PL83238B1 - Derivatives of dibenzo(b,f) pyrrolo (3,4-d)azepine as cns - depressants[us3783161a] - Google Patents
Derivatives of dibenzo(b,f) pyrrolo (3,4-d)azepine as cns - depressants[us3783161a] Download PDFInfo
- Publication number
- PL83238B1 PL83238B1 PL1971148114A PL14811471A PL83238B1 PL 83238 B1 PL83238 B1 PL 83238B1 PL 1971148114 A PL1971148114 A PL 1971148114A PL 14811471 A PL14811471 A PL 14811471A PL 83238 B1 PL83238 B1 PL 83238B1
- Authority
- PL
- Poland
- Prior art keywords
- solution
- hydrogen
- azepine
- chloro
- dissolved
- Prior art date
Links
- UZVGSSNIUNSOFA-UHFFFAOYSA-N dibenzofuran-1-carboxylic acid Chemical class O1C2=CC=CC=C2C2=C1C=CC=C2C(=O)O UZVGSSNIUNSOFA-UHFFFAOYSA-N 0.000 title description 9
- QPPXNMSORVYMTG-UHFFFAOYSA-N pyrrolo[3,4-d]azepine Chemical compound C1=NC=C2C1=CC=NC=C2 QPPXNMSORVYMTG-UHFFFAOYSA-N 0.000 title description 6
- 239000003874 central nervous system depressant Substances 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims abstract description 51
- 150000003839 salts Chemical class 0.000 claims abstract description 22
- 229910052801 chlorine Inorganic materials 0.000 claims abstract description 6
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 5
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims abstract description 5
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims abstract description 3
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 12
- 239000001257 hydrogen Substances 0.000 claims description 10
- 229910052739 hydrogen Inorganic materials 0.000 claims description 10
- 150000001538 azepines Chemical class 0.000 claims description 8
- 238000000034 method Methods 0.000 claims description 7
- 238000002360 preparation method Methods 0.000 claims description 6
- 239000007795 chemical reaction product Substances 0.000 claims description 5
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 5
- 150000007522 mineralic acids Chemical class 0.000 claims description 5
- 150000007524 organic acids Chemical class 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 150000001412 amines Chemical class 0.000 claims description 2
- 235000005985 organic acids Nutrition 0.000 claims description 2
- -1 N-substituted 10,11-bis-bromomethyl-5H-dibenz[b,f]azepines Chemical class 0.000 abstract description 14
- 239000004480 active ingredient Substances 0.000 abstract description 3
- 230000000694 effects Effects 0.000 abstract description 2
- NZGMDXBJKQZVRQ-UHFFFAOYSA-N 4,13-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),7,9,11,14,16-heptaene Chemical class C12=CC=CC=C2NC2=CC=CC=C2C2=C1CNC2 NZGMDXBJKQZVRQ-UHFFFAOYSA-N 0.000 abstract 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 abstract 1
- 210000003169 central nervous system Anatomy 0.000 abstract 1
- 239000000460 chlorine Substances 0.000 abstract 1
- 230000000994 depressogenic effect Effects 0.000 abstract 1
- 239000008194 pharmaceutical composition Substances 0.000 abstract 1
- 125000002924 primary amino group Chemical class [H]N([H])* 0.000 abstract 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 93
- 239000000243 solution Substances 0.000 description 75
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 55
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 54
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 52
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 46
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 39
- 239000000203 mixture Substances 0.000 description 31
