PL81620B1 - - Google Patents
Download PDFInfo
- Publication number
- PL81620B1 PL81620B1 PL1971148153A PL14815371A PL81620B1 PL 81620 B1 PL81620 B1 PL 81620B1 PL 1971148153 A PL1971148153 A PL 1971148153A PL 14815371 A PL14815371 A PL 14815371A PL 81620 B1 PL81620 B1 PL 81620B1
- Authority
- PL
- Poland
- Prior art keywords
- alkali metal
- solution
- anode
- concentrated
- phosphoric acid
- Prior art date
Links
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 38
- 238000000034 method Methods 0.000 claims description 35
- 239000012528 membrane Substances 0.000 claims description 23
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 22
- 239000000460 chlorine Substances 0.000 claims description 22
- 229910052801 chlorine Inorganic materials 0.000 claims description 22
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 19
- 229910019142 PO4 Inorganic materials 0.000 claims description 18
- 235000021317 phosphate Nutrition 0.000 claims description 18
- 239000001257 hydrogen Substances 0.000 claims description 16
- 229910052739 hydrogen Inorganic materials 0.000 claims description 16
- 229910000318 alkali metal phosphate Inorganic materials 0.000 claims description 14
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 13
- 238000005868 electrolysis reaction Methods 0.000 claims description 13
- 239000000203 mixture Substances 0.000 claims description 12
- 229910001514 alkali metal chloride Inorganic materials 0.000 claims description 9
- 238000004519 manufacturing process Methods 0.000 claims description 7
- 229910052751 metal Inorganic materials 0.000 claims description 7
- 239000002184 metal Substances 0.000 claims description 7
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 claims description 7
- 239000010452 phosphate Substances 0.000 claims description 7
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical group [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims description 7
- 125000002091 cationic group Chemical group 0.000 claims description 5
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical group [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 4
- 150000003839 salts Chemical class 0.000 claims description 4
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 229910045601 alloy Inorganic materials 0.000 claims description 3
- 239000000956 alloy Substances 0.000 claims description 3
- 230000000694 effects Effects 0.000 claims description 3
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- 239000011248 coating agent Substances 0.000 claims description 2
- 238000000576 coating method Methods 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims 1
- 229910000510 noble metal Inorganic materials 0.000 claims 1
- 229920005597 polymer membrane Polymers 0.000 claims 1
- 239000000243 solution Substances 0.000 description 26
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 17
- 235000002639 sodium chloride Nutrition 0.000 description 13
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 11
- 239000012267 brine Substances 0.000 description 10
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 10
- 239000011780 sodium chloride Substances 0.000 description 9
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 8
- 238000007872 degassing Methods 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- 239000007789 gas Substances 0.000 description 7
- 239000011734 sodium Substances 0.000 description 7
- 239000003513 alkali Substances 0.000 description 5
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 4
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 4
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 4
- 229910002092 carbon dioxide Inorganic materials 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 239000001488 sodium phosphate Substances 0.000 description 4
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 238000011109 contamination Methods 0.000 description 3
- 150000002739 metals Chemical class 0.000 description 3
- 229910052698 phosphorus Inorganic materials 0.000 description 3
- 239000011574 phosphorus Substances 0.000 description 3
- 229910052697 platinum Inorganic materials 0.000 description 3
- 229910052719 titanium Inorganic materials 0.000 description 3
- 239000010936 titanium Substances 0.000 description 3
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- -1 alkali metal salts Chemical class 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 239000001569 carbon dioxide Substances 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 239000011651 chromium Substances 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- 239000003792 electrolyte Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- 229910000403 monosodium phosphate Inorganic materials 0.000 description 2
