PL79446B1 - Organic compounds[au4589772a] - Google Patents
Organic compounds[au4589772a] Download PDFInfo
- Publication number
- PL79446B1 PL79446B1 PL1972157376A PL15737672A PL79446B1 PL 79446 B1 PL79446 B1 PL 79446B1 PL 1972157376 A PL1972157376 A PL 1972157376A PL 15737672 A PL15737672 A PL 15737672A PL 79446 B1 PL79446 B1 PL 79446B1
- Authority
- PL
- Poland
- Prior art keywords
- formula
- indan
- compounds
- product
- pyrrolidin
- Prior art date
Links
- 150000002894 organic compounds Chemical class 0.000 title 1
- -1 methylenedioxy Chemical group 0.000 claims abstract description 69
- 229910052801 chlorine Inorganic materials 0.000 claims abstract description 11
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 10
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 6
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims abstract description 6
- 229910052794 bromium Inorganic materials 0.000 claims abstract description 5
- 229910052731 fluorine Inorganic materials 0.000 claims abstract description 3
- 150000001875 compounds Chemical class 0.000 claims description 112
- 239000000203 mixture Substances 0.000 claims description 64
- 238000000034 method Methods 0.000 claims description 34
- 239000002253 acid Substances 0.000 claims description 20
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 12
- 150000003839 salts Chemical class 0.000 claims description 9
- 239000000460 chlorine Substances 0.000 claims description 8
- 239000001257 hydrogen Substances 0.000 claims description 8
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 7
- ALQRKFSWQNBCSJ-UHFFFAOYSA-N spiro[1,2-dihydroindene-3,3'-pyrrolidine] Chemical compound C1NCCC11C2=CC=CC=C2CC1 ALQRKFSWQNBCSJ-UHFFFAOYSA-N 0.000 claims description 7
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 6
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 5
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 5
- ZSBPDAQOZOLDDN-UHFFFAOYSA-N 6-chlorospiro[1,2-dihydroindene-3,3'-pyrrolidine] Chemical compound C=1C(Cl)=CC=C2C=1CCC21CCNC1 ZSBPDAQOZOLDDN-UHFFFAOYSA-N 0.000 claims description 4
- 125000005157 alkyl carboxy group Chemical group 0.000 claims description 4
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 4
- 229910052740 iodine Chemical group 0.000 claims description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- 150000002391 heterocyclic compounds Chemical class 0.000 claims description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 2
- 230000015572 biosynthetic process Effects 0.000 claims description 2
- SKOLWUPSYHWYAM-UHFFFAOYSA-N carbonodithioic O,S-acid Chemical compound SC(S)=O SKOLWUPSYHWYAM-UHFFFAOYSA-N 0.000 claims description 2
- 125000006243 carbonyl protecting group Chemical group 0.000 claims description 2
- 239000011737 fluorine Substances 0.000 claims description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims 1
- 125000000542 sulfonic acid group Chemical group 0.000 claims 1
- 125000005196 alkyl carbonyloxy group Chemical group 0.000 abstract 1
- 239000000047 product Substances 0.000 description 112
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 106
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 70
- 239000000155 melt Substances 0.000 description 51
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 46
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 39
- 238000009835 boiling Methods 0.000 description 36
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 26
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 24
- 239000000243 solution Substances 0.000 description 23
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 21
- 238000006243 chemical reaction Methods 0.000 description 21
- 239000012043 crude product Substances 0.000 description 21
- VZCYOOQTPOCHFL-OWOJBTEDSA-M fumarate(1-) Chemical compound OC(=O)\C=C\C([O-])=O VZCYOOQTPOCHFL-OWOJBTEDSA-M 0.000 description 20
