PL81333B1 - - Google Patents
Download PDFInfo
- Publication number
- PL81333B1 PL81333B1 PL1970141917A PL14191770A PL81333B1 PL 81333 B1 PL81333 B1 PL 81333B1 PL 1970141917 A PL1970141917 A PL 1970141917A PL 14191770 A PL14191770 A PL 14191770A PL 81333 B1 PL81333 B1 PL 81333B1
- Authority
- PL
- Poland
- Prior art keywords
- nitro
- methyl
- indanone
- imidazolylmethylene
- theory
- Prior art date
Links
- -1 2-benzoyloxyethyl Chemical group 0.000 description 126
- 239000000047 product Substances 0.000 description 102
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 85
- 238000002844 melting Methods 0.000 description 81
- 230000008018 melting Effects 0.000 description 81
- 238000000921 elemental analysis Methods 0.000 description 72
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 54
- 239000011541 reaction mixture Substances 0.000 description 46
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 42
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 40
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 39
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 36
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 33
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 30
- 150000001875 compounds Chemical class 0.000 description 29
- 239000000203 mixture Substances 0.000 description 28
- 229910052757 nitrogen Inorganic materials 0.000 description 27
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 26
- 239000000243 solution Substances 0.000 description 25
- 238000000034 method Methods 0.000 description 24
- 229910052739 hydrogen Inorganic materials 0.000 description 23
- 239000002244 precipitate Substances 0.000 description 22
- 229960000583 acetic acid Drugs 0.000 description 20
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 18
- 125000004432 carbon atom Chemical group C* 0.000 description 18
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 15
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 15
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 13
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 13
- 239000012043 crude product Substances 0.000 description 13
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 12
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 12
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 12
- QNXSIUBBGPHDDE-UHFFFAOYSA-N indan-1-one Chemical compound C1=CC=C2C(=O)CCC2=C1 QNXSIUBBGPHDDE-UHFFFAOYSA-N 0.000 description 11
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 10
- 235000011054 acetic acid Nutrition 0.000 description 10
- 238000001816 cooling Methods 0.000 description 10
- 238000001914 filtration Methods 0.000 description 10
- 239000012362 glacial acetic acid Substances 0.000 description 10
- 239000002253 acid Substances 0.000 description 9
- 150000003839 salts Chemical class 0.000 description 9
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 8
- ZRKQOVXGDIZYDS-UHFFFAOYSA-N 5-hydroxy-2,3-dihydroinden-1-one Chemical compound OC1=CC=C2C(=O)CCC2=C1 ZRKQOVXGDIZYDS-UHFFFAOYSA-N 0.000 description 8
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
- 239000000706 filtrate Substances 0.000 description 8
- QOPRWBRNMPANKN-UHFFFAOYSA-N 5-methoxy-2,3-dihydroinden-1-one Chemical compound COC1=CC=C2C(=O)CCC2=C1 QOPRWBRNMPANKN-UHFFFAOYSA-N 0.000 description 7
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 7
- 125000005843 halogen group Chemical group 0.000 description 7
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 7
- 238000001953 recrystallisation Methods 0.000 description 7
- 239000011734 sodium Substances 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 6
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 6
- 238000009835 boiling Methods 0.000 description 6
- 239000013078 crystal Substances 0.000 description 6
- 238000001704 evaporation Methods 0.000 description 6
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 6
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 6
- 239000012044 organic layer Substances 0.000 description 6
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 6
- 229910052708 sodium Inorganic materials 0.000 description 6
- 125000000217 alkyl group Chemical group 0.000 description 5
- 230000008020 evaporation Effects 0.000 description 5
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 description 5
- 238000010438 heat treatment Methods 0.000 description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 5
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 5
- 238000002360 preparation method Methods 0.000 description 5
- TXFPEBPIARQUIG-UHFFFAOYSA-N 4'-hydroxyacetophenone Chemical compound CC(=O)C1=CC=C(O)C=C1 TXFPEBPIARQUIG-UHFFFAOYSA-N 0.000 description 4
- NVKJOXRVEKMMHS-UHFFFAOYSA-N 5-nitro-1,2,4-triazol-3-one Chemical compound [O-][N+](=O)C1=NC(=O)N=N1 NVKJOXRVEKMMHS-UHFFFAOYSA-N 0.000 description 4
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- 125000004423 acyloxy group Chemical group 0.000 description 4
- 125000003277 amino group Chemical group 0.000 description 4
- 229940040526 anhydrous sodium acetate Drugs 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 4
- 229940046892 lead acetate Drugs 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- VAOCPAMSLUNLGC-UHFFFAOYSA-N metronidazole Chemical compound CC1=NC=C([N+]([O-])=O)N1CCO VAOCPAMSLUNLGC-UHFFFAOYSA-N 0.000 description 4
