PL85609B1 - - Google Patents
Download PDFInfo
- Publication number
- PL85609B1 PL85609B1 PL1970162138A PL16213870A PL85609B1 PL 85609 B1 PL85609 B1 PL 85609B1 PL 1970162138 A PL1970162138 A PL 1970162138A PL 16213870 A PL16213870 A PL 16213870A PL 85609 B1 PL85609 B1 PL 85609B1
- Authority
- PL
- Poland
- Prior art keywords
- radical
- formula
- general formula
- group
- oxidizing agent
- Prior art date
Links
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 15
- -1 monoazo compound Chemical class 0.000 claims description 14
- 238000000034 method Methods 0.000 claims description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 6
- 239000007800 oxidant agent Substances 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 150000001879 copper Chemical class 0.000 claims description 5
- 150000001875 compounds Chemical class 0.000 claims description 4
- UFWIBTONFRDIAS-UHFFFAOYSA-N naphthalene-acid Natural products C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 claims description 4
- 239000003054 catalyst Substances 0.000 claims description 3
- 238000006243 chemical reaction Methods 0.000 claims description 3
- 125000001624 naphthyl group Chemical group 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 claims description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 claims description 2
- 229910006069 SO3H Inorganic materials 0.000 claims description 2
- 150000004973 alkali metal peroxides Chemical class 0.000 claims description 2
- IFVTZJHWGZSXFD-UHFFFAOYSA-N biphenylene Chemical group C1=CC=C2C3=CC=CC=C3C2=C1 IFVTZJHWGZSXFD-UHFFFAOYSA-N 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 239000000203 mixture Substances 0.000 claims description 2
- 239000000985 reactive dye Substances 0.000 claims description 2
- 125000001931 aliphatic group Chemical group 0.000 claims 1
- 229910052799 carbon Inorganic materials 0.000 claims 1
- 150000001451 organic peroxides Chemical class 0.000 claims 1
- 229920006395 saturated elastomer Polymers 0.000 claims 1
- 239000002253 acid Substances 0.000 description 7
- 239000000975 dye Substances 0.000 description 7
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- 150000003254 radicals Chemical class 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 238000004043 dyeing Methods 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- NNBZCPXTIHJBJL-UHFFFAOYSA-N decalin Chemical compound C1CCCC2CCCCC21 NNBZCPXTIHJBJL-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 1
- SXZKTOHJUQZUJI-UHFFFAOYSA-L NC1=C(C=C(C(=C1)S(=O)(=O)[O-])N)S(=O)(=O)[O-].[Na+].[Na+] Chemical compound NC1=C(C=C(C(=C1)S(=O)(=O)[O-])N)S(=O)(=O)[O-].[Na+].[Na+] SXZKTOHJUQZUJI-UHFFFAOYSA-L 0.000 description 1
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 1
- 239000004115 Sodium Silicate Substances 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- JZCCFEFSEZPSOG-UHFFFAOYSA-L copper(II) sulfate pentahydrate Chemical compound O.O.O.O.O.[Cu+2].[O-]S([O-])(=O)=O JZCCFEFSEZPSOG-UHFFFAOYSA-L 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 description 1
- 239000012954 diazonium Substances 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical compound [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 description 1
- ICIDZHMCYAIUIJ-UHFFFAOYSA-N dinaphthalen-1-yldiazene Chemical compound C1=CC=C2C(N=NC=3C4=CC=CC=C4C=CC=3)=CC=CC2=C1 ICIDZHMCYAIUIJ-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 description 1
