PL77753B1 - - Google Patents
Download PDFInfo
- Publication number
- PL77753B1 PL77753B1 PL1971149676A PL14967671A PL77753B1 PL 77753 B1 PL77753 B1 PL 77753B1 PL 1971149676 A PL1971149676 A PL 1971149676A PL 14967671 A PL14967671 A PL 14967671A PL 77753 B1 PL77753 B1 PL 77753B1
- Authority
- PL
- Poland
- Prior art keywords
- formula
- dinitro
- trifluoromethylaniline
- alkyl
- radical
- Prior art date
Links
- -1 haloacetylamine Chemical compound 0.000 claims description 51
- 150000001875 compounds Chemical class 0.000 claims description 36
- 239000000203 mixture Substances 0.000 claims description 26
- 229910052757 nitrogen Inorganic materials 0.000 claims description 17
- 125000003545 alkoxy group Chemical group 0.000 claims description 12
- 125000000217 alkyl group Chemical group 0.000 claims description 12
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 10
- 230000002363 herbicidal effect Effects 0.000 claims description 9
- 125000004001 thioalkyl group Chemical group 0.000 claims description 7
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 6
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 6
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 150000002367 halogens Chemical class 0.000 claims description 5
- 239000004009 herbicide Substances 0.000 claims description 5
- 125000001424 substituent group Chemical group 0.000 claims description 5
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 4
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 claims description 4
- 125000001188 haloalkyl group Chemical group 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 claims description 4
- 150000003839 salts Chemical class 0.000 claims description 4
- 125000003342 alkenyl group Chemical group 0.000 claims description 3
- 125000003282 alkyl amino group Chemical group 0.000 claims description 3
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 3
- 150000002148 esters Chemical group 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- OQLZINXFSUDMHM-UHFFFAOYSA-N Acetamidine Chemical compound CC(N)=N OQLZINXFSUDMHM-UHFFFAOYSA-N 0.000 claims description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- 239000004480 active ingredient Substances 0.000 claims description 2
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 2
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 2
- 125000006323 alkenyl amino group Chemical group 0.000 claims description 2
- 125000000304 alkynyl group Chemical group 0.000 claims description 2
- 150000001412 amines Chemical class 0.000 claims description 2
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- ZSIQJIWKELUFRJ-UHFFFAOYSA-N azepane Chemical group C1CCCNCC1 ZSIQJIWKELUFRJ-UHFFFAOYSA-N 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 239000000460 chlorine Substances 0.000 claims description 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 2
- 125000004966 cyanoalkyl group Chemical group 0.000 claims description 2
- 229910052740 iodine Inorganic materials 0.000 claims description 2
- 239000007788 liquid Substances 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- DSWNRHCOGVRDOE-UHFFFAOYSA-N n,n-dimethylmethanimidamide Chemical compound CN(C)C=N DSWNRHCOGVRDOE-UHFFFAOYSA-N 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 125000005359 phenoxyalkyl group Chemical group 0.000 claims description 2