- 235000019799 monosodium phosphate Nutrition 0.000 description 2
- 238000006386 neutralization reaction Methods 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 230000035699 permeability Effects 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 239000001103 potassium chloride Substances 0.000 description 2
- 235000011164 potassium chloride Nutrition 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- AJPJDKMHJJGVTQ-UHFFFAOYSA-M sodium dihydrogen phosphate Chemical compound [Na+].OP(O)([O-])=O AJPJDKMHJJGVTQ-UHFFFAOYSA-M 0.000 description 2
- 229910000162 sodium phosphate Inorganic materials 0.000 description 2
- 235000011008 sodium phosphates Nutrition 0.000 description 2
- 235000019832 sodium triphosphate Nutrition 0.000 description 2
- LWIHDJKSTIGBAC-UHFFFAOYSA-K tripotassium phosphate Chemical compound [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 description 2
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- XTEGARKTQYYJKE-UHFFFAOYSA-M Chlorate Chemical class [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 229910001413 alkali metal ion Inorganic materials 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000012295 chemical reaction liquid Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 230000005611 electricity Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 229910052741 iridium Inorganic materials 0.000 description 1
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910001463 metal phosphate Inorganic materials 0.000 description 1
- 230000005012 migration Effects 0.000 description 1
- 238000013508 migration Methods 0.000 description 1
- 229910052758 niobium Inorganic materials 0.000 description 1
- 239000010955 niobium Substances 0.000 description 1
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 description 1
- 229910052762 osmium Inorganic materials 0.000 description 1
- SYQBFIAQOQZEGI-UHFFFAOYSA-N osmium atom Chemical compound [Os] SYQBFIAQOQZEGI-UHFFFAOYSA-N 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 150000002927 oxygen compounds Chemical class 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 239000012466 permeate Substances 0.000 description 1
- 229920001343 polytetrafluoroethylene Polymers 0.000 description 1
- 239000004810 polytetrafluoroethylene Substances 0.000 description 1
- 229910000160 potassium phosphate Inorganic materials 0.000 description 1
- 235000011009 potassium phosphates Nutrition 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 229910052715 tantalum Inorganic materials 0.000 description 1
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
- LEONUFNNVUYDNQ-UHFFFAOYSA-N vanadium atom Chemical compound [V] LEONUFNNVUYDNQ-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 229910052726 zirconium Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25B—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES FOR THE PRODUCTION OF COMPOUNDS OR NON-METALS; APPARATUS THEREFOR
- C25B1/00—Electrolytic production of inorganic compounds or non-metals
- C25B1/01—Products
- C25B1/14—Alkali metal compounds
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B25/00—Phosphorus; Compounds thereof
- C01B25/16—Oxyacids of phosphorus; Salts thereof
- C01B25/26—Phosphates
- C01B25/30—Alkali metal phosphates
- C01B25/301—Preparation from liquid orthophosphoric acid or from an acid solution or suspension of orthophosphates
- C01B25/303—Preparation from liquid orthophosphoric acid or from an acid solution or suspension of orthophosphates with elimination of impurities
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25B—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES FOR THE PRODUCTION OF COMPOUNDS OR NON-METALS; APPARATUS THEREFOR
- C25B1/00—Electrolytic production of inorganic compounds or non-metals
- C25B1/01—Products
- C25B1/24—Halogens or compounds thereof
- C25B1/26—Chlorine; Compounds thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Electrochemistry (AREA)
- Materials Engineering (AREA)
- Metallurgy (AREA)
- Electrolytic Production Of Non-Metals, Compounds, Apparatuses Therefor (AREA)
- Separation Using Semi-Permeable Membranes (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7017742A FR2087342A5 (enExample) | 1970-05-15 | 1970-05-15 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL81620B1 true PL81620B1 (enExample) | 1975-08-30 |
Family
ID=9055567
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1971148153A PL81620B1 (enExample) | 1970-05-15 | 1971-05-13 |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3763005A (enExample) |
| BE (1) | BE767226A (enExample) |
| CA (1) | CA948150A (enExample) |
| CS (1) | CS172923B2 (enExample) |
| DE (1) | DE2124045C3 (enExample) |