- KWYUFKZDYYNOTN-UHFFFAOYSA-M potassium hydroxide Inorganic materials [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 28
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 25
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 21
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 18
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 18
- 239000002585 base Substances 0.000 description 18
- 239000013078 crystal Substances 0.000 description 18
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 16
- 239000000706 filtrate Substances 0.000 description 16
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 14
- 238000003756 stirring Methods 0.000 description 13
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 12
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 12
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 12
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 11
- 239000002253 acid Substances 0.000 description 11
- 239000000284 extract Substances 0.000 description 11
- 229940088623 biologically active substance Drugs 0.000 description 10
- 238000001816 cooling Methods 0.000 description 10
- 239000011541 reaction mixture Substances 0.000 description 10
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- 239000000741 silica gel Substances 0.000 description 9
- 229910002027 silica gel Inorganic materials 0.000 description 9
- 239000000725 suspension Substances 0.000 description 9
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 8
- 239000002775 capsule Substances 0.000 description 8
- 238000010992 reflux Methods 0.000 description 8
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 7
- XYOVOXDWRFGKEX-UHFFFAOYSA-N azepine Chemical compound N1C=CC=CC=C1 XYOVOXDWRFGKEX-UHFFFAOYSA-N 0.000 description 7
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Substances [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 7
- 229910052757 nitrogen Inorganic materials 0.000 description 7
- 239000000126 substance Substances 0.000 description 7
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 6
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 6
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 229920000159 gelatin Polymers 0.000 description 6
- 235000019322 gelatine Nutrition 0.000 description 6
- 229910052700 potassium Inorganic materials 0.000 description 6
- 239000011591 potassium Substances 0.000 description 6
- 229910000027 potassium carbonate Inorganic materials 0.000 description 6
- 239000000829 suppository Substances 0.000 description 6
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 5
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 5
- 239000012043 crude product Substances 0.000 description 5
- 239000008298 dragée Substances 0.000 description 5
- 150000002576 ketones Chemical class 0.000 description 5
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 5
- 235000019341 magnesium sulphate Nutrition 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 239000000454 talc Substances 0.000 description 5
- 235000012222 talc Nutrition 0.000 description 5
- 229910052623 talc Inorganic materials 0.000 description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 4
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 4
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 4
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 4
- 239000003814 drug Substances 0.000 description 4
- 239000012259 ether extract Substances 0.000 description 4
- 239000006260 foam Substances 0.000 description 4