- 238000002844 melting Methods 0.000 description 20
- 230000008018 melting Effects 0.000 description 20
- 238000001953 recrystallisation Methods 0.000 description 20
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 18
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 17
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 16
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 16
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 15
- PSLIMVZEAPALCD-UHFFFAOYSA-N ethanol;ethoxyethane Chemical compound CCO.CCOCC PSLIMVZEAPALCD-UHFFFAOYSA-N 0.000 description 15
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 14
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 14
- AZUYLZMQTIKGSC-UHFFFAOYSA-N 1-[6-[4-(5-chloro-6-methyl-1H-indazol-4-yl)-5-methyl-3-(1-methylindazol-5-yl)pyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one Chemical compound ClC=1C(=C2C=NNC2=CC=1C)C=1C(=NN(C=1C)C1CC2(CN(C2)C(C=C)=O)C1)C=1C=C2C=NN(C2=CC=1)C AZUYLZMQTIKGSC-UHFFFAOYSA-N 0.000 description 11
- 239000003921 oil Substances 0.000 description 11
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 10
- 238000000746 purification Methods 0.000 description 10
- 229910000029 sodium carbonate Inorganic materials 0.000 description 9
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 8
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 7
- VGUWZCUCNQXGBU-UHFFFAOYSA-N 3-[(4-methylpiperazin-1-yl)methyl]-5-nitro-1h-indole Chemical compound C1CN(C)CCN1CC1=CNC2=CC=C([N+]([O-])=O)C=C12 VGUWZCUCNQXGBU-UHFFFAOYSA-N 0.000 description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 6
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 239000003054 catalyst Substances 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- 239000001530 fumaric acid Substances 0.000 description 6
- 230000007062 hydrolysis Effects 0.000 description 6
- 238000006460 hydrolysis reaction Methods 0.000 description 6
- 239000012280 lithium aluminium hydride Substances 0.000 description 6
- 238000012545 processing Methods 0.000 description 6
- 239000000741 silica gel Substances 0.000 description 6
- 229910002027 silica gel Inorganic materials 0.000 description 6
- 238000012360 testing method Methods 0.000 description 6
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 6
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 5
- IJHWXCVVGXKIKM-UHFFFAOYSA-N 5-chlorospiro[1,2-dihydroindene-3,3'-pyrrolidine] Chemical compound C12=CC(Cl)=CC=C2CCC21CCNC2 IJHWXCVVGXKIKM-UHFFFAOYSA-N 0.000 description 5
- 241000699670 Mus sp. Species 0.000 description 5
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 5
- 230000037396 body weight Effects 0.000 description 5
- 238000004587 chromatography analysis Methods 0.000 description 5
- 239000012442 inert solvent Substances 0.000 description 5
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 5
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- OSPSOZHMNXONME-UHFFFAOYSA-N C12=CC(OC)=CC=C2CCC21CCNC2 Chemical compound C12=CC(OC)=CC=C2CCC21CCNC2 OSPSOZHMNXONME-UHFFFAOYSA-N 0.000 description 4
- 150000001298 alcohols Chemical class 0.000 description 4
- 238000002425 crystallisation Methods 0.000 description 4
- 230000008025 crystallization Effects 0.000 description 4
- 238000005984 hydrogenation reaction Methods 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- 239000012071 phase Substances 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 230000009467 reduction Effects 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 239000012279 sodium borohydride Substances 0.000 description 4
- 229910000033 sodium borohydride Inorganic materials 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- UHKAJLSKXBADFT-UHFFFAOYSA-N 1,3-indandione Chemical compound C1=CC=C2C(=O)CC(=O)C2=C1 UHKAJLSKXBADFT-UHFFFAOYSA-N 0.000 description 3
