical compound O.[OH-].[Na+] JBJWASZNUJCEKT-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 230000008925 spontaneous activity Effects 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000001384 succinic acid Substances 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- 229940066771 systemic antihistamines piperazine derivative Drugs 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical class CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 210000004291 uterus Anatomy 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings directly linked by a ring-member-to-ring-member bond
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Thiazole And Isothizaole Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH156373A CH583232A5 (cg-RX-API-DMAC10.html) | 1973-02-02 | 1973-02-02 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL88592B1 true PL88592B1 (cg-RX-API-DMAC10.html) | 1976-09-30 |
Family
ID=4213345
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1974168473A PL88592B1 (cg-RX-API-DMAC10.html) | 1973-02-02 | 1974-01-31 |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US4064244A (cg-RX-API-DMAC10.html) |
| JP (1) | JPS49102682A (cg-RX-API-DMAC10.html) |
| AT (1) | AT348531B (cg-RX-API-DMAC10.html) |
| BE (1) | BE810467A (cg-RX-API-DMAC10.html) |
| CA (1) | CA1018168A (cg-RX-API-DMAC10.html) |
| CH (1) | CH583232A5 (cg-RX-API-DMAC10.html) |
| DD (1) | DD109390A5 (cg-RX-API-DMAC10.html) |
| DE (1) | DE2404050A1 (cg-RX-API-DMAC10.html) |
| ES (3) | ES422886A1 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2215960B1 (cg-RX-API-DMAC10.html) |
| GB (1) | GB1461874A (cg-RX-API-DMAC10.html) |
| HU (1) | HU167399B (cg-RX-API-DMAC10.html) |
| IE (1) | IE40253B1 (cg-RX-API-DMAC10.html) |
| IL (3) | IL44122A (cg-RX-API-DMAC10.html) |
| NL (1) | NL7401253A (cg-RX-API-DMAC10.html) |
| PH (1) | PH13708A (cg-RX-API-DMAC10.html) |
| PL (1) | PL88592B1 (cg-RX-API-DMAC10.html) |
| SE (1) | SE404801B (cg-RX-API-DMAC10.html) |
| SU (1) | SU513624A3 (cg-RX-API-DMAC10.html) |
| ZA (1) | ZA74679B (cg-RX-API-DMAC10.html) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1518559A (en) * | 1976-04-12 | 1978-07-19 | Science Union & Cie | Naphthyl derivatives processes for their preparation an pharmaceutical compositions containing them |
| YU135378A (en) * | 1977-06-10 | 1982-08-31 | Science Union Et Cie Francis D | Process for the manufacture of new piperazine-dithiocarboxylic acid derivatives |
| EP0094498A3 (en) * | 1982-05-06 | 1985-04-03 | American Cyanamid Company | Antiatherosclerotic 1-piperazine derivatives |
| NL8601494A (nl) * | 1985-06-22 | 1987-01-16 | Sandoz Ag | Thiazolen, hun bereiding en farmaceutische preparaten die ze bevatten. |
| IT1191845B (it) * | 1986-01-20 | 1988-03-23 | Dompe Farmaceutici Spa | Alchiloli derivati farmacologicamente attivi |
| FR2612187B1 (fr) * | 1987-03-12 | 1989-07-21 | Sanofi Sa | Derives du thiazole actifs sur le systeme cholinergique, leur procede de preparation et compositions pharmaceutiques en contenant |
| US5232921A (en) * | 1987-03-12 | 1993-08-03 | Sanofi | Thiazole derivatives active on the cholinergic system, process for obtention and pharmaceutical compositions |
| DE4136579A1 (de) * | 1991-11-07 | 1993-05-13 | Rewo Chemische Werke Gmbh | Polyolpolyethersulfosuccinate, verfahren zu ihrer herstelllung und ihre verwendung |
| DE69829875T2 (de) * | 1997-10-14 | 2006-03-09 | Mitsubishi Pharma Corp. | Piperazin-verbindungen und ihre medizinische verwendung |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE485737A (cg-RX-API-DMAC10.html) * | 1947-11-12 | |||
| US2606906A (en) * | 1948-10-14 | 1952-08-12 | American Cyanamid Co | 1-(2-pyridyl) piperazine and process of preparing same |
| NL237878A (cg-RX-API-DMAC10.html) * | 1958-04-07 | |||
| US2975182A (en) * | 1959-11-16 | 1961-03-14 | Paul A J Janssen | 1-(aroylalkyl)-4-(heterocyclyl) piperazines |
| DE1595923A1 (de) * | 1965-02-20 | 1969-11-27 | Merck Ag E | 1-Aralkyl-4-(thiazolyl-2)-piperazine und Verfahren zu ihrer Herstellung |
-
1973
- 1973-02-02 CH CH156373A patent/CH583232A5/xx not_active IP Right Cessation
-
1974
- 1974-01-24 SE SE7400917A patent/SE404801B/xx unknown
- 1974-01-29 DE DE2404050A patent/DE2404050A1/de active Pending
- 1974-01-29 GB GB409074A patent/GB1461874A/en not_active Expired