- 229960000282 metronidazole Drugs 0.000 description 4
- GHUPGGYDRVSZSW-UHFFFAOYSA-N n-(1-oxo-2,3-dihydroinden-5-yl)acetamide Chemical compound CC(=O)NC1=CC=C2C(=O)CCC2=C1 GHUPGGYDRVSZSW-UHFFFAOYSA-N 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 3
- UMSMQVJJULFTFY-UHFFFAOYSA-N 2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-3H-inden-1-one Chemical compound [N+](=O)([O-])C1=CN=C(N1C)C=C1C(C2=CC=CC=C2C1)=O UMSMQVJJULFTFY-UHFFFAOYSA-N 0.000 description 3
- WQMAANNAZKNUDL-UHFFFAOYSA-N 2-dimethylaminoethyl chloride Chemical compound CN(C)CCCl WQMAANNAZKNUDL-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- 241000224527 Trichomonas vaginalis Species 0.000 description 3
- 125000001931 aliphatic group Chemical group 0.000 description 3
- 125000003545 alkoxy group Chemical group 0.000 description 3
- 150000008051 alkyl sulfates Chemical class 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 125000002431 aminoalkoxy group Chemical group 0.000 description 3
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 150000002366 halogen compounds Chemical class 0.000 description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 description 3
- 150000004957 nitroimidazoles Chemical class 0.000 description 3
- 239000001632 sodium acetate Substances 0.000 description 3
- 235000017281 sodium acetate Nutrition 0.000 description 3
- 229910052717 sulfur Inorganic materials 0.000 description 3
- GPRYKVSEZCQIHD-UHFFFAOYSA-N 1-(4-aminophenyl)ethanone Chemical compound CC(=O)C1=CC=C(N)C=C1 GPRYKVSEZCQIHD-UHFFFAOYSA-N 0.000 description 2
- XHQBIYCRFVVHFD-UHFFFAOYSA-N 1-benzothiophen-3-ol Chemical group C1=CC=C2C(O)=CSC2=C1 XHQBIYCRFVVHFD-UHFFFAOYSA-N 0.000 description 2
- XHLHPRDBBAGVEG-UHFFFAOYSA-N 1-tetralone Chemical compound C1=CC=C2C(=O)CCCC2=C1 XHLHPRDBBAGVEG-UHFFFAOYSA-N 0.000 description 2
- LDLCZOVUSADOIV-UHFFFAOYSA-N 2-bromoethanol Chemical compound OCCBr LDLCZOVUSADOIV-UHFFFAOYSA-N 0.000 description 2
- UCQUAMAQHHEXGD-UHFFFAOYSA-N 3',4'-dihydroxyacetophenone Chemical compound CC(=O)C1=CC=C(O)C(O)=C1 UCQUAMAQHHEXGD-UHFFFAOYSA-N 0.000 description 2
- OOIVTNPWFIHCAL-UHFFFAOYSA-N 3-(1-methyl-5-nitroimidazol-2-yl)-1-phenylprop-2-en-1-one Chemical compound [N+](=O)([O-])C1=CN=C(N1C)C=CC(=O)C1=CC=CC=C1 OOIVTNPWFIHCAL-UHFFFAOYSA-N 0.000 description 2
- XVTQSYKCADSUHN-UHFFFAOYSA-N 3-methyl-2,3-dihydroinden-1-one Chemical compound C1=CC=C2C(C)CC(=O)C2=C1 XVTQSYKCADSUHN-UHFFFAOYSA-N 0.000 description 2
- IJCQVTSNIBWXLF-UHFFFAOYSA-N 5-(2-hydroxyethoxy)-2,3-dihydroinden-1-one Chemical compound OCCOC=1C=C2CCC(C2=CC1)=O IJCQVTSNIBWXLF-UHFFFAOYSA-N 0.000 description 2
- LLTZGIHNPKZNHN-UHFFFAOYSA-N 5-(2-hydroxyethoxy)-2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-3H-inden-1-one Chemical compound OCCOC=1C=C2CC(C(C2=CC1)=O)=CC=1N(C(=CN1)[N+](=O)[O-])C LLTZGIHNPKZNHN-UHFFFAOYSA-N 0.000 description 2
- XLQKISIXNZMCOT-UHFFFAOYSA-N 5-[2-(diethylamino)ethoxy]-2,3-dihydroinden-1-one hydrochloride Chemical compound Cl.C(C)N(CCOC=1C=C2CCC(C2=CC1)=O)CC XLQKISIXNZMCOT-UHFFFAOYSA-N 0.000 description 2
- OCWVNNPXBSSEIV-UHFFFAOYSA-N 5-[2-(dimethylamino)ethoxy]-2,3-dihydroinden-1-one;hydrochloride Chemical compound Cl.CN(C)CCOC1=CC=C2C(=O)CCC2=C1 OCWVNNPXBSSEIV-UHFFFAOYSA-N 0.000 description 2
- PMRNLVGKMGUYCZ-UHFFFAOYSA-N 5-hydroxy-2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-3H-inden-1-one Chemical compound OC=1C=C2CC(C(C2=CC1)=O)=CC=1N(C(=CN1)[N+](=O)[O-])C PMRNLVGKMGUYCZ-UHFFFAOYSA-N 0.000 description 2
- KLJWFFXNAZUXFJ-UHFFFAOYSA-N 6-(dimethylamino)-3,4-dihydro-2h-naphthalen-1-one Chemical compound O=C1CCCC2=CC(N(C)C)=CC=C21 KLJWFFXNAZUXFJ-UHFFFAOYSA-N 0.000 description 2
- RFKQURMVRQGGLW-UHFFFAOYSA-N 6-[2-(dimethylamino)ethoxy]-3,4-dihydro-2H-naphthalen-1-one hydrochloride Chemical compound Cl.CN(C)CCOC1=CC2=C(C=C1)C(=O)CCC2 RFKQURMVRQGGLW-UHFFFAOYSA-N 0.000 description 2
- FNSQPQKPPGALFA-UHFFFAOYSA-N 6-hydroxy-3,4-dihydro-2h-naphthalen-1-one Chemical compound O=C1CCCC2=CC(O)=CC=C21 FNSQPQKPPGALFA-UHFFFAOYSA-N 0.000 description 2
- DBOXRDYLMJMQBB-UHFFFAOYSA-N 6-methyl-2,3-dihydroinden-1-one Chemical compound CC1=CC=C2CCC(=O)C2=C1 DBOXRDYLMJMQBB-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- WRQNXSQPRJRPPM-UHFFFAOYSA-N N-[2-[(1-butyl-5-nitroimidazol-2-yl)methylidene]-1-oxo-3H-inden-5-yl]acetamide Chemical compound N(C(=O)C)C=1C=C2CC(C(C2=CC1)=O)=CC=1N(C(=CN1)[N+](=O)[O-])CCCC WRQNXSQPRJRPPM-UHFFFAOYSA-N 0.000 description 2
- UOCMSTAGMGBWPC-UHFFFAOYSA-N N-[2-[(1-ethyl-5-nitroimidazol-2-yl)methylidene]-1-oxo-3H-inden-5-yl]acetamide Chemical compound N(C(=O)C)C=1C=C2CC(C(C2=CC1)=O)=CC=1N(C(=CN1)[N+](=O)[O-])CC UOCMSTAGMGBWPC-UHFFFAOYSA-N 0.000 description 2
- ODUMTQBXNCKRFL-UHFFFAOYSA-N N-[2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-1-oxo-3H-inden-5-yl]acetamide Chemical compound C(C)(=O)NC=1C=C2CC(C(C2=CC1)=O)=CC=1N(C(=CN1)[N+](=O)[O-])C ODUMTQBXNCKRFL-UHFFFAOYSA-N 0.000 description 2
- WXBPPTKUSWCKBV-UHFFFAOYSA-N N-[6-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-5-oxo-7,8-dihydronaphthalen-2-yl]acetamide Chemical compound C(C)(=O)NC=1C=C2CCC(C(C2=CC1)=O)=CC=1N(C(=CN1)[N+](=O)[O-])C WXBPPTKUSWCKBV-UHFFFAOYSA-N 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Natural products CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 2