- 229920006395 saturated elastomer Polymers 0.000 claims description 2
- 239000007787 solid Substances 0.000 claims description 2
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 claims 2
- YZCKVEUIGOORGS-IGMARMGPSA-N Protium Chemical compound [1H] YZCKVEUIGOORGS-IGMARMGPSA-N 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- IVRMZWNICZWHMI-UHFFFAOYSA-N azide group Chemical group [N-]=[N+]=[N-] IVRMZWNICZWHMI-UHFFFAOYSA-N 0.000 claims 1
- 125000000522 cyclooctenyl group Chemical group C1(=CCCCCCC1)* 0.000 claims 1
- 125000005265 dialkylamine group Chemical group 0.000 claims 1
- 125000004992 haloalkylamino group Chemical group 0.000 claims 1
- 150000003254 radicals Chemical class 0.000 claims 1
- 230000006378 damage Effects 0.000 description 13
- 239000013543 active substance Substances 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- 241000219318 Amaranthus Species 0.000 description 7
- 241000196324 Embryophyta Species 0.000 description 7
- 241001148727 Bromus tectorum Species 0.000 description 6
- 241000219295 Portulaca Species 0.000 description 6
- 244000234609 Portulaca oleracea Species 0.000 description 6
- 235000001855 Portulaca oleracea Nutrition 0.000 description 6
- 239000004202 carbamide Substances 0.000 description 6
- PUPPKTICUIGNCI-UHFFFAOYSA-N n-butyl-1,3,5-triazin-2-amine Chemical compound CCCCNC1=NC=NC=N1 PUPPKTICUIGNCI-UHFFFAOYSA-N 0.000 description 6
- 244000299507 Gossypium hirsutum Species 0.000 description 5
- 235000009432 Gossypium hirsutum Nutrition 0.000 description 5
- 239000000839 emulsion Substances 0.000 description 5
- 244000068988 Glycine max Species 0.000 description 4
- 235000010469 Glycine max Nutrition 0.000 description 4
- 241001355178 Setaria faberi Species 0.000 description 4
- 239000006185 dispersion Substances 0.000 description 4
- 244000237956 Amaranthus retroflexus Species 0.000 description 3
- 235000013479 Amaranthus retroflexus Nutrition 0.000 description 3
- 241000209200 Bromus Species 0.000 description 3
- 235000017896 Digitaria Nutrition 0.000 description 3
- 241001303487 Digitaria <clam> Species 0.000 description 3
- 244000058871 Echinochloa crus-galli Species 0.000 description 3
- 235000009438 Gossypium Nutrition 0.000 description 3
- 241000219146 Gossypium Species 0.000 description 3
- 240000003461 Setaria viridis Species 0.000 description 3
- 235000002248 Setaria viridis Nutrition 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- QPQPCSJXTCQSAT-UHFFFAOYSA-N 1-(4-chlorophenyl)-1-(cyclohexen-1-yl)-3-methylurea Chemical compound C=1C=C(Cl)C=CC=1N(C(=O)NC)C1=CCCCC1 QPQPCSJXTCQSAT-UHFFFAOYSA-N 0.000 description 2
- YRKPFWUTEXEYDM-UHFFFAOYSA-N 4-but-1-ynyl-2-chloro-6-n-ethyl-2h-1,3,5-triazine-1,6-diamine Chemical group CCNC1=NC(C#CCC)=NC(Cl)N1N YRKPFWUTEXEYDM-UHFFFAOYSA-N 0.000 description 2
- 235000021533 Beta vulgaris Nutrition 0.000 description 2
- 241000335053 Beta vulgaris Species 0.000 description 2
- 235000008427 Brassica arvensis Nutrition 0.000 description 2
- 244000024671 Brassica kaber Species 0.000 description 2
- 235000004977 Brassica sinapistrum Nutrition 0.000 description 2
- 241000234653 Cyperus Species 0.000 description 2
- 244000285774 Cyperus esculentus Species 0.000 description 2
- 235000005853 Cyperus esculentus Nutrition 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 244000152970 Digitaria sanguinalis Species 0.000 description 2
