PL76031B1 - N-tritylimidazolium salts [gb1260211a] - Google Patents
N-tritylimidazolium salts [gb1260211a] Download PDFInfo
- Publication number
- PL76031B1 PL76031B1 PL1969131421A PL13142169A PL76031B1 PL 76031 B1 PL76031 B1 PL 76031B1 PL 1969131421 A PL1969131421 A PL 1969131421A PL 13142169 A PL13142169 A PL 13142169A PL 76031 B1 PL76031 B1 PL 76031B1
- Authority
- PL
- Poland
- Prior art keywords
- formula
- tritylimidazolium
- admixture
- salts
- anion
- Prior art date
Links
- NPZDCTUDQYGYQD-UHFFFAOYSA-O 1-trityl-1h-imidazol-1-ium Chemical class C1=NC=C[NH+]1C(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 NPZDCTUDQYGYQD-UHFFFAOYSA-O 0.000 title abstract description 5
- 150000007524 organic acids Chemical class 0.000 claims abstract description 7
- 125000003282 alkyl amino group Chemical group 0.000 claims abstract description 5
- 150000007522 mineralic acids Chemical class 0.000 claims abstract description 5
- 125000003545 alkoxy group Chemical group 0.000 claims abstract 3
- 150000001450 anions Chemical class 0.000 claims abstract 3
- 229910052736 halogen Inorganic materials 0.000 claims abstract 2
- 150000002367 halogens Chemical class 0.000 claims abstract 2
- -1 dialmloemin Chemical group 0.000 claims description 6
- 235000005985 organic acids Nutrition 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- 238000000034 method Methods 0.000 claims description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 150000003839 salts Chemical class 0.000 claims description 2
- 150000002431 hydrogen Chemical group 0.000 claims 1
- 239000003085 diluting agent Substances 0.000 abstract description 5
- 150000001875 compounds Chemical class 0.000 abstract description 4
- 125000004390 alkyl sulfonyl group Chemical group 0.000 abstract description 3
- 125000004414 alkyl thio group Chemical group 0.000 abstract description 3
- 230000000855 fungicidal effect Effects 0.000 abstract description 3
- 241000233866 Fungi Species 0.000 abstract description 2
- 125000004765 (C1-C4) haloalkyl group Chemical group 0.000 abstract 2
- 125000004644 alkyl sulfinyl group Chemical group 0.000 abstract 2
- 239000000969 carrier Substances 0.000 abstract 2
- 239000007788 liquid Substances 0.000 abstract 2
- 239000007787 solid Substances 0.000 abstract 2
- KNIUHBNRWZGIQQ-UHFFFAOYSA-N 7-diethoxyphosphinothioyloxy-4-methylchromen-2-one Chemical compound CC1=CC(=O)OC2=CC(OP(=S)(OCC)OCC)=CC=C21 KNIUHBNRWZGIQQ-UHFFFAOYSA-N 0.000 abstract 1
- 239000004480 active ingredient Substances 0.000 abstract 1
- 125000004985 dialkyl amino alkyl group Chemical group 0.000 abstract 1
- 125000004663 dialkyl amino group Chemical group 0.000 abstract 1
- 239000000417 fungicide Substances 0.000 abstract 1
- 239000000203 mixture Substances 0.000 abstract 1
- 239000004094 surface-active agent Substances 0.000 abstract 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 13
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 12
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 11
- 238000006243 chemical reaction Methods 0.000 description 9
- UHOVQNZJYSORNB-UHFFFAOYSA-N monobenzene Natural products C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 8
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 4
- 239000000460 chlorine Chemical group 0.000 description 4
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 4
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 125000005843 halogen group Chemical group 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- ANRQGKOBLBYXFM-UHFFFAOYSA-M phenylmagnesium bromide Chemical compound Br[Mg]C1=CC=CC=C1 ANRQGKOBLBYXFM-UHFFFAOYSA-M 0.000 description 2