- 239000008101 lactose Substances 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 235000019359 magnesium stearate Nutrition 0.000 description 4
- 239000012299 nitrogen atmosphere Substances 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- 229920001223 polyethylene glycol Polymers 0.000 description 4
- 229920001592 potato starch Polymers 0.000 description 4
- 239000012279 sodium borohydride Substances 0.000 description 4
- 229910000033 sodium borohydride Inorganic materials 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- KZNICNPSHKQLFF-UHFFFAOYSA-N succinimide Chemical compound O=C1CCC(=O)N1 KZNICNPSHKQLFF-UHFFFAOYSA-N 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- 229920002261 Corn starch Polymers 0.000 description 3
- 108010010803 Gelatin Proteins 0.000 description 3
- 239000001828 Gelatine Substances 0.000 description 3
- 239000008346 aqueous phase Substances 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 239000008120 corn starch Substances 0.000 description 3
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 3
- 229940079593 drug Drugs 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 239000008273 gelatin Substances 0.000 description 3
- 235000011852 gelatine desserts Nutrition 0.000 description 3
- 239000008187 granular material Substances 0.000 description 3
- 229930195733 hydrocarbon Natural products 0.000 description 3
- 150000002430 hydrocarbons Chemical class 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- MHAJPDPJQMAIIY-UHFFFAOYSA-M hydroperoxide group Chemical group [O-]O MHAJPDPJQMAIIY-UHFFFAOYSA-M 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- 239000003381 stabilizer Substances 0.000 description 3
- 239000003826 tablet Substances 0.000 description 3
- LMDYEJQCBCEBQI-UHFFFAOYSA-N 1-(3-chloro-5,6-dimethylbenzo[b][1]benzazepin-11-yl)ethanone Chemical compound ClC1=CC2=C(N(C3=C(C(=C2C)C)C=CC=C3)C(C)=O)C=C1 LMDYEJQCBCEBQI-UHFFFAOYSA-N 0.000 description 2
- BWHNDUOBIWFYLY-UHFFFAOYSA-N 2-chloro-9-methylacridine Chemical compound C1=C(Cl)C=C2C(C)=C(C=CC=C3)C3=NC2=C1 BWHNDUOBIWFYLY-UHFFFAOYSA-N 0.000 description 2
- HHUULMYBIYRINT-UHFFFAOYSA-N 3-chloro-9-methylacridine Chemical compound ClC1=CC=C2C(C)=C(C=CC=C3)C3=NC2=C1 HHUULMYBIYRINT-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- SPMLLTAMNKATCF-UHFFFAOYSA-N CC(=O)C1(C2=CC=CC=C2NC=2C=CC(=CC12)Cl)C Chemical compound CC(=O)C1(C2=CC=CC=C2NC=2C=CC(=CC12)Cl)C SPMLLTAMNKATCF-UHFFFAOYSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 235000021355 Stearic acid Nutrition 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 2
- 235000010489 acacia gum Nutrition 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 239000003463 adsorbent Substances 0.000 description 2
- 230000001476 alcoholic effect Effects 0.000 description 2
- 239000003708 ampul Substances 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000008119 colloidal silica Substances 0.000 description 2
- PNZDZRMOBIIQTC-UHFFFAOYSA-N ethanamine;hydron;bromide Chemical compound Br.CCN PNZDZRMOBIIQTC-UHFFFAOYSA-N 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- SURQXAFEQWPFPV-UHFFFAOYSA-L iron(2+) sulfate heptahydrate Chemical compound O.O.O.O.O.O.O.[Fe+2].[O-]S([O-])(=O)=O SURQXAFEQWPFPV-UHFFFAOYSA-L 0.000 description 2
- 239000000314 lubricant Substances 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 239000012452 mother liquor Substances 0.000 description 2
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 2
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 2
