PL69796B1 - - Google Patents
Download PDFInfo
- Publication number
- PL69796B1 PL69796B1 PL1968128332A PL12833268A PL69796B1 PL 69796 B1 PL69796 B1 PL 69796B1 PL 1968128332 A PL1968128332 A PL 1968128332A PL 12833268 A PL12833268 A PL 12833268A PL 69796 B1 PL69796 B1 PL 69796B1
- Authority
- PL
- Poland
- Prior art keywords
- acid
- formula
- general formula
- methyl
- compounds
- Prior art date
Links
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical group Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 73
- -1 heterocyclic carboxylic acids Chemical class 0.000 claims description 61
- 239000002253 acid Substances 0.000 claims description 44
- 150000001875 compounds Chemical class 0.000 claims description 41
- 238000000034 method Methods 0.000 claims description 34
- 150000007530 organic bases Chemical group 0.000 claims description 17
- 150000003839 salts Chemical class 0.000 claims description 16
- 238000009835 boiling Methods 0.000 claims description 14
- 238000006243 chemical reaction Methods 0.000 claims description 14
- 150000007529 inorganic bases Chemical class 0.000 claims description 14
- 239000002904 solvent Substances 0.000 claims description 14
- 125000000217 alkyl group Chemical group 0.000 claims description 12
- 230000007017 scission Effects 0.000 claims description 8
- 238000003776 cleavage reaction Methods 0.000 claims description 7
- 125000005843 halogen group Chemical group 0.000 claims description 7
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 7
- 238000002360 preparation method Methods 0.000 claims description 7
- 238000010438 heat treatment Methods 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 claims description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 239000002168 alkylating agent Substances 0.000 claims description 3
- 229940100198 alkylating agent Drugs 0.000 claims description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Chemical group Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 claims description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 claims description 3
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 claims description 2
- 150000008065 acid anhydrides Chemical class 0.000 claims description 2
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 2
- 150000001412 amines Chemical class 0.000 claims description 2
- 150000001450 anions Chemical class 0.000 claims description 2
- 150000002148 esters Chemical class 0.000 claims description 2
- 125000001841 imino group Chemical group [H]N=* 0.000 claims description 2
- 229910052740 iodine Inorganic materials 0.000 claims description 2
- 150000007522 mineralic acids Chemical class 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 2
- RWSOTUBLDIXVET-UHFFFAOYSA-O sulfonium group Chemical group [SH3+] RWSOTUBLDIXVET-UHFFFAOYSA-O 0.000 claims description 2
- 229910052717 sulfur Chemical group 0.000 claims description 2
- 125000004434 sulfur atom Chemical group 0.000 claims description 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims 3
- 101100399480 Caenorhabditis elegans lmn-1 gene Proteins 0.000 claims 1
- 238000007796 conventional method Methods 0.000 claims 1
- 238000007257 deesterification reaction Methods 0.000 claims 1
- 238000010931 ester hydrolysis Methods 0.000 claims 1
- 229910052736 halogen Inorganic materials 0.000 claims 1
- 239000007787 solid Substances 0.000 claims 1
- RLUJQBLWUQZMDG-UHFFFAOYSA-N toluene;hydrochloride Chemical compound Cl.CC1=CC=CC=C1 RLUJQBLWUQZMDG-UHFFFAOYSA-N 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 102
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 89
- 239000000243 solution Substances 0.000 description 64
- 239000000203 mixture Substances 0.000 description 59
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 55
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 48
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 44
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 42
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 40
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 38
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 36
- 229960000583 acetic acid Drugs 0.000 description 25
