PL55630B3 - - Google Patents
Download PDFInfo
- Publication number
- PL55630B3 PL55630B3 PL109846A PL10984665A PL55630B3 PL 55630 B3 PL55630 B3 PL 55630B3 PL 109846 A PL109846 A PL 109846A PL 10984665 A PL10984665 A PL 10984665A PL 55630 B3 PL55630 B3 PL 55630B3
- Authority
- PL
- Poland
- Prior art keywords
- barium
- sodium
- column
- nitrate
- sulphide
- Prior art date
Links
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 claims description 24
- IWOUKMZUPDVPGQ-UHFFFAOYSA-N barium nitrate Chemical compound [Ba+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O IWOUKMZUPDVPGQ-UHFFFAOYSA-N 0.000 claims description 23
- 239000000243 solution Substances 0.000 claims description 14
- 229910052788 barium Inorganic materials 0.000 claims description 13
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 claims description 12
- 235000010344 sodium nitrate Nutrition 0.000 claims description 12
- 239000004317 sodium nitrate Substances 0.000 claims description 12
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 claims description 8
- 229910017604 nitric acid Inorganic materials 0.000 claims description 8
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 claims description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 7
- 238000010828 elution Methods 0.000 claims description 6
- 238000000034 method Methods 0.000 claims description 6
- 159000000009 barium salts Chemical class 0.000 claims description 5
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 claims description 5
- 150000001450 anions Chemical class 0.000 claims description 4
- 238000005406 washing Methods 0.000 claims description 4
- 239000006286 aqueous extract Substances 0.000 claims description 3
- 229910001422 barium ion Inorganic materials 0.000 claims description 3
- 239000010428 baryte Substances 0.000 claims description 3
- 229910052601 baryte Inorganic materials 0.000 claims description 3
- 150000001768 cations Chemical class 0.000 claims description 3
- 229920006395 saturated elastomer Polymers 0.000 claims description 3
- 238000001704 evaporation Methods 0.000 claims description 2
- 230000008020 evaporation Effects 0.000 claims description 2
- FKNQFGJONOIPTF-UHFFFAOYSA-N Sodium cation Chemical compound [Na+] FKNQFGJONOIPTF-UHFFFAOYSA-N 0.000 claims 1
- 239000002253 acid Substances 0.000 claims 1
- 239000003638 chemical reducing agent Substances 0.000 claims 1
- 239000012266 salt solution Substances 0.000 claims 1
- 159000000000 sodium salts Chemical class 0.000 claims 1
- 238000002425 crystallisation Methods 0.000 description 5
- 230000008025 crystallization Effects 0.000 description 5
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- CJDPJFRMHVXWPT-UHFFFAOYSA-N barium sulfide Chemical compound [S-2].[Ba+2] CJDPJFRMHVXWPT-UHFFFAOYSA-N 0.000 description 4
- 230000020477 pH reduction Effects 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- AYJRCSIUFZENHW-UHFFFAOYSA-L barium carbonate Chemical compound [Ba+2].[O-]C([O-])=O AYJRCSIUFZENHW-UHFFFAOYSA-L 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 238000005342 ion exchange Methods 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- -1 sodium sulphide barium nitrate Chemical compound 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 229910021536 Zeolite Inorganic materials 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- WDIHJSXYQDMJHN-UHFFFAOYSA-L barium chloride Chemical compound [Cl-].[Cl-].[Ba+2] WDIHJSXYQDMJHN-UHFFFAOYSA-L 0.000 description 1
- 229910001626 barium chloride Inorganic materials 0.000 description 1
- 238000001354 calcination Methods 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000013065 commercial product Substances 0.000 description 1
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000010304 firing Methods 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 238000002386 leaching Methods 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 229920001467 poly(styrenesulfonates) Polymers 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 230000002829 reductive effect Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 229910052979 sodium sulfide Inorganic materials 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000010457 zeolite Substances 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL55630B3 true PL55630B3 (https=) | 1968-06-25 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI121785B (fi) | Menetelmä litiumbikarbonaatin puhdistamiseksi | |
| RU2660864C2 (ru) | Способ получения карбоната лития из литийсодержащих природных рассолов | |
| PL55630B3 (https=) | ||
| US2804371A (en) | Recovery of potash values from brines | |
| RU2492255C1 (ru) | Способ извлечения редкоземельных металлов из фосфогипса | |
| US4427639A (en) | Ion exchange process | |
| US3393233A (en) | Method for recovering ethylene diamine tetraacetic acid | |
| DE1206872B (de) | Verfahren zur Herstellung von Bariumhydroxyd hohen Reinheitsgrades durch Ionenaustausch | |
| PL55626B1 (https=) | ||
| DE517748C (de) | Verfahren zur Gewinnung der wertvollen Bestandteile von chlorierend geroesteten Kiesabbraenden durch Auslaugen | |
| AT213191B (de) | Verfahren zum Regenerieren von Beizsäuren | |
| US4585627A (en) | Process for the concentration of uranium from sea water | |
| PL53026B1 (https=) | ||
| AT215438B (de) | Verfahren zur Gewinnung von gelöstem Quecksilber aus entchlorten wässerigen Lösungen | |
| DE2021149A1 (de) | Verfahren zur Gewinnung von schwerloeslichen Salzen der Gluconsaeure | |
| SU1745676A1 (ru) | Способ извлечени мышь ка из сернокислого раствора | |
| JPS6219066A (ja) | 特殊塩の製造方法 | |
| GB845842A (en) | Improvements in and relating to uranium extraction processes | |
| SU1074821A1 (ru) | Способ получени гидроксида магни | |
| SU916399A1 (ru) | Способ переработки калийной полиминеральной руды1 | |
| SU398659A1 (ru) | Способ переработки марганцевых руд | |
| SU924135A1 (ru) | Способ переработки конвертерной пыли никелевого производства 1 | |
| SU382595A1 (ru) | Способ получения нитрата калия | |
| SU1758002A1 (ru) | Способ получени концентрированных растворов сульфата магни из рассолов морского типа | |
| SU1504276A1 (ru) | Способ переработки серно-мышь ковокислых растворов, содержащих цветные металлы |