PL59010B1 - - Google Patents
Download PDFInfo
- Publication number
- PL59010B1 PL59010B1 PL115040A PL11504066A PL59010B1 PL 59010 B1 PL59010 B1 PL 59010B1 PL 115040 A PL115040 A PL 115040A PL 11504066 A PL11504066 A PL 11504066A PL 59010 B1 PL59010 B1 PL 59010B1
- Authority
- PL
- Poland
- Prior art keywords
- parts
- chloro
- dithiol
- diatomaceous earth
- test
- Prior art date
Links
- 239000004480 active ingredient Substances 0.000 claims description 4
- 239000000969 carrier Substances 0.000 claims description 4
- 239000002270 dispersing agent Substances 0.000 claims description 3
- 230000000855 fungicidal effect Effects 0.000 claims description 3
- 239000000203 mixture Substances 0.000 claims description 3
- 230000000844 anti-bacterial effect Effects 0.000 claims description 2
- IRGJAPXKRFEBNA-UHFFFAOYSA-N 5-aminodithiol-3-one Chemical compound NC1=CC(=O)SS1 IRGJAPXKRFEBNA-UHFFFAOYSA-N 0.000 claims 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical group [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims 1
- 239000003899 bactericide agent Substances 0.000 claims 1
- 125000004432 carbon atom Chemical group C* 0.000 claims 1
- 239000000417 fungicide Substances 0.000 claims 1
- 125000005843 halogen group Chemical group 0.000 claims 1
- 229910052739 hydrogen Inorganic materials 0.000 claims 1
- 239000001257 hydrogen Substances 0.000 claims 1
- 229910052757 nitrogen Inorganic materials 0.000 claims 1
- 125000004433 nitrogen atom Chemical group N* 0.000 claims 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 20
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 12
- 239000005909 Kieselgur Substances 0.000 description 9
- 239000004744 fabric Substances 0.000 description 8
- 239000013543 active substance Substances 0.000 description 6
- 239000000843 powder Substances 0.000 description 5
- 239000000377 silicon dioxide Substances 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- 239000005995 Aluminium silicate Substances 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- 235000012211 aluminium silicate Nutrition 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 239000003995 emulsifying agent Substances 0.000 description 4
- 239000000839 emulsion Substances 0.000 description 4
- 239000004615 ingredient Substances 0.000 description 4
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 4
- 239000003350 kerosene Substances 0.000 description 4
- 239000000454 talc Substances 0.000 description 4
- 235000012222 talc Nutrition 0.000 description 4
- 229910052623 talc Inorganic materials 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- WBIQQQGBSDOWNP-UHFFFAOYSA-N 2-dodecylbenzenesulfonic acid Chemical compound CCCCCCCCCCCCC1=CC=CC=C1S(O)(=O)=O WBIQQQGBSDOWNP-UHFFFAOYSA-N 0.000 description 3
- 229920001817 Agar Polymers 0.000 description 3
- 241000228245 Aspergillus niger Species 0.000 description 3
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 3
- 235000019738 Limestone Nutrition 0.000 description 3
- 239000008272 agar Substances 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 239000004359 castor oil Substances 0.000 description 3
- 235000019438 castor oil Nutrition 0.000 description 3
- 239000012141 concentrate Substances 0.000 description 3
- 239000007859 condensation product Substances 0.000 description 3
- 229940060296 dodecylbenzenesulfonic acid Drugs 0.000 description 3
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 3
- 239000006028 limestone Substances 0.000 description 3
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 239000002689 soil Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- QGSRKGWCQSATCL-UHFFFAOYSA-N 4,5-dichloro-3h-1,3-dithiol-2-one Chemical compound ClC=1SSC(=O)C=1Cl QGSRKGWCQSATCL-UHFFFAOYSA-N 0.000 description 2
- -1 4-chloro-5-diethylamino-1,2-dithiol-3-one Chemical compound 0.000 description 2
- YEAROXXUXFESIE-UHFFFAOYSA-N 5-(benzylamino)-4-chlorodithiol-3-one Chemical compound ClC=1C(SSC1NCC1=CC=CC=C1)=O YEAROXXUXFESIE-UHFFFAOYSA-N 0.000 description 2
- BWTGFYQZOUAOQW-UHFFFAOYSA-N 5-chloro-4-phenyldithiol-3-one Chemical compound S1SC(=O)C(C=2C=CC=CC=2)=C1Cl BWTGFYQZOUAOQW-UHFFFAOYSA-N 0.000 description 2
- 241000222122 Candida albicans Species 0.000 description 2
- 241000588724 Escherichia coli Species 0.000 description 2
- 241000233866 Fungi Species 0.000 description 2
- 239000002202 Polyethylene glycol Substances 0.000 description 2
- 239000004372 Polyvinyl alcohol Substances 0.000 description 2
- 241000191967 Staphylococcus aureus Species 0.000 description 2
- JXLHNMVSKXFWAO-UHFFFAOYSA-N azane;7-fluoro-2,1,3-benzoxadiazole-4-sulfonic acid Chemical compound N.OS(=O)(=O)C1=CC=C(F)C2=NON=C12 JXLHNMVSKXFWAO-UHFFFAOYSA-N 0.000 description 2
- 229940095731 candida albicans Drugs 0.000 description 2