- 238000002425 crystallisation Methods 0.000 description 24
- 230000008025 crystallization Effects 0.000 description 24
- 239000000725 suspension Substances 0.000 description 23
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 21
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 21
- 239000012362 glacial acetic acid Substances 0.000 description 20
- 239000001632 sodium acetate Substances 0.000 description 19
- 235000017281 sodium acetate Nutrition 0.000 description 19
- 229930040373 Paraformaldehyde Natural products 0.000 description 18
- IQDGSYLLQPDQDV-UHFFFAOYSA-N dimethylazanium;chloride Chemical compound Cl.CNC IQDGSYLLQPDQDV-UHFFFAOYSA-N 0.000 description 18
- 229920002866 paraformaldehyde Polymers 0.000 description 18
- XHFGWHUWQXTGAT-UHFFFAOYSA-N dimethylamine hydrochloride Natural products CNC(C)C XHFGWHUWQXTGAT-UHFFFAOYSA-N 0.000 description 17
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 16
- UIIMBOGNXHQVGW-UHFFFAOYSA-M sodium bicarbonate Substances [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 15
- 238000003756 stirring Methods 0.000 description 15
- 239000002244 precipitate Substances 0.000 description 14
- 238000002844 melting Methods 0.000 description 13
- 230000008018 melting Effects 0.000 description 13
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 12
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 12
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- 239000000155 melt Substances 0.000 description 12
- 239000000047 product Substances 0.000 description 12
- DVECBJCOGJRVPX-UHFFFAOYSA-N butyryl chloride Chemical compound CCCC(Cl)=O DVECBJCOGJRVPX-UHFFFAOYSA-N 0.000 description 11
- 239000013078 crystal Substances 0.000 description 11
- 238000001953 recrystallisation Methods 0.000 description 11
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 10
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 9
- OFFSPAZVIVZPHU-UHFFFAOYSA-N 1-benzofuran-2-carboxylic acid Chemical class C1=CC=C2OC(C(=O)O)=CC2=C1 OFFSPAZVIVZPHU-UHFFFAOYSA-N 0.000 description 8
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- 239000002585 base Substances 0.000 description 8
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 7
- 235000019341 magnesium sulphate Nutrition 0.000 description 7
- 235000017557 sodium bicarbonate Nutrition 0.000 description 7
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 6
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 6
- 239000012043 crude product Substances 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- AZUYLZMQTIKGSC-UHFFFAOYSA-N 1-[6-[4-(5-chloro-6-methyl-1H-indazol-4-yl)-5-methyl-3-(1-methylindazol-5-yl)pyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one Chemical compound ClC=1C(=C2C=NNC2=CC=1C)C=1C(=NN(C=1C)C1CC2(CN(C2)C(C=C)=O)C1)C=1C=C2C=NN(C2=CC=1)C AZUYLZMQTIKGSC-UHFFFAOYSA-N 0.000 description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 5
- 239000008346 aqueous phase Substances 0.000 description 5
- 239000007864 aqueous solution Substances 0.000 description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 5
- 229910052794 bromium Chemical group 0.000 description 5
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 5
- 239000008298 dragée Substances 0.000 description 5
- 239000010410 layer Substances 0.000 description 5
- 229910000027 potassium carbonate Inorganic materials 0.000 description 5
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 5
- MTVMBYHIKUWTPS-UHFFFAOYSA-N 2-methyl-3h-1-benzofuran-2-carboxylic acid Chemical compound C1=CC=C2OC(C)(C(O)=O)CC2=C1 MTVMBYHIKUWTPS-UHFFFAOYSA-N 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- 239000004480 active ingredient Substances 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- 235000014113 dietary fatty acids Nutrition 0.000 description 4
- 239000000194 fatty acid Substances 0.000 description 4
- 229930195729 fatty acid Natural products 0.000 description 4
- 150000004665 fatty acids Chemical class 0.000 description 4
- DLTWLXUYSLIIQN-UHFFFAOYSA-N furacrinic acid Chemical compound C1=C(C)C(C(=O)C(=C)CC)=CC2=C1OC(C(O)=O)=C2 DLTWLXUYSLIIQN-UHFFFAOYSA-N 0.000 description 4