- 235000010823 Digitaria sanguinalis Nutrition 0.000 description 2
- 241000192043 Echinochloa Species 0.000 description 2
- 244000214240 Galinsoga parviflora Species 0.000 description 2
- 235000018914 Galinsoga parviflora Nutrition 0.000 description 2
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methylaniline Chemical compound CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 2
- UMKANAFDOQQUKE-UHFFFAOYSA-N Nitralin Chemical group CCCN(CCC)C1=C([N+]([O-])=O)C=C(S(C)(=O)=O)C=C1[N+]([O-])=O UMKANAFDOQQUKE-UHFFFAOYSA-N 0.000 description 2
- 235000011999 Panicum crusgalli Nutrition 0.000 description 2
- 235000005775 Setaria Nutrition 0.000 description 2
- 241000232088 Setaria <nematode> Species 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- FHULFRVQYMSSFB-UHFFFAOYSA-N [3-(methylcarbamoylamino)phenyl] n-ethylcarbamate Chemical compound CCNC(=O)OC1=CC=CC(NC(=O)NC)=C1 FHULFRVQYMSSFB-UHFFFAOYSA-N 0.000 description 2
- 230000009286 beneficial effect Effects 0.000 description 2
- SMDHCQAYESWHAE-UHFFFAOYSA-N benfluralin Chemical compound CCCCN(CC)C1=C([N+]([O-])=O)C=C(C(F)(F)F)C=C1[N+]([O-])=O SMDHCQAYESWHAE-UHFFFAOYSA-N 0.000 description 2
- 230000004071 biological effect Effects 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 235000013877 carbamide Nutrition 0.000 description 2
- 125000002603 chloroethyl group Chemical group [H]C([*])([H])C([H])([H])Cl 0.000 description 2
- 150000004702 methyl esters Chemical class 0.000 description 2
- SYVSAUXBPCEHBA-UHFFFAOYSA-N n-(2-chloroethyl)-2,6-dinitro-4-(trifluoromethyl)aniline Chemical compound [O-][N+](=O)C1=CC(C(F)(F)F)=CC([N+]([O-])=O)=C1NCCCl SYVSAUXBPCEHBA-UHFFFAOYSA-N 0.000 description 2
- DOOFIWHGCPBLOA-UHFFFAOYSA-N n-ethyl-2,6-dinitro-4-(trifluoromethyl)aniline Chemical compound CCNC1=C([N+]([O-])=O)C=C(C(F)(F)F)C=C1[N+]([O-])=O DOOFIWHGCPBLOA-UHFFFAOYSA-N 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000002689 soil Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- ZSDSQXJSNMTJDA-UHFFFAOYSA-N trifluralin Chemical compound CCCN(CCC)C1=C([N+]([O-])=O)C=C(C(F)(F)F)C=C1[N+]([O-])=O ZSDSQXJSNMTJDA-UHFFFAOYSA-N 0.000 description 2
- FIDRAVVQGKNYQK-UHFFFAOYSA-N 1,2,3,4-tetrahydrotriazine Chemical compound C1NNNC=C1 FIDRAVVQGKNYQK-UHFFFAOYSA-N 0.000 description 1
- NCQVQQNVWXQOAD-UHFFFAOYSA-N 1-(3-chlorophenyl)-1-(cyclohexen-1-yl)-3-methylurea Chemical compound C=1C=CC(Cl)=CC=1N(C(=O)NC)C1=CCCCC1 NCQVQQNVWXQOAD-UHFFFAOYSA-N 0.000 description 1
- LHVXDMMNONKTMG-UHFFFAOYSA-N 1-(4-bromophenyl)-1-(cyclohexen-1-yl)-3,3-dimethylurea Chemical compound C=1C=C(Br)C=CC=1N(C(=O)N(C)C)C1=CCCCC1 LHVXDMMNONKTMG-UHFFFAOYSA-N 0.000 description 1
- HYCUUTWFLXHTQB-UHFFFAOYSA-N 1-(cyclohexen-1-yl)-3-methyl-1-phenylurea Chemical compound C=1C=CC=CC=1N(C(=O)NC)C1=CCCCC1 HYCUUTWFLXHTQB-UHFFFAOYSA-N 0.000 description 1
- QXXIZJPWGJDHKR-UHFFFAOYSA-N 2,6-dinitro-n-propyl-4-(trifluoromethyl)aniline Chemical compound CCCNC1=C([N+]([O-])=O)C=C(C(F)(F)F)C=C1[N+]([O-])=O QXXIZJPWGJDHKR-UHFFFAOYSA-N 0.000 description 1
- ODUKBIAFNCULOT-UHFFFAOYSA-N 3-[n-ethyl-2,6-dinitro-4-(trifluoromethyl)anilino]propanenitrile Chemical compound N#CCCN(CC)C1=C([N+]([O-])=O)C=C(C(F)(F)F)C=C1[N+]([O-])=O ODUKBIAFNCULOT-UHFFFAOYSA-N 0.000 description 1