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 150000004967 organic peroxy acids Chemical class 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 238000005185 salting out Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 229910052911 sodium silicate Inorganic materials 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000001174 sulfone group Chemical group 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B62/00—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves
- C09B62/02—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group directly attached to a heterocyclic ring
- C09B62/04—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group directly attached to a heterocyclic ring to a triazine ring
- C09B62/043—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group directly attached to a heterocyclic ring to a triazine ring containing two or more triazine rings linked together by a non-chromophoric link
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB2663/69A GB1272291A (en) | 1969-01-16 | 1969-01-16 | New reactive metallised disazo dyestuffs |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL85609B1 true PL85609B1 (esLanguage) | 1976-04-30 |
Family
ID=9743574
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1970162138A PL85609B1 (esLanguage) | 1969-01-16 | 1970-01-07 | |
| PL1970138033A PL80427B1 (esLanguage) | 1969-01-16 | 1970-01-07 |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1970138033A PL80427B1 (esLanguage) | 1969-01-16 | 1970-01-07 |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3646002A (esLanguage) |
| BR (1) | BR7016030D0 (esLanguage) |
| CH (3) | CH559237A5 (esLanguage) |
| ES (1) | ES375489A1 (esLanguage) |
| FR (1) | FR2028478A1 (esLanguage) |
| GB (1) | GB1272291A (esLanguage) |
| NL (1) | NL7000383A (esLanguage) |
| PL (2) | PL85609B1 (esLanguage) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3936436A (en) * | 1969-12-22 | 1976-02-03 | Imperial Chemical Industries Limited | Water-soluble azo dyestuffs containing triazine and 3-azo-2,6-dihydroxypyrid-6-one radicals |
| JPS5011414B1 (esLanguage) * | 1970-08-31 | 1975-05-01 | ||
| US4148790A (en) * | 1973-05-24 | 1979-04-10 | Sumitomo Chemical Company Limited | Metallized triazine reactive dyes |
| US3966705A (en) * | 1974-01-04 | 1976-06-29 | Ciba-Geigy Corporation | Disulfo naphthalene containing fiber-reactive tetrazo dyes |
| DE2600164A1 (de) * | 1975-01-08 | 1976-07-15 | Ciba Geigy Ag | Faserreaktive disazofarbstoffe, deren herstellung und verwendung |
| CH606347A5 (esLanguage) * | 1975-01-15 | 1978-10-31 | Ciba Geigy Ag | |
| DE2748975A1 (de) * | 1977-11-02 | 1979-05-03 | Hoechst Ag | Wasserloesliche farbstoffe, verfahren zu ihrer herstellung, deren verwendung als faserreaktive farbstoffe zum faerben und bedrucken von fasermaterialien und die mit ihnen gefaerbten fasermaterialien |
| DE3043915A1 (de) * | 1979-12-06 | 1981-06-11 | Sandoz-Patent-GmbH, 7850 Lörrach | Halo-triazinyl verbindungen |
| US5395925A (en) * | 1980-10-07 | 1995-03-07 | Sandoz Ltd. | Asymmetric sulfo group-containing disazo compounds containing two 6-halo-1,3,5-triazinyl groups |
| GB2182669B (en) * | 1985-11-07 | 1990-06-20 | Sandoz Ltd | Metallised disazo compounds |
| US5196033A (en) * | 1986-08-15 | 1993-03-23 | Imperial Chemical Industries Plc | BIS-azotriazinyl reactive dyes having an N-alkyl-phenylenediamine link for cellulose textiles |
| GB8619914D0 (en) * | 1986-08-15 | 1986-09-24 | Ici Plc | Reactive dyes |
| EP0584045B1 (de) * | 1992-08-19 | 2000-03-01 | Ciba SC Holding AG | Faserreaktive Farbstoffe, deren Herstellung und Verwendung |
