PL55334B3 - - Google Patents
Download PDFInfo
- Publication number
- PL55334B3 PL55334B3 PL109847A PL10984765A PL55334B3 PL 55334 B3 PL55334 B3 PL 55334B3 PL 109847 A PL109847 A PL 109847A PL 10984765 A PL10984765 A PL 10984765A PL 55334 B3 PL55334 B3 PL 55334B3
- Authority
- PL
- Poland
- Prior art keywords
- barium
- sodium
- chloride
- solution
- barium chloride
- Prior art date
Links
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 claims description 34
- 229910001626 barium chloride Inorganic materials 0.000 claims description 20
- WDIHJSXYQDMJHN-UHFFFAOYSA-L barium chloride Chemical compound [Cl-].[Cl-].[Ba+2] WDIHJSXYQDMJHN-UHFFFAOYSA-L 0.000 claims description 19
- 239000011780 sodium chloride Substances 0.000 claims description 17
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 claims description 10
- 238000000034 method Methods 0.000 claims description 9
- 238000004519 manufacturing process Methods 0.000 claims description 8
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 claims description 6
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 claims description 6
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 claims description 5
- 238000002425 crystallisation Methods 0.000 claims description 5
- 230000008025 crystallization Effects 0.000 claims description 5
- 238000010828 elution Methods 0.000 claims description 5
- 229910000029 sodium carbonate Inorganic materials 0.000 claims description 5
- 229910052938 sodium sulfate Inorganic materials 0.000 claims description 4
- 235000011152 sodium sulphate Nutrition 0.000 claims description 4
- 229910001422 barium ion Inorganic materials 0.000 claims description 3
- 150000001768 cations Chemical class 0.000 claims description 3
- FKNQFGJONOIPTF-UHFFFAOYSA-N Sodium cation Chemical compound [Na+] FKNQFGJONOIPTF-UHFFFAOYSA-N 0.000 claims description 2
- 239000006286 aqueous extract Substances 0.000 claims description 2
- -1 barium chloride cation Chemical class 0.000 claims description 2
- 229910052601 baryte Inorganic materials 0.000 claims description 2
- 239000010428 baryte Substances 0.000 claims description 2
- 238000001354 calcination Methods 0.000 claims 1
- 239000000284 extract Substances 0.000 claims 1
- 239000012452 mother liquor Substances 0.000 claims 1
- 230000002829 reductive effect Effects 0.000 claims 1
- 229910052788 barium Inorganic materials 0.000 description 18
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 18
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- 238000000926 separation method Methods 0.000 description 4
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 229910001863 barium hydroxide Inorganic materials 0.000 description 3
- CJDPJFRMHVXWPT-UHFFFAOYSA-N barium sulfide Chemical compound [S-2].[Ba+2] CJDPJFRMHVXWPT-UHFFFAOYSA-N 0.000 description 3
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical compound [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 description 2
- 230000007423 decrease Effects 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- PWHCIQQGOQTFAE-UHFFFAOYSA-L barium chloride dihydrate Chemical compound O.O.[Cl-].[Cl-].[Ba+2] PWHCIQQGOQTFAE-UHFFFAOYSA-L 0.000 description 1
- 150000001553 barium compounds Chemical class 0.000 description 1
- AYJRCSIUFZENHW-DEQYMQKBSA-L barium(2+);oxomethanediolate Chemical compound [Ba+2].[O-][14C]([O-])=O AYJRCSIUFZENHW-DEQYMQKBSA-L 0.000 description 1
- SMDYOPXOCHURNS-UHFFFAOYSA-N barium;dihydrate Chemical compound O.O.[Ba] SMDYOPXOCHURNS-UHFFFAOYSA-N 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000002950 deficient Effects 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 238000000752 ionisation method Methods 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL55334B3 true PL55334B3 (Direct) | 1968-04-25 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE102009020419B3 (de) | Verfahren zur Verarbeitung kalihaltiger Hartsalzsole | |
| US3728438A (en) | Method of producing potassium sulphate from alkali metal sulphates or their mixtures with carbonates | |
| US4072472A (en) | Production of high purity salt from high sulfate salt deposits | |
| PL55334B3 (Direct) | ||
| DE1567478C3 (de) | Verfahren zur Herstellung von Chlordioxyd und Chlor | |
| CN85100373B (zh) | 矿盐溶卤联产精盐和硫酸钠 | |
| US2343081A (en) | Production of sodium and potassium carbonates | |
| US2758912A (en) | Process for producing a substantially sulfate-free and potassium-free magnesium chloride solution | |
| US1402173A (en) | Process for obtaining potassium chloride | |
| GB1162514A (en) | Process for the preparation of Phosphoric Acid and Gypsum from Phosphate Rock | |
| US1914404A (en) | Treatment of leucite and like minerals | |
| GB1007898A (en) | A process for the production of phosphoric acid and gypsum | |
| DE5061C (de) | Verfahren zur Darstellung von reinem Kaliumcarbonat und Kalium-Hydrocyd | |
| US1944598A (en) | Process for the manufacture of boric acid | |
| US1182668A (en) | Process for treating rock containing alkali metals. | |
| US1770995A (en) | Process for manufacture of chloride of potassium and carbonates of sodium and potassium | |
| US1975798A (en) | Process for recovering potassium salts from minerals | |
| DE517748C (de) | Verfahren zur Gewinnung der wertvollen Bestandteile von chlorierend geroesteten Kiesabbraenden durch Auslaugen | |
| GB437652A (en) | Improvements in or relating to the production of potassium sulphate | |
| SU1712345A1 (ru) | Способ получени шенита | |
| DE852844C (de) | Verfahren zur Aufarbeitung eines Natriumvanadat-, Natriumarsenat-, Natriumphosphat-Salzgemisches | |
| SU527410A1 (ru) | Способ получени калийных удобрений | |
| CN109607574A (zh) | 一种浓盐水生产盐硝工艺 | |
| DE320048C (de) | Verfahren zur Herstellung eines Seifenersatzmittels | |
| DE883433C (de) | Verfahren zur Aufarbeitung der beim Aufschluss von Rohbleicherde mit Salzsaeure anfallenden salzsauren Abwaesser |