- TUGATRAPWYKNCO-UHFFFAOYSA-N 1-(4-fluorophenyl)-4-(1-hydroxyspiro[1,2-dihydroindene-3,3'-pyrrolidine]-1'-yl)butan-1-one Chemical compound C12=CC=CC=C2C(O)CC1(C1)CCN1CCCC(=O)C1=CC=C(F)C=C1 TUGATRAPWYKNCO-UHFFFAOYSA-N 0.000 description 3
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- 240000001546 Byrsonima crassifolia Species 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 150000004820 halides Chemical class 0.000 description 3
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 3
- 239000003208 petroleum Substances 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 239000002002 slurry Substances 0.000 description 3
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 3
- KEAYESYHFKHZAL-IGMARMGPSA-N sodium-23 atom Chemical compound [23Na] KEAYESYHFKHZAL-IGMARMGPSA-N 0.000 description 3
- RXNANSLKIJLAPY-UHFFFAOYSA-N spiro[1,2-dihydroindene-3,3'-pyrrolidine]-1-yl acetate Chemical compound C12=CC=CC=C2C(OC(=O)C)CC21CCNC2 RXNANSLKIJLAPY-UHFFFAOYSA-N 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 125000004201 2,4-dichlorophenyl group Chemical group [H]C1=C([H])C(*)=C(Cl)C([H])=C1Cl 0.000 description 2
- 125000003762 3,4-dimethoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 description 2
- HXAOUYGZEOZTJO-UHFFFAOYSA-N 4-chloro-1-(4-fluorophenyl)butan-1-one Chemical compound FC1=CC=C(C(=O)CCCCl)C=C1 HXAOUYGZEOZTJO-UHFFFAOYSA-N 0.000 description 2
- 125000004861 4-isopropyl phenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- SPFLXYFHASMZPS-UHFFFAOYSA-N 6-chlorospiro[1,2-dihydroindene-3,3'-pyrrolidine]-1-ol Chemical compound C12=CC=C(Cl)C=C2C(O)CC21CCNC2 SPFLXYFHASMZPS-UHFFFAOYSA-N 0.000 description 2
- VQBKERXGUPDKFL-UHFFFAOYSA-N 6-fluorospiro[1,2-dihydroindene-3,3'-pyrrolidine] Chemical compound C=1C(F)=CC=C2C=1CCC21CCNC1 VQBKERXGUPDKFL-UHFFFAOYSA-N 0.000 description 2
- TWZQXGRKDWKGII-UHFFFAOYSA-N 6-methylspiro[1,2-dihydroindene-3,3'-pyrrolidine] Chemical compound C=1C(C)=CC=C2C=1CCC21CCNC1 TWZQXGRKDWKGII-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Natural products CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- CTAIHNGYGLXODY-UHFFFAOYSA-N CC(C)C1=CC=C(C2(CC3)CNCC2)C3=C1 Chemical compound CC(C)C1=CC=C(C2(CC3)CNCC2)C3=C1 CTAIHNGYGLXODY-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- 241000124008 Mammalia Species 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- 239000007868 Raney catalyst Substances 0.000 description 2
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 2
- 229910000564 Raney nickel Inorganic materials 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- GYZLDUSXWFGPTP-UHFFFAOYSA-N [1'-[4-(4-fluorophenyl)-4-oxobutyl]spiro[1,2-dihydroindene-3,3'-pyrrolidine]-1-yl] acetate Chemical compound C12=CC=CC=C2C(OC(=O)C)CC1(C1)CCN1CCCC(=O)C1=CC=C(F)C=C1 GYZLDUSXWFGPTP-UHFFFAOYSA-N 0.000 description 2
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 2
- 150000008041 alkali metal carbonates Chemical class 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 230000003444 anaesthetic effect Effects 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- FFSAXUULYPJSKH-UHFFFAOYSA-N butyrophenone Chemical compound CCCC(=O)C1=CC=CC=C1 FFSAXUULYPJSKH-UHFFFAOYSA-N 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 150000004292 cyclic ethers Chemical class 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- VFIQYNCJSDGNGB-UHFFFAOYSA-N diethyl 3-cyano-3-phenylpentanedioate Chemical compound CCOC(=O)CC(CC(=O)OCC)(C#N)C1=CC=CC=C1 VFIQYNCJSDGNGB-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- 239000012259 ether extract Substances 0.000 description 2
- HJKJXWMIISKYGB-UHFFFAOYSA-N ethyl 3-cyano-3-phenylpropanoate Chemical compound CCOC(=O)CC(C#N)C1=CC=CC=C1 HJKJXWMIISKYGB-UHFFFAOYSA-N 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- PQNFLJBBNBOBRQ-UHFFFAOYSA-N indane Chemical compound C1=CC=C2CCCC2=C1 PQNFLJBBNBOBRQ-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- XTEGVFVZDVNBPF-UHFFFAOYSA-N naphthalene-1,5-disulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1S(O)(=O)=O XTEGVFVZDVNBPF-UHFFFAOYSA-N 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 2