- AMGFTYFMEZSCMH-UHFFFAOYSA-N 3-[n-methyl-2,6-dinitro-4-(trifluoromethyl)anilino]propanenitrile Chemical compound N#CCCN(C)C1=C([N+]([O-])=O)C=C(C(F)(F)F)C=C1[N+]([O-])=O AMGFTYFMEZSCMH-UHFFFAOYSA-N 0.000 description 1
- ODGIMMLDVSWADK-UHFFFAOYSA-N 4-trifluoromethylaniline Chemical compound NC1=CC=C(C(F)(F)F)C=C1 ODGIMMLDVSWADK-UHFFFAOYSA-N 0.000 description 1
- LXILAQXSFLCWDQ-UHFFFAOYSA-N 5-amino-4-chloro-2-phenyl-1,5-dihydropyridazin-6-one Chemical compound C1=C(Cl)C(N)C(=O)NN1C1=CC=CC=C1 LXILAQXSFLCWDQ-UHFFFAOYSA-N 0.000 description 1
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 1
- 244000075850 Avena orientalis Species 0.000 description 1
- 235000007319 Avena orientalis Nutrition 0.000 description 1
- 240000002791 Brassica napus Species 0.000 description 1
- 235000011293 Brassica napus Nutrition 0.000 description 1
- 206010006895 Cachexia Diseases 0.000 description 1
- 240000006122 Chenopodium album Species 0.000 description 1
- 235000009344 Chenopodium album Nutrition 0.000 description 1
- RYECOJGRJDOGPP-UHFFFAOYSA-N Ethylurea Chemical compound CCNC(N)=O RYECOJGRJDOGPP-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- OWYWGLHRNBIFJP-UHFFFAOYSA-N Ipazine Chemical compound CCN(CC)C1=NC(Cl)=NC(NC(C)C)=N1 OWYWGLHRNBIFJP-UHFFFAOYSA-N 0.000 description 1
- XGEGHDBEHXKFPX-UHFFFAOYSA-N N-methylthiourea Natural products CNC(N)=O XGEGHDBEHXKFPX-UHFFFAOYSA-N 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- 241000209117 Panicum Species 0.000 description 1
- 235000006443 Panicum miliaceum subsp. miliaceum Nutrition 0.000 description 1
- 235000009037 Panicum miliaceum subsp. ruderale Nutrition 0.000 description 1
- 241000209048 Poa Species 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 241000205407 Polygonum Species 0.000 description 1
- 241000220261 Sinapis Species 0.000 description 1
- 244000062793 Sorghum vulgare Species 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical group [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 229960000250 adipic acid Drugs 0.000 description 1
- 125000006319 alkynyl amino group Chemical group 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- PXWUKZGIHQRDHL-UHFFFAOYSA-N atraton Chemical compound CCNC1=NC(NC(C)C)=NC(OC)=N1 PXWUKZGIHQRDHL-UHFFFAOYSA-N 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 230000031018 biological processes and functions Effects 0.000 description 1
- 229960003369 butacaine Drugs 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 229910052570 clay Inorganic materials 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 239000004495 emulsifiable concentrate Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 125000001183 hydrocarbyl group Chemical group 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- JOHLTMWXHJLNDE-UHFFFAOYSA-N methoxyurea Chemical compound CONC(N)=O JOHLTMWXHJLNDE-UHFFFAOYSA-N 0.000 description 1
- XGEGHDBEHXKFPX-NJFSPNSNSA-N methylurea Chemical compound [14CH3]NC(N)=O XGEGHDBEHXKFPX-NJFSPNSNSA-N 0.000 description 1
- 235000019713 millet Nutrition 0.000 description 1
- JDEJGVSZUIJWBM-UHFFFAOYSA-N n,n,2-trimethylaniline Chemical compound CN(C)C1=CC=CC=C1C JDEJGVSZUIJWBM-UHFFFAOYSA-N 0.000 description 1
- WHNCLGWWBVRVCW-UHFFFAOYSA-N n-(2-bromoethyl)-n-ethyl-2,6-dinitro-4-(trifluoromethyl)aniline Chemical compound BrCCN(CC)C1=C([N+]([O-])=O)C=C(C(F)(F)F)C=C1[N+]([O-])=O WHNCLGWWBVRVCW-UHFFFAOYSA-N 0.000 description 1
