PL80290B1 - - Google Patents
Download PDFInfo
- Publication number
- PL80290B1 PL80290B1 PL1969135362A PL13536269A PL80290B1 PL 80290 B1 PL80290 B1 PL 80290B1 PL 1969135362 A PL1969135362 A PL 1969135362A PL 13536269 A PL13536269 A PL 13536269A PL 80290 B1 PL80290 B1 PL 80290B1
- Authority
- PL
- Poland
- Prior art keywords
- formula
- compound
- aoln
- mkp
- parts
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 69
- 239000000460 chlorine Substances 0.000 claims description 20
- -1 chlorine halogen Chemical class 0.000 claims description 10
- 239000013543 active substance Substances 0.000 claims description 9
- 239000004480 active ingredient Substances 0.000 claims description 7
- 239000003795 chemical substances by application Substances 0.000 claims description 6
- 244000005700 microbiome Species 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 241000228245 Aspergillus niger Species 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 229910052736 halogen Chemical group 0.000 claims 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims 3
- 150000002367 halogens Chemical group 0.000 claims 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims 1
- 150000002431 hydrogen Chemical class 0.000 claims 1
- 241000196324 Embryophyta Species 0.000 description 12
- 239000000203 mixture Substances 0.000 description 8
- 241000233866 Fungi Species 0.000 description 7
- 241000209094 Oryza Species 0.000 description 6
- KZNICNPSHKQLFF-UHFFFAOYSA-N succinimide Chemical compound O=C1CCC(=O)N1 KZNICNPSHKQLFF-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 5
- 239000000654 additive Substances 0.000 description 5
- 230000000052 comparative effect Effects 0.000 description 5
- 201000010099 disease Diseases 0.000 description 5
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- 239000004927 clay Substances 0.000 description 4
- 239000000428 dust Substances 0.000 description 4
- 125000005843 halogen group Chemical group 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 241001330975 Magnaporthe oryzae Species 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000004495 emulsifiable concentrate Substances 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- 239000001384 succinic acid Substances 0.000 description 3
- 229960002317 succinimide Drugs 0.000 description 3
- RYYWUUFWQRZTIU-UHFFFAOYSA-K thiophosphate Chemical compound [O-]P([O-])([O-])=S RYYWUUFWQRZTIU-UHFFFAOYSA-K 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- GTOFKXZQQDSVFH-UHFFFAOYSA-N 2-benzylsuccinic acid Chemical compound OC(=O)CC(C(O)=O)CC1=CC=CC=C1 GTOFKXZQQDSVFH-UHFFFAOYSA-N 0.000 description 2
- LVFFZQQWIZURIO-UHFFFAOYSA-N 2-phenylbutanedioic acid Chemical compound OC(=O)CC(C(O)=O)C1=CC=CC=C1 LVFFZQQWIZURIO-UHFFFAOYSA-N 0.000 description 2
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 2
- 241000894006 Bacteria Species 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 235000007164 Oryza sativa Nutrition 0.000 description 2
- 241000579741 Sphaerotheca <fungi> Species 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 2
- 241001617088 Thanatephorus sasakii Species 0.000 description 2
- 230000000844 anti-bacterial effect Effects 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 125000004188 dichlorophenyl group Chemical group 0.000 description 2
- 238000010410 dusting Methods 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 230000002070 germicidal effect Effects 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 150000003949 imides Chemical class 0.000 description 2
- PNMGPRJUKKTPSV-UHFFFAOYSA-N n-[(2,3,4,5,6-pentachlorophenyl)methylidene]hydroxylamine Chemical compound ON=CC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl PNMGPRJUKKTPSV-UHFFFAOYSA-N 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 235000009566 rice Nutrition 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 239000004563 wettable powder Substances 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- WAGQACWCKJRRQD-UHFFFAOYSA-N 1-(3,5-dibromophenyl)pyrrolidine-2,5-dione Chemical compound BrC1=CC(Br)=CC(N2C(CCC2=O)=O)=C1 WAGQACWCKJRRQD-UHFFFAOYSA-N 0.000 description 1