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 229920000137 polyphosphoric acid Polymers 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 235000011181 potassium carbonates Nutrition 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- KKUOXODQUOYWKW-UHFFFAOYSA-N spiro[1,2-dihydroindene-3,3'-pyrrolidine]-1-yl n-methylcarbamate Chemical compound C12=CC=CC=C2C(OC(=O)NC)CC21CCNC2 KKUOXODQUOYWKW-UHFFFAOYSA-N 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- CPLAAFCISRWJMD-UHFFFAOYSA-N (1'-benzylspiro[1,2-dihydroindene-3,3'-pyrrolidine]-1-yl) acetate Chemical compound C12=CC=CC=C2C(OC(=O)C)CC1(C1)CCN1CC1=CC=CC=C1 CPLAAFCISRWJMD-UHFFFAOYSA-N 0.000 description 1
- MIVJTECSULGHPA-UHFFFAOYSA-N (1'-benzylspiro[1,2-dihydroindene-3,3'-pyrrolidine]-1-yl) n-methylcarbamate Chemical compound C12=CC=CC=C2C(OC(=O)NC)CC1(C1)CCN1CC1=CC=CC=C1 MIVJTECSULGHPA-UHFFFAOYSA-N 0.000 description 1
- CAQZTSCRGMRSHX-TYYBGVCCSA-N (e)-but-2-enedioic acid;ethanol Chemical compound CCO.OC(=O)\C=C\C(O)=O CAQZTSCRGMRSHX-TYYBGVCCSA-N 0.000 description 1
- DOKKBKKKEAPXSM-UHFFFAOYSA-N 1'-benzylspiro[1,2-dihydroindene-3,3'-pyrrolidine]-1-ol Chemical compound C12=CC=CC=C2C(O)CC1(C1)CCN1CC1=CC=CC=C1 DOKKBKKKEAPXSM-UHFFFAOYSA-N 0.000 description 1
- FRASJONUBLZVQX-UHFFFAOYSA-N 1,4-naphthoquinone Chemical compound C1=CC=C2C(=O)C=CC(=O)C2=C1 FRASJONUBLZVQX-UHFFFAOYSA-N 0.000 description 1
- ZAOHNRVHMQHNQP-UHFFFAOYSA-N 1-(4-fluorophenyl)-4-(1-hydroxy-5,6-dimethoxyspiro[1,2-dihydroindene-3,3'-pyrrolidine]-1'-yl)butan-1-one Chemical compound C1=2C=C(OC)C(OC)=CC=2C(O)CC1(C1)CCN1CCCC(=O)C1=CC=C(F)C=C1 ZAOHNRVHMQHNQP-UHFFFAOYSA-N 0.000 description 1
- LWWWUFWEBKSIJK-UHFFFAOYSA-N 1-(4-fluorophenyl)-4-(1-hydroxy-6-methoxyspiro[1,2-dihydroindene-3,3'-pyrrolidine]-1'-yl)butan-1-one Chemical compound C=1C(OC)=CC=C2C=1C(O)CC2(C1)CCN1CCCC(=O)C1=CC=C(F)C=C1 LWWWUFWEBKSIJK-UHFFFAOYSA-N 0.000 description 1
- ZWHAYRITAMAMDO-UHFFFAOYSA-N 1-(4-fluorophenyl)-4-(1-hydroxy-6-methylspiro[1,2-dihydroindene-3,3'-pyrrolidine]-1'-yl)butan-1-one Chemical compound C=1C(C)=CC=C2C=1C(O)CC2(C1)CCN1CCCC(=O)C1=CC=C(F)C=C1 ZWHAYRITAMAMDO-UHFFFAOYSA-N 0.000 description 1
- DYPHDCYZFREKGF-UHFFFAOYSA-N 2-[3-(4-chlorophenyl)-5-oxopyrrolidin-3-yl]acetic acid Chemical compound C=1C=C(Cl)C=CC=1C1(CC(=O)O)CNC(=O)C1 DYPHDCYZFREKGF-UHFFFAOYSA-N 0.000 description 1
- NJOSHDTWSJDWIF-UHFFFAOYSA-N 2-ethoxycarbonyl-3-(4-propan-2-ylphenyl)prop-2-enoic acid Chemical compound CCOC(=O)C(C(O)=O)=CC1=CC=C(C(C)C)C=C1 NJOSHDTWSJDWIF-UHFFFAOYSA-N 0.000 description 1
- RLQZIECDMISZHS-UHFFFAOYSA-N 2-phenylcyclohexa-2,5-diene-1,4-dione Chemical compound O=C1C=CC(=O)C(C=2C=CC=CC=2)=C1 RLQZIECDMISZHS-UHFFFAOYSA-N 0.000 description 1
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 1
- VUAOCULDPHYPMX-UHFFFAOYSA-N 3-(2,4-dimethylphenyl)-2-ethoxycarbonylprop-2-enoic acid Chemical compound CCOC(=O)C(C(O)=O)=CC1=CC=C(C)C=C1C VUAOCULDPHYPMX-UHFFFAOYSA-N 0.000 description 1
- IIRKMLGWDNHZQE-UHFFFAOYSA-N 3-(3,4-dimethoxyphenyl)-2-ethoxycarbonylprop-2-enoic acid Chemical compound CCOC(=O)C(C(O)=O)=CC1=CC=C(OC)C(OC)=C1 IIRKMLGWDNHZQE-UHFFFAOYSA-N 0.000 description 1
- YOUJATHSLGZWFQ-UHFFFAOYSA-N 4-(6,7-dichloro-1-hydroxyspiro[1,2-dihydroindene-3,3'-pyrrolidine]-1'-yl)-1-(4-fluorophenyl)butan-1-one Chemical compound C12=CC=C(Cl)C(Cl)=C2C(O)CC1(C1)CCN1CCCC(=O)C1=CC=C(F)C=C1 YOUJATHSLGZWFQ-UHFFFAOYSA-N 0.000 description 1
- BCZMQWRTGDXRDN-UHFFFAOYSA-N 4-(6-chloro-1-hydroxyspiro[1,2-dihydroindene-3,3'-pyrrolidine]-1'-yl)-1-(4-fluorophenyl)butan-1-one Chemical compound C12=CC=C(Cl)C=C2C(O)CC1(C1)CCN1CCCC(=O)C1=CC=C(F)C=C1 BCZMQWRTGDXRDN-UHFFFAOYSA-N 0.000 description 1
