PL86506B1 - - Google Patents
Download PDFInfo
- Publication number
- PL86506B1 PL86506B1 PL1971175330A PL17533071A PL86506B1 PL 86506 B1 PL86506 B1 PL 86506B1 PL 1971175330 A PL1971175330 A PL 1971175330A PL 17533071 A PL17533071 A PL 17533071A PL 86506 B1 PL86506 B1 PL 86506B1
- Authority
- PL
- Poland
- Prior art keywords
- trimethoxy
- pattern
- propyl
- methyl
- quinazolinone
- Prior art date
Links
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 21
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 12
- 229910052757 nitrogen Inorganic materials 0.000 claims description 11
- 238000002360 preparation method Methods 0.000 claims description 9
- 150000001412 amines Chemical class 0.000 claims description 8
- 229910052760 oxygen Inorganic materials 0.000 claims description 7
- 239000001301 oxygen Substances 0.000 claims description 7
- 238000000034 method Methods 0.000 claims description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 4
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 4
- 125000003341 7 membered heterocyclic group Chemical group 0.000 claims description 3
- 125000001931 aliphatic group Chemical group 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 229940070891 pyridium Drugs 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims 1
- 239000013527 degreasing agent Substances 0.000 claims 1
- 125000004434 sulfur atom Chemical group 0.000 claims 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 24
- -1 alkyl radical Chemical class 0.000 description 22
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 18
- 239000000243 solution Substances 0.000 description 7
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 6
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 5
- 239000008280 blood Substances 0.000 description 5
- 210000004369 blood Anatomy 0.000 description 5
- 239000011591 potassium Substances 0.000 description 5
- 229910052700 potassium Inorganic materials 0.000 description 5
- 210000003462 vein Anatomy 0.000 description 5
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 238000000354 decomposition reaction Methods 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- 238000005259 measurement Methods 0.000 description 4
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 238000006467 substitution reaction Methods 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- WEYVCQFUGFRXOM-UHFFFAOYSA-N perazine Chemical compound C1CN(C)CCN1CCCN1C2=CC=CC=C2SC2=CC=CC=C21 WEYVCQFUGFRXOM-UHFFFAOYSA-N 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- AVRPFRMDMNDIDH-UHFFFAOYSA-N 1h-quinazolin-2-one Chemical class C1=CC=CC2=NC(O)=NC=C21 AVRPFRMDMNDIDH-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 210000001367 artery Anatomy 0.000 description 2
- 125000001231 benzoyloxy group Chemical group C(C1=CC=CC=C1)(=O)O* 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 150000004985 diamines Chemical class 0.000 description 2
- 239000007884 disintegrant Substances 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 150000003840 hydrochlorides Chemical class 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- 229920000137 polyphosphoric acid Polymers 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- 230000000304 vasodilatating effect Effects 0.000 description 2