- NITOVKVCLCBSJS-UHFFFAOYSA-N [2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-1-oxo-3H-inden-4-yl] acetate Chemical compound C(C)(=O)OC1=C2CC(C(C2=CC=C1)=O)=CC=1N(C(=CN1)[N+](=O)[O-])C NITOVKVCLCBSJS-UHFFFAOYSA-N 0.000 description 2
- DGJNWYUVKARAOL-UHFFFAOYSA-N [6-methoxy-2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-1-oxo-3H-inden-5-yl] acetate Chemical compound COC1=C(C=C2CC(C(C2=C1)=O)=CC=1N(C(=CN1)[N+](=O)[O-])C)OC(C)=O DGJNWYUVKARAOL-UHFFFAOYSA-N 0.000 description 2
- XMUWQZLPLKUXFU-UHFFFAOYSA-N [6-methoxy-2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-3-oxo-1H-inden-5-yl] acetate Chemical compound COC=1C=C2CC(C(C2=CC1OC(C)=O)=O)=CC=1N(C(=CN1)[N+](=O)[O-])C XMUWQZLPLKUXFU-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 150000001350 alkyl halides Chemical class 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 229940058965 antiprotozoal agent against amoebiasis and other protozoal diseases nitroimidazole derivative Drugs 0.000 description 2
- 229940088623 biologically active substance Drugs 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 238000006482 condensation reaction Methods 0.000 description 2
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- 239000012467 final product Substances 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 238000004949 mass spectrometry Methods 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 238000006396 nitration reaction Methods 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 239000000546 pharmaceutical excipient Substances 0.000 description 2
- 235000011007 phosphoric acid Nutrition 0.000 description 2
- 150000003335 secondary amines Chemical class 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 238000004809 thin layer chromatography Methods 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- SJLPSXHHPOFHGX-UHFFFAOYSA-N (1-butyl-5-nitroimidazol-2-yl)methanol Chemical compound CCCCN1C(CO)=NC=C1[N+]([O-])=O SJLPSXHHPOFHGX-UHFFFAOYSA-N 0.000 description 1
- QMSWFMGOXOPHMN-UHFFFAOYSA-N (1-oxo-2,3-dihydroinden-5-yl) benzoate Chemical compound C=1C=C2C(=O)CCC2=CC=1OC(=O)C1=CC=CC=C1 QMSWFMGOXOPHMN-UHFFFAOYSA-N 0.000 description 1
- SQOOZGUUCAYPJE-UHFFFAOYSA-N (3-oxo-1,2-dihydroinden-4-yl) acetate Chemical compound CC(=O)OC1=CC=CC2=C1C(=O)CC2 SQOOZGUUCAYPJE-UHFFFAOYSA-N 0.000 description 1
- WOGITNXCNOTRLK-VOTSOKGWSA-N (e)-3-phenylprop-2-enoyl chloride Chemical compound ClC(=O)\C=C\C1=CC=CC=C1 WOGITNXCNOTRLK-VOTSOKGWSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- MFJCFSDSJMSMQK-UHFFFAOYSA-N 1-(3-hydroxy-4-methylphenyl)ethanone Chemical compound CC(=O)C1=CC=C(C)C(O)=C1 MFJCFSDSJMSMQK-UHFFFAOYSA-N 0.000 description 1
- GAGUQISURGFYNC-UHFFFAOYSA-N 1-[4-(2-hydroxyethoxy)phenyl]ethanone Chemical compound CC(=O)C1=CC=C(OCCO)C=C1 GAGUQISURGFYNC-UHFFFAOYSA-N 0.000 description 1
- GIJREQFJZFXMBZ-UHFFFAOYSA-N 1-[4-[2-(dimethylamino)ethoxy]phenyl]ethanone;hydrochloride Chemical compound Cl.CN(C)CCOC1=CC=C(C(C)=O)C=C1 GIJREQFJZFXMBZ-UHFFFAOYSA-N 0.000 description 1
- JIUFIUFXILBXAC-UHFFFAOYSA-N 1-ethyl-5-nitroimidazole Chemical compound CCN1C=NC=C1[N+]([O-])=O JIUFIUFXILBXAC-UHFFFAOYSA-N 0.000 description 1
- FPZWZCWUIYYYBU-UHFFFAOYSA-N 2-(2-ethoxyethoxy)ethyl acetate Chemical group CCOCCOCCOC(C)=O FPZWZCWUIYYYBU-UHFFFAOYSA-N 0.000 description 1
- CWAVYSZFZKUHHM-UHFFFAOYSA-N 2-(2-hydroxyethoxy)-1-phenylethanone Chemical compound OCCOCC(=O)C1=CC=CC=C1 CWAVYSZFZKUHHM-UHFFFAOYSA-N 0.000 description 1
- XNDSJJDAFCAZAM-UHFFFAOYSA-N 2-(5-nitroimidazol-1-yl)ethyl benzoate Chemical compound [N+](=O)([O-])C1=CN=CN1CCOC(C1=CC=CC=C1)=O XNDSJJDAFCAZAM-UHFFFAOYSA-N 0.000 description 1
- NWOLIURIORAIFV-UHFFFAOYSA-N 2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-3-phenyl-3H-inden-1-one Chemical compound C1(=CC=CC=C1)C1C(C(C2=CC=CC=C12)=O)=CC=1N(C(=CN1)[N+](=O)[O-])C NWOLIURIORAIFV-UHFFFAOYSA-N 0.000 description 1
- FZMNXQMKWJBZQL-UHFFFAOYSA-N 2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-6-propan-2-yl-3H-inden-1-one Chemical compound C(C)(C)C1=CC=C2CC(C(C2=C1)=O)=CC=1N(C(=CN1)[N+](=O)[O-])C FZMNXQMKWJBZQL-UHFFFAOYSA-N 0.000 description 1
- XUUOYQOKQATGRR-UHFFFAOYSA-N 2-[[2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-1-oxo-3H-inden-5-yl]oxy]ethyl acetate Chemical compound C(C)(=O)OCCOC=1C=C2CC(C(C2=CC1)=O)=CC=1N(C(=CN1)[N+](=O)[O-])C XUUOYQOKQATGRR-UHFFFAOYSA-N 0.000 description 1
- LGXFSKZWCMLCBH-UHFFFAOYSA-N 2-[[6-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-5-oxo-7,8-dihydronaphthalen-2-yl]oxy]ethyl 4-methylbenzenesulfonate Chemical compound C1=CC(C)=CC=C1S(=O)(=O)OCCOC1=CC=C(C(=O)C(CC2)=CC=3N(C(=CN=3)[N+]([O-])=O)C)C2=C1 LGXFSKZWCMLCBH-UHFFFAOYSA-N 0.000 description 1
- WCJNIDIXZYVFKO-UHFFFAOYSA-N 2-[[6-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-5-oxo-7,8-dihydronaphthalen-2-yl]oxy]ethyl acetate Chemical compound C(C)(=O)OCCOC=1C=C2CCC(C(C2=CC1)=O)=CC=1N(C(=CN1)[N+](=O)[O-])C WCJNIDIXZYVFKO-UHFFFAOYSA-N 0.000 description 1
- YMDNODNLFSHHCV-UHFFFAOYSA-N 2-chloro-n,n-diethylethanamine Chemical compound CCN(CC)CCCl YMDNODNLFSHHCV-UHFFFAOYSA-N 0.000 description 1
- RAGSWDIQBBZLLL-UHFFFAOYSA-N 2-chloroethyl(diethyl)azanium;chloride Chemical compound Cl.CCN(CC)CCCl RAGSWDIQBBZLLL-UHFFFAOYSA-N 0.000 description 1