- 230000000885 phytotoxic effect Effects 0.000 description 2
- 239000003495 polar organic solvent Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- KHVJXWFCBMQXLH-UHFFFAOYSA-N (4-chlorophenyl)-diphenylmethanol Chemical compound C=1C=CC=CC=1C(C=1C=CC(Cl)=CC=1)(O)C1=CC=CC=C1 KHVJXWFCBMQXLH-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- LMSWYOHFMJDYAF-UHFFFAOYSA-N 1-chloro-4-[chloro(diphenyl)methyl]benzene Chemical compound C1=CC(Cl)=CC=C1C(Cl)(C=1C=CC=CC=1)C1=CC=CC=C1 LMSWYOHFMJDYAF-UHFFFAOYSA-N 0.000 description 1
- NPZDCTUDQYGYQD-UHFFFAOYSA-N 1-tritylimidazole Chemical compound C1=NC=CN1C(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 NPZDCTUDQYGYQD-UHFFFAOYSA-N 0.000 description 1
- JDIIGWSSTNUWGK-UHFFFAOYSA-N 1h-imidazol-3-ium;chloride Chemical compound [Cl-].[NH2+]1C=CN=C1 JDIIGWSSTNUWGK-UHFFFAOYSA-N 0.000 description 1
- LXBGSDVWAMZHDD-UHFFFAOYSA-N 2-methyl-1h-imidazole Chemical class CC1=NC=CN1 LXBGSDVWAMZHDD-UHFFFAOYSA-N 0.000 description 1
- AGUNPFIFLDXKPR-UHFFFAOYSA-N 2-trityl-1h-imidazole Chemical class C1=CNC(C(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)=N1 AGUNPFIFLDXKPR-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- JPCJJVANGGNFHJ-UHFFFAOYSA-N C(C(O)C)(=O)[O-].C1(=CC=CC=C1)C([NH+]1C=NC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 Chemical compound C(C(O)C)(=O)[O-].C1(=CC=CC=C1)C([NH+]1C=NC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 JPCJJVANGGNFHJ-UHFFFAOYSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical group FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 208000031888 Mycoses Diseases 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 description 1
- 239000012965 benzophenone Substances 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 210000000601 blood cell Anatomy 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 239000011737 fluorine Chemical group 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 238000002386 leaching Methods 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- LCPDWSOZIOUXRV-UHFFFAOYSA-N phenoxyacetic acid Chemical class OC(=O)COC1=CC=CC=C1 LCPDWSOZIOUXRV-UHFFFAOYSA-N 0.000 description 1
- 231100000208 phytotoxic Toxicity 0.000 description 1
- 150000007519 polyprotic acids Polymers 0.000 description 1
- 239000011814 protection agent Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19681670977 DE1670977C3 (de) | 1968-01-29 | 1968-01-29 | N-Trityl-Imidazoliumsalze |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL76031B1 true PL76031B1 (en) | 1975-02-28 |
Family
ID=5686364
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1969131421A PL76031B1 (en) | 1968-01-29 | 1969-01-27 | N-tritylimidazolium salts [gb1260211a] |
| PL1969155790A PL82141B1 (en) | 1968-01-29 | 1969-01-27 | N-tritylimidazolium salts [gb1260211a] |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1969155790A PL82141B1 (en) | 1968-01-29 | 1969-01-27 | N-tritylimidazolium salts [gb1260211a] |
Country Status (12)
| Country | Link |
|---|---|
| JP (1) | JPS4825188B1 (https=) |
| AT (2) | AT283354B (https=) |
| BE (1) | BE727489A (https=) |
| BR (1) | BR6804399D0 (https=) |
| CH (1) | CH511561A (https=) |
| CS (1) | CS153028B2 (https=) |
| ES (1) | ES362951A1 (https=) |
| FR (1) | FR1599525A (https=) |
| GB (2) | GB1261880A (https=) |
| IL (1) | IL31301A (https=) |
| PL (2) | PL76031B1 (https=) |
