PL81423B1 - - Google Patents
Download PDFInfo
- Publication number
- PL81423B1 PL81423B1 PL1971151641A PL15164171A PL81423B1 PL 81423 B1 PL81423 B1 PL 81423B1 PL 1971151641 A PL1971151641 A PL 1971151641A PL 15164171 A PL15164171 A PL 15164171A PL 81423 B1 PL81423 B1 PL 81423B1
- Authority
- PL
- Poland
- Prior art keywords
- explosive
- detonating cord
- cord according
- fuse
- hollow tube
- Prior art date
Links
- 239000002360 explosive Substances 0.000 claims description 45
- 239000000463 material Substances 0.000 claims description 21
- 239000000203 mixture Substances 0.000 claims description 13
- 239000007789 gas Substances 0.000 claims description 12
- 229920003023 plastic Polymers 0.000 claims description 10
- 239000004033 plastic Substances 0.000 claims description 10
- 210000003462 vein Anatomy 0.000 claims description 7
- 238000000576 coating method Methods 0.000 claims description 6
- 229910001610 cryolite Inorganic materials 0.000 claims description 6
- 239000011248 coating agent Substances 0.000 claims description 5
- 238000005474 detonation Methods 0.000 claims description 5
- 238000000034 method Methods 0.000 claims description 5
- 239000000126 substance Substances 0.000 claims description 5
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 claims description 4
- 238000001816 cooling Methods 0.000 claims description 4
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 claims description 3
- TZRXHJWUDPFEEY-UHFFFAOYSA-N Pentaerythritol Tetranitrate Chemical compound [O-][N+](=O)OCC(CO[N+]([O-])=O)(CO[N+]([O-])=O)CO[N+]([O-])=O TZRXHJWUDPFEEY-UHFFFAOYSA-N 0.000 claims description 3
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 150000001340 alkali metals Chemical class 0.000 claims description 3
- 150000003863 ammonium salts Chemical class 0.000 claims description 3
- 229910052791 calcium Inorganic materials 0.000 claims description 3
- 239000011575 calcium Substances 0.000 claims description 3
- -1 calcium metals Chemical class 0.000 claims description 3
- 150000004649 carbonic acid derivatives Chemical class 0.000 claims description 3
- 239000002817 coal dust Substances 0.000 claims description 3
- 229910052751 metal Inorganic materials 0.000 claims description 3
- 239000002184 metal Substances 0.000 claims description 3
- 229920002239 polyacrylonitrile Polymers 0.000 claims description 3
- 150000003467 sulfuric acid derivatives Chemical class 0.000 claims description 3
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical group C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims description 2
- 239000000654 additive Substances 0.000 claims description 2
- 239000003000 extruded plastic Substances 0.000 claims description 2
- 230000000996 additive effect Effects 0.000 claims 1
- 229910052736 halogen Inorganic materials 0.000 claims 1
- 150000002367 halogens Chemical class 0.000 claims 1
- 238000004880 explosion Methods 0.000 description 5
- 239000003245 coal Substances 0.000 description 4
- 238000005065 mining Methods 0.000 description 4
- 239000004800 polyvinyl chloride Substances 0.000 description 4
- 229920000915 polyvinyl chloride Polymers 0.000 description 4
- 239000000835 fiber Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 230000003472 neutralizing effect Effects 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 229920002994 synthetic fiber Polymers 0.000 description 2
- 229920001169 thermoplastic Polymers 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 229920003043 Cellulose fiber Polymers 0.000 description 1
- 235000019738 Limestone Nutrition 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 238000005422 blasting Methods 0.000 description 1