- LQLJZSJKRYTKTP-UHFFFAOYSA-N 2-dimethylaminoethyl chloride hydrochloride Chemical compound Cl.CN(C)CCCl LQLJZSJKRYTKTP-UHFFFAOYSA-N 0.000 description 1
- DTCMYTPNBWNTIW-UHFFFAOYSA-N 2-ethoxy-2,3-dihydroinden-1-one Chemical compound C1=CC=C2C(=O)C(OCC)CC2=C1 DTCMYTPNBWNTIW-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- YZEUHQHUFTYLPH-UHFFFAOYSA-N 2-nitroimidazole Chemical compound [O-][N+](=O)C1=NC=CN1 YZEUHQHUFTYLPH-UHFFFAOYSA-N 0.000 description 1
- 150000004959 2-nitroimidazoles Chemical class 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- DRGVIUMCNFXLKU-UHFFFAOYSA-N 3-methyl-2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-3H-inden-1-one Chemical compound CC1C(C(C2=CC=CC=C12)=O)=CC=1N(C(=CN1)[N+](=O)[O-])C DRGVIUMCNFXLKU-UHFFFAOYSA-N 0.000 description 1
- SIUOTMYWHGODQX-UHFFFAOYSA-N 3-phenyl-2,3-dihydroinden-1-one Chemical compound C12=CC=CC=C2C(=O)CC1C1=CC=CC=C1 SIUOTMYWHGODQX-UHFFFAOYSA-N 0.000 description 1
- ACZGCWSMSTYWDQ-UHFFFAOYSA-N 3h-1-benzofuran-2-one Chemical compound C1=CC=C2OC(=O)CC2=C1 ACZGCWSMSTYWDQ-UHFFFAOYSA-N 0.000 description 1
- XQODIRIVQXQUFN-UHFFFAOYSA-N 4,5-dimethoxy-2,3-dihydroinden-1-one Chemical compound COC1=CC=C2C(=O)CCC2=C1OC XQODIRIVQXQUFN-UHFFFAOYSA-N 0.000 description 1
- APYKLGSCNNJICF-UHFFFAOYSA-N 4,5-dimethoxy-2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-3H-inden-1-one Chemical compound COC1=C2CC(C(C2=CC=C1OC)=O)=CC=1N(C(=CN1)[N+](=O)[O-])C APYKLGSCNNJICF-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- MSTDXOZUKAQDRL-UHFFFAOYSA-N 4-Chromanone Chemical compound C1=CC=C2C(=O)CCOC2=C1 MSTDXOZUKAQDRL-UHFFFAOYSA-N 0.000 description 1
- PQVHMOLNSYFXIJ-UHFFFAOYSA-N 4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-1-[2-oxo-2-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethyl]pyrazole-3-carboxylic acid Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C=1C(=NN(C=1)CC(N1CC2=C(CC1)NN=N2)=O)C(=O)O PQVHMOLNSYFXIJ-UHFFFAOYSA-N 0.000 description 1
- ZTWBCFVYMDBPPD-UHFFFAOYSA-N 4-bromo-7-hydroxy-2,3-dihydroinden-1-one Chemical compound OC1=CC=C(Br)C2=C1C(=O)CC2 ZTWBCFVYMDBPPD-UHFFFAOYSA-N 0.000 description 1
- MYCZDIIPHIGLCH-UHFFFAOYSA-N 4-chloro-2,3-dihydroinden-1-one Chemical compound ClC1=CC=CC2=C1CCC2=O MYCZDIIPHIGLCH-UHFFFAOYSA-N 0.000 description 1
- YVNMNVRDMWVUNR-UHFFFAOYSA-N 4-chloro-7-hydroxy-2,3-dihydroinden-1-one Chemical compound OC1=CC=C(Cl)C2=C1C(=O)CC2 YVNMNVRDMWVUNR-UHFFFAOYSA-N 0.000 description 1
- CKSCMRNFDBWFND-UHFFFAOYSA-N 4-hydroxy-2,3-dihydroinden-1-one Chemical compound OC1=CC=CC2=C1CCC2=O CKSCMRNFDBWFND-UHFFFAOYSA-N 0.000 description 1
- PHGWEMNTLBGHNW-UHFFFAOYSA-N 4-hydroxy-2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-3H-inden-1-one Chemical compound OC1=C2CC(C(C2=CC=C1)=O)=CC=1N(C(=CN1)[N+](=O)[O-])C PHGWEMNTLBGHNW-UHFFFAOYSA-N 0.000 description 1
- BTYSYELHQDGJAB-UHFFFAOYSA-N 4-methoxy-2,3-dihydroinden-1-one Chemical compound COC1=CC=CC2=C1CCC2=O BTYSYELHQDGJAB-UHFFFAOYSA-N 0.000 description 1
- JEEGSBBVYUJLNR-UHFFFAOYSA-N 4-methoxy-2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-3H-inden-1-one Chemical compound COC1=C2CC(C(C2=CC=C1)=O)=CC=1N(C(=CN1)[N+](=O)[O-])C JEEGSBBVYUJLNR-UHFFFAOYSA-N 0.000 description 1
- WAWRQRQDWAMCBW-UHFFFAOYSA-N 4-methyl-2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-3H-inden-1-one Chemical compound CC1=C2CC(C(C2=CC=C1)=O)=CC=1N(C(=CN1)[N+](=O)[O-])C WAWRQRQDWAMCBW-UHFFFAOYSA-N 0.000 description 1
- GXHNCAMVICUOOD-UHFFFAOYSA-N 4-methyl-N-[2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-1-oxo-3H-inden-5-yl]benzenesulfonamide Chemical compound C1(=CC=C(C=C1)S(=O)(=O)NC=1C=C2CC(C(C2=CC1)=O)=CC=1N(C(=CN1)[N+](=O)[O-])C)C GXHNCAMVICUOOD-UHFFFAOYSA-N 0.000 description 1
- WMDAUVLSCBKCBO-UHFFFAOYSA-N 5,6-dihydroxy-2,3-dihydroinden-1-one Chemical compound C1=C(O)C(O)=CC2=C1C(=O)CC2 WMDAUVLSCBKCBO-UHFFFAOYSA-N 0.000 description 1
- IHMQOBPGHZFGLC-UHFFFAOYSA-N 5,6-dimethoxy-2,3-dihydroinden-1-one Chemical compound C1=C(OC)C(OC)=CC2=C1C(=O)CC2 IHMQOBPGHZFGLC-UHFFFAOYSA-N 0.000 description 1
- VAYNNOKNORRJTN-UHFFFAOYSA-N 5,6-dimethoxy-2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-3H-inden-1-one Chemical compound COC=1C=C2CC(C(C2=CC1OC)=O)=CC=1N(C(=CN1)[N+](=O)[O-])C VAYNNOKNORRJTN-UHFFFAOYSA-N 0.000 description 1
- ACTHIPKFWKJAAS-UHFFFAOYSA-N 5,7-dimethyl-2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-3,4-dihydronaphthalen-1-one Chemical compound CC1=C2CCC(C(C2=CC(=C1)C)=O)=CC=1N(C(=CN1)[N+](=O)[O-])C ACTHIPKFWKJAAS-UHFFFAOYSA-N 0.000 description 1
- UYJCNOMEGPDXMV-UHFFFAOYSA-N 5,7-dimethyl-3,4-dihydro-2h-naphthalen-1-one Chemical compound C1CCC(=O)C2=CC(C)=CC(C)=C21 UYJCNOMEGPDXMV-UHFFFAOYSA-N 0.000 description 1
- IAGBSOUQRXYEMV-UHFFFAOYSA-N 5-(2-chloroethoxy)-2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-3H-inden-1-one Chemical compound ClCCOC=1C=C2CC(C(C2=CC1)=O)=CC=1N(C(=CN1)[N+](=O)[O-])C IAGBSOUQRXYEMV-UHFFFAOYSA-N 0.000 description 1
- AGQQGJQMPHRIOX-UHFFFAOYSA-N 5-(2-ethoxyethoxy)-2,3-dihydroinden-1-one Chemical compound C(C)OCCOC=1C=C2CCC(C2=CC1)=O AGQQGJQMPHRIOX-UHFFFAOYSA-N 0.000 description 1
- VYNSLCZZQAUSQM-UHFFFAOYSA-N 5-(2-morpholin-4-ylethoxy)-2,3-dihydroinden-1-one hydrochloride Chemical compound Cl.O1CCN(CC1)CCOC=1C=C2CCC(C2=CC1)=O VYNSLCZZQAUSQM-UHFFFAOYSA-N 0.000 description 1