- OSSFTHGZMNLASE-UHFFFAOYSA-N 1-(3,5-dichlorophenyl)pyrrole-2,5-dione Chemical compound ClC1=CC(Cl)=CC(N2C(C=CC2=O)=O)=C1 OSSFTHGZMNLASE-UHFFFAOYSA-N 0.000 description 1
- GOHPTLYPQCTZSE-UHFFFAOYSA-N 2,2-dimethylsuccinic acid Chemical compound OC(=O)C(C)(C)CC(O)=O GOHPTLYPQCTZSE-UHFFFAOYSA-N 0.000 description 1
- JMZRZEXRYJUHEB-UHFFFAOYSA-N 2-carbamothioylsulfanylethyl carbamodithioate;zinc Chemical compound [Zn].NC(=S)SCCSC(N)=S JMZRZEXRYJUHEB-UHFFFAOYSA-N 0.000 description 1
- ZQVXSSDWCRHKPX-UHFFFAOYSA-N 2-methyl-2-phenylbutanedioic acid Chemical compound OC(=O)CC(C)(C(O)=O)C1=CC=CC=C1 ZQVXSSDWCRHKPX-UHFFFAOYSA-N 0.000 description 1
- KTFGFGGLCMGYTP-UHFFFAOYSA-N 4-Anilino-4-oxobutanoic acid Chemical class OC(=O)CCC(=O)NC1=CC=CC=C1 KTFGFGGLCMGYTP-UHFFFAOYSA-N 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- 241000228212 Aspergillus Species 0.000 description 1
- 241001450781 Bipolaris oryzae Species 0.000 description 1
- 240000001980 Cucurbita pepo Species 0.000 description 1
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 description 1
- 241000238631 Hexapoda Species 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 241000317981 Podosphaera fuliginea Species 0.000 description 1
- 229930182764 Polyoxin Natural products 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 241000233639 Pythium Species 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 241000589652 Xanthomonas oryzae Species 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 230000000895 acaricidal effect Effects 0.000 description 1
- 239000000642 acaricide Substances 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 206010000496 acne Diseases 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- OSRFHSRSBBCUGJ-UHFFFAOYSA-N aniline pyrrolidine-2,5-dione Chemical class NC1=CC=CC=C1.C1(CCC(N1)=O)=O OSRFHSRSBBCUGJ-UHFFFAOYSA-N 0.000 description 1
- 230000000845 anti-microbial effect Effects 0.000 description 1
- 239000004599 antimicrobial Substances 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 229930189065 blasticidin Natural products 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- ZJUGAXARPHQZMX-UHFFFAOYSA-N dihydroxy-(3-methyl-4-nitrophenoxy)-sulfanylidene-$l^{5}-phosphane Chemical compound CC1=CC(OP(O)(O)=S)=CC=C1[N+]([O-])=O ZJUGAXARPHQZMX-UHFFFAOYSA-N 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- FPAFDBFIGPHWGO-UHFFFAOYSA-N dioxosilane;oxomagnesium;hydrate Chemical compound O.[Mg]=O.[Mg]=O.[Mg]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O FPAFDBFIGPHWGO-UHFFFAOYSA-N 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 244000053095 fungal pathogen Species 0.000 description 1
- 230000000855 fungicidal effect Effects 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 229960002809 lindane Drugs 0.000 description 1
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical group [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 description 1
- 230000000813 microbial effect Effects 0.000 description 1
- 239000005645 nematicide Substances 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- YEBIHIICWDDQOL-YBHNRIQQSA-N polyoxin Polymers O[C@@H]1[C@H](O)[C@@H](C(C=O)N)O[C@H]1N1C(=O)NC(=O)C(C(O)=O)=C1 YEBIHIICWDDQOL-YBHNRIQQSA-N 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- WCJYTPVNMWIZCG-UHFFFAOYSA-N xylylcarb Chemical compound CNC(=O)OC1=CC=C(C)C(C)=C1 WCJYTPVNMWIZCG-UHFFFAOYSA-N 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/34—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/36—Oxygen or sulfur atoms
- C07D207/40—2,5-Pyrrolidine-diones
- C07D207/404—2,5-Pyrrolidine-diones with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms, e.g. succinimide
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/34—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/36—Oxygen or sulfur atoms