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical class [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 description 1
- 235000012255 calcium oxide Nutrition 0.000 description 1
- 238000002485 combustion reaction Methods 0.000 description 1
- 239000004020 conductor Substances 0.000 description 1
- 238000010411 cooking Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000003546 flue gas Substances 0.000 description 1
- 239000006028 limestone Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 239000004570 mortar (masonry) Substances 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 239000002985 plastic film Substances 0.000 description 1
- 229920006255 plastic film Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920001343 polytetrafluoroethylene Polymers 0.000 description 1
- 239000004810 polytetrafluoroethylene Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 238000010257 thawing Methods 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
- 239000002966 varnish Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06C—DETONATING OR PRIMING DEVICES; FUSES; CHEMICAL LIGHTERS; PYROPHORIC COMPOSITIONS
- C06C5/00—Fuses, e.g. fuse cords
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06B—EXPLOSIVES OR THERMIC COMPOSITIONS; MANUFACTURE THEREOF; USE OF SINGLE SUBSTANCES AS EXPLOSIVES
- C06B25/00—Compositions containing a nitrated organic compound
- C06B25/32—Compositions containing a nitrated organic compound the compound being nitrated pentaerythritol
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06C—DETONATING OR PRIMING DEVICES; FUSES; CHEMICAL LIGHTERS; PYROPHORIC COMPOSITIONS
- C06C5/00—Fuses, e.g. fuse cords
- C06C5/04—Detonating fuses
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06C—DETONATING OR PRIMING DEVICES; FUSES; CHEMICAL LIGHTERS; PYROPHORIC COMPOSITIONS
- C06C5/00—Fuses, e.g. fuse cords
- C06C5/06—Fuse igniting means; Fuse connectors
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Air Bags (AREA)
- Ropes Or Cables (AREA)
- Compositions Of Oxide Ceramics (AREA)
- Materials For Medical Uses (AREA)
- Adhesives Or Adhesive Processes (AREA)
- Chemical Or Physical Treatment Of Fibers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2057042A DE2057042C3 (de) | 1970-11-20 | 1970-11-20 | Sprengschnur für den Einsatz in Schlagwetter- und kohlenstaubgefährdeten Betrieben |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL81423B1 true PL81423B1 (OSRAM) | 1975-08-30 |
Family
ID=5788630
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1971151641A PL81423B1 (OSRAM) | 1970-11-20 | 1971-11-18 |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3730097A (OSRAM) |
| BE (1) | BE775433A (OSRAM) |
| CS (1) | CS159294B2 (OSRAM) |
| DE (1) | DE2057042C3 (OSRAM) |
| FR (1) | FR2114857A5 (OSRAM) |
| GB (1) | GB1321526A (OSRAM) |
| PL (1) | PL81423B1 (OSRAM) |
| SU (1) | SU464102A3 (OSRAM) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1396471A (en) * | 1973-02-19 | 1975-06-04 | Ici Ltd | Exposive fuse-cord |
| US3867884A (en) * | 1973-02-19 | 1975-02-25 | Ici Ltd | Explosive fuse-cord |
| DE2529039A1 (de) * | 1975-06-28 | 1977-01-20 | Dynamit Nobel Ag | Wettersprengstoffe |
| US4178853A (en) * | 1976-04-28 | 1979-12-18 | Teledyne Mccormick Selph, An Operating Division Of Teledyne Industries, Inc. | Mild detonating cord confinement |
| US4083305A (en) * | 1976-04-28 | 1978-04-11 | Teledyne Mccormick Selph, An Operating Division Of Teledyne Ind. Inc. | Mild detonating cord confinement |
| US4102428A (en) * | 1976-11-03 | 1978-07-25 | Ensign-Bickford Company | No-flash seismic cord |
| DE3020957C2 (de) * | 1980-06-03 | 1983-03-03 | Dynamit Nobel Ag, 5210 Troisdorf | Wasserfeste Sprengschnur |