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 1
- AFSFDBMQFFAZQR-UHFFFAOYSA-N 1-amino-3-(diethylamino)propan-1-ol Chemical compound CCN(CC)CCC(N)O AFSFDBMQFFAZQR-UHFFFAOYSA-N 0.000 description 1
- LJDSTRZHPWMDPG-UHFFFAOYSA-N 2-(butylamino)ethanol Chemical compound CCCCNCCO LJDSTRZHPWMDPG-UHFFFAOYSA-N 0.000 description 1
- RILLZYSZSDGYGV-UHFFFAOYSA-N 2-(propan-2-ylamino)ethanol Chemical compound CC(C)NCCO RILLZYSZSDGYGV-UHFFFAOYSA-N 0.000 description 1
- VBTJLUHQGXNGAO-UHFFFAOYSA-N 2-methoxy-1h-quinazolin-4-one Chemical compound C1=CC=C2NC(OC)=NC(=O)C2=C1 VBTJLUHQGXNGAO-UHFFFAOYSA-N 0.000 description 1
- KRGXWTOLFOPIKV-UHFFFAOYSA-N 3-(methylamino)propan-1-ol Chemical compound CNCCCO KRGXWTOLFOPIKV-UHFFFAOYSA-N 0.000 description 1
- RSOVYHJBOYUBKJ-UHFFFAOYSA-N 3-ethoxy-n-methylpropan-1-amine Chemical compound CCOCCCNC RSOVYHJBOYUBKJ-UHFFFAOYSA-N 0.000 description 1
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 1
- 206010002091 Anaesthesia Diseases 0.000 description 1
- GZLYSDJGEXGQDO-UHFFFAOYSA-N C1=CC=CC2=NCNC=C21 Chemical compound C1=CC=CC2=NCNC=C21 GZLYSDJGEXGQDO-UHFFFAOYSA-N 0.000 description 1
- 101100042016 Caenorhabditis elegans npp-20 gene Proteins 0.000 description 1
- 240000006890 Erythroxylum coca Species 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- XTUVJUMINZSXGF-UHFFFAOYSA-N N-methylcyclohexylamine Chemical compound CNC1CCCCC1 XTUVJUMINZSXGF-UHFFFAOYSA-N 0.000 description 1
- PAMIQIKDUOTOBW-UHFFFAOYSA-N N-methylcyclohexylamine Natural products CN1CCCCC1 PAMIQIKDUOTOBW-UHFFFAOYSA-N 0.000 description 1
- OPKOKAMJFNKNAS-UHFFFAOYSA-N N-methylethanolamine Chemical compound CNCCO OPKOKAMJFNKNAS-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 125000005078 alkoxycarbonylalkyl group Chemical group 0.000 description 1
- 125000005263 alkylenediamine group Chemical group 0.000 description 1
- 230000037005 anaesthesia Effects 0.000 description 1
- 230000004872 arterial blood pressure Effects 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 235000008957 cocaer Nutrition 0.000 description 1
- ZPUCINDJVBIVPJ-LJISPDSOSA-N cocaine Chemical compound O([C@H]1C[C@@H]2CC[C@@H](N2C)[C@H]1C(=O)OC)C(=O)C1=CC=CC=C1 ZPUCINDJVBIVPJ-LJISPDSOSA-N 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 208000029078 coronary artery disease Diseases 0.000 description 1
- 210000004351 coronary vessel Anatomy 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000005265 dialkylamine group Chemical group 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 150000002431 hydrogen Chemical group 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- MKDYQLJYEBWUIG-UHFFFAOYSA-N n',n'-diethyl-n-methylethane-1,2-diamine Chemical compound CCN(CC)CCNC MKDYQLJYEBWUIG-UHFFFAOYSA-N 0.000 description 1
- FMHTZXCLFALLKX-UHFFFAOYSA-N n-methoxy-n-methylpropan-1-amine Chemical compound CCCN(C)OC FMHTZXCLFALLKX-UHFFFAOYSA-N 0.000 description 1
- VEBLEROFGPOMPB-UHFFFAOYSA-N n-methylcyclopropanamine Chemical compound CNC1CC1 VEBLEROFGPOMPB-UHFFFAOYSA-N 0.000 description 1
- SASNBVQSOZSTPD-UHFFFAOYSA-N n-methylphenethylamine Chemical compound CNCCC1=CC=CC=C1 SASNBVQSOZSTPD-UHFFFAOYSA-N 0.000 description 1
- IOXXVNYDGIXMIP-UHFFFAOYSA-N n-methylprop-2-en-1-amine Chemical compound CNCC=C IOXXVNYDGIXMIP-UHFFFAOYSA-N 0.000 description 1
- 101150032584 oxy-4 gene Proteins 0.000 description 1