- OTYBMLCTZGSZBG-UHFFFAOYSA-L potassium sulfate Chemical compound [K+].[K+].[O-]S([O-])(=O)=O OTYBMLCTZGSZBG-UHFFFAOYSA-L 0.000 description 2
- 229910052939 potassium sulfate Inorganic materials 0.000 description 2
- 235000011151 potassium sulphates Nutrition 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000008117 stearic acid Substances 0.000 description 2
- 229960002317 succinimide Drugs 0.000 description 2
- 239000005720 sucrose Substances 0.000 description 2
- 239000002511 suppository base Substances 0.000 description 2
- 239000004408 titanium dioxide Substances 0.000 description 2
- 150000003626 triacylglycerols Chemical class 0.000 description 2
- KWTSXDURSIMDCE-QMMMGPOBSA-N (S)-amphetamine Chemical compound C[C@H](N)CC1=CC=CC=C1 KWTSXDURSIMDCE-QMMMGPOBSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- GJXSXYGGEBKXDG-UHFFFAOYSA-N 1-[5,6-bis(bromomethyl)-3-chlorobenzo[b][1]benzazepin-11-yl]ethanone Chemical class ClC1=CC2=C(N(C3=C(C(=C2CBr)CBr)C=CC=C3)C(C)=O)C=C1 GJXSXYGGEBKXDG-UHFFFAOYSA-N 0.000 description 1
- WMUCXGVIZJXMGU-UHFFFAOYSA-N 1-[9-methyl-3-(trifluoromethyl)-10H-acridin-9-yl]ethanone Chemical compound CC(=O)C1(C2=CC=CC=C2NC=2C=C(C=CC12)C(F)(F)F)C WMUCXGVIZJXMGU-UHFFFAOYSA-N 0.000 description 1
- HKWKBPILHZOCND-UHFFFAOYSA-N 10-chloro-4-ethyl-4,13-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),7(12),8,10,14,16-heptaene Chemical class C(C)N1CC=2C3=C(NC4=C(C2C1)C=CC=C4)C=C(C=C3)Cl HKWKBPILHZOCND-UHFFFAOYSA-N 0.000 description 1
- LFDGRWDETVOGDT-UHFFFAOYSA-N 1h-pyrrole;hydrochloride Chemical compound Cl.C=1C=CNC=1 LFDGRWDETVOGDT-UHFFFAOYSA-N 0.000 description 1
- QWVAWNHYONGJOY-UHFFFAOYSA-N 2-chloro-11h-benzo[b][1]benzazepine Chemical compound C1=CC2=CC=CC=C2NC2=CC(Cl)=CC=C21 QWVAWNHYONGJOY-UHFFFAOYSA-N 0.000 description 1
- WVDZIPXDDPNKCJ-UHFFFAOYSA-N 2-chloro-5,6-dimethyl-11h-benzo[b][1]benzazepine Chemical compound CC1=C(C)C2=CC=C(Cl)C=C2NC2=CC=CC=C12 WVDZIPXDDPNKCJ-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- JHGMSFFGANMUTD-UHFFFAOYSA-N 3-chloro-5,6-dimethyl-11h-benzo[b][1]benzazepine Chemical compound CC1=C(C)C2=CC(Cl)=CC=C2NC2=CC=CC=C12 JHGMSFFGANMUTD-UHFFFAOYSA-N 0.000 description 1
- OJYZMVFCXXSHCL-UHFFFAOYSA-N 5,6-dimethyl-2-(trifluoromethyl)-11h-benzo[b][1]benzazepine Chemical compound CC1=C(C)C2=CC=C(C(F)(F)F)C=C2NC2=CC=CC=C12 OJYZMVFCXXSHCL-UHFFFAOYSA-N 0.000 description 1
- MKJIEFSOBYUXJB-UHFFFAOYSA-N 9,10-dimethoxy-3-isobutyl-1,3,4,6,7,11b-hexahydro-2H-pyrido[2,1-a]isoquinolin-2-one Chemical compound C1CN2CC(CC(C)C)C(=O)CC2C2=C1C=C(OC)C(OC)=C2 MKJIEFSOBYUXJB-UHFFFAOYSA-N 0.000 description 1
- DFXXCQVNSXNPBP-UHFFFAOYSA-N 9-chloro-4,13-dimethyl-4,13-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),7(12),8,10,14,16-heptaene Chemical compound CN1CC=2C3=C(N(C4=C(C2C1)C=CC=C4)C)C=CC(=C3)Cl DFXXCQVNSXNPBP-UHFFFAOYSA-N 0.000 description 1
- QDAKGVYHUZQQKH-UHFFFAOYSA-N 9-methyl-3-(trifluoromethyl)acridine Chemical compound FC(F)(F)C1=CC=C2C(C)=C(C=CC=C3)C3=NC2=C1 QDAKGVYHUZQQKH-UHFFFAOYSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 244000144725 Amygdalus communis Species 0.000 description 1
- 235000011437 Amygdalus communis Nutrition 0.000 description 1
- 229920000945 Amylopectin Polymers 0.000 description 1
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Natural products OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- OSNAMCUCVUWTEH-UHFFFAOYSA-N C(C)N1CC=2C3=C(NC4=C(C2C1)C=CC=C4)C=C(C=C3)C(F)(F)F Chemical compound C(C)N1CC=2C3=C(NC4=C(C2C1)C=CC=C4)C=C(C=C3)C(F)(F)F OSNAMCUCVUWTEH-UHFFFAOYSA-N 0.000 description 1