- HEGVEAMROAWNRN-UHFFFAOYSA-N 4-(6-fluoro-1-hydroxyspiro[1,2-dihydroindene-3,3'-pyrrolidine]-1'-yl)-1-(4-fluorophenyl)butan-1-one Chemical compound C12=CC=C(F)C=C2C(O)CC1(C1)CCN1CCCC(=O)C1=CC=C(F)C=C1 HEGVEAMROAWNRN-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- FAROABBQKSTYQC-UHFFFAOYSA-N 5-chlorospiro[1,2-dihydroindene-3,3'-pyrrolidine]-1-ol Chemical compound C12=CC(Cl)=CC=C2C(O)CC21CCNC2 FAROABBQKSTYQC-UHFFFAOYSA-N 0.000 description 1
- TVFGWSVHUUTITG-UHFFFAOYSA-N 5-fluorospiro[1,2-dihydroindole-3,4'-piperidine] Chemical compound C12=CC(F)=CC=C2NCC21CCNCC2 TVFGWSVHUUTITG-UHFFFAOYSA-N 0.000 description 1
- LUHNAMQMZMWKFI-UHFFFAOYSA-N 5-methylspiro[1,2-dihydroindene-3,3'-pyrrolidine]-1-ol Chemical compound C12=CC(C)=CC=C2C(O)CC21CCNC2 LUHNAMQMZMWKFI-UHFFFAOYSA-N 0.000 description 1
- YBCJZEBAZYSAQY-UHFFFAOYSA-N 6-chloro-1-hydroxyspiro[1,2-dihydroindene-3,4'-pyrrolidine]-2'-one Chemical compound C12=CC=C(Cl)C=C2C(O)CC21CNC(=O)C2 YBCJZEBAZYSAQY-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- IYXGSMUGOJNHAZ-UHFFFAOYSA-N Ethyl malonate Chemical compound CCOC(=O)CC(=O)OCC IYXGSMUGOJNHAZ-UHFFFAOYSA-N 0.000 description 1
- 229910052693 Europium Inorganic materials 0.000 description 1
- 229930194542 Keto Natural products 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical class OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- 206010039897 Sedation Diseases 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- 230000001133 acceleration Effects 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000005233 alkylalcohol group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 230000037007 arousal Effects 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 238000005574 benzylation reaction Methods 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 229940112021 centrally acting muscle relaxants carbamic acid ester Drugs 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- RCTYPNKXASFOBE-UHFFFAOYSA-M chloromercury Chemical compound [Hg]Cl RCTYPNKXASFOBE-UHFFFAOYSA-M 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 230000036461 convulsion Effects 0.000 description 1
- ASZSQVRNXYEROB-UHFFFAOYSA-N diethyl 2-[(3-chlorophenyl)methylidene]propanedioate Chemical compound CCOC(=O)C(C(=O)OCC)=CC1=CC=CC(Cl)=C1 ASZSQVRNXYEROB-UHFFFAOYSA-N 0.000 description 1
- IKPJWXIDYODYGY-UHFFFAOYSA-N diethyl 2-[(3-methoxyphenyl)methylidene]propanedioate Chemical compound CCOC(=O)C(C(=O)OCC)=CC1=CC=CC(OC)=C1 IKPJWXIDYODYGY-UHFFFAOYSA-N 0.000 description 1
- NDOSDZBQFXJNCH-UHFFFAOYSA-N diethyl 2-[(3-methylphenyl)methylidene]propanedioate Chemical compound CCOC(=O)C(C(=O)OCC)=CC1=CC=CC(C)=C1 NDOSDZBQFXJNCH-UHFFFAOYSA-N 0.000 description 1
- MVRRBDRVDOIABW-UHFFFAOYSA-N diethyl 2-[(4-chlorophenyl)methylidene]propanedioate Chemical compound CCOC(=O)C(C(=O)OCC)=CC1=CC=C(Cl)C=C1 MVRRBDRVDOIABW-UHFFFAOYSA-N 0.000 description 1
- VUWPIBNKJSEYIN-UHFFFAOYSA-N diethyl 2-benzylidenepropanedioate Chemical compound CCOC(=O)C(C(=O)OCC)=CC1=CC=CC=C1 VUWPIBNKJSEYIN-UHFFFAOYSA-N 0.000 description 1
- XLMBIZDYYVRQHQ-UHFFFAOYSA-N diethyl 3-(3-chlorophenyl)-3-cyanopentanedioate Chemical compound CCOC(=O)CC(CC(=O)OCC)(C#N)C1=CC=CC(Cl)=C1 XLMBIZDYYVRQHQ-UHFFFAOYSA-N 0.000 description 1
- NRZBGRIQTPDKOT-UHFFFAOYSA-N diethyl 3-cyano-3-(2,4-dichlorophenyl)pentanedioate Chemical compound CCOC(=O)CC(CC(=O)OCC)(C#N)C1=CC=C(Cl)C=C1Cl NRZBGRIQTPDKOT-UHFFFAOYSA-N 0.000 description 1
- RREADBLJWOLFNF-UHFFFAOYSA-N diethyl 3-cyano-3-(2,4-dimethylphenyl)pentanedioate Chemical compound CCOC(=O)CC(CC(=O)OCC)(C#N)C1=CC=C(C)C=C1C RREADBLJWOLFNF-UHFFFAOYSA-N 0.000 description 1
- MOLWDHUTJGGDTJ-UHFFFAOYSA-N diethyl 3-cyano-3-(3,4-dichlorophenyl)pentanedioate Chemical compound CCOC(=O)CC(CC(=O)OCC)(C#N)C1=CC=C(Cl)C(Cl)=C1 MOLWDHUTJGGDTJ-UHFFFAOYSA-N 0.000 description 1
- PBLQGYDMFKYUNR-UHFFFAOYSA-N diethyl 3-cyano-3-(3-methoxyphenyl)pentanedioate Chemical compound CCOC(=O)CC(CC(=O)OCC)(C#N)C1=CC=CC(OC)=C1 PBLQGYDMFKYUNR-UHFFFAOYSA-N 0.000 description 1