- 229960002195 perazine Drugs 0.000 description 1
- YZTJYBJCZXZGCT-UHFFFAOYSA-N phenylpiperazine Chemical compound C1CNCCN1C1=CC=CC=C1 YZTJYBJCZXZGCT-UHFFFAOYSA-N 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 230000029058 respiratory gaseous exchange Effects 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- BRNULMACUQOKMR-UHFFFAOYSA-N thiomorpholine Chemical compound C1CSCCN1 BRNULMACUQOKMR-UHFFFAOYSA-N 0.000 description 1
- GSQBIOQCECCMOQ-UHFFFAOYSA-N β-alanine ethyl ester Chemical compound CCOC(=O)CCN GSQBIOQCECCMOQ-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/70—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings condensed with carbocyclic rings or ring systems
- C07D239/72—Quinazolines; Hydrogenated quinazolines
- C07D239/86—Quinazolines; Hydrogenated quinazolines with hetero atoms directly attached in position 4
- C07D239/88—Oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Plural Heterocyclic Compounds (AREA)
- Quinoline Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19702020233 DE2020233A1 (de) | 1970-04-25 | 1970-04-25 | Basisch substituierte Derivate des 4(3H)-Chinazolinons |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL86506B1 true PL86506B1 (en:Method) | 1976-06-30 |
Family
ID=5769323
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1971175330A PL86506B1 (en:Method) | 1970-04-25 | 1971-04-24 |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3738985A (en:Method) |
| AT (2) | AT306030B (en:Method) |
| BE (1) | BE766241A (en:Method) |
| CA (1) | CA933924A (en:Method) |
| CH (2) | CH556848A (en:Method) |
| DE (1) | DE2020233A1 (en:Method) |
| FR (1) | FR2092091B1 (en:Method) |
| GB (1) | GB1312392A (en:Method) |
| NL (1) | NL7105068A (en:Method) |
| PL (1) | PL86506B1 (en:Method) |
| RO (1) | RO63328A (en:Method) |
| SU (2) | SU403181A3 (en:Method) |
| ZA (1) | ZA712630B (en:Method) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2050640A1 (de) * | 1970-10-15 | 1972-04-20 | Cassella Farbwerke Mainkur Ag, 6000 Frankfurt | Basisch substituierte Derivate des (lH,3H)-Chinazolin-2-thion-4-ons |
| US7064721B2 (en) | 2003-06-27 | 2006-06-20 | Delphi Technologies, Inc. | Mobile satellite radio antenna system |
| US20100132094A1 (en) * | 2008-12-01 | 2010-06-03 | Mullen Michael L | Removable liner system for headgear |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3322766A (en) * | 1964-11-13 | 1967-05-30 | Shulton Inc | 3-beta-(4-pyridyl) ethyl-2, 3-dihydro-4(1h)-quinazolinones |
-
1970
- 1970-04-25 DE DE19702020233 patent/DE2020233A1/de active Pending
-
1971
- 1971-04-15 NL NL7105068A patent/NL7105068A/xx unknown
- 1971-04-22 US US00136560A patent/US3738985A/en not_active Expired - Lifetime
- 1971-04-22 RO RO7100066654A patent/RO63328A/ro unknown
- 1971-04-23 GB GB1117771*[A patent/GB1312392A/en not_active Expired
- 1971-04-23 CH CH596571A patent/CH556848A/xx not_active IP Right Cessation
- 1971-04-23 CA CA111159A patent/CA933924A/en not_active Expired
- 1971-04-23 FR FR7114533A patent/FR2092091B1/fr not_active Expired
- 1971-04-23 AT AT352271A patent/AT306030B/de not_active IP Right Cessation
- 1971-04-23 SU SU1648742A patent/SU403181A3/ru active
- 1971-04-23 ZA ZA712630A patent/ZA712630B/xx unknown
- 1971-04-23 CH CH596671A patent/CH556849A/xx not_active IP Right Cessation