- 239000005457 ice water Substances 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- 239000000454 talc Substances 0.000 description 4
- 235000012222 talc Nutrition 0.000 description 4
- 229910052623 talc Inorganic materials 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- IHZAGSISYYKXQJ-UHFFFAOYSA-N 1,4-dimethylindole-2-carboxylic acid Chemical compound CC1=CC=CC2=C1C=C(C(O)=O)N2C IHZAGSISYYKXQJ-UHFFFAOYSA-N 0.000 description 3
- FGVVMPNBRRRIPB-UHFFFAOYSA-N 2-chloro-6-hydroxy-3-(1-hydroxybutyl)benzaldehyde Chemical compound ClC=1C(=C(C=CC1C(CCC)O)O)C=O FGVVMPNBRRRIPB-UHFFFAOYSA-N 0.000 description 3
- VXZHQADIRFFCMJ-UHFFFAOYSA-N 4-chloro-1h-indole-2-carboxylic acid Chemical compound C1=CC=C2NC(C(=O)O)=CC2=C1Cl VXZHQADIRFFCMJ-UHFFFAOYSA-N 0.000 description 3
- JSPROHYDTPRJQU-UHFFFAOYSA-N 4-chloro-2-hydroxy-5-(1-hydroxybutyl)benzaldehyde Chemical compound ClC=1C=C(C(=CC1C(CCC)O)C=O)O JSPROHYDTPRJQU-UHFFFAOYSA-N 0.000 description 3
- DQDCZFBXEHDCFX-UHFFFAOYSA-N 5-butanoyl-6-ethyl-1-benzofuran-2-carboxylic acid Chemical compound C(C)C1=CC2=C(C=C(O2)C(=O)O)C=C1C(CCC)=O DQDCZFBXEHDCFX-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 3
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 3
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 3
- 239000012670 alkaline solution Substances 0.000 description 3
- FNJVDWXUKLTFFL-UHFFFAOYSA-N diethyl 2-bromopropanedioate Chemical compound CCOC(=O)C(Br)C(=O)OCC FNJVDWXUKLTFFL-UHFFFAOYSA-N 0.000 description 3
- 239000012259 ether extract Substances 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 229920000159 gelatin Polymers 0.000 description 3
- 235000019322 gelatine Nutrition 0.000 description 3
- 229930195733 hydrocarbon Natural products 0.000 description 3
- 239000008101 lactose Substances 0.000 description 3
- 235000019359 magnesium stearate Nutrition 0.000 description 3
- 229920001592 potato starch Polymers 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 238000007127 saponification reaction Methods 0.000 description 3
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 2
- HMNKTRSOROOSPP-UHFFFAOYSA-N 3-Ethylphenol Chemical compound CCC1=CC=CC(O)=C1 HMNKTRSOROOSPP-UHFFFAOYSA-N 0.000 description 2
- CQMCKRWLZREDIF-UHFFFAOYSA-N 3-chloro-4-(1-hydroxybutyl)phenol Chemical compound ClC=1C=C(C=CC1C(CCC)O)O CQMCKRWLZREDIF-UHFFFAOYSA-N 0.000 description 2
- FDOKRIDWESVKTM-UHFFFAOYSA-N 4-chloro-5-(2-methylidenebutanoyl)-1H-indole-2-carboxylic acid Chemical compound ClC1=C2C=C(NC2=CC=C1C(C(CC)=C)=O)C(=O)O FDOKRIDWESVKTM-UHFFFAOYSA-N 0.000 description 2
- QMSCXKCJGFIXDF-UHFFFAOYSA-N 4-methyl-1h-indole-2-carboxylic acid Chemical compound CC1=CC=CC2=C1C=C(C(O)=O)N2 QMSCXKCJGFIXDF-UHFFFAOYSA-N 0.000 description 2
- FUHWOXRDZFAXPI-UHFFFAOYSA-N 5-(2-bromo-2-methylpropanoyl)-6-methyl-1-benzofuran-2-carboxylic acid Chemical compound CC1=CC2=C(C=C(O2)C(=O)O)C=C1C(C(C)(C)Br)=O FUHWOXRDZFAXPI-UHFFFAOYSA-N 0.000 description 2
- UWWHJLKVWYOXKR-UHFFFAOYSA-N 5-(2-methylidenebutanoyl)-1-benzofuran-2-carboxylic acid Chemical compound C=C(C(=O)C=1C=CC2=C(C=C(O2)C(=O)O)C1)CC UWWHJLKVWYOXKR-UHFFFAOYSA-N 0.000 description 2
- ZNCWIQRZAFXNOO-UHFFFAOYSA-N 5-[2-[(dimethylamino)methyl]butanoyl]-6-methyl-1-benzofuran-2-carboxylic acid;hydrochloride Chemical compound Cl.C1=C(C)C(C(=O)C(CN(C)C)CC)=CC2=C1OC(C(O)=O)=C2 ZNCWIQRZAFXNOO-UHFFFAOYSA-N 0.000 description 2
- YVGFVSXINRSZBX-UHFFFAOYSA-N 5-butanoyl-3,4-dichloro-1-methylindole-2-carboxylic acid Chemical compound CN1C(=C(C2=C(C(=CC=C12)C(CCC)=O)Cl)Cl)C(=O)O YVGFVSXINRSZBX-UHFFFAOYSA-N 0.000 description 2
- MXMSAXLUMANTAH-UHFFFAOYSA-N 5-butanoyl-3,4-dichloro-1H-indole-2-carboxylic acid Chemical compound ClC1=C(NC2=CC=C(C(=C12)Cl)C(CCC)=O)C(=O)O MXMSAXLUMANTAH-UHFFFAOYSA-N 0.000 description 2
- JVSLLRPJEZSVHY-UHFFFAOYSA-N 5-butanoyl-3,6-dimethyl-1-benzofuran-2-carboxylic acid Chemical compound CC1=C(OC2=C1C=C(C(=C2)C)C(CCC)=O)C(=O)O JVSLLRPJEZSVHY-UHFFFAOYSA-N 0.000 description 2
- JYZADLYFHXZKDK-UHFFFAOYSA-N 5-butanoyl-6-chloro-1-benzofuran-2-carboxylic acid Chemical compound C(CCC)(=O)C=1C(=CC2=C(C=C(O2)C(=O)O)C1)Cl JYZADLYFHXZKDK-UHFFFAOYSA-N 0.000 description 2
- FECWAUVNWRDABN-UHFFFAOYSA-N 6-ethyl-1-benzofuran-2-carboxylic acid Chemical compound CCC1=CC=C2C=C(C(O)=O)OC2=C1 FECWAUVNWRDABN-UHFFFAOYSA-N 0.000 description 2