- UGTWKOHFGKPYCY-UHFFFAOYSA-N n-(2-chloroethyl)-4-methyl-2,6-dinitro-n-propylaniline Chemical compound CCCN(CCCl)C1=C([N+]([O-])=O)C=C(C)C=C1[N+]([O-])=O UGTWKOHFGKPYCY-UHFFFAOYSA-N 0.000 description 1
- YPEZVVNZIBDLGH-UHFFFAOYSA-N n-(2-chloroethyl)-n-ethyl-2,6-dinitro-4-(trifluoromethyl)aniline Chemical group ClCCN(CC)C1=C([N+]([O-])=O)C=C(C(F)(F)F)C=C1[N+]([O-])=O YPEZVVNZIBDLGH-UHFFFAOYSA-N 0.000 description 1
- DTKZZQHRNFHLOH-UHFFFAOYSA-N n-(2-chloropropyl)-2,6-dinitro-n-propyl-4-(trifluoromethyl)aniline Chemical compound CCCN(CC(C)Cl)C1=C([N+]([O-])=O)C=C(C(F)(F)F)C=C1[N+]([O-])=O DTKZZQHRNFHLOH-UHFFFAOYSA-N 0.000 description 1
- KXHORCXSQZTQQI-UHFFFAOYSA-N n-(fluoromethyl)aniline Chemical compound FCNC1=CC=CC=C1 KXHORCXSQZTQQI-UHFFFAOYSA-N 0.000 description 1
- SLFVYFOEHHLHDW-UHFFFAOYSA-N n-(trifluoromethyl)aniline Chemical compound FC(F)(F)NC1=CC=CC=C1 SLFVYFOEHHLHDW-UHFFFAOYSA-N 0.000 description 1
- UMRMRBSCLRWNTL-UHFFFAOYSA-N n-butyl-n-ethyl-4-methylsulfonyl-2,6-dinitroaniline Chemical compound CCCCN(CC)C1=C([N+]([O-])=O)C=C(S(C)(=O)=O)C=C1[N+]([O-])=O UMRMRBSCLRWNTL-UHFFFAOYSA-N 0.000 description 1
- 150000002790 naphthalenes Chemical class 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 150000008027 tertiary esters Chemical class 0.000 description 1
- 150000003918 triazines Chemical class 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/06—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by halogen atoms or nitro radicals
- C07D295/073—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by halogen atoms or nitro radicals with the ring nitrogen atoms and the substituents separated by carbocyclic rings or by carbon chains interrupted by carbocyclic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/06—Phosphorus compounds without P—C bonds
- C07F9/16—Esters of thiophosphoric acids or thiophosphorous acids
- C07F9/165—Esters of thiophosphoric acids
- C07F9/1651—Esters of thiophosphoric acids with hydroxyalkyl compounds with further substituents on alkyl
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Biochemistry (AREA)
- General Health & Medical Sciences (AREA)
- Molecular Biology (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19702037265 DE2037265A1 (de) | 1970-07-28 | 1970-07-28 | Herbizid |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL77753B1 true PL77753B1 (env) | 1975-04-30 |
Family
ID=5778058
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1971149676A PL77753B1 (env) | 1970-07-28 | 1971-07-27 |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US3849107A (env) |
| AT (4) | AT309888B (env) |
| AU (1) | AU461725B2 (env) |
| BE (1) | BE770395A (env) |
| BR (1) | BR7104766D0 (env) |
| CA (1) | CA970181A (env) |
| CS (1) | CS171657B2 (env) |
| DE (1) | DE2037265A1 (env) |
| DK (1) | DK129074B (env) |
| FR (1) | FR2099642B1 (env) |
| GB (1) | GB1348428A (env) |
| HU (1) | HU165877B (env) |
| IL (1) | IL37313A (env) |
| NL (1) | NL7110345A (env) |
| PL (1) | PL77753B1 (env) |
| SE (1) | SE381160B (env) |
| SU (2) | SU511830A3 (env) |
| ZA (1) | ZA714937B (env) |
Families Citing this family (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4042628A (en) * | 1967-12-21 | 1977-08-16 | Badische Anilin- & Soda-Fabrik Aktiengesellschaft | 2,6-Dinitro-4-trifluoromethylanilines |