- 1971-04-23 SU SU1651516A patent/SU422157A3/ru active
- 1971-04-23 AT AT352371A patent/AT306031B/de not_active IP Right Cessation
- 1971-04-23 BE BE766241A patent/BE766241A/xx unknown
- 1971-04-24 PL PL1971175330A patent/PL86506B1/pl unknown
Also Published As
| Publication number | Publication date |
|---|---|
| GB1312392A (en) | 1973-04-04 |
| NL7105068A (en:Method) | 1971-10-27 |
| CH556848A (de) | 1974-12-13 |
| US3738985A (en) | 1973-06-12 |
| FR2092091A1 (en:Method) | 1972-01-21 |
| RO63328A (fr) | 1978-09-15 |
| ZA712630B (en) | 1972-01-26 |
| SU422157A3 (ru) | 1974-03-30 |
| SU403181A3 (en:Method) | 1973-10-19 |
| AT306030B (de) | 1973-03-26 |
| CH556849A (de) | 1974-12-13 |
| BE766241A (fr) | 1971-10-25 |
| CA933924A (en) | 1973-09-18 |
| FR2092091B1 (en:Method) | 1974-08-23 |
| DE2020233A1 (de) | 1971-11-18 |
| AT306031B (de) | 1973-03-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3594480A (en) | Nitrogen heterocycles for therapeutic administration | |
| US3282938A (en) | 3-tertiary aminoloweralkyl-4-lower alkyl or phenyl-7-lower carbalkoxy lower alkyl or carboxy lower alkyl coumarins | |
| JPS5927875A (ja) | 新規なイミダゾ−ル誘導体 | |
| Ellis et al. | Benzopyrones. 14. Synthesis and anti-allergic properties of some N-tetrazolylcarboxamides and related compounds | |
| NO151287B (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive 9-hydrazono-6,7,8,9-tetrahydro-4h-pyrido(1,2-a)-pyrimidinderivater | |
| Topliss et al. | Antihypertensive agents. I. Non-diuretic 2H-1, 2, 4-benzothiadiazine 1, 1-dioxides | |
| US4282222A (en) | 3-Piperidino or apiperazino-1-phenyl or 1-substituted phenyl isoquinoline and antidepressant compositions thereof | |
| US3538086A (en) | 4-oxo-4h-pyrimido 2,1-b benzothiazoles | |
| NO169965B (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive 5-substituerte (4,5-c)imidazopyridiner | |
| US3954748A (en) | 3-Alkoxy-thianapthene-2-carboxamides | |
| PL86506B1 (en:Method) | ||
| HU199124B (en) | Process for producing benzazepine sulfonamides and antiarrhythmic agents comprising these compounds | |
| NO139386B (no) | Analogifremgangsmaate for fremstilling av farmakologisk aktive imidazopyridiner | |
| JPH0643404B2 (ja) | ベンズイミダゾール―2―スルホンアミド、イミダゾピリジン―2―スルホンアミド誘導体およびその製法 | |
| US4171361A (en) | 1-Substituted-3-amino-6,7-dialkoxy-1H-1,2,4-benzothiadiazine-1-oxides | |
| GB2050353A (en) | Substituted pyrido(1,2-a) pyrimidines | |
| BG63336B1 (bg) | Нови производни на хидроксамови киселини, фармацевтични състави на тяхна основа и метод за получаването им | |
| US4500714A (en) | 3-Substituted-ureido-N-pyridyl benzamides | |
| FI64371C (fi) | Foerfarande foer framstaellning av kardiovaskulaera 5h,7h-imidazo(4,5-h)-isokinolin-4,6-dioner | |
| US4714700A (en) | N-substituted 2,4-dialkoxy benzenesulfonamides and pharmaceutical compositions | |
| US3845052A (en) | Basically substituted 1(2h)-phthalazinone derivatives | |
| US3318882A (en) | 2-amino-5-diloweralkyl sulfamoyl-n, n-disubstituted benzamides | |
| Tatarczyñska et al. | Synthesis, 5-HT1A and 5-HT2A receptor activity of new 1-phenylpiperazinylpropyl derivatives with arylalkyl substituents in position 7 of purine-2, 6-dione | |
| US3316249A (en) | Part a.xmethyl n n-(z-diethylaminoethyl)-n-(z- nitrophenyl) anthranilate hydrochloride | |
| PL84236B1 (en:Method) |