| RU2190587C2 (ru) * | 2000-03-21 | 2002-10-10 | Стадник Валентин Васильевич | Шнур для передачи инициирующего импульса и состав для его изготовления |
| RU2215726C2 (ru) * | 2002-01-03 | 2003-11-10 | Федеральное государственное унитарное предприятие "Пермский завод им. С.М.Кирова" | Способ изготовления огнепроводного шнура |
| DE102005040392A1 (de) * | 2005-08-25 | 2007-05-03 | Dynaenergetics Gmbh & Co. Kg | Sprengschnur zur Behandlung von schlecht erreichbaren Oberflächen |
| DE102006007483B4 (de) * | 2006-02-17 | 2010-02-11 | Atc Establishment | Zündschlauch |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2380312A (en) * | 1942-11-19 | 1945-07-10 | Du Pont | Detonating fuse |
| US2891475A (en) * | 1954-02-01 | 1959-06-23 | Ici Ltd | Fuse |
| US3027839A (en) * | 1959-04-02 | 1962-04-03 | Andrew J Grandy | Tubular explosive transmission line |
| US3344005A (en) * | 1966-02-23 | 1967-09-26 | Trojan Powder Co | Pentaerythritol tetranitrate-trimethylolethane trinitrate explosives |
| SE333321B (sv) * | 1967-07-20 | 1971-03-08 | Nitro Nobel Ab | Lagenergistubin foer oeverfoering eller alstring av detonation |
| DE1916685C3 (de) * | 1969-04-01 | 1974-04-04 | Dynamit Nobel Ag, 5210 Troisdorf | Sprengschnur |
-
1970
- 1970-11-20 DE DE2057042A patent/DE2057042C3/de not_active Expired
-
1971
- 1971-10-28 US US00193460A patent/US3730097A/en not_active Expired - Lifetime
- 1971-11-09 CS CS784571A patent/CS159294B2/cs unknown
- 1971-11-12 SU SU1713683A patent/SU464102A3/ru active
- 1971-11-17 BE BE775433A patent/BE775433A/xx not_active IP Right Cessation
- 1971-11-18 FR FR7141318A patent/FR2114857A5/fr not_active Expired
- 1971-11-18 PL PL1971151641A patent/PL81423B1/pl unknown
- 1971-11-19 GB GB5395171A patent/GB1321526A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| SU464102A3 (ru) | 1975-03-15 |
| GB1321526A (en) | 1973-06-27 |
| CS159294B2 (OSRAM) | 1974-12-27 |
| DE2057042C3 (de) | 1974-06-12 |
| BE775433A (fr) | 1972-03-16 |
| FR2114857A5 (OSRAM) | 1972-06-30 |
| DE2057042A1 (de) | 1972-05-31 |
| DE2057042B2 (de) | 1973-10-25 |
| US3730097A (en) | 1973-05-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3125024A (en) | Explosive connecting cord | |
| US4290366A (en) | Energy transmission device | |
| US4335652A (en) | Non-electric delay detonator | |
| US2923239A (en) | Ignition transmission line and systems including the same | |
| CA2242237C (en) | Detonators having multiple-line input leads | |
| CA1064322A (en) | Elongated, flexible detonating device | |
| US2736263A (en) | Blasting explosive device | |
| PL81423B1 (OSRAM) | ||
| US3709149A (en) | Detonator assembly, and booster and blasting system containing same | |
| US3306201A (en) | Explosive composition and waterhammer-resistant delay device containing same | |
| US4314508A (en) | Device with incendiary fusecord ignited by detonation | |
| KR840002759A (ko) | 비전기성 폭팔물 | |
| US2891475A (en) | Fuse | |
| US4023493A (en) | Fireline detonator | |
| CA1150104A (en) | Non-electric delay detonator with percussion -sensitive ignition charge in spacing between deformable shell and rigid metal capsule | |
| US3353485A (en) | Bidirectional delay connector | |
| US3155038A (en) | Detonating fuse | |
| US3726216A (en) | Detonation device and method for making the same | |
| US2771841A (en) | Belt line charge | |
| DE4107349A1 (de) | Energiearme sprengzuendschnur | |
| US2498050A (en) | Fulminating fuse | |
| US3518942A (en) | Antiaircraft projectile | |
| US3792660A (en) | Flexible pyrotechnic relay | |
| US2863392A (en) | Delay electric initiators | |
| US1785529A (en) | Blasting-explosive assembly |