- IQELKSYGXWBQJA-UHFFFAOYSA-N 6-methoxy-1-benzofuran-2-carboxylic acid Chemical compound COC1=CC=C2C=C(C(O)=O)OC2=C1 IQELKSYGXWBQJA-UHFFFAOYSA-N 0.000 description 2
- NRQCYWFYNWDXDP-UHFFFAOYSA-N 6-methoxy-5-(2-methylidenebutanoyl)-1-benzofuran-2-carboxylic acid Chemical compound C1=C(OC)C(C(=O)C(=C)CC)=CC2=C1OC(C(O)=O)=C2 NRQCYWFYNWDXDP-UHFFFAOYSA-N 0.000 description 2
- STGSJLZWQHRTGE-UHFFFAOYSA-N 6-methyl-1-benzofuran-2-carboxylic acid Chemical compound CC1=CC=C2C=C(C(O)=O)OC2=C1 STGSJLZWQHRTGE-UHFFFAOYSA-N 0.000 description 2
- OVKDHPPBTOWMFD-UHFFFAOYSA-N 6-methyl-5-(2-methylpropanoyl)-1-benzofuran-2-carboxylic acid Chemical compound CC1=CC2=C(C=C(O2)C(=O)O)C=C1C(C(C)C)=O OVKDHPPBTOWMFD-UHFFFAOYSA-N 0.000 description 2
- LEAIVCIJBJKOLK-UHFFFAOYSA-N 6-methyl-5-[2-(methylsulfanylmethyl)butanoyl]-1-benzofuran-2-carboxylic acid Chemical compound CC1=CC2=C(C=C(O2)C(=O)O)C=C1C(C(CC)CSC)=O LEAIVCIJBJKOLK-UHFFFAOYSA-N 0.000 description 2
- BDYQLWXMEDHFKC-UHFFFAOYSA-N 6-methyl-5-propanoyl-1-benzofuran-2-carboxylic acid Chemical compound CC1=CC2=C(C=C(O2)C(=O)O)C=C1C(CC)=O BDYQLWXMEDHFKC-UHFFFAOYSA-N 0.000 description 2
- 244000215068 Acacia senegal Species 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- CIHQGUVWVVNTMI-UHFFFAOYSA-N COC1=CC2=C(C=C(O2)C(=O)O)C=C1C(CC)=O Chemical compound COC1=CC2=C(C=C(O2)C(=O)O)C=C1C(CC)=O CIHQGUVWVVNTMI-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- 108010010803 Gelatin Proteins 0.000 description 2
- 229920000084 Gum arabic Polymers 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- 239000000205 acacia gum Substances 0.000 description 2
- 235000010489 acacia gum Nutrition 0.000 description 2
- 229940040526 anhydrous sodium acetate Drugs 0.000 description 2
- ZYGHJZDHTFUPRJ-UHFFFAOYSA-N benzo-alpha-pyrone Natural products C1=CC=C2OC(=O)C=CC2=C1 ZYGHJZDHTFUPRJ-UHFFFAOYSA-N 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 229940075614 colloidal silicon dioxide Drugs 0.000 description 2
- 235000001671 coumarin Nutrition 0.000 description 2
- 229960000956 coumarin Drugs 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 239000008273 gelatin Substances 0.000 description 2
- 235000011852 gelatine desserts Nutrition 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 150000008282 halocarbons Chemical class 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- AMXOYNBUYSYVKV-UHFFFAOYSA-M lithium bromide Chemical compound [Li+].[Br-] AMXOYNBUYSYVKV-UHFFFAOYSA-M 0.000 description 2
- 150000004702 methyl esters Chemical class 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000003791 organic solvent mixture Substances 0.000 description 2
- 239000008188 pellet Substances 0.000 description 2
- 150000004965 peroxy acids Chemical class 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 239000012047 saturated solution Substances 0.000 description 2
- 150000003335 secondary amines Chemical class 0.000 description 2
- 238000010898 silica gel chromatography Methods 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000005720 sucrose Substances 0.000 description 2
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- DYSJMQABFPKAQM-UHFFFAOYSA-N 1-benzothiophene-2-carboxylic acid Chemical compound C1=CC=C2SC(C(=O)O)=CC2=C1 DYSJMQABFPKAQM-UHFFFAOYSA-N 0.000 description 1
- MAHAMBLNIDMREX-UHFFFAOYSA-N 1-methylindole-2-carboxylic acid Chemical class C1=CC=C2N(C)C(C(O)=O)=CC2=C1 MAHAMBLNIDMREX-UHFFFAOYSA-N 0.000 description 1
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- FPYUJUBAXZAQNL-UHFFFAOYSA-N 2-chlorobenzaldehyde Chemical compound ClC1=CC=CC=C1C=O FPYUJUBAXZAQNL-UHFFFAOYSA-N 0.000 description 1
- BEJRTZMUFBZONR-UHFFFAOYSA-N 2-chloroindole-2-carboxylic acid Chemical compound C1=CC=CC2=NC(C(=O)O)(Cl)C=C21 BEJRTZMUFBZONR-UHFFFAOYSA-N 0.000 description 1
- XRPVXVRWIDOORM-UHFFFAOYSA-N 2-methylbutanoyl chloride Chemical compound CCC(C)C(Cl)=O XRPVXVRWIDOORM-UHFFFAOYSA-N 0.000 description 1
- DGMOBVGABMBZSB-UHFFFAOYSA-N 2-methylpropanoyl chloride Chemical compound CC(C)C(Cl)=O DGMOBVGABMBZSB-UHFFFAOYSA-N 0.000 description 1
- IXBLVHFNRPEBDO-UHFFFAOYSA-N 3,6-dimethyl-1-benzofuran-2-carboxylic acid Chemical compound CC1=CC=C2C(C)=C(C(O)=O)OC2=C1 IXBLVHFNRPEBDO-UHFFFAOYSA-N 0.000 description 1