- QUZUZRBUNJHZBL-UHFFFAOYSA-N diethyl 3-cyano-3-(4-fluorophenyl)pentanedioate Chemical compound CCOC(=O)CC(CC(=O)OCC)(C#N)C1=CC=C(F)C=C1 QUZUZRBUNJHZBL-UHFFFAOYSA-N 0.000 description 1
- FLKAGVOKXFBJMI-UHFFFAOYSA-N diethyl 3-cyano-3-(4-methylphenyl)pentanedioate Chemical compound CCOC(=O)CC(CC(=O)OCC)(C#N)C1=CC=C(C)C=C1 FLKAGVOKXFBJMI-UHFFFAOYSA-N 0.000 description 1
- NJZLYWSODYFBJG-UHFFFAOYSA-N diethyl 3-cyano-3-(4-propan-2-ylphenyl)pentanedioate Chemical compound CCOC(=O)CC(CC(=O)OCC)(C#N)C1=CC=C(C(C)C)C=C1 NJZLYWSODYFBJG-UHFFFAOYSA-N 0.000 description 1
- OUWSNHWQZPEFEX-UHFFFAOYSA-N diethyl glutarate Chemical compound CCOC(=O)CCCC(=O)OCC OUWSNHWQZPEFEX-UHFFFAOYSA-N 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- DZGCGKFAPXFTNM-UHFFFAOYSA-N ethanol;hydron;chloride Chemical compound Cl.CCO DZGCGKFAPXFTNM-UHFFFAOYSA-N 0.000 description 1
- GLCIFTVZMWHJBE-UHFFFAOYSA-N ethyl 2-(2-oxo-4-phenylpyrrolidin-1-yl)acetate Chemical compound C1C(=O)N(CC(=O)OCC)CC1C1=CC=CC=C1 GLCIFTVZMWHJBE-UHFFFAOYSA-N 0.000 description 1
- SVZBPMMAVQLFRE-UHFFFAOYSA-N ethyl 3-(3-chlorophenyl)-3-cyanopropanoate Chemical compound CCOC(=O)CC(C#N)C1=CC=CC(Cl)=C1 SVZBPMMAVQLFRE-UHFFFAOYSA-N 0.000 description 1
- XEZYVIMQKOFWRH-UHFFFAOYSA-N ethyl 3-(4-chlorophenyl)-3-cyanopropanoate Chemical compound CCOC(=O)CC(C#N)C1=CC=C(Cl)C=C1 XEZYVIMQKOFWRH-UHFFFAOYSA-N 0.000 description 1
- NSJVVGMIKQNLRF-UHFFFAOYSA-N ethyl 3-cyano-3-(2,4-dimethylphenyl)propanoate Chemical compound CCOC(=O)CC(C#N)C1=CC=C(C)C=C1C NSJVVGMIKQNLRF-UHFFFAOYSA-N 0.000 description 1
- URZIWQQFAJQHKQ-UHFFFAOYSA-N ethyl 3-cyano-3-(3,4-dichlorophenyl)propanoate Chemical compound CCOC(=O)CC(C#N)C1=CC=C(Cl)C(Cl)=C1 URZIWQQFAJQHKQ-UHFFFAOYSA-N 0.000 description 1
- UNQLSSYUCYRCDS-UHFFFAOYSA-N ethyl 3-cyano-3-(3,4-dimethoxyphenyl)propanoate Chemical compound CCOC(=O)CC(C#N)C1=CC=C(OC)C(OC)=C1 UNQLSSYUCYRCDS-UHFFFAOYSA-N 0.000 description 1
- HYFNZPUVJOTMIF-UHFFFAOYSA-N ethyl 3-cyano-3-(3-methoxyphenyl)propanoate Chemical compound CCOC(=O)CC(C#N)C1=CC=CC(OC)=C1 HYFNZPUVJOTMIF-UHFFFAOYSA-N 0.000 description 1
- KSFVZJGNEAWOAN-UHFFFAOYSA-N ethyl 3-cyano-3-(3-methylphenyl)propanoate Chemical compound CCOC(=O)CC(C#N)C1=CC=CC(C)=C1 KSFVZJGNEAWOAN-UHFFFAOYSA-N 0.000 description 1
- WXQAOVNYTQPQPR-UHFFFAOYSA-N ethyl 3-cyano-3-(4-fluorophenyl)propanoate Chemical compound CCOC(=O)CC(C#N)C1=CC=C(F)C=C1 WXQAOVNYTQPQPR-UHFFFAOYSA-N 0.000 description 1
- WDIVNWWDHNBCAR-UHFFFAOYSA-N ethyl 3-cyano-3-(4-methoxyphenyl)propanoate Chemical compound CCOC(=O)CC(C#N)C1=CC=C(OC)C=C1 WDIVNWWDHNBCAR-UHFFFAOYSA-N 0.000 description 1
- YBDYGPCRAONDAG-UHFFFAOYSA-N ethyl 3-cyano-3-(4-methylphenyl)propanoate Chemical compound CCOC(=O)CC(C#N)C1=CC=C(C)C=C1 YBDYGPCRAONDAG-UHFFFAOYSA-N 0.000 description 1
- NARPDUDUGUFABF-UHFFFAOYSA-N ethyl 3-cyano-3-(4-propan-2-ylphenyl)propanoate Chemical compound CCOC(=O)CC(C#N)C1=CC=C(C(C)C)C=C1 NARPDUDUGUFABF-UHFFFAOYSA-N 0.000 description 1
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- OGPBJKLSAFTDLK-UHFFFAOYSA-N europium atom Chemical compound [Eu] OGPBJKLSAFTDLK-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- JPELCBSZNYYDPE-UHFFFAOYSA-N formaldehyde;lithium Chemical compound [Li].O=C JPELCBSZNYYDPE-UHFFFAOYSA-N 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 239000011630 iodine Chemical group 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 239000003446 ligand Substances 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 229910052987 metal hydride Inorganic materials 0.000 description 1
- 150000004681 metal hydrides Chemical class 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 230000037023 motor activity Effects 0.000 description 1