- BYHOLJMUXHEAMZ-UHFFFAOYSA-N 5-(2-pyrrolidin-1-ylethoxy)-2,3-dihydroinden-1-one hydrochloride Chemical compound Cl.N1(CCCC1)CCOC=1C=C2CCC(C2=CC1)=O BYHOLJMUXHEAMZ-UHFFFAOYSA-N 0.000 description 1
- XXAWPKPQMFWGTQ-UHFFFAOYSA-N 5-(dimethylamino)-2,3-dihydroinden-1-one Chemical compound CN(C)C1=CC=C2C(=O)CCC2=C1 XXAWPKPQMFWGTQ-UHFFFAOYSA-N 0.000 description 1
- RXKZAWOROTYWDR-UHFFFAOYSA-N 5-[2-(dimethylamino)ethoxy]-2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-3h-inden-1-one Chemical compound C1C2=CC(OCCN(C)C)=CC=C2C(=O)C1=CC1=NC=C([N+]([O-])=O)N1C RXKZAWOROTYWDR-UHFFFAOYSA-N 0.000 description 1
- HODOSJNSRPXYBH-UHFFFAOYSA-N 5-amino-2,3-dihydroinden-1-one Chemical compound NC1=CC=C2C(=O)CCC2=C1 HODOSJNSRPXYBH-UHFFFAOYSA-N 0.000 description 1
- ZTDQOMMUEHXPKO-UHFFFAOYSA-N 5-amino-2-[(1-ethyl-5-nitroimidazol-2-yl)methylidene]-3H-inden-1-one Chemical compound NC=1C=C2CC(C(C2=CC1)=O)=CC=1N(C(=CN1)[N+](=O)[O-])CC ZTDQOMMUEHXPKO-UHFFFAOYSA-N 0.000 description 1
- HLHYKDZZYONDKO-UHFFFAOYSA-N 5-amino-2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-3H-inden-1-one Chemical compound NC=1C=C2CC(C(C2=CC1)=O)=CC=1N(C(=CN1)[N+](=O)[O-])C HLHYKDZZYONDKO-UHFFFAOYSA-N 0.000 description 1
- CYHREFRIOXCPGS-UHFFFAOYSA-N 5-butoxy-1,3-dihydroinden-2-one Chemical compound C(CCC)OC=1C=C2CC(CC2=CC1)=O CYHREFRIOXCPGS-UHFFFAOYSA-N 0.000 description 1
- MEDSHTHCZIOVPU-UHFFFAOYSA-N 5-chloro-2,3-dihydroinden-1-one Chemical compound ClC1=CC=C2C(=O)CCC2=C1 MEDSHTHCZIOVPU-UHFFFAOYSA-N 0.000 description 1
- FXYGJDAGSIFPIB-UHFFFAOYSA-N 5-chloro-2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-3H-inden-1-one Chemical compound ClC=1C=C2CC(C(C2=CC1)=O)=CC=1N(C(=CN1)[N+](=O)[O-])C FXYGJDAGSIFPIB-UHFFFAOYSA-N 0.000 description 1
- JKNWCWRDILUFOU-UHFFFAOYSA-N 5-chloro-4,6-dimethyl-1-benzofuran-3-one Chemical compound CC1=C(Cl)C(C)=CC2=C1C(=O)CO2 JKNWCWRDILUFOU-UHFFFAOYSA-N 0.000 description 1
- FLMVKFTYGACBNH-UHFFFAOYSA-N 5-ethoxy-2,3-dihydroinden-1-one Chemical compound CCOC1=CC=C2C(=O)CCC2=C1 FLMVKFTYGACBNH-UHFFFAOYSA-N 0.000 description 1
- ZIYMSHKCDCYEBL-UHFFFAOYSA-N 5-hydroxy-6,7-dimethoxy-3,4-dihydro-2h-naphthalen-1-one Chemical compound O=C1CCCC2=C1C=C(OC)C(OC)=C2O ZIYMSHKCDCYEBL-UHFFFAOYSA-N 0.000 description 1
- ACECGHQDQWBTBM-UHFFFAOYSA-N 5-hydroxy-6-methoxy-2,3-dihydroinden-1-one Chemical compound C1=C(O)C(OC)=CC2=C1CCC2=O ACECGHQDQWBTBM-UHFFFAOYSA-N 0.000 description 1
- CKPZRIYEXNKFLL-UHFFFAOYSA-N 5-methoxy-2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-3H-inden-1-one Chemical compound COC=1C=C2CC(C(C2=CC1)=O)=CC=1N(C(=CN1)[N+](=O)[O-])C CKPZRIYEXNKFLL-UHFFFAOYSA-N 0.000 description 1
- 150000004958 5-nitroimidazoles Chemical class 0.000 description 1
- KZCXMVUPIHBDQP-UHFFFAOYSA-N 6,7-dimethoxy-1-benzofuran-3-one Chemical compound COC1=CC=C2C(=O)COC2=C1OC KZCXMVUPIHBDQP-UHFFFAOYSA-N 0.000 description 1
- FMJAEMCDTDPGTL-UHFFFAOYSA-N 6,7-dimethoxy-2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-1-benzofuran-3-one Chemical compound O1C2=C(OC)C(OC)=CC=C2C(=O)C1=CC1=NC=C([N+]([O-])=O)N1C FMJAEMCDTDPGTL-UHFFFAOYSA-N 0.000 description 1
- SORFNYWLKDSNNF-UHFFFAOYSA-N 6-(2,6-dimethylpyridin-4-yl)-5-phenyl-1,2,4-triazin-3-amine Chemical compound CC1=NC(C)=CC(C=2C(=NC(N)=NN=2)C=2C=CC=CC=2)=C1 SORFNYWLKDSNNF-UHFFFAOYSA-N 0.000 description 1
- CXZSQSHKHHTTDN-UHFFFAOYSA-N 6-(2-hydroxyethoxy)-2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-3,4-dihydronaphthalen-1-one Chemical compound OCCOC=1C=C2CCC(C(C2=CC1)=O)=CC=1N(C(=CN1)[N+](=O)[O-])C CXZSQSHKHHTTDN-UHFFFAOYSA-N 0.000 description 1
- ZXGAPAUXCAUXDW-UHFFFAOYSA-N 6-(methylamino)-3,4-dihydro-2h-naphthalen-1-one Chemical compound O=C1CCCC2=CC(NC)=CC=C21 ZXGAPAUXCAUXDW-UHFFFAOYSA-N 0.000 description 1
- OMXBYAZWEHKRHC-UHFFFAOYSA-N 6-[2-(dimethylamino)ethoxy]-2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-3,4-dihydronaphthalen-1-one Chemical compound C1CC2=CC(OCCN(C)C)=CC=C2C(=O)C1=CC1=NC=C([N+]([O-])=O)N1C OMXBYAZWEHKRHC-UHFFFAOYSA-N 0.000 description 1
- IBGSTOWDILMEHA-UHFFFAOYSA-N 6-amino-2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-3,4-dihydronaphthalen-1-one Chemical compound NC=1C=C2CCC(C(C2=CC1)=O)=CC=1N(C(=CN1)[N+](=O)[O-])C IBGSTOWDILMEHA-UHFFFAOYSA-N 0.000 description 1
- BEVVUJBVEXJGKM-UHFFFAOYSA-N 6-amino-3,4-dihydro-2h-naphthalen-1-one Chemical compound O=C1CCCC2=CC(N)=CC=C21 BEVVUJBVEXJGKM-UHFFFAOYSA-N 0.000 description 1
- SMSGJDOJSQHQIW-UHFFFAOYSA-N 6-chloro-2,3-dihydroinden-1-one Chemical compound ClC1=CC=C2CCC(=O)C2=C1 SMSGJDOJSQHQIW-UHFFFAOYSA-N 0.000 description 1
- GBDMODVZBPFQKI-UHFFFAOYSA-N 6-hydroxy-1-benzofuran-3-one Chemical compound OC1=CC=C2C(=O)COC2=C1 GBDMODVZBPFQKI-UHFFFAOYSA-N 0.000 description 1
- FEUMSMHGLKFCLZ-UHFFFAOYSA-N 6-hydroxy-5-methoxy-2,3-dihydroinden-1-one Chemical compound C1=C(O)C(OC)=CC2=C1C(=O)CC2 FEUMSMHGLKFCLZ-UHFFFAOYSA-N 0.000 description 1
- IDIFMIWQKRIFFX-UHFFFAOYSA-N 6-hydroxy-5-methoxy-2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-3H-inden-1-one Chemical compound COC=1C=C2CC(C(C2=CC1O)=O)=CC=1N(C(=CN1)[N+](=O)[O-])C IDIFMIWQKRIFFX-UHFFFAOYSA-N 0.000 description 1