- CYTFMBZVPUBGMY-UHFFFAOYSA-N 3,6-dimethyl-5-(2-methylidenebutanoyl)-1-benzofuran-2-carboxylic acid Chemical compound CC1=C(OC2=C1C=C(C(=C2)C)C(C(CC)=C)=O)C(=O)O CYTFMBZVPUBGMY-UHFFFAOYSA-N 0.000 description 1
- ISULZYQDGYXDFW-UHFFFAOYSA-N 3-methylbutanoyl chloride Chemical compound CC(C)CC(Cl)=O ISULZYQDGYXDFW-UHFFFAOYSA-N 0.000 description 1
- IPAXPERGAMNMIJ-UHFFFAOYSA-N 4-chloro-1-benzothiophene-2-carboxylic acid Chemical compound C1=CC=C2SC(C(=O)O)=CC2=C1Cl IPAXPERGAMNMIJ-UHFFFAOYSA-N 0.000 description 1
- BOQYRMQKAHZRQI-UHFFFAOYSA-N 5-[3-(dimethylamino)-2-methylpropanoyl]-6-methyl-1-benzofuran-2-carboxylic acid Chemical compound CN(C)CC(C(=O)C=1C(=CC2=C(C=C(O2)C(=O)O)C1)C)C BOQYRMQKAHZRQI-UHFFFAOYSA-N 0.000 description 1
- HILLAFZODPUECD-UHFFFAOYSA-N 5-butanoyl-1-benzofuran-2-carboxylic acid Chemical compound C(CCC)(=O)C=1C=CC2=C(C=C(O2)C(=O)O)C1 HILLAFZODPUECD-UHFFFAOYSA-N 0.000 description 1
- YCBKOVFRLFDVSK-UHFFFAOYSA-N 5-butanoyl-4,6-dimethyl-1-benzofuran-2-carboxylic acid Chemical compound CC1=C(C(=CC2=C1C=C(O2)C(=O)O)C)C(CCC)=O YCBKOVFRLFDVSK-UHFFFAOYSA-N 0.000 description 1
- YAAUEYJXFCKWOP-UHFFFAOYSA-N 5-butanoyl-4-methyl-1-benzofuran-2-carboxylic acid Chemical compound CC1=C(C=CC2=C1C=C(O2)C(=O)O)C(CCC)=O YAAUEYJXFCKWOP-UHFFFAOYSA-N 0.000 description 1
- LAUAXYFRFTYCPU-UHFFFAOYSA-N 5-butanoyl-6-ethoxy-1-benzofuran-2-carboxylic acid Chemical compound C(C)OC1=CC2=C(C=C(O2)C(=O)O)C=C1C(CCC)=O LAUAXYFRFTYCPU-UHFFFAOYSA-N 0.000 description 1
- JBPCJIAECCXDNJ-UHFFFAOYSA-N 5-butanoyl-6-methoxy-1-benzofuran-2-carboxylic acid Chemical compound COC1=CC2=C(C=C(O2)C(=O)O)C=C1C(CCC)=O JBPCJIAECCXDNJ-UHFFFAOYSA-N 0.000 description 1
- ISHJFUWRRWBXGC-UHFFFAOYSA-N 5-butanoyl-6-methyl-1-benzofuran-2-carboxylic acid Chemical compound CC1=CC2=C(C=C(O2)C(=O)O)C=C1C(CCC)=O ISHJFUWRRWBXGC-UHFFFAOYSA-N 0.000 description 1
- FRPJVIKXPDPKEW-UHFFFAOYSA-N 6-ethoxy-5-(2-methylidenebutanoyl)-1-benzofuran-2-carboxylic acid Chemical compound C(C)OC1=CC2=C(C=C(O2)C(=O)O)C=C1C(C(CC)=C)=O FRPJVIKXPDPKEW-UHFFFAOYSA-N 0.000 description 1
- JYVZRRLDAFCFJH-UHFFFAOYSA-N 6-ethyl-5-(2-methylidenebutanoyl)-1-benzofuran-2-carboxylic acid Chemical compound C(C)C1=CC2=C(C=C(O2)C(=O)O)C=C1C(C(CC)=C)=O JYVZRRLDAFCFJH-UHFFFAOYSA-N 0.000 description 1
- PSBUPVYEUWGKHS-UHFFFAOYSA-N 6-methoxy-5-(2-methylprop-2-enoyl)-1-benzofuran-2-carboxylic acid Chemical compound COC1=CC2=C(C=C(O2)C(=O)O)C=C1C(C(C)=C)=O PSBUPVYEUWGKHS-UHFFFAOYSA-N 0.000 description 1
- UKNLZJGUUXBXPU-UHFFFAOYSA-N 6-methyl-5-(2-methylidenepentanoyl)-1-benzofuran-2-carboxylic acid Chemical compound CC1=CC2=C(C=C(O2)C(=O)O)C=C1C(C(CCC)=C)=O UKNLZJGUUXBXPU-UHFFFAOYSA-N 0.000 description 1
- DLCASBFCJDKEJT-UHFFFAOYSA-N 6-methyl-5-(2-methylprop-2-enoyl)-1-benzofuran-2-carboxylic acid Chemical compound C1=C(C)C(C(=O)C(=C)C)=CC2=C1OC(C(O)=O)=C2 DLCASBFCJDKEJT-UHFFFAOYSA-N 0.000 description 1
- NZACGBBKGLIORV-UHFFFAOYSA-N 6-methyl-5-[2-(methylsulfonylmethyl)butanoyl]-1-benzofuran-2-carboxylic acid Chemical compound CC1=CC2=C(C=C(O2)C(=O)O)C=C1C(C(CC)CS(=O)(=O)C)=O NZACGBBKGLIORV-UHFFFAOYSA-N 0.000 description 1
- PAOSYJAWQPYGKA-UHFFFAOYSA-N 6-methyl-5-pentanoyl-1-benzofuran-2-carboxylic acid Chemical compound CC1=CC2=C(C=C(O2)C(=O)O)C=C1C(CCCC)=O PAOSYJAWQPYGKA-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 229920000945 Amylopectin Polymers 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- DYJWTKHZDGPMAT-UHFFFAOYSA-N CCOC1(CC2=CC=CC=C2O1)C(=O)O Chemical compound CCOC1(CC2=CC=CC=C2O1)C(=O)O DYJWTKHZDGPMAT-UHFFFAOYSA-N 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- 241000207199 Citrus Species 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- 239000001828 Gelatine Substances 0.000 description 1
- HCUARRIEZVDMPT-UHFFFAOYSA-N Indole-2-carboxylic acid Chemical compound C1=CC=C2NC(C(=O)O)=CC2=C1 HCUARRIEZVDMPT-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 238000006683 Mannich reaction Methods 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- 206010030113 Oedema Diseases 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 229920001800 Shellac Polymers 0.000 description 1