| US3989508A (en) * | 1970-01-28 | 1976-11-02 | Basf Aktiengesellschaft | Substituted nitroanilines and ureas as herbicidal mixtures |
| DE2334787A1 (de) * | 1973-07-09 | 1975-02-06 | Basf Ag | Herbizid |
| GB1473105A (env) * | 1973-08-10 | 1977-05-11 | ||
| DE2352537A1 (de) * | 1973-10-19 | 1975-04-30 | Basf Ag | Herbizid |
| US3979453A (en) * | 1975-06-23 | 1976-09-07 | Eli Lilly And Company | 3-Cyanamino-2,6-dinitroanilines |
| DE2534042A1 (de) * | 1975-07-30 | 1977-02-17 | Shell Int Research | Herbicide mittel |
| US4124639A (en) * | 1975-12-22 | 1978-11-07 | America Cyanamid Company | N-alkoxyalkyl-2,6-dinitroaniline herbicides |
| DE2604224A1 (de) * | 1976-02-04 | 1977-08-11 | Hoechst Ag | Herbizide mittel |
| DE2617736C2 (de) * | 1976-04-23 | 1982-12-09 | Hoechst Ag, 6000 Frankfurt | Schädlingsbekämpfungsmittel |
| DE2706700A1 (de) * | 1977-02-17 | 1978-08-24 | Consortium Elektrochem Ind | Verfahren zur herstellung von pyridazin-3-on-verbindungen, neue pyridazin-3-one und deren verwendung |
| US4087460A (en) * | 1977-06-27 | 1978-05-02 | Eli Lilly And Company | Substituted N-alkoxy-N-substituted-2,6-dinitroanilines and intermediates for the preparation thereof |
| US4453965A (en) * | 1977-07-13 | 1984-06-12 | Patel Natu R | N-Isopropylcarbanilylmethyl dithiophosphates as pre-emergent herbicides |
| EP0006681A1 (en) * | 1978-06-17 | 1980-01-09 | FISONS plc | Herbicidal composition and method |
| DE2842142A1 (de) * | 1978-09-28 | 1980-04-10 | Hoechst Ag | Herbizide mittel |
| IT1131750B (it) * | 1980-06-06 | 1986-06-25 | Montedison Spa | Formulazioni stabili di n-(3,4-diclorofenil)-n'metossi-n'-metilurea (linorun) e 2,6-dinitor-n,n-dipropil-4-trifluoro metilanilina (trifluralin) in emulsione |
| DE3129374A1 (de) * | 1981-07-25 | 1983-02-10 | Norddeutsche Affinerie AG, 2000 Hamburg | Mittel zur selktiven unkrautbekaempfung und seine anwendung |
| DE3807896A1 (de) * | 1988-03-10 | 1989-09-21 | Basf Ag | 2-phenylpyridazin-3-on-verbindungen, verfahren zu ihrer herstellung und ihre verwendung als herbizide |
| ZA200601765B (en) | 2003-08-29 | 2008-03-26 | Mitsui Chemicals Inc | Insecticide for agricultural or horticultural use and method of use thereof |
| US7390395B2 (en) * | 2005-06-23 | 2008-06-24 | Saleh Elomari | Hydrocarbon conversion using molecular sieve SSZ-56 |
| JP2013518907A (ja) * | 2010-02-08 | 2013-05-23 | アラーガン インコーポレイテッド | カンナビノイド−2作動薬として有用なピリダジン誘導体 |
| CN116635386A (zh) * | 2020-12-22 | 2023-08-22 | Fmc公司 | 取代的哒嗪酮除草剂 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3257190A (en) * | 1962-12-10 | 1966-06-21 | Lilly Co Eli | Method of eliminating weed grasses and broadleaf weeds |
| FR1486323A (fr) * | 1965-07-12 | 1967-06-23 | Daikin Ind Ltd | Compositions herbicides, procédés pour les obtenir et applications de ces compositions |
| US3442639A (en) * | 1965-12-22 | 1969-05-06 | Lilly Co Eli | Process of selectively eliminating weeds |
| US3449111A (en) * | 1966-12-08 | 1969-06-10 | Lilly Co Eli | Method of eliminating weeds |
| DE1670315B1 (de) * | 1968-02-10 | 1972-05-31 | Basf Ag | 1-(m-Trifluormethylphenyl)-4-methoxy-5-halogen-pyridazon-(6)-derivate |
-
1970
- 1970-07-28 DE DE19702037265 patent/DE2037265A1/de active Pending
-
1971
- 1971-07-13 US US00162317A patent/US3849107A/en not_active Expired - Lifetime