- 210000000653 nervous system Anatomy 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 238000010899 nucleation Methods 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 230000003285 pharmacodynamic effect Effects 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- WYVAMUWZEOHJOQ-UHFFFAOYSA-N propionic anhydride Chemical compound CCC(=O)OC(=O)CC WYVAMUWZEOHJOQ-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 230000036280 sedation Effects 0.000 description 1
- 208000019116 sleep disease Diseases 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 125000003003 spiro group Chemical group 0.000 description 1
- KZPNXPYMYHZEHR-UHFFFAOYSA-N spiro[1,2-dihydroindene-3,3'-pyrrolidine]-1-ol Chemical compound C12=CC=CC=C2C(O)CC21CCNC2 KZPNXPYMYHZEHR-UHFFFAOYSA-N 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 208000011580 syndromic disease Diseases 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N urethane group Chemical group NC(=O)OCC JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/24—Oxygen or sulfur atoms
- C07D207/26—2-Pyrrolidones
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/56—Ring systems containing three or more rings
- C07D209/96—Spiro-condensed ring systems
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/55—Design of synthesis routes, e.g. reducing the use of auxiliary or protecting groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Plural Heterocyclic Compounds (AREA)
- Indole Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1231871A CH556835A (de) | 1971-08-23 | 1971-08-23 | Verfahren zur herstellung neuer spiroindanpyrrolidinderivate. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL79446B1 true PL79446B1 (en) | 1975-06-30 |
Family
ID=4381893
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1972157376A PL79446B1 (en) | 1971-08-23 | 1972-08-21 | Organic compounds[au4589772a] |
Country Status (16)
| Country | Link |
|---|---|
| JP (1) | JPS4829765A (online.php) |
| AT (2) | AT330167B (online.php) |
| AU (1) | AU4589772A (online.php) |
| BE (1) | BE787804A (online.php) |
| CH (2) | CH556837A (online.php) |
| DD (1) | DD102146A5 (online.php) |
| DE (1) | DE2241027A1 (online.php) |
| ES (1) | ES406008A1 (online.php) |
| FR (1) | FR2150797B1 (online.php) |
| GB (2) | GB1401049A (online.php) |
| HU (1) | HU165127B (online.php) |
| IL (1) | IL40177A0 (online.php) |
| NL (1) | NL7211304A (online.php) |
| PL (1) | PL79446B1 (online.php) |
| SE (1) | SE385584B (online.php) |
| ZA (2) | ZA725796B (online.php) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3903111A (en) * | 1972-09-11 | 1975-09-02 | Sandoz Ltd | 4-{8 3-Phenyl-pyrrolidin-1-yl{9 -butyrophenone derivatives |
| FR2207718A2 (en) * | 1972-11-28 | 1974-06-21 | Sandoz Sa | Analgesic and sedative spiro (indane 1:3'-pyrrolidines) - 4-(spiro (5-substd.-3-hydroxy or acyloxy-indane-1:3'-pyrrolidine)-1'-yl)-p-fluorobutyrophene derivs |
| JPS5933344A (ja) * | 1982-08-19 | 1984-02-23 | Mitsubishi Monsanto Chem Co | 塩化ビニル系樹脂組成物 |
| US5948807A (en) * | 1997-09-03 | 1999-09-07 | Regents Of The University Of Minnesota | Spiroindanamines and Spiroindanimides |
| JP2005525293A (ja) * | 2001-08-29 | 2005-08-25 | エンドー ファーマシューティカルズ, インコーポレイティド | 鎮痛薬およびその使用方法 |
| EP3233077B1 (en) * | 2014-12-19 | 2026-05-06 | The Broad Institute, Inc. | Dopamine d2 receptor ligands |
| US10752588B2 (en) | 2014-12-19 | 2020-08-25 | The Broad Institute, Inc. | Dopamine D2 receptor ligands |
-
0
- BE BE787804D patent/BE787804A/xx unknown
-
1971
- 1971-08-23 CH CH1827473A patent/CH556837A/de not_active IP Right Cessation
- 1971-08-23 CH CH1231871A patent/CH556835A/xx not_active IP Right Cessation
-
1972
- 1972-04-21 ES ES406008A patent/ES406008A1/es not_active Expired
- 1972-08-14 SE SE7210502A patent/SE385584B/xx unknown
- 1972-08-18 FR FR7229540A patent/FR2150797B1/fr not_active Expired
- 1972-08-18 NL NL7211304A patent/NL7211304A/xx unknown
- 1972-08-21 GB GB451775A patent/GB1401049A/en not_active Expired
- 1972-08-21 DE DE2241027A patent/DE2241027A1/de active Pending
- 1972-08-21 GB GB3880272A patent/GB1401048A/en not_active Expired