- C07D207/40—2,5-Pyrrolidine-diones
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/34—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/36—Oxygen or sulfur atoms
- C07D207/40—2,5-Pyrrolidine-diones
- C07D207/404—2,5-Pyrrolidine-diones with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms, e.g. succinimide
- C07D207/408—Radicals containing only hydrogen and carbon atoms attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pyrrole Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP5749868 | 1968-08-12 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL80290B1 true PL80290B1 (enExample) | 1975-08-30 |
Family
ID=13057378
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1969135362A PL80290B1 (enExample) | 1968-08-12 | 1969-08-11 |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3741981A (enExample) |
| BE (1) | BE737350A (enExample) |
| CH (1) | CH513155A (enExample) |
| CS (1) | CS157069B2 (enExample) |
| DE (1) | DE1940032A1 (enExample) |
| DK (1) | DK127555B (enExample) |
| ES (1) | ES369802A1 (enExample) |
| FR (1) | FR2015493A1 (enExample) |
| GB (1) | GB1231311A (enExample) |
| IL (1) | IL32786A (enExample) |
| NL (1) | NL143918B (enExample) |
| PL (1) | PL80290B1 (enExample) |
| RO (1) | RO56659A (enExample) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5398959A (en) * | 1977-02-07 | 1978-08-29 | Sumitomo Chem Co Ltd | Cycloalkanespiro-3- 1-(3,5-dihalogenophenyl) pyrrolidine-2,5-dione process for their preparation and nonmedical fungicides containing the same as active constituents |
| DE2740848A1 (de) * | 1977-09-10 | 1979-03-29 | Bayer Ag | Substituierte n-phenyl-bernsteinsaeureimide, verfahren zu ihrer herstellung sowie ihre verwendung als fungizide |
| DE2852924A1 (de) * | 1978-12-07 | 1980-06-26 | Bayer Ag | Substituierte spiro-derivate von 3- (3,5-dihalogenphenyl)-oxazolidin-2,4-dionen (thion-onen), verfahren zu ihrer herstellung sowie ihre verwendung als fungizide |
| DE3013566A1 (de) * | 1980-04-09 | 1981-10-15 | Consortium für elektrochemische Industrie GmbH, 8000 München | Herstellung von n-phenyl-bernsteinsaeureimiden und ihre verwendung als fungizide mittel |
| DE3030926A1 (de) * | 1980-08-16 | 1982-04-01 | Consortium für elektrochemische Industrie GmbH, 8000 München | Substituierte bernsteinsaeureimide |
| US4804400A (en) * | 1986-09-12 | 1989-02-14 | Ciba-Geigy Corporation | N-phenyl-maleimides and herbicidal and plant growth regulating methods of use thereof |
| US6355664B1 (en) | 1997-03-03 | 2002-03-12 | Boehringer Ingelheim Pharmaceuticals, Inc. | Phenylpyrrolidines, phenylimidazolidines, 3-phenyl-1,3-oxizolidines and 3-phenyl-1,3-thiazolidines and their use in the treatment of inflammatory disease |
| USRE38132E1 (en) | 1997-03-03 | 2003-06-03 | Boehringer Ingelheim Pharmaceuticals, Inc. | Phenylpyrrolidines, phenylimidazolidines,3-phenyl-1,3-oxizolidines and 3-phenyl-1,3-thiazolidines and their use in the treatment of inflammatory disease |
| WO1998039303A1 (en) * | 1997-03-03 | 1998-09-11 | Boehringer Ingelheim Pharmaceuticals, Inc. | Small molecules useful in the treatment of inflammatory disease |
| WO2001006984A2 (en) | 1999-07-21 | 2001-02-01 | Boehringer Ingelheim Pharmaceuticals, Inc. | Small molecules useful in the treatment of inflammatory disease |
| WO2001007044A1 (en) * | 1999-07-21 | 2001-02-01 | Boehringer Ingelheim Pharmaceuticals, Inc. | Small molecules useful in the treatment of inflammatory disease |
| WO2001007052A1 (en) | 1999-07-21 | 2001-02-01 | Boehringer Ingelheim Pharmaceuticals, Inc. | Small molecules useful in the treatment of inflammatory disease |
| US6492408B1 (en) * | 1999-07-21 | 2002-12-10 | Boehringer Ingelheim Pharmaceuticals, Inc. | Small molecules useful in the treatment of inflammatory disease |
| NZ585640A (en) * | 2007-11-29 | 2011-03-31 | Boehringer Ingelhelheim Internat Gmbh | Derivatives of 6,7-dihydro-5h-imidazo[1,2-alpha]imidazole-3- carboxylic acid amides |