- 241000207199 Citrus Species 0.000 description 1
- UHYATTVPQAZPNT-UHFFFAOYSA-N ClC1=CC2=C(N(C3=C(C(=C2C)C)C=CC=C3)C)C=C1 Chemical compound ClC1=CC2=C(N(C3=C(C(=C2C)C)C=CC=C3)C)C=C1 UHYATTVPQAZPNT-UHFFFAOYSA-N 0.000 description 1
- BWMFGUDRYHIARO-UHFFFAOYSA-N ClC=1C=CC2=C(N(C3=C(C(=C2C)C)C=CC=C3)C(C)=O)C1 Chemical compound ClC=1C=CC2=C(N(C3=C(C(=C2C)C)C=CC=C3)C(C)=O)C1 BWMFGUDRYHIARO-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- UEAHLRRGUVSINB-UHFFFAOYSA-N FC(C=1C=CC2=C(N(C3=C(C(=C2C)C)C=CC=C3)C(C)=O)C1)(F)F Chemical compound FC(C=1C=CC2=C(N(C3=C(C(=C2C)C)C=CC=C3)C(C)=O)C1)(F)F UEAHLRRGUVSINB-UHFFFAOYSA-N 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 239000004166 Lanolin Substances 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- 229920001800 Shellac Polymers 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- GUGOEEXESWIERI-UHFFFAOYSA-N Terfenadine Chemical compound C1=CC(C(C)(C)C)=CC=C1C(O)CCCN1CCC(C(O)(C=2C=CC=CC=2)C=2C=CC=CC=2)CC1 GUGOEEXESWIERI-UHFFFAOYSA-N 0.000 description 1
- 239000006096 absorbing agent Substances 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 239000001785 acacia senegal l. willd gum Substances 0.000 description 1
- IKHGUXGNUITLKF-XPULMUKRSA-N acetaldehyde Chemical compound [14CH]([14CH3])=O IKHGUXGNUITLKF-XPULMUKRSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 150000001251 acridines Chemical class 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 230000002908 adrenolytic effect Effects 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001346 alkyl aryl ethers Chemical class 0.000 description 1
- 235000020224 almond Nutrition 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 229940025084 amphetamine Drugs 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 230000001387 anti-histamine Effects 0.000 description 1
- 239000000935 antidepressant agent Substances 0.000 description 1
- 229940005513 antidepressants Drugs 0.000 description 1
- 239000000739 antihistaminic agent Substances 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- RTEXIPZMMDUXMR-UHFFFAOYSA-N benzene;ethyl acetate Chemical compound CCOC(C)=O.C1=CC=CC=C1 RTEXIPZMMDUXMR-UHFFFAOYSA-N 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- MDHYEMXUFSJLGV-UHFFFAOYSA-N beta-phenethyl acetate Natural products CC(=O)OCCC1=CC=CC=C1 MDHYEMXUFSJLGV-UHFFFAOYSA-N 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 1
- 239000008116 calcium stearate Substances 0.000 description 1
- 235000013539 calcium stearate Nutrition 0.000 description 1
- 125000005586 carbonic acid group Chemical group 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 235000020971 citrus fruits Nutrition 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 229940125773 compound 10 Drugs 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 230000000881 depressing effect Effects 0.000 description 1
- FHHZOYXKOICLGH-UHFFFAOYSA-N dichloromethane;ethanol Chemical compound CCO.ClCCl FHHZOYXKOICLGH-UHFFFAOYSA-N 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- PSLIMVZEAPALCD-UHFFFAOYSA-N ethanol;ethoxyethane Chemical compound CCO.CCOCC PSLIMVZEAPALCD-UHFFFAOYSA-N 0.000 description 1
- XTLNYNMNUCLWEZ-UHFFFAOYSA-N ethanol;propan-2-one Chemical compound CCO.CC(C)=O XTLNYNMNUCLWEZ-UHFFFAOYSA-N 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- ZKQFHRVKCYFVCN-UHFFFAOYSA-N ethoxyethane;hexane Chemical compound CCOCC.CCCCCC ZKQFHRVKCYFVCN-UHFFFAOYSA-N 0.000 description 1