| SU (1) | SU400093A3 (https=) |
-
1968
- 1968-11-28 BR BR204399/68A patent/BR6804399D0/pt unknown
- 1968-12-18 CH CH1888768A patent/CH511561A/de not_active IP Right Cessation
- 1968-12-20 IL IL6831301A patent/IL31301A/en unknown
- 1968-12-30 FR FR1599525D patent/FR1599525A/fr not_active Expired
-
1969
- 1969-01-15 CS CS24869*#A patent/CS153028B2/cs unknown
- 1969-01-16 AT AT43069A patent/AT283354B/de not_active IP Right Cessation
- 1969-01-16 AT AT951969A patent/AT300458B/de not_active IP Right Cessation
- 1969-01-27 PL PL1969131421A patent/PL76031B1/pl unknown
- 1969-01-27 BE BE727489D patent/BE727489A/xx unknown
- 1969-01-27 ES ES362951A patent/ES362951A1/es not_active Expired
- 1969-01-27 PL PL1969155790A patent/PL82141B1/pl unknown
- 1969-01-29 GB GB43217/71A patent/GB1261880A/en not_active Expired
- 1969-01-29 JP JP44006263A patent/JPS4825188B1/ja active Pending
- 1969-01-29 GB GB4897/69A patent/GB1260211A/en not_active Expired
- 1969-01-29 SU SU1705173A patent/SU400093A3/ru active
Also Published As
| Publication number | Publication date |
|---|---|
| GB1260211A (en) | 1972-01-12 |
| BE727489A (https=) | 1969-07-28 |
| FR1599525A (https=) | 1970-07-15 |
| IL31301A (en) | 1972-07-26 |
| PL82141B1 (en) | 1975-10-31 |
| AT283354B (de) | 1970-08-10 |
| CH511561A (de) | 1971-08-31 |
| ES362951A1 (es) | 1970-11-16 |
| JPS4825188B1 (https=) | 1973-07-26 |
| GB1261880A (en) | 1972-01-26 |
| SU400093A3 (https=) | 1973-10-03 |
| BR6804399D0 (pt) | 1973-02-22 |
| AT300458B (de) | 1972-07-25 |
| CS153028B2 (https=) | 1974-02-22 |
| IL31301A0 (en) | 1969-02-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0234242B1 (en) | Fungicidal azolyl-derivatives | |
| CA1045628A (en) | Labile quaternary ammonium salts as transient derivatives | |
| WO2014158644A1 (en) | Process for the preparation of triaryl rhamnose carbamates | |
| PL97300B1 (pl) | Srodek grzybobojczy | |
| US4118461A (en) | 1-Substituted aralkyl imidazoles | |
| CS200238B2 (en) | Fungicide | |
| PL76033B1 (en) | N-trityl-imidazoles as plant fungicides[us3665076a] | |
| US4073921A (en) | Substituted arylcyanoalkyl and diarylcyanoalkylimidazoles and fungical compositions and methods utilizing them | |
| JPH0463068B2 (https=) | ||
| US4495191A (en) | Fungicidal 3-1,2,4-triazol-1-yl-1,2-diaryl-1-halogeno-prop-1-ene derivatives, compositions, and method of use | |
| CS221276B2 (en) | Fungicide means | |
| PL121391B1 (en) | Fungicide and process for preparing fluorinated derivatives of 1-triazolylbutane 1-triazolilbutana | |
| EP0586556B1 (en) | Substituted 2,6-substituted pyridine herbicides | |
| JPS6224425B2 (https=) | ||
| US4456608A (en) | Azole compounds, their preparation, and fungicides which contain these compounds | |
| PL76031B1 (en) | N-tritylimidazolium salts [gb1260211a] | |
| KR20200110381A (ko) | 술펜트라존의 합성 방법 | |
| CA1127154A (en) | .alpha.-AZOLYL-.alpha.-PHENYLACETIC ACID DERIVATIVES | |
| US5021442A (en) | Fungicide azolyl-derivatives | |
| CA1325637C (en) | Fungicide azolyl-derivatives | |
| DK175378B1 (da) | Fremgangsmåde til minimering af racemiseringen ved fremstilling af optisk aktive [(aryloxy)-phenoxy]propionatherbicider | |
| EP0254632B1 (en) | Azolyl-derivativates having fungicidal activity | |
| US4225723A (en) | Process for the preparation of substituted arylcyanoalkyl and diaryl cyanoalkylimidazoles | |
| US4237158A (en) | 1-Substituted aralkyl imidazoles and their use as fungicides | |
| US3719760A (en) | N-trityl-imidazolium salts as a fungicide |