- 1972-08-21 PL PL1972157376A patent/PL79446B1/pl unknown
- 1972-08-22 HU HUSA2388A patent/HU165127B/hu unknown
- 1972-08-22 AT AT722872A patent/AT330167B/de not_active IP Right Cessation
- 1972-08-22 IL IL40177A patent/IL40177A0/xx unknown
- 1972-08-22 JP JP47084027A patent/JPS4829765A/ja active Pending
- 1972-08-23 ZA ZA725796A patent/ZA725796B/xx unknown
- 1972-08-23 ZA ZA740329*DA patent/ZA74329B/xx unknown
- 1972-08-23 DD DD165200A patent/DD102146A5/xx unknown
- 1972-08-23 AU AU45897/72A patent/AU4589772A/en not_active Expired
-
1974
- 1974-07-24 AT AT607274A patent/ATA607274A/de not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| HU165127B (online.php) | 1974-06-28 |
| ES406008A1 (es) | 1976-06-01 |
| CH556837A (de) | 1974-12-13 |
| GB1401049A (en) | 1975-07-16 |
| BE787804A (fr) | 1973-02-21 |
| JPS4829765A (online.php) | 1973-04-19 |
| AT330167B (de) | 1976-06-25 |
| DE2241027A1 (de) | 1973-03-01 |
| ZA725796B (en) | 1974-04-24 |
| ZA74329B (en) | 1974-05-29 |
| ATA607274A (de) | 1975-09-15 |
| NL7211304A (online.php) | 1973-02-27 |
| DD102146A5 (online.php) | 1973-12-05 |
| IL40177A0 (en) | 1972-10-29 |
| AU4589772A (en) | 1974-02-28 |
| CH556835A (de) | 1974-12-13 |
| FR2150797B1 (online.php) | 1976-04-16 |
| ATA722872A (de) | 1975-09-15 |
| FR2150797A1 (online.php) | 1973-04-13 |
| GB1401048A (en) | 1975-07-16 |
| SE385584B (sv) | 1976-07-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NL1028624C2 (nl) | Alfa-aryl- of -heteroarylmethyl-bèta-piperidinopropaan-zuurverbindingen als ORL1-receptorantagonisten. | |
| US4259338A (en) | Benzofuranyl-tetrahydropyridines and -piperidines, their acid addition salts and antidepressant preparations thereof | |
| US4590189A (en) | Condensed pyrrolinone derivatives, their production and use | |
| US3420851A (en) | Novel dibenzoxepines | |
| US4613603A (en) | Compounds with a nitrogen-containing heterocyclic nucleus, and drugs in which they are present | |
| BG60270B2 (bg) | Метод за получаване на 5н-2,3-бензодиазепинови производни | |
| SE430983B (sv) | Farmaceutiskt aktiva derivat av 1-hydroxi-oktahydrofenantren-9-on, 1,9-dihydroxi-oktahydrofenantren och 1-hydroxi-hexa-hydrofenantren-9-on | |
| PL76913B1 (en) | Benzonaphthyridine derivatives[gb1361441a] | |
| DE2846043A1 (de) | Isochromane, isothiochromane, 2-benzoxepine und 2-benzothiepine | |
| US4870084A (en) | Bicyclic benzo fused pyran compounds used for nausea treatment and prevention | |
| EP0028717B1 (en) | 6,7-benzomorphan derivatives, processes for their production, pharmaceutical compositions containing said derivatives and their use as pharmaceuticals | |
| US5420150A (en) | 3-aminochroman spiro compounds | |
| AU736710B2 (en) | New indanol compounds, a process for their preparation and pharmaceutical compositions containing them | |
| US4486428A (en) | Bicyclic benzo fused compounds | |
| US3941782A (en) | Heterocyclic esters of benzopyrans | |
| NZ187333A (en) | 2-substituted-trans-2,3,4,4a,5,9b-hexahydro-1h-pyrido-(4,3-b)indoles | |
| US4680404A (en) | Benzopyrans | |
| US5001129A (en) | Oxazoloquinoline compounds and therapeutic application thereof | |
| US4472408A (en) | Substituted trifluoromethylphenyltetrahydropyridines having an anorectic activity | |
| EP0024843A1 (en) | 3,4,5,6-Tetrahydro-2,6-methano-4 beta-amino-1-benzoxocin derivatives, process for their preparation and compositions containing them | |
| CA1192198A (en) | Quinolylacetic acid compounds, process for producing thereof and pharmaceutical compositions containing them | |
| US4769367A (en) | Heterocyclic amino compounds | |
| EP0086982A1 (de) | Substituierte Thienobenzodiazepinone, Verfahren zu ihrer Herstellung und sie enthaltende Arzneimittel | |
| DE2241027A1 (de) | Verfahren zur herstellung neuer heterocyclischer verbindungen | |
| CH616934A5 (en) | Process for the preparation of chromone derivatives |