- MDKXBBPLEGPIRI-UHFFFAOYSA-N ethoxyethane;methanol Chemical compound OC.CCOCC MDKXBBPLEGPIRI-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000011790 ferrous sulphate Substances 0.000 description 1
- 235000003891 ferrous sulphate Nutrition 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 238000005286 illumination Methods 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- XNCMOUSLNOHBKY-UHFFFAOYSA-H iron(3+);trisulfate;heptahydrate Chemical compound O.O.O.O.O.O.O.[Fe+3].[Fe+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O XNCMOUSLNOHBKY-UHFFFAOYSA-H 0.000 description 1
- 229910000359 iron(II) sulfate Inorganic materials 0.000 description 1
- YOBAEOGBNPPUQV-UHFFFAOYSA-N iron;trihydrate Chemical compound O.O.O.[Fe].[Fe] YOBAEOGBNPPUQV-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- ZLVXBBHTMQJRSX-VMGNSXQWSA-N jdtic Chemical compound C1([C@]2(C)CCN(C[C@@H]2C)C[C@H](C(C)C)NC(=O)[C@@H]2NCC3=CC(O)=CC=C3C2)=CC=CC(O)=C1 ZLVXBBHTMQJRSX-VMGNSXQWSA-N 0.000 description 1
- TYQCGQRIZGCHNB-JLAZNSOCSA-N l-ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(O)=C(O)C1=O TYQCGQRIZGCHNB-JLAZNSOCSA-N 0.000 description 1
- 239000004922 lacquer Substances 0.000 description 1
- 235000019388 lanolin Nutrition 0.000 description 1
- 229940039717 lanolin Drugs 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 235000012771 pancakes Nutrition 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 125000006678 phenoxycarbonyl group Chemical group 0.000 description 1
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 1
- 239000001120 potassium sulphate Substances 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000004208 shellac Substances 0.000 description 1
- ZLGIYFNHBLSMPS-ATJNOEHPSA-N shellac Chemical compound OCCCCCC(O)C(O)CCCCCCCC(O)=O.C1C23[C@H](C(O)=O)CCC2[C@](C)(CO)[C@@H]1C(C(O)=O)=C[C@@H]3O ZLGIYFNHBLSMPS-ATJNOEHPSA-N 0.000 description 1
- 235000013874 shellac Nutrition 0.000 description 1
- 229940113147 shellac Drugs 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- HRZFUMHJMZEROT-UHFFFAOYSA-L sodium disulfite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])(=O)=O HRZFUMHJMZEROT-UHFFFAOYSA-L 0.000 description 1
- 229940001584 sodium metabisulfite Drugs 0.000 description 1
- 235000010262 sodium metabisulphite Nutrition 0.000 description 1
- 239000007901 soft capsule Substances 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 231100001274 therapeutic index Toxicity 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D219/00—Heterocyclic compounds containing acridine or hydrogenated acridine ring systems
- C07D219/02—Heterocyclic compounds containing acridine or hydrogenated acridine ring systems with only hydrogen, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the ring system
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D219/00—Heterocyclic compounds containing acridine or hydrogenated acridine ring systems
- C07D219/04—Heterocyclic compounds containing acridine or hydrogenated acridine ring systems with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to carbon atoms of the ring system
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DK615069AA DK126202B (da) | 1968-12-19 | 1969-11-20 | Analogifremgangsmåde til fremstilling af azepinderivater eller syreadditionssalte deraf. |
| CH706970A CH531525A (de) | 1970-05-13 | 1970-05-13 | Verfahren zur Herstellung von neuen Azepinderivaten |