| KR20120024699A (ko) | 2009-06-02 | 2012-03-14 | 베링거 인겔하임 인터내셔날 게엠베하 | 6,7-디하이드로-5H-이미다조[1,2-a]이미다졸-3-카복실산 아미드의 유도체 |
| EP2445914B1 (en) | 2009-06-02 | 2015-07-22 | Boehringer Ingelheim International GmbH | DERIVATIVES OF 6,7-DIHYDRO-5H-IMIDAZO[1,2-a]IMIDAZOLE-3-CARBOXYLIC ACID AMIDES |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3162648A (en) * | 1964-12-22 | Alpha-methyl-alpha-phenyl | ||
| US3586697A (en) * | 1967-12-01 | 1971-06-22 | Sumitomo Chemical Co | Novel n-(3,5-dichlorophenyl) cyclic imide derivatives |
-
1969
- 1969-07-03 FR FR6922560A patent/FR2015493A1/fr not_active Withdrawn
- 1969-07-17 CH CH1095369A patent/CH513155A/fr not_active IP Right Cessation
- 1969-07-23 ES ES369802A patent/ES369802A1/es not_active Expired
- 1969-07-25 GB GB1231311D patent/GB1231311A/en not_active Expired
- 1969-08-01 US US00846931A patent/US3741981A/en not_active Expired - Lifetime
- 1969-08-06 DE DE19691940032 patent/DE1940032A1/de not_active Withdrawn
- 1969-08-06 IL IL32786A patent/IL32786A/xx unknown
- 1969-08-11 BE BE737350D patent/BE737350A/xx unknown
- 1969-08-11 NL NL696912186A patent/NL143918B/xx not_active IP Right Cessation
- 1969-08-11 DK DK431969AA patent/DK127555B/da unknown
- 1969-08-11 CS CS554469A patent/CS157069B2/cs unknown
- 1969-08-11 PL PL1969135362A patent/PL80290B1/pl unknown
- 1969-08-12 RO RO60782A patent/RO56659A/ro unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NL6912186A (enExample) | 1970-02-16 |
| IL32786A (en) | 1973-02-28 |
| ES369802A1 (es) | 1972-01-16 |
| DE1940032A1 (de) | 1970-03-12 |
| US3741981A (en) | 1973-06-26 |
| GB1231311A (enExample) | 1971-05-12 |
| DK127555B (da) | 1973-11-26 |
| FR2015493A1 (enExample) | 1970-04-30 |
| IL32786A0 (en) | 1969-11-12 |
| BE737350A (enExample) | 1970-01-16 |
| CS157069B2 (enExample) | 1974-08-23 |
| RO56659A (enExample) | 1974-09-01 |
| NL143918B (nl) | 1974-11-15 |
| CH513155A (fr) | 1971-09-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL80290B1 (enExample) | ||
| US3761488A (en) | 3-isothiazolones | |
| SK284631B6 (sk) | Prostriedok a spôsob na kontrolu škodlivých bioorganizmov, a spôsob zvýšenia účinku činidla na takú kontrolu | |
| US4310590A (en) | 3-Isothiazolones as biocides | |
| PL78373B1 (en) | 3-(3{40 ,5{40 -dihalogenophenyl)imidazolidine-2,4-dione derivatives [us3668217a] | |
| PL139657B1 (en) | Process for manufacturing novel salt of organophosphorus derivative and fungicide containing the same | |
| CS236864B2 (en) | Fungicide agent and processing of active component | |
| JPS6365669B2 (enExample) | ||
| AU596436B2 (en) | Novel fungicidal compositions | |
| US3641050A (en) | 1 5-substituted indazoles | |
| JP4388638B2 (ja) | 農園芸用有害生物防除組成物 | |
| US5045555A (en) | N-alkylbenzenesulfonylcarbamoyl-5-chloroisothiazole derivatives and microbicides containing the same | |
| JP3102500B2 (ja) | 種子消毒剤 | |
| CA1046061A (en) | Pyridyltriazinone compounds | |
| US3799945A (en) | 2-(n-2-cyanoethyldithiocarbamylmethylene)-5-hydroxy-4h-pyran-4-one and metal chelates | |
| PL153804B1 (en) | Fungicide | |
| PL82801B1 (en) | N-(3,5-dihalogenophenyl)-oxazolidine compounds and preparation thereof[us3743651a] | |
| DE69012921T2 (de) | Azolidin-Derivate, Verfahren zu deren Herstellung und Fungizide für die Landwirtschaft und den Gartenbau. | |
| PL84075B1 (enExample) | ||
| US4100281A (en) | Mono-5-substituted-thio-3-chloro-4H-1,2,6-thiadiazin-4-one antifungal agents | |
| US4143138A (en) | 3-chloro-5-(optionally substituted heterocycloxy)-4h-1,2,6-thiadiazin-4-one antifungal agents | |
| GB1564387A (en) | Germicidal herbicide compositions for use in agriculture and horticulture containing active ingredients amides of alkylthioalkylsulphinyl and alkylsulphonyl-acrylic acids | |
| US3784654A (en) | O-alkyl(-cycloalkyl)-s-alkyl-s-phenyl-phosphorodithiolates | |
| US4196284A (en) | 5-Substituted-thio-3-chloro-4H-1,2,6-thiadiazin-4-ones | |
| SU296304A1 (enExample) |