- TWANVBMFHYTTTN-UHFFFAOYSA-N 6-methoxy-2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-3,4-dihydronaphthalen-1-one Chemical compound COC=1C=C2CCC(C(C2=CC1)=O)=CC=1N(C(=CN1)[N+](=O)[O-])C TWANVBMFHYTTTN-UHFFFAOYSA-N 0.000 description 1
- MNALUTYMBUBKNX-UHFFFAOYSA-N 6-methoxy-3,4-dihydro-2h-naphthalen-1-one Chemical compound O=C1CCCC2=CC(OC)=CC=C21 MNALUTYMBUBKNX-UHFFFAOYSA-N 0.000 description 1
- MCUOFUVXPWBTDH-UHFFFAOYSA-N 6-methyl-2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-3H-inden-1-one Chemical compound CC1=CC=C2CC(C(C2=C1)=O)=CC=1N(C(=CN1)[N+](=O)[O-])C MCUOFUVXPWBTDH-UHFFFAOYSA-N 0.000 description 1
- DUYPYGNHXIOWBV-UHFFFAOYSA-N 6-propan-2-yl-2,3-dihydroinden-1-one Chemical compound CC(C)C1=CC=C2CCC(=O)C2=C1 DUYPYGNHXIOWBV-UHFFFAOYSA-N 0.000 description 1
- LXAQGDPMKKHFKF-UHFFFAOYSA-N 7-chloro-4,6-dimethoxy-1-benzofuran-3-one Chemical compound COC1=CC(OC)=C(Cl)C2=C1C(=O)CO2 LXAQGDPMKKHFKF-UHFFFAOYSA-N 0.000 description 1
- NWIGGOXLUZMSRH-UHFFFAOYSA-N 7-chloro-4,6-dimethoxy-2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-1-benzofuran-3-one Chemical compound ClC1=C(C=C(C=2C(C(OC21)=CC=2N(C(=CN2)[N+](=O)[O-])C)=O)OC)OC NWIGGOXLUZMSRH-UHFFFAOYSA-N 0.000 description 1
- YAZAFYZFXUURBC-UHFFFAOYSA-N 7-chloro-4-fluoro-3-methyl-2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-3H-inden-1-one Chemical compound CC1C(=CC2=NC=C(N2C)[N+]([O-])=O)C(=O)C2=C(Cl)C=CC(F)=C12 YAZAFYZFXUURBC-UHFFFAOYSA-N 0.000 description 1
- HFMZPBSZKCDKOR-UHFFFAOYSA-N 7-hydroxy-2,3-dihydroinden-1-one Chemical compound OC1=CC=CC2=C1C(=O)CC2 HFMZPBSZKCDKOR-UHFFFAOYSA-N 0.000 description 1
- KUBMVWRTCSIXMU-UHFFFAOYSA-N 7-hydroxy-2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-3H-inden-1-one Chemical compound OC=1C=CC=C2CC(C(C12)=O)=CC=1N(C(=CN1)[N+](=O)[O-])C KUBMVWRTCSIXMU-UHFFFAOYSA-N 0.000 description 1
- DRHXUYFRRQUTNN-UHFFFAOYSA-N 7-hydroxy-3,4-dimethyl-2,3-dihydroinden-1-one Chemical compound CC1=CC=C(O)C2=C1C(C)CC2=O DRHXUYFRRQUTNN-UHFFFAOYSA-N 0.000 description 1
- DVZOPBRQQANNAS-UHFFFAOYSA-N 7-hydroxychromene-2,4-dione Chemical compound O=C1CC(=O)OC2=CC(O)=CC=C21 DVZOPBRQQANNAS-UHFFFAOYSA-N 0.000 description 1
- CZXBVBATQPHSSL-UHFFFAOYSA-N 7-methoxy-2,3-dihydroinden-1-one Chemical compound COC1=CC=CC2=C1C(=O)CC2 CZXBVBATQPHSSL-UHFFFAOYSA-N 0.000 description 1
- PMBWLPGJYMCUCE-UHFFFAOYSA-N 7-methoxy-2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-3H-inden-1-one Chemical compound COC=1C=CC=C2CC(C(C12)=O)=CC=1N(C(=CN1)[N+](=O)[O-])C PMBWLPGJYMCUCE-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- NAVKVJHCJPCNJR-UHFFFAOYSA-N C(C)(=O)NC1=CC=C(C=C1)C(C=CC=1N(C(=CN1)[N+](=O)[O-])C)=O Chemical compound C(C)(=O)NC1=CC=C(C=C1)C(C=CC=1N(C(=CN1)[N+](=O)[O-])C)=O NAVKVJHCJPCNJR-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- VDNVKWFAUUDWCQ-UHFFFAOYSA-N FC1=C2C(CC(C2=C(C=C1)Cl)=O)C Chemical compound FC1=C2C(CC(C2=C(C=C1)Cl)=O)C VDNVKWFAUUDWCQ-UHFFFAOYSA-N 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- WEBCZGJWXXPNHB-UHFFFAOYSA-N N1-(5-oxo-5,6,7,8-tetrahydronaphthalen-2-yl)acetamide Chemical compound O=C1CCCC2=CC(NC(=O)C)=CC=C21 WEBCZGJWXXPNHB-UHFFFAOYSA-N 0.000 description 1
- LVPWKJQIJLGVBZ-UHFFFAOYSA-N OCCOC1C(C2=CC=CC=C2C1)=O Chemical compound OCCOC1C(C2=CC=CC=C2C1)=O LVPWKJQIJLGVBZ-UHFFFAOYSA-N 0.000 description 1
- 229930040373 Paraformaldehyde Natural products 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 241000224526 Trichomonas Species 0.000 description 1
- INLXWEPOPWUEQU-UHFFFAOYSA-N [2-[(1-butyl-5-nitroimidazol-2-yl)methylidene]-1-oxo-3H-inden-5-yl] acetate Chemical compound C(C)(=O)OC=1C=C2CC(C(C2=CC1)=O)=CC=1N(C(=CN1)[N+](=O)[O-])CCCC INLXWEPOPWUEQU-UHFFFAOYSA-N 0.000 description 1
- ZUSCMTAIOCIDRZ-UHFFFAOYSA-N [2-[(1-ethyl-5-nitroimidazol-2-yl)methylidene]-1-oxo-3H-inden-5-yl] acetate Chemical compound C(C)(=O)OC=1C=C2CC(C(C2=CC1)=O)=CC=1N(C(=CN1)[N+](=O)[O-])CC ZUSCMTAIOCIDRZ-UHFFFAOYSA-N 0.000 description 1
- ZURUMWDEKSVHQF-UHFFFAOYSA-N [2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-1-oxo-3H-inden-5-yl] acetate Chemical compound C(C)(=O)OC=1C=C2CC(C(C2=CC1)=O)=CC=1N(C(=CN1)[N+](=O)[O-])C ZURUMWDEKSVHQF-UHFFFAOYSA-N 0.000 description 1
- DLTCVBCFGMEENN-UHFFFAOYSA-N [2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-3-oxo-1-benzofuran-6-yl] acetate Chemical compound C(C)(=O)OC1=CC2=C(C(C(O2)=CC=2N(C(=CN2)[N+](=O)[O-])C)=O)C=C1 DLTCVBCFGMEENN-UHFFFAOYSA-N 0.000 description 1
- MTSIHPNKISGDDS-UHFFFAOYSA-N [2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-3-oxo-1H-inden-4-yl] acetate Chemical compound C(C)(=O)OC=1C=CC=C2CC(C(C12)=O)=CC=1N(C(=CN1)[N+](=O)[O-])C MTSIHPNKISGDDS-UHFFFAOYSA-N 0.000 description 1
- NNDHNVRZAIZPBA-UHFFFAOYSA-N [3-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-4-oxochromen-7-yl] acetate Chemical compound C(C)(=O)OC1=CC=C2C(C(COC2=C1)=CC=1N(C(=CN1)[N+](=O)[O-])C)=O NNDHNVRZAIZPBA-UHFFFAOYSA-N 0.000 description 1
- UJTDFBJJWFCRMC-UHFFFAOYSA-N [7-bromo-2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-3-oxo-1H-inden-4-yl] acetate Chemical compound BrC1=C2CC(C(C2=C(C=C1)OC(C)=O)=O)=CC=1N(C(=CN1)[N+](=O)[O-])C UJTDFBJJWFCRMC-UHFFFAOYSA-N 0.000 description 1
- VGCGZUOVJXBUSJ-UHFFFAOYSA-N [7-chloro-2-[(1-methyl-5-nitroimidazol-2-yl)methylidene]-3-oxo-1H-inden-4-yl] acetate Chemical compound ClC1=C2CC(C(C2=C(C=C1)OC(C)=O)=O)=CC=1N(C(=CN1)[N+](=O)[O-])C VGCGZUOVJXBUSJ-UHFFFAOYSA-N 0.000 description 1