- 229910021607 Silver chloride Inorganic materials 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- 244000061456 Solanum tuberosum Species 0.000 description 1
- 235000002595 Solanum tuberosum Nutrition 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- 230000005856 abnormality Effects 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N alpha-methyl toluene Natural products CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- HOPRXXXSABQWAV-UHFFFAOYSA-N anhydrous collidine Natural products CC1=CC=NC(C)=C1C HOPRXXXSABQWAV-UHFFFAOYSA-N 0.000 description 1
- RTEXIPZMMDUXMR-UHFFFAOYSA-N benzene;ethyl acetate Chemical compound CCOC(C)=O.C1=CC=CC=C1 RTEXIPZMMDUXMR-UHFFFAOYSA-N 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- MDHYEMXUFSJLGV-UHFFFAOYSA-N beta-phenethyl acetate Natural products CC(=O)OCCC1=CC=CC=C1 MDHYEMXUFSJLGV-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical class [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 1
- 235000013539 calcium stearate Nutrition 0.000 description 1
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- OEYIOHPDSNJKLS-UHFFFAOYSA-N choline Chemical compound C[N+](C)(C)CCO OEYIOHPDSNJKLS-UHFFFAOYSA-N 0.000 description 1
- 229960001231 choline Drugs 0.000 description 1
- 229940117975 chromium trioxide Drugs 0.000 description 1
- WGLPBDUCMAPZCE-UHFFFAOYSA-N chromium trioxide Inorganic materials O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 1
- GAMDZJFZMJECOS-UHFFFAOYSA-N chromium(6+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Cr+6] GAMDZJFZMJECOS-UHFFFAOYSA-N 0.000 description 1
- 235000020971 citrus fruits Nutrition 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- UTBIMNXEDGNJFE-UHFFFAOYSA-N collidine Natural products CC1=CC=C(C)C(C)=N1 UTBIMNXEDGNJFE-UHFFFAOYSA-N 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 150000008050 dialkyl sulfates Chemical class 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- XPPKVPWEQAFLFU-UHFFFAOYSA-N diphosphoric acid Chemical compound OP(O)(=O)OP(O)(O)=O XPPKVPWEQAFLFU-UHFFFAOYSA-N 0.000 description 1
- 239000002934 diuretic Substances 0.000 description 1
- 230000001882 diuretic effect Effects 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 239000003792 electrolyte Substances 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000029142 excretion Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 229910052808 lithium carbonate Inorganic materials 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- QWDJLDTYWNBUKE-UHFFFAOYSA-L magnesium bicarbonate Chemical compound [Mg+2].OC([O-])=O.OC([O-])=O QWDJLDTYWNBUKE-UHFFFAOYSA-L 0.000 description 1
- 229910000022 magnesium bicarbonate Inorganic materials 0.000 description 1
- 235000014824 magnesium bicarbonate Nutrition 0.000 description 1
- 239000002370 magnesium bicarbonate Substances 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000002483 medication Methods 0.000 description 1
- PMQWODZYXFCTTM-UHFFFAOYSA-N methyl 4-chloro-1-methylindole-2-carboxylate Chemical compound C1=CC=C2N(C)C(C(=O)OC)=CC2=C1Cl PMQWODZYXFCTTM-UHFFFAOYSA-N 0.000 description 1
- BIWZRELMJUNEDA-UHFFFAOYSA-N methyl 6-methyl-5-(2-methylidenebutanoyl)-1-benzofuran-2-carboxylate Chemical compound COC(=O)C=1OC2=C(C1)C=C(C(=C2)C)C(C(CC)=C)=O BIWZRELMJUNEDA-UHFFFAOYSA-N 0.000 description 1
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- NJNQUTDUIPVROZ-UHFFFAOYSA-N nitrocyclohexane Chemical compound [O-][N+](=O)C1CCCCC1 NJNQUTDUIPVROZ-UHFFFAOYSA-N 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 235000012771 pancakes Nutrition 0.000 description 1
- XGISHOFUAFNYQF-UHFFFAOYSA-N pentanoyl chloride Chemical compound CCCCC(Cl)=O XGISHOFUAFNYQF-UHFFFAOYSA-N 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229940005657 pyrophosphoric acid Drugs 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- KIWUVOGUEXMXSV-UHFFFAOYSA-N rhodanine Chemical compound O=C1CSC(=S)N1 KIWUVOGUEXMXSV-UHFFFAOYSA-N 0.000 description 1
- 230000000894 saliuretic effect Effects 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 230000028327 secretion Effects 0.000 description 1
- ZLGIYFNHBLSMPS-ATJNOEHPSA-N shellac Chemical compound OCCCCCC(O)C(O)CCCCCCCC(O)=O.C1C23[C@H](C(O)=O)CCC2[C@](C)(CO)[C@@H]1C(C(O)=O)=C[C@@H]3O ZLGIYFNHBLSMPS-ATJNOEHPSA-N 0.000 description 1