- 239000002361 compost Substances 0.000 description 2
- 238000010410 dusting Methods 0.000 description 2
- 238000004453 electron probe microanalysis Methods 0.000 description 2
- UFZOPKFMKMAWLU-UHFFFAOYSA-N ethoxy(methyl)phosphinic acid Chemical compound CCOP(C)(O)=O UFZOPKFMKMAWLU-UHFFFAOYSA-N 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 229920005610 lignin Polymers 0.000 description 2
- 229940057995 liquid paraffin Drugs 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 239000011368 organic material Substances 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- 229920000151 polyglycol Polymers 0.000 description 2
- 239000010695 polyglycol Substances 0.000 description 2
- 229920002451 polyvinyl alcohol Polymers 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- 239000004753 textile Substances 0.000 description 2
- CDFPXALLOJLBDX-UHFFFAOYSA-N 2,3-dibutylnaphthalene-1-sulfonic acid;sodium Chemical compound [Na].C1=CC=C2C(S(O)(=O)=O)=C(CCCC)C(CCCC)=CC2=C1 CDFPXALLOJLBDX-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- GXJQMKFJQFGQKV-KHPPLWFESA-N 2-[methyl-[(z)-octadec-9-enoyl]amino]ethanesulfonic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)N(C)CCS(O)(=O)=O GXJQMKFJQFGQKV-KHPPLWFESA-N 0.000 description 1
- YVIRYQGPSXXRLJ-UHFFFAOYSA-N 4-chloro-5-(dimethylamino)dithiol-3-one Chemical compound ClC=1C(SSC1N(C)C)=O YVIRYQGPSXXRLJ-UHFFFAOYSA-N 0.000 description 1
- 241001515917 Chaetomium globosum Species 0.000 description 1
- 101100139089 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) PUT3 gene Proteins 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- 238000009933 burial Methods 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 235000019993 champagne Nutrition 0.000 description 1
- 230000001143 conditioned effect Effects 0.000 description 1
- 230000000249 desinfective effect Effects 0.000 description 1
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 1
- YDEXUEFDPVHGHE-GGMCWBHBSA-L disodium;(2r)-3-(2-hydroxy-3-methoxyphenyl)-2-[2-methoxy-4-(3-sulfonatopropyl)phenoxy]propane-1-sulfonate Chemical compound [Na+].[Na+].COC1=CC=CC(C[C@H](CS([O-])(=O)=O)OC=2C(=CC(CCCS([O-])(=O)=O)=CC=2)OC)=C1O YDEXUEFDPVHGHE-GGMCWBHBSA-L 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 210000003608 fece Anatomy 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 239000010985 leather Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000006199 nebulizer Substances 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- DAJSVUQLFFJUSX-UHFFFAOYSA-M sodium;dodecane-1-sulfonate Chemical compound [Na+].CCCCCCCCCCCCS([O-])(=O)=O DAJSVUQLFFJUSX-UHFFFAOYSA-M 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL59010B1 true PL59010B1 (enExample) | 1969-10-25 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS63115803A (ja) | 稲作において選択的に雑草を防除するための相乗作用組成物 | |
| PL139657B1 (en) | Process for manufacturing novel salt of organophosphorus derivative and fungicide containing the same | |
| NZ230815A (en) | Biocides for protecting industrial materials and water systems, comprising 1,2,6-thiadiazin-4-ones | |
| PL80290B1 (enExample) | ||
| US3069252A (en) | Methods for the control of the growth of plants and plant parts | |
| US2999047A (en) | Bactericidal composition | |
| US3412090A (en) | Organotin-substituted s-triazines | |
| PL59010B1 (enExample) | ||
| US4593040A (en) | Compositions for combatting phytopathogenical fungi and bacteria employing mixtures of benzyl phenol derivatives and carbendazin | |
| PL80654B1 (enExample) | ||
| US3306810A (en) | Compositions containing methylene bisthiocyanate, dispersant and a dimethylamide and processes of inhibiting microbiological deterioration utilizing said composition | |
| PT84854B (pt) | Processo para a preparacao de derivados da benzotiazinona | |
| FI59997C (fi) | Nya 2-bensimidazol-karbaminsyraesterderivat med icke-terapeutisk fungicid och ovicid verkan | |
| US3251733A (en) | Antimicrobic compositions and process for protection of organic materials therewith | |
| DE1904004A1 (de) | Schaedlingsbekaempfungsmittel | |
| EP0302451B1 (en) | N-alkylbenzenesulfonylcarbamoyl-5-chloroisothiazole derivatives and microbicides containing the same | |
| CA1046061A (en) | Pyridyltriazinone compounds | |
| IL25982A (en) | 5-sulphonyl-1,2-dithiol-3-one compounds,their preparation | |
| DE2019535C3 (de) | 2,5-Dimethyl-furan-3-carbonsäure-cyclohexylamid und diese Verbindung enthaltende fungizide Mittel | |
| PL138023B1 (en) | Fungicide | |
| CA1118776A (en) | Bis(dithiocarbamate)salts | |
| US2536750A (en) | Organic mercury compounds and germicidal compositions thereof | |
| PL84075B1 (enExample) | ||
| NO124777B (enExample) | ||
| US3293124A (en) | Antimicrobic compositions and process for protection of organic materials therewith |