- 1971-07-14 CA CA118,250A patent/CA970181A/en not_active Expired
- 1971-07-14 IL IL37313A patent/IL37313A/xx unknown
- 1971-07-16 AU AU31319/71A patent/AU461725B2/en not_active Expired
- 1971-07-21 CS CS5381A patent/CS171657B2/cs unknown
- 1971-07-23 BE BE770395A patent/BE770395A/xx unknown
- 1971-07-23 ZA ZA714937A patent/ZA714937B/xx unknown
- 1971-07-26 SU SU1789831A patent/SU511830A3/ru active
- 1971-07-26 SU SU1790688A patent/SU460604A3/ru active
- 1971-07-26 SE SE7109578A patent/SE381160B/xx unknown
- 1971-07-27 AT AT462372A patent/AT309888B/de not_active IP Right Cessation
- 1971-07-27 DK DK367871AA patent/DK129074B/da unknown
- 1971-07-27 AT AT462272A patent/AT309887B/de not_active IP Right Cessation
- 1971-07-27 GB GB3518671A patent/GB1348428A/en not_active Expired
- 1971-07-27 AT AT462072A patent/AT309886B/de active
- 1971-07-27 AT AT653671A patent/AT308465B/de not_active IP Right Cessation
- 1971-07-27 NL NL7110345A patent/NL7110345A/xx unknown
- 1971-07-27 PL PL1971149676A patent/PL77753B1/pl unknown
- 1971-07-28 HU HUBA2817A patent/HU165877B/hu unknown
- 1971-07-28 BR BR4766/71A patent/BR7104766D0/pt unknown
- 1971-07-28 FR FR7127692A patent/FR2099642B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CA970181A (en) | 1975-07-01 |
| AU3131971A (en) | 1973-01-18 |
| DK129074B (da) | 1974-08-19 |
| AT308465B (de) | 1973-07-10 |
| BR7104766D0 (pt) | 1973-04-17 |
| IL37313A (en) | 1974-06-30 |
| SU460604A3 (ru) | 1975-02-15 |
| AT309886B (de) | 1973-09-10 |
| AT309888B (de) | 1973-09-10 |
| DE2037265A1 (de) | 1972-02-03 |
| FR2099642A1 (env) | 1972-03-17 |
| SU404189A3 (env) | 1973-10-26 |
| ZA714937B (en) | 1972-05-31 |
| CS171657B2 (env) | 1976-10-29 |
| NL7110345A (env) | 1972-02-01 |
| AT309887B (de) | 1973-09-10 |
| SU511830A3 (ru) | 1976-04-25 |
| HU165877B (env) | 1974-12-28 |
| IL37313A0 (en) | 1971-11-29 |
| SE381160B (sv) | 1975-12-01 |
| US3849107A (en) | 1974-11-19 |
| BE770395A (fr) | 1972-01-24 |
| GB1348428A (en) | 1974-03-20 |
| AU461725B2 (en) | 1975-06-05 |
| FR2099642B1 (env) | 1976-03-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3060235A (en) | Phenyl ether-ureas | |
| US3849107A (en) | Herbicide | |
| US3119682A (en) | Herbicidal composition containing as the active ingredient a phenyl ether urea | |
| PL83205B1 (env) | ||
| US3989508A (en) | Substituted nitroanilines and ureas as herbicidal mixtures | |
| PL80180B1 (env) | ||
| IL32022A (en) | N-(3-chloro-4-ethoxyphenyl)-n'-methyl-n'-methoxyurea,its manufacture and its use as herbicide | |
| PL147685B1 (en) | Insecticide | |
| US3808262A (en) | Urea derivatives | |
| PL82048B1 (env) | ||
| PL126774B1 (en) | Herbicide | |
| PL78984B1 (env) | ||
| US3184301A (en) | Method for destroying weeds | |
| US3933467A (en) | Substituted nitroanilines and substituted 1, 3, 5-triazines as herbicidal mixtures | |
| PL83285B1 (env) | ||
| US4185989A (en) | 3-Phenacyl phthaldide safening agents | |
| US3877924A (en) | Herbicide | |
| PL88965B3 (env) | ||
| PL77191B1 (env) | ||
| PL76179B1 (env) | ||
| US3480658A (en) | 3,5-dihalo-4-carbamato benzonitriles | |
| PL83665B1 (env) | ||
| US3763209A (en) | 2,4-dicyano-6-nitro-benzene amines | |
| PL99608B1 (pl) | Srodek do selektywnego zwalczania chwastow w uprawach zboz | |
| US3984468A (en) | Herbicidal N-trifluoromethylmercaptophenyl ureas |