- 239000004208 shellac Substances 0.000 description 1
- 229940113147 shellac Drugs 0.000 description 1
- 235000013874 shellac Nutrition 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- CQLFBEKRDQMJLZ-UHFFFAOYSA-M silver acetate Chemical compound [Ag+].CC([O-])=O CQLFBEKRDQMJLZ-UHFFFAOYSA-M 0.000 description 1
- 229940071536 silver acetate Drugs 0.000 description 1
- HKZLPVFGJNLROG-UHFFFAOYSA-M silver monochloride Chemical compound [Cl-].[Ag+] HKZLPVFGJNLROG-UHFFFAOYSA-M 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical class [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 description 1
- 150000003463 sulfur Chemical class 0.000 description 1
- GFYHSKONPJXCDE-UHFFFAOYSA-N sym-collidine Natural products CC1=CN=C(C)C(C)=C1 GFYHSKONPJXCDE-UHFFFAOYSA-N 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 125000000101 thioether group Chemical group 0.000 description 1
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical class Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- 235000010215 titanium dioxide Nutrition 0.000 description 1
- 210000002700 urine Anatomy 0.000 description 1
- 239000002966 varnish Substances 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/335—Heterocyclic compounds having oxygen as the only ring hetero atom, e.g. fungichromin
- A61K31/34—Heterocyclic compounds having oxygen as the only ring hetero atom, e.g. fungichromin having five-membered rings with one oxygen as the only ring hetero atom, e.g. isosorbide
- A61K31/343—Heterocyclic compounds having oxygen as the only ring hetero atom, e.g. fungichromin having five-membered rings with one oxygen as the only ring hetero atom, e.g. isosorbide condensed with a carbocyclic ring, e.g. coumaran, bufuralol, befunolol, clobenfurol, amiodarone
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/78—Benzo [b] furans; Hydrogenated benzo [b] furans
- C07D307/82—Benzo [b] furans; Hydrogenated benzo [b] furans with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to carbon atoms of the hetero ring
- C07D307/84—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
- C07D307/85—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/30—Indoles; Hydrogenated indoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to carbon atoms of the hetero ring
- C07D209/42—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Furan Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1076467A CH484092A (de) | 1967-07-28 | 1967-07-28 | Verfahren zur Herstellung von neuen heterocyclischen Carbonsäuren |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL69796B1 true PL69796B1 (cg-RX-API-DMAC10.html) | 1973-10-31 |
Family
ID=4366590
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1968128332A PL69796B1 (cg-RX-API-DMAC10.html) | 1967-07-28 | 1968-07-26 |
Country Status (15)
| Country | Link |
|---|---|
| AT (4) | AT281811B (cg-RX-API-DMAC10.html) |
| BG (2) | BG15386A3 (cg-RX-API-DMAC10.html) |
| BR (1) | BR6800997D0 (cg-RX-API-DMAC10.html) |
| CH (2) | CH484094A (cg-RX-API-DMAC10.html) |
| CS (2) | CS153468B2 (cg-RX-API-DMAC10.html) |
| DK (1) | DK121087B (cg-RX-API-DMAC10.html) |
| FI (2) | FI49416C (cg-RX-API-DMAC10.html) |
| GT (1) | GT197640170A (cg-RX-API-DMAC10.html) |
| IE (1) | IE32222B1 (cg-RX-API-DMAC10.html) |
| IL (1) | IL30442A (cg-RX-API-DMAC10.html) |
| NO (1) | NO122751B (cg-RX-API-DMAC10.html) |
| PL (1) | PL69796B1 (cg-RX-API-DMAC10.html) |
| SE (1) | SE364270B (cg-RX-API-DMAC10.html) |
| SU (1) | SU393827A3 (cg-RX-API-DMAC10.html) |
| YU (1) | YU32705B (cg-RX-API-DMAC10.html) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2467004C2 (ru) * | 2010-10-07 | 2012-11-20 | Учреждение Российской Академии Наук Институт Нефтехимии И Катализа Ран | СПОСОБ ПОЛУЧЕНИЯ МЕТИЛОВОГО ЭФИРА 2-БЕНЗО[b]ФУРАНКАРБОНОВОЙ КИСЛОТЫ |
-
1967
- 1967-07-28 CH CH1806969A patent/CH484094A/de not_active IP Right Cessation
- 1967-07-28 CH CH1807069A patent/CH484095A/de not_active IP Right Cessation
-
1968
- 1968-07-19 NO NO2865/68A patent/NO122751B/no unknown
- 1968-07-19 FI FI682064A patent/FI49416C/fi active
- 1968-07-19 FI FI682063A patent/FI49415C/fi active
- 1968-07-19 SE SE09915/68A patent/SE364270B/xx unknown