- 1974-01-30 FR FR7403094A patent/FR2215960B1/fr not_active Expired
- 1974-01-30 NL NL7401253A patent/NL7401253A/xx not_active Application Discontinuation
- 1974-01-31 IL IL44122A patent/IL44122A/en unknown
- 1974-01-31 IL IL50304A patent/IL50304A/en unknown
- 1974-01-31 BE BE140433A patent/BE810467A/xx unknown
- 1974-01-31 DD DD176293A patent/DD109390A5/xx unknown
- 1974-01-31 PL PL1974168473A patent/PL88592B1/pl unknown
- 1974-01-31 CA CA191,436A patent/CA1018168A/en not_active Expired
- 1974-01-31 PH PH15462A patent/PH13708A/en unknown
- 1974-01-31 IE IE187/74A patent/IE40253B1/xx unknown
- 1974-01-31 JP JP49012296A patent/JPS49102682A/ja active Pending
- 1974-02-01 AT AT80674A patent/AT348531B/de not_active IP Right Cessation
- 1974-02-01 ZA ZA00740679A patent/ZA74679B/xx unknown
- 1974-02-01 HU HUWA291A patent/HU167399B/hu unknown
- 1974-02-02 ES ES422886A patent/ES422886A1/es not_active Expired
- 1974-12-12 SU SU2082480A patent/SU513624A3/ru active
-
1975
- 1975-06-18 US US05/588,002 patent/US4064244A/en not_active Expired - Lifetime
-
1976
- 1976-03-16 ES ES446076A patent/ES446076A1/es not_active Expired
- 1976-03-16 ES ES446077A patent/ES446077A1/es not_active Expired
- 1976-08-19 IL IL50304A patent/IL50304A0/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| JPS49102682A (cg-RX-API-DMAC10.html) | 1974-09-27 |
| SU513624A3 (ru) | 1976-05-05 |
| ZA74679B (en) | 1975-09-24 |
| NL7401253A (cg-RX-API-DMAC10.html) | 1974-08-06 |
| DD109390A5 (cg-RX-API-DMAC10.html) | 1974-11-05 |
| ES446077A1 (es) | 1977-10-01 |
| IL44122A0 (en) | 1974-05-16 |
| IL50304A0 (en) | 1976-10-31 |
| AT348531B (de) | 1979-02-26 |
| ATA80674A (de) | 1978-07-15 |
| CA1018168A (en) | 1977-09-27 |
| IE40253L (en) | 1974-08-02 |
| PH13708A (en) | 1980-09-08 |
| IE40253B1 (en) | 1979-04-25 |
| US4064244A (en) | 1977-12-20 |
| IL50304A (en) | 1977-05-31 |
| CH583232A5 (cg-RX-API-DMAC10.html) | 1976-12-31 |
| GB1461874A (en) | 1977-01-19 |
| HU167399B (cg-RX-API-DMAC10.html) | 1975-09-27 |
| FR2215960A1 (cg-RX-API-DMAC10.html) | 1974-08-30 |
| ES422886A1 (es) | 1976-09-16 |
| DE2404050A1 (de) | 1974-08-08 |
| FR2215960B1 (cg-RX-API-DMAC10.html) | 1976-12-03 |
| BE810467A (fr) | 1974-07-31 |
| IL44122A (en) | 1977-05-31 |
| SE404801B (sv) | 1978-10-30 |
| ES446076A1 (es) | 1977-09-01 |
| AU6506574A (en) | 1975-07-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3991057A (en) | C-Piperazino-pyridine sulfonamides | |
| CA1041095A (en) | Benzimidazoles | |
| US3211731A (en) | Pyrazolo-pyrimidines and process for preparing same | |
| JPS607633B2 (ja) | ピリジン誘導体及びその製法 | |
| EP0674627A1 (en) | Pyrimidine, pyridine, pteridinone and indazole derivatives as enzyme inhibitors | |
| JPS6056143B2 (ja) | アミジン誘導体ならびにその製造法 | |
| GB2177395A (en) | Thiazole derivatives | |
| DD283395A5 (de) | Verfahren zur herstellung von tetrahydropyridinen | |
| US3993656A (en) | 1,8-Naphthyridine compounds | |
| PL88592B1 (cg-RX-API-DMAC10.html) | ||
| US3761481A (en) | 11-(4-heterocyclic alkyl substituted-1-piperazinyl) dibenzooxazepines | |
| DE69321254T2 (de) | Quinuclidin derivate als squalene synthase inhibitoren | |
| US3993764A (en) | Treatment of depressive states and Parkinson's disease | |
| DK159969B (da) | Pyridazinderivater, der har psykotropisk virkning, og laegemidler indeholdende dem | |
| CA1082714A (en) | Indazole derivatives | |
| US4363813A (en) | 2-(3,4,5-Trimethoxyphenyl)-4,5-disubstituted thiazoles | |
| RU2259371C2 (ru) | Замещенные 5r1,6r2 1,3,4-тиадиазин-2 амины и содержащие их фармацевтические композиции в качестве фармакологически активных средств, обладающих антикоагулянтным и антиагрегантным действием | |
| EP0039519A1 (de) | Substituierte Thienotricyclen, Verfahren zu ihrer Herstellung und sie enthaltende Arzneimittel | |
| JPS61254591A (ja) | 新規なチエノ(2、3−d)イミダゾ−ル誘導体、その製法、製剤および使用法 | |
| PL123699B1 (en) | Process for preparing novel derivatives of pyran-4-one | |
| US4791115A (en) | 2,6-dimethyl-8α-pivaloylamino-9,10-didehydro-ergoline | |
| US4344946A (en) | 2,6-Diamino-benzo[1,2-d:5,4-d']bisthiazoles and salts thereof | |
| CA1287632C (en) | Quinazolinone compounds and processes for the preparation thereof | |
| US4348403A (en) | 2-Amino-4-(4-benzyloxyphenyl)thiazoles, and their use in hyperlipemia | |
| CS241539B2 (en) | Method of pyridazine's amine derivatives production |