| GB9608488D0 (en) * | 1996-04-25 | 1996-07-03 | Zeneca Ltd | Compositions, processes and uses |
| WO2000046309A1 (en) * | 1999-02-05 | 2000-08-10 | Ciba Specialty Chemicals Holding Inc. | Black-dyeing inks and their use |
| CN106854382A (zh) * | 2017-01-03 | 2017-06-16 | 上海安诺其集团股份有限公司 | 一种偶氮类化合物及其应用 |
-
1969
- 1969-01-16 GB GB2663/69A patent/GB1272291A/en not_active Expired
-
1970
- 1970-01-07 PL PL1970162138A patent/PL85609B1/pl unknown
- 1970-01-07 PL PL1970138033A patent/PL80427B1/pl unknown
- 1970-01-12 NL NL7000383A patent/NL7000383A/xx unknown
- 1970-01-12 US US2389A patent/US3646002A/en not_active Expired - Lifetime
- 1970-01-14 BR BR216030/70A patent/BR7016030D0/pt unknown
- 1970-01-16 CH CH1467673A patent/CH559237A5/xx not_active IP Right Cessation
- 1970-01-16 CH CH63170A patent/CH561262A5/xx not_active IP Right Cessation
- 1970-01-16 FR FR7001653A patent/FR2028478A1/fr not_active Withdrawn
- 1970-01-16 ES ES375489A patent/ES375489A1/es not_active Expired
- 1970-01-16 CH CH1767771A patent/CH569769A5/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| PL80427B1 (esLanguage) | 1975-08-30 |
| DE2001961A1 (de) | 1970-07-30 |
| GB1272291A (en) | 1972-04-26 |
| CH569769A5 (esLanguage) | 1975-11-28 |
| CH559237A5 (esLanguage) | 1975-02-28 |
| US3646002A (en) | 1972-02-29 |
| ES375489A1 (es) | 1972-05-16 |
| DE2001961B2 (de) | 1976-03-11 |
| BR7016030D0 (pt) | 1973-04-19 |
| FR2028478A1 (esLanguage) | 1970-10-09 |
| CH561262A5 (esLanguage) | 1975-04-30 |
| NL7000383A (esLanguage) | 1970-07-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL85609B1 (esLanguage) | ||
| CH660016A5 (de) | Reaktivfarbstoffe und deren herstellung. | |
| DE2614550B2 (de) | Neue Reaktivfarbstoffe, ihre Herstellung und Verwendung zum Färben und Bedrucken von Cellulose sowie natürlichen und synthetischen Polyamidsubstraten | |
| GB2076006A (en) | Reactive disazo compounds | |
| US3433781A (en) | 2,4-dihalogeno-pyrimidine-5-carbamyl-substituted reactive dyes | |
| EP0365486A2 (en) | Fibre-reactive azo dyes | |
| WO1996002593A1 (en) | Reactive monoazo dyestuffs | |
| US3226176A (en) | Cellulose, wool, silk and leather fibers fast-dyed with chlorotriazine containing reactive dyestuffs | |
| US3234205A (en) | Metal complex compounds of monoazo-dyestuffs | |
| JP2747500B2 (ja) | 繊維反応性フタロシアニン染料 | |
| US3345122A (en) | Process for preparing dyeings and prints fast to wetting on cellulosic materials | |
| US3406163A (en) | Water-soluble monoazo pyrazolone dyestuffs | |
| US2951070A (en) | Monoazo dyestuffs | |
| US2951071A (en) | New monoazo dyestuffs | |
| KR20020070430A (ko) | 아조 염료 | |
| GB2271776A (en) | Fibre-reactive azo dyestuffs | |
| EP0343262B1 (en) | Fibre-reactive azo dyes, process for their preparation and their use for dyeing hydroxy- and/or carboxamide groups containing fibre-material | |
| US4035351A (en) | Water-soluble monoazo dyestuff containing a phenylene diazo component | |
| US4129736A (en) | Triazinyl-antraquinone dyestuffs | |
| CS235960B2 (en) | Method of water-soluble monoazocompounds production | |
| US3380989A (en) | Copper-containing dis-, tris- and tetrakisazo dyestuffs of resorcin with beta-oxyethylsulfone-sulfuric acid ester groups | |
| US3035043A (en) | Water-soluble azo dyestuffs containing reactive groups | |
| KR100391859B1 (ko) | 신규한디스아조염료 | |
| US3125564A (en) | Table | |
| US3351578A (en) | Monoazo dyestuffs having a monochlorotriazine ring carrying a sulfoanthranilic acid amino substituent |