- 1968-07-19 DK DK351368AA patent/DK121087B/da unknown
- 1968-07-25 YU YU1783/68A patent/YU32705B/xx unknown
- 1968-07-26 CS CS719771*1A patent/CS153468B2/cs unknown
- 1968-07-26 AT AT07301/68A patent/AT281811B/de not_active IP Right Cessation
- 1968-07-26 SU SU1415775A patent/SU393827A3/ru active
- 1968-07-26 CS CS547268A patent/CS153467B2/cs unknown
- 1968-07-26 IL IL30442A patent/IL30442A/en unknown
- 1968-07-26 AT AT06940/69A patent/AT285595B/de not_active IP Right Cessation
- 1968-07-26 IE IE904/68A patent/IE32222B1/xx unknown
- 1968-07-26 BR BR200997/68A patent/BR6800997D0/pt unknown
- 1968-07-26 BG BG012202A patent/BG15386A3/bg unknown
- 1968-07-26 PL PL1968128332A patent/PL69796B1/pl unknown
- 1968-07-26 AT AT729868A patent/AT280272B/de not_active IP Right Cessation
- 1968-07-26 BG BG012203A patent/BG15387A3/bg unknown
- 1968-07-26 AT AT446869A patent/AT283346B/de not_active IP Right Cessation
-
1976
- 1976-02-13 GT GT197640170A patent/GT197640170A/es unknown
Also Published As
| Publication number | Publication date |
|---|---|
| SE364270B (cg-RX-API-DMAC10.html) | 1974-02-18 |
| BR6800997D0 (pt) | 1973-01-02 |
| IL30442A (en) | 1972-01-27 |
| FI49415C (fi) | 1975-06-10 |
| IE32222L (en) | 1969-01-28 |
| CH484094A (de) | 1970-01-15 |
| BG15386A3 (bg) | 1976-03-23 |
| CH484095A (de) | 1970-01-15 |
| AT283346B (de) | 1970-08-10 |
| FI49416C (fi) | 1975-06-10 |
| AT285595B (de) | 1970-11-10 |
| AT281811B (de) | 1970-06-10 |
| IL30442A0 (en) | 1968-11-27 |
| AT280272B (de) | 1970-04-10 |
| CS153467B2 (cg-RX-API-DMAC10.html) | 1974-02-25 |
| FI49416B (cg-RX-API-DMAC10.html) | 1975-02-28 |
| BG15387A3 (bg) | 1976-05-10 |
| YU178368A (en) | 1974-12-31 |
| FI49415B (cg-RX-API-DMAC10.html) | 1975-02-28 |
| NO122751B (cg-RX-API-DMAC10.html) | 1971-08-09 |
| SU393827A3 (cg-RX-API-DMAC10.html) | 1973-08-10 |
| IE32222B1 (en) | 1973-05-16 |
| YU32705B (en) | 1975-06-30 |
| DK121087B (da) | 1971-09-06 |
| CS153468B2 (cg-RX-API-DMAC10.html) | 1974-02-25 |
| GT197640170A (es) | 1977-08-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3991057A (en) | C-Piperazino-pyridine sulfonamides | |
| NO760003L (cg-RX-API-DMAC10.html) | ||
| FI80691C (fi) | Foerfarande foer framstaellning av bensotiofener och bensofuraner med antiallergisk aktivitet. | |
| EP0399422A1 (en) | Benzocycloalkane derivatives and production thereof | |
| PL69796B1 (cg-RX-API-DMAC10.html) | ||
| DE1793049A1 (de) | Verfahren zur Herstellung von neuen heterocyclischen Carbonsaeuren | |
| US3674810A (en) | 4-chloro-5-(2-methylene-butyryl)-benzo(6)thiophene-2-carboxylic acids | |
| US3454577A (en) | 4-(1,2,3,4,5,6,7,8 - octahydro - 1,8 - dioxo-9-acridanyl) - benzenesulfonamide and derivatives | |
| US3646009A (en) | Anti-diabetically active sulfonyl-semicarbazides | |
| US3414587A (en) | 4-(1, 2, 3, 4, 5, 6, 7, 8-octahydro-1, 8-dioxo-9-xanthenyl)-benzene-sulfonamide and derivatives | |
| US3873538A (en) | Amino-9,10-dihydro-9,10-dioxo-2-anthroic acids | |
| US3627785A (en) | Benzofuran-2-carboxylic acids | |
| US3112337A (en) | 4-halo-3-sulfamoylbenzoic acid esters | |
| US3843797A (en) | Saluretic and diuretic compositions and method with 2,3-dihydro-5-(2-nitro-1-alkenylbenzofuran-2-carboxylic acids and pharmaceutically acceptable salts | |
| US3862140A (en) | 4-hydroxy-2h- 1-benzothiopyran-3-carboxamide 1,1-dioxides | |
| US3502717A (en) | 2-arylthio and 2-arylsulfonyl benzoic acid | |
| US3681502A (en) | Diuretic and saluretic composition and method containing 5-(2-methylene-alkanoyl)-benzofuran compounds | |
| US3726904A (en) | 2,3-dihydro-5-(2-nitro-1-alkenyl)-benzofuran-2-carboxylic acid and pharmaceutically acceptable salts | |
| US3714155A (en) | 4-hydroxy-2,n-dimethyl-2h-1,2-benzothiazine-3-carboxanilide1,1-dioxide and process therefor | |
| NO122754B (cg-RX-API-DMAC10.html) | ||
| DE2922248C2 (cg-RX-API-DMAC10.html) | ||
| US3597448A (en) | 2-arylbenzo(b) thiophen - 3(2h) - one - 1,1 - dioxides and 2 - arylnaphtho(2,3-b)thiophen-3(2h)-one-1,1-dioxides | |
| PL87665B1 (cg-RX-API-DMAC10.html) | ||
| PL69900B1 (cg-RX-API-DMAC10.html) | ||
| US3676560A (en) | Producing diuretic and saluretic effects with benzofuran carboxylic acid derivatives |