- FXRLQKXOJACDDT-UHFFFAOYSA-N [acetyloxy-(1-methyl-5-nitroimidazol-2-yl)methyl] acetate Chemical compound [N+](=O)([O-])C1=CN=C(N1C)C(OC(C)=O)OC(C)=O FXRLQKXOJACDDT-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 125000005041 acyloxyalkyl group Chemical group 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 230000000843 anti-fungal effect Effects 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- ZSIQJIWKELUFRJ-UHFFFAOYSA-N azepane Chemical compound C1CCCNCC1 ZSIQJIWKELUFRJ-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 230000003115 biocidal effect Effects 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 125000002474 dimethylaminoethoxy group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])C([H])([H])O* 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- CAFXCCNVUAESCN-UHFFFAOYSA-N ethenyl 4-methylbenzenesulfonate Chemical group CC1=CC=C(S(=O)(=O)OC=C)C=C1 CAFXCCNVUAESCN-UHFFFAOYSA-N 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- NSHIYIMHYBAIEY-UHFFFAOYSA-N ethyl hypochlorite Chemical compound CCOCl NSHIYIMHYBAIEY-UHFFFAOYSA-N 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- IJDNQMDRQITEOD-UHFFFAOYSA-N n-butane Chemical compound CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 description 1
- OFBQJSOFQDEBGM-UHFFFAOYSA-N n-pentane Natural products CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 150000004967 organic peroxy acids Chemical class 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 229920002866 paraformaldehyde Polymers 0.000 description 1
- 230000003071 parasitic effect Effects 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000001384 succinic acid Substances 0.000 description 1
- 235000011044 succinic acid Nutrition 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- HFRXJVQOXRXOPP-UHFFFAOYSA-N thionyl bromide Chemical compound BrS(Br)=O HFRXJVQOXRXOPP-UHFFFAOYSA-N 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 125000004417 unsaturated alkyl group Chemical group 0.000 description 1
- 229930195735 unsaturated hydrocarbon Natural products 0.000 description 1
- 239000003039 volatile agent Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/08—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms
- C07D295/084—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/088—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings to an acyclic saturated chain
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/68—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms
- C07C45/70—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form
- C07C45/71—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form being hydroxy groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/66—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/91—Nitro radicals
- C07D233/92—Nitro radicals attached in position 4 or 5
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/66—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/91—Nitro radicals
- C07D233/92—Nitro radicals attached in position 4 or 5
- C07D233/94—Nitro radicals attached in position 4 or 5 with hydrocarbon radicals, substituted by oxygen or sulfur atoms, attached to other ring members
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/66—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/91—Nitro radicals
- C07D233/92—Nitro radicals attached in position 4 or 5
- C07D233/95—Nitro radicals attached in position 4 or 5 with hydrocarbon radicals, substituted by nitrogen atoms, attached to other ring members
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19691935685 DE1935685A1 (de) | 1969-07-10 | 1969-07-10 | Neue antimikrobiell wirksame Verbindungen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL81333B1 true PL81333B1 (enFirst) | 1975-08-30 |
Family
ID=5739764
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1970141917A PL81333B1 (enFirst) | 1969-07-10 | 1970-07-08 |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US3721668A (enFirst) |
| JP (1) | JPS52948B1 (enFirst) |
| AT (1) | AT295523B (enFirst) |
| BE (1) | BE753277A (enFirst) |
| CA (1) | CA919181A (enFirst) |
| CH (1) | CH547290A (enFirst) |
| DE (1) | DE1935685A1 (enFirst) |
| EG (1) | EG10938A (enFirst) |
| ES (1) | ES381633A1 (enFirst) |
| FR (1) | FR2059500B1 (enFirst) |
| GB (1) | GB1320712A (enFirst) |
| IL (1) | IL34881A (enFirst) |
| NL (1) | NL7010291A (enFirst) |
| NO (1) | NO127348B (enFirst) |
| PL (1) | PL81333B1 (enFirst) |
| SE (1) | SE387115B (enFirst) |
| SU (1) | SU365886A3 (enFirst) |
| ZA (1) | ZA704381B (enFirst) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3989832A (en) * | 1972-04-01 | 1976-11-02 | Boehringer Mannheim G.M.B.H. | Combating bacteria with nitroimidazolyl-triazolo-pyridiazine compounds |
| PL91799B1 (enFirst) * | 1972-04-01 | 1977-03-31 | ||
| US4086351A (en) * | 1975-10-09 | 1978-04-25 | Imperial Chemical Industries Limited | 1,2,4-Triazole-containing compounds and their use as pesticides |
| US4087536A (en) * | 1976-05-04 | 1978-05-02 | The Dow Chemical Company | Method for the use of thienylvinylimidazoles as anthelmintics |
| US4067989A (en) * | 1976-05-07 | 1978-01-10 | Imperial Chemical Industries Limited | 1,3-Diazole heterocyclic compounds and their use as pesticides |