| ES (1) | ES391040A1 (enExample) |
| FR (1) | FR2087342A5 (enExample) |
| GB (1) | GB1313441A (enExample) |
| NL (1) | NL7106594A (enExample) |
| PL (1) | PL81620B1 (enExample) |
| RO (1) | RO59453A (enExample) |
| SU (1) | SU467511A3 (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE795460A (fr) * | 1972-02-16 | 1973-08-16 | Diamond Shamrock Corp | Perfectionnements relatifs a des cuves electrolytiques |
| US4100050A (en) * | 1973-11-29 | 1978-07-11 | Hooker Chemicals & Plastics Corp. | Coating metal anodes to decrease consumption rates |
| CH597371A5 (enExample) * | 1975-04-25 | 1978-03-31 | Battelle Memorial Institute | |
| US3974047A (en) * | 1975-06-02 | 1976-08-10 | The B. F. Goodrich Company | Electrolytic cation exchange process for conjoint manufacture of chlorine and phosphate salts |
| CA1159008A (en) * | 1978-12-04 | 1983-12-20 | Sankar Das Gupta | Reactor with working and secondary electrodes and polarity reversal means for treating waste water |
| US4389287A (en) * | 1980-01-31 | 1983-06-21 | Skala Stephen F | Withdrawal of molten alkali hydroxide through an electrode for depletion of water dissolved therein |
| CN102732906B (zh) * | 2012-07-04 | 2014-08-06 | 四川大学 | 一种电解法制备磷酸二氢钾的方法 |
-
1970
- 1970-05-15 FR FR7017742A patent/FR2087342A5/fr not_active Expired
-
1971
- 1971-04-15 CS CS2692A patent/CS172923B2/cs unknown
- 1971-05-05 GB GB1319471*[A patent/GB1313441A/en not_active Expired
- 1971-05-11 ES ES391040A patent/ES391040A1/es not_active Expired
- 1971-05-12 SU SU1650585A patent/SU467511A3/ru active
- 1971-05-12 US US00142672A patent/US3763005A/en not_active Expired - Lifetime
- 1971-05-13 CA CA112,962*7A patent/CA948150A/en not_active Expired
- 1971-05-13 NL NL7106594A patent/NL7106594A/xx unknown
- 1971-05-13 PL PL1971148153A patent/PL81620B1/pl unknown
- 1971-05-14 BE BE767226A patent/BE767226A/xx not_active IP Right Cessation
- 1971-05-14 DE DE2124045A patent/DE2124045C3/de not_active Expired
- 1971-05-15 RO RO66908A patent/RO59453A/ro unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE2124045A1 (de) | 1971-11-25 |
| DE2124045B2 (de) | 1973-04-26 |
| BE767226A (fr) | 1971-11-16 |
| US3763005A (en) | 1973-10-02 |
| DE2124045C3 (de) | 1973-11-22 |
| CA948150A (en) | 1974-05-28 |
| CS172923B2 (enExample) | 1977-01-28 |
| SU467511A3 (ru) | 1975-04-15 |
| GB1313441A (en) | 1973-04-11 |
| RO59453A (enExample) | 1976-03-15 |
| FR2087342A5 (enExample) | 1971-12-31 |
| NL7106594A (enExample) | 1971-11-17 |
| ES391040A1 (es) | 1973-06-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4456510A (en) | Process for manufacturing chlorine dioxide | |
| US5230779A (en) | Electrochemical production of sodium hydroxide and sulfuric acid from acidified sodium sulfate solutions | |
| US5246551A (en) | Electrochemical methods for production of alkali metal hydroxides without the co-production of chlorine | |
| US4242185A (en) | Process and apparatus for controlling impurities and pollution from membrane chlor-alkali cells | |
| US5106465A (en) | Electrochemical process for producing chlorine dioxide solutions from chlorites | |
| US5084149A (en) | Electrolytic process for producing chlorine dioxide | |
| JP2864168B2 (ja) | 硫化物を含有する白液の電解による多硫化物の製造 | |
| US5198080A (en) | Electrochemical processing of aqueous solutions | |
| JPH05504170A (ja) | 塩素酸・アルカリ金属塩素酸塩混合物の電気化学的製造方法 | |
| CZ289193A3 (en) | Process of electrochemical decomposition of salt solutions and electrolytic cell for making the same | |
| US4059496A (en) | Process for the preparation of sulfuric acid from sulphur dioxide | |
| FI94063C (fi) | Menetelmä alkalimetalli- tai ammoniumperoksodisulfaattisuolojen ja alkalimetallihydroksidin samanaikaiseksi valmistamiseksi | |
| US4613416A (en) | Process for the concentration of sulfuric acid | |
| CA1214429A (en) | Removal of chlorate from electrolyte cell brine | |
| US5419818A (en) | Process for the production of alkali metal chlorate | |
| CN1369576A (zh) | 反式双膜三室电解槽 | |
| PL81620B1 (enExample) | ||
| US4415413A (en) | Method of concentrating alkali metal hydroxide in a cascade of hybrid cells | |
| US5248397A (en) | Chlorine dioxide generation from chloric acid - alkali metal chlorate mixtures | |
| JPH10291808A (ja) | 過酸化水素水の製造方法及び装置 | |
| US5242554A (en) | Electrolytic production of chloric acid and sodium chlorate mixtures for the generation of chlorine dioxide | |
| CA2084183C (en) | Electrochemical processing of aqueous solutions | |
| SK49793A3 (en) | Process for preparing alkali metal chlorate (v) and device for its executing | |
| KR20230162984A (ko) | 고순도 수산화리튬 일수화물을 생산하는 방법 | |
| US5264089A (en) | Production of chlorine dioxide employing chloric acid - alkali metal chlorate mixtures |