| DK263070AA DK134555B (da) | 1969-11-20 | 1970-05-22 | Analogifremgangsmåde til fremstilling af azepinderivater eller additionssalte deraf med uorganiske eller organiske syrer. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL83238B1 true PL83238B1 (en) | 1975-12-31 |
Family
ID=27175683
Family Applications (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1971148114A PL83238B1 (en) | 1969-11-20 | 1971-05-12 | Derivatives of dibenzo(b,f) pyrrolo (3,4-d)azepine as cns - depressants[us3783161a] |
| PL1971177294A PL86934B1 (en) | 1969-11-20 | 1971-05-12 | Derivatives of dibenzo(b,f) pyrrolo (3,4-d)azepine as cns - depressants[us3783161a] |
| PL1971177295A PL86935B1 (en) | 1969-11-20 | 1971-05-12 | Derivatives of dibenzo(b,f) pyrrolo (3,4-d)azepine as cns - depressants[us3783161a] |
Family Applications After (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1971177294A PL86934B1 (en) | 1969-11-20 | 1971-05-12 | Derivatives of dibenzo(b,f) pyrrolo (3,4-d)azepine as cns - depressants[us3783161a] |
| PL1971177295A PL86935B1 (en) | 1969-11-20 | 1971-05-12 | Derivatives of dibenzo(b,f) pyrrolo (3,4-d)azepine as cns - depressants[us3783161a] |
Country Status (17)
| Country | Link |
|---|---|
| US (2) | US3772348A (en, 2012) |
| AT (2) | AT306035B (en, 2012) |
| BE (1) | BE767061A (en, 2012) |
| CA (1) | CA926394A (en, 2012) |
| CS (3) | CS172343B2 (en, 2012) |
| DE (1) | DE2123574A1 (en, 2012) |
| DK (1) | DK134555B (en, 2012) |
| ES (1) | ES391056A1 (en, 2012) |
| FR (1) | FR2100648B1 (en, 2012) |
| GB (1) | GB1336891A (en, 2012) |
| HU (1) | HU162765B (en, 2012) |
| IE (1) | IE35218B1 (en, 2012) |
| IL (1) | IL36832A0 (en, 2012) |
| NL (1) | NL7106226A (en, 2012) |
| PL (3) | PL83238B1 (en, 2012) |
| SU (3) | SU381221A3 (en, 2012) |
| ZA (1) | ZA713101B (en, 2012) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ATE9159T1 (de) * | 1979-12-10 | 1984-09-15 | Ciba-Geigy Ag | Azatetracyclische carbonitrile. |
| US5760246A (en) * | 1996-12-17 | 1998-06-02 | Biller; Scott A. | Conformationally restricted aromatic inhibitors of microsomal triglyceride transfer protein and method |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH501650A (de) * | 1968-12-19 | 1971-01-15 | Ciba Geigy Ag | Verfahren zur Herstellung von neuen Azepinderivaten |
-
1970
- 1970-05-22 DK DK263070AA patent/DK134555B/da unknown
-
1971
- 1971-05-06 NL NL7106226A patent/NL7106226A/xx unknown
- 1971-05-11 US US00142390A patent/US3772348A/en not_active Expired - Lifetime
- 1971-05-11 SU SU1658713A patent/SU381221A3/ru active
- 1971-05-11 SU SU1716024A patent/SU422149A3/ru active
- 1971-05-12 DE DE19712123574 patent/DE2123574A1/de active Pending
- 1971-05-12 PL PL1971148114A patent/PL83238B1/pl unknown
- 1971-05-12 CS CS5586*A patent/CS172343B2/cs unknown
- 1971-05-12 PL PL1971177294A patent/PL86934B1/pl unknown
- 1971-05-12 ES ES391056A patent/ES391056A1/es not_active Expired
- 1971-05-12 IE IE598/71A patent/IE35218B1/xx unknown
- 1971-05-12 CA CA112765A patent/CA926394A/en not_active Expired
- 1971-05-12 AT AT411871A patent/AT306035B/de not_active IP Right Cessation
- 1971-05-12 CS CS3462A patent/CS172342B2/cs unknown
- 1971-05-12 BE BE767061A patent/BE767061A/xx unknown
- 1971-05-12 HU HUCI1113A patent/HU162765B/hu unknown
- 1971-05-12 PL PL1971177295A patent/PL86935B1/pl unknown
- 1971-05-12 FR FR7117123A patent/FR2100648B1/fr not_active Expired
- 1971-05-12 ZA ZA713101A patent/ZA713101B/xx unknown
- 1971-05-12 IL IL36832A patent/IL36832A0/xx unknown
- 1971-05-12 AT AT346872A patent/AT307425B/de not_active IP Right Cessation
- 1971-05-12 GB GB1440771*[A patent/GB1336891A/en not_active Expired