| GB2060611A (en) * | 1979-08-08 | 1981-05-07 | Squibb & Sons Inc | 2,3-Dihydro-4H-1- benzothiopyran-4-ones and 2,3- dihydro-1H-inden-1-ones |
| US4273776A (en) * | 1980-01-30 | 1981-06-16 | E. R. Squibb & Sons, Inc. | Antibacterial and antifungal derivatives of 3-(1H-imidazol-1-yl)-2-propen-1-ones |
| US5158943A (en) * | 1988-11-21 | 1992-10-27 | Takeda Chemical Industries, Ltd. | Sulfur-containing heterocyclic compounds |
| DK656789A (da) * | 1988-12-28 | 1990-06-29 | Takeda Chemical Industries Ltd | Benzoheterocykliske forbindelser |
| JP2001510801A (ja) * | 1997-07-25 | 2001-08-07 | フィテラ インク. | 置換アウロン誘導体 |
| DE69805596T2 (de) * | 1997-12-16 | 2002-11-28 | Ssp Co., Ltd. | Imidazol-Derivat und dieses als aktiven Bestandteil enthaltendes Arzneimittel |
| CN1324212A (zh) * | 1998-09-25 | 2001-11-28 | 维洛药品公司 | 治疗或预防病毒感染及有关疾病的方法 |
| US20040154264A1 (en) * | 2000-08-04 | 2004-08-12 | Colbert Elizabeth A. | Coated gypsum board products and method of manufacture |
| CN103483476B (zh) * | 2012-06-13 | 2017-02-22 | 中国石油化工股份有限公司 | 一种抗菌高分子聚合物及其制备方法和应用 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1480662A (fr) * | 1965-10-07 | 1967-05-12 | Pfizer & Co C | Perfectionnements aux procédés pour la préparation de vinyl-amidines cycliques substituées |
| AT277985B (de) * | 1967-11-14 | 1970-01-12 | Schering Ag | Verfahren zur Herstellung von neuen Nitro-furan-, -thiophen- oder -pyrrol-derivaten |
-
1969
- 1969-07-10 DE DE19691935685 patent/DE1935685A1/de active Pending
-
1970
- 1970-06-25 ZA ZA704381A patent/ZA704381B/xx unknown
- 1970-07-02 SU SU1454753A patent/SU365886A3/ru active
- 1970-07-03 SE SE7009299A patent/SE387115B/xx unknown
- 1970-07-04 EG EG304/70A patent/EG10938A/xx active
- 1970-07-08 US US00053298A patent/US3721668A/en not_active Expired - Lifetime
- 1970-07-08 PL PL1970141917A patent/PL81333B1/pl unknown
- 1970-07-08 GB GB3317870A patent/GB1320712A/en not_active Expired
- 1970-07-09 IL IL34881A patent/IL34881A/en unknown
- 1970-07-09 NO NO2694/70A patent/NO127348B/no unknown
- 1970-07-09 FR FR7025515A patent/FR2059500B1/fr not_active Expired
- 1970-07-09 AT AT626270A patent/AT295523B/de not_active IP Right Cessation
- 1970-07-09 ES ES381633A patent/ES381633A1/es not_active Expired
- 1970-07-10 JP JP45060553A patent/JPS52948B1/ja active Pending
- 1970-07-10 CH CH1054470A patent/CH547290A/xx not_active IP Right Cessation
- 1970-07-10 CA CA087898A patent/CA919181A/en not_active Expired
- 1970-07-10 BE BE753277D patent/BE753277A/xx unknown
- 1970-07-10 NL NL7010291A patent/NL7010291A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IL34881A (en) | 1974-07-31 |
| FR2059500B1 (enFirst) | 1974-02-01 |
| NO127348B (enFirst) | 1973-06-12 |
| FR2059500A1 (enFirst) | 1971-06-04 |
| GB1320712A (en) | 1973-06-20 |
| IL34881A0 (en) | 1971-02-25 |
| NL7010291A (enFirst) | 1971-01-12 |
| JPS52948B1 (enFirst) | 1977-01-11 |
| SU365886A3 (enFirst) | 1973-01-08 |
| EG10938A (en) | 1976-10-31 |
| ZA704381B (en) | 1971-03-31 |
| SE387115B (sv) | 1976-08-30 |
| US3721668A (en) | 1973-03-20 |
| DE1935685A1 (de) | 1971-01-14 |
| AT295523B (de) | 1972-01-10 |
| CA919181A (en) | 1973-01-16 |
| ES381633A1 (es) | 1972-12-01 |
| BE753277A (fr) | 1971-01-11 |
| CH547290A (de) | 1974-03-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL81333B1 (enFirst) | ||
| PL93115B1 (enFirst) | ||
| EP0691966B1 (en) | Quinolines as type iv phosphodiesterase inhibitors | |
| CA1217767A (en) | Pyrimidones | |
| AU2008345681A1 (en) | Imidazo [1,2-a] pyridine compounds | |
| EP0291916A1 (en) | Dithioacetal compounds, processes for preparation thereof and pharmaceutical composition comprising the same | |
| JPH0670021B2 (ja) | 医薬品としてのスルホンアミドの使用および新規スルホンアミド | |
| EP0481429A2 (en) | Quinoline derivatives | |
| US4476132A (en) | Acylquinolinone derivatives, and antiallergic preparations and methods of inhibiting allergic reactions using them | |
| EP0531823A1 (en) | Bicyclic carboxylic acid derivatives as anti-inflammatory agents | |
| SU365886A1 (enFirst) | ||
| CA1092112A (en) | 3-substituted-4-aminoalcoxy-5,6-condensed ring-2- pyranones and their preparation | |
| FR2675802A1 (fr) | Antiserotonines, leur preparation et les medicaments les contenant. | |
| PL147636B1 (en) | Method of obtaining novel derivatives of isoquinoline | |
| JPH06763B2 (ja) | ベンゾ〔h〕シンノリン誘導体 | |
| EP0074130B1 (en) | New imidazole compounds, process for the preparation thereof and pharmaceutical compositions containing them | |
| US3126384A (en) | X-quinolyl-aminoalkylamino | |
| IE830558L (en) | Bicyclic benzo fused compounds | |
| PL98290B1 (pl) | Sposob wytwarzania pochodnych chinazolinonu | |
| EP0233760A1 (en) | Sulfenamide derivatives and their production | |
| US5019573A (en) | Substituted dibenzofurans and methods of using same | |
| PT93606B (pt) | Processo para a preparacao de novos 4(5)-imidazois que inibem a aromatase | |
| PL119177B1 (en) | Process for preparing novel derivatives of carbostyryl and oxyindolesiindola | |
| CZ342590A3 (en) | Derivatives of 2-imino-3-heterocyclyl alkylbenzothiazoline, process of their preparation and pharmaceutical composition containing thereof | |
| Lester et al. | Vilsmeier reaction with 14-hydroxydihydrocodeinone and derived enol ethers |