- 1971-05-12 CS CS5587*A patent/CS172344B2/cs unknown
- 1971-11-17 SU SU1716025A patent/SU507237A3/ru active
-
1972
- 1972-08-23 US US00283011A patent/US3783161A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| AT307425B (de) | 1973-05-25 |
| PL86934B1 (en) | 1976-06-30 |
| US3772348A (en) | 1973-11-13 |
| BE767061A (en, 2012) | 1971-11-12 |
| SU422149A3 (ru) | 1974-03-30 |
| AT306035B (de) | 1973-03-26 |
| FR2100648A1 (en, 2012) | 1972-03-24 |
| GB1336891A (en) | 1973-11-14 |
| SU381221A3 (en, 2012) | 1973-05-15 |
| DK134555B (da) | 1976-11-29 |
| US3783161A (en) | 1974-01-01 |
| CS172344B2 (en, 2012) | 1976-12-29 |
| HU162765B (en, 2012) | 1973-04-28 |
| CS172342B2 (en, 2012) | 1976-12-29 |
| IE35218B1 (en) | 1975-12-10 |
| NL7106226A (en, 2012) | 1971-11-16 |
| ES391056A1 (es) | 1973-07-01 |
| IE35218L (en) | 1971-11-13 |
| ZA713101B (en) | 1972-01-26 |
| IL36832A0 (en) | 1971-07-28 |
| DK134555C (en, 2012) | 1977-05-23 |
| PL86935B1 (en) | 1976-06-30 |
| CS172343B2 (en, 2012) | 1976-12-29 |
| SU507237A3 (ru) | 1976-03-15 |
| FR2100648B1 (en, 2012) | 1974-08-02 |
| DE2123574A1 (de) | 1971-12-02 |
| CA926394A (en) | 1973-05-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3743734A (en) | Pharmaceutical compositions comprising an 11-aminoacetyl - 5,11 - dihydro-6h-pyrido(2,3-b)(1,4)benzodiazepin-6-one | |
| IL34026A (en) | 10-oxo-10,11-dihydro-5h-dibenz(b,f)azepine-5-carboxamide,its production and pharmaceutical preparations containing it | |
| EP0503844B1 (en) | Thienopyridine derivatives and pharmaceutical compositions containing them | |
| US4308207A (en) | Morphanthridine derivatives | |
| US4076812A (en) | 10-Halogeno- or 10,11-dihalogeno derivatives of 5H-dibenz[b,f]azepine | |
| IE46908B1 (en) | Pyridobenzodiazepines | |
| US4279914A (en) | Thrombocyte aggregation inhibiting composition and methods | |
| IL44489A (en) | Quaternary salts of 11-(8-alkyl-3-nortropanyloxy)-6,11-dihydrodibenzo(b,e)thiepine derivatives,their production and pharmaceutical compositions containing them | |
| PL83238B1 (en) | Derivatives of dibenzo(b,f) pyrrolo (3,4-d)azepine as cns - depressants[us3783161a] | |
| US3859439A (en) | 2,3-dihydro-5 -trifluoromethyl-1h-dibenzo(2,3:6,7) thiepino (4,5-c) pyrroles as cns-depressants | |
| IL22791A (en) | Tetrahydro indenopyridine compounds | |
| CS244107B2 (en) | Method of substituted pyrdoido-(1,2-a)pyrimidines production | |
| NZ203217A (en) | Pyridobenzodiazepinone derivatives and pharmaceutical compositions | |
| US3719669A (en) | Amino(or amido)-phenyl-alkyl-benzazepine analgesics and narcotic antagonists | |
| EP0270692A1 (en) | Antiarrhythmic agent | |
| JPS63208520A (ja) | ピラジン誘導体を含有する血小板凝集抑制剤 | |
| US3880862A (en) | 6{62 -Azido-17-cycloalkylmethyl-4,5{60 -epoxymorphinan-3-ols | |
| US3917833A (en) | Amino-substituted benzocycloheptenones for inducing sleep | |
| US3755357A (en) | 2,3 - dihydro - 5-trifluoromethyl-1h-di-benzo(2,3:6,7)thiepino(4,5-c)pyrroles as cns-depressants | |
| US3376289A (en) | Novel 5, 6-dihydro-6-oxo-pyrido[2, 3-b] [1, 4]benzoxazepines and process for their preparation | |
| US3317544A (en) | 3-tropinyl esters of substituted acrylic and thio acrylic acids | |
| US3978081A (en) | 11H,12H-[1]benzopyrano[2,3-b][1]benzopyran-11,12-dione and derivatives | |
| GB1591126A (en) | Quinolizidines | |
| US3777032A (en) | 2,3-dihydro-1h-thienobenozothiepino(4,5-c)pyrroles as cns-depressants | |
| US3882127A (en) | 17-alkenyl-6{62 -azido-4,5{60 -epoxymorphinan-3-ols |