PL53617B1 - - Google Patents
Download PDFInfo
- Publication number
- PL53617B1 PL53617B1 PL107011A PL10701165A PL53617B1 PL 53617 B1 PL53617 B1 PL 53617B1 PL 107011 A PL107011 A PL 107011A PL 10701165 A PL10701165 A PL 10701165A PL 53617 B1 PL53617 B1 PL 53617B1
- Authority
- PL
- Poland
- Prior art keywords
- acid
- cyanomethyl
- pyridine
- acylated
- carboxylic acids
- Prior art date
Links
- -1 cyanomethyl esters Chemical class 0.000 claims description 13
- NGHVIOIJCVXTGV-ALEPSDHESA-N 6-APA Chemical compound [O-]C(=O)[C@H]1C(C)(C)S[C@@H]2[C@H]([NH3+])C(=O)N21 NGHVIOIJCVXTGV-ALEPSDHESA-N 0.000 claims description 9
- 239000002253 acid Substances 0.000 claims description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 8
- JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 8
- 239000003960 organic solvent Substances 0.000 claims description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 6
- 238000005917 acylation reaction Methods 0.000 claims description 5
- UBQKCCHYAOITMY-UHFFFAOYSA-N pyridin-2-ol Chemical compound OC1=CC=CC=N1 UBQKCCHYAOITMY-UHFFFAOYSA-N 0.000 claims description 5
- RAXXELZNTBOGNW-UHFFFAOYSA-N Imidazole Chemical compound C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 claims description 4
- 150000002960 penicillins Chemical class 0.000 claims description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims description 4
- 125000003277 amino group Chemical group 0.000 claims description 3
- 150000001735 carboxylic acids Chemical class 0.000 claims description 3
- 238000000034 method Methods 0.000 claims description 3
- WTKZEGDFNFYCGP-UHFFFAOYSA-N pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 claims description 3
- KZNICNPSHKQLFF-UHFFFAOYSA-N Succinimide Chemical compound O=C1CCC(=O)N1 KZNICNPSHKQLFF-UHFFFAOYSA-N 0.000 claims description 2
- 150000002391 heterocyclic compounds Chemical class 0.000 claims description 2
- 229960002317 succinimide Drugs 0.000 claims description 2
- 150000003512 tertiary amines Chemical class 0.000 claims description 2
- 150000003852 triazoles Chemical class 0.000 claims description 2
- 150000003335 secondary amines Chemical class 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N acetic acid ethyl ester Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 21
- 238000006243 chemical reaction Methods 0.000 description 9
- ZMANZCXQSJIPKH-UHFFFAOYSA-N triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 7
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- 239000007864 aqueous solution Substances 0.000 description 5
- 229940049954 Penicillin Drugs 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 229960000626 benzylpenicillin Drugs 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L mgso4 Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 238000001816 cooling Methods 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- 229940056360 Penicillin G Drugs 0.000 description 2
- 150000001413 amino acids Chemical class 0.000 description 2
- 230000001588 bifunctional Effects 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- BTJIUGUIPKRLHP-UHFFFAOYSA-N 4-Nitrophenol Chemical compound OC1=CC=C([N+]([O-])=O)C=C1 BTJIUGUIPKRLHP-UHFFFAOYSA-N 0.000 description 1
- CJUMAFVKTCBCJK-UHFFFAOYSA-N N-benzyloxycarbonylglycine Chemical compound OC(=O)CNC(=O)OCC1=CC=CC=C1 CJUMAFVKTCBCJK-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000001476 alcoholic Effects 0.000 description 1
- 125000000539 amino acid group Chemical group 0.000 description 1
- 238000007098 aminolysis reaction Methods 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 125000003460 beta-lactamyl group Chemical group 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 230000002906 microbiologic Effects 0.000 description 1
- 235000019796 monopotassium phosphate Nutrition 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 230000001131 transforming Effects 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Priority Applications (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR45755A FR1463536A (fr) | 1965-01-16 | 1966-01-13 | Procédé de préparation de pénicillines semi-synthétiques |
| GB171366A GB1111214A (en) | 1965-01-16 | 1966-01-13 | Process for preparing semisynthetic penicilins |
| SE52166A SE349813B (da) | 1965-01-16 | 1966-01-14 | |
| BE675128D BE675128A (da) | 1965-01-16 | 1966-01-14 | |
| CH47666A CH468407A (de) | 1965-01-16 | 1966-01-14 | Verfahren zur Herstellung von 6-Acylaminopenicillansäuren |
| DK25166A DK125596B (da) | 1965-01-16 | 1966-01-17 | Fremgangsmåde til fremstilling af N-acylerede 6-aminopenicillansyrer. |
| BR17645766A BR6676457D0 (pt) | 1965-01-16 | 1966-01-17 | Processo para obtencao de penicilinas semi-sinteticas |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL53617B1 true PL53617B1 (da) | 1967-06-25 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP5932754B2 (ja) | ｃ−ｆｍｓキナーゼの阻害剤 | |
| JP2009534407A (ja) | ｃ−ｆｍｓキナーゼの阻害剤 | |
| PL53617B1 (da) | ||
| DE60112091T2 (de) | Verfahren zur herstellung von azacycloalkanoylaminothiazolen | |
| SU1128839A3 (ru) | Способ получени алкалоидов типа лейрозина | |
| DE3520514C2 (de) | Verfahren zur Herstellung von Aminohydroxycephamcarboxylaten | |
| US3832352A (en) | 2-(thi)oxo-3-imidazolyl(2)-tetrahydroimidazoles | |
| SU423303A3 (ru) | Способ получения производных цефалоспорина с | |
| US3960940A (en) | Process for the preparation of D(-)-penicillamine and salts thereof | |
| DE2244915B2 (de) | Methoxymethylester von Hetacillin und Verfahren zu seiner Herstellung | |
| US3555017A (en) | Derivative of 7-acylaminocephalosporanic acid | |
| SU1456014A3 (ru) | Способ получени 5-хлор-4-(2-имидазолин-2-иламино)-2,1,3-бензотиадиазола | |
| DE1966203C3 (de) | 2,3-Dioxo-4-(R',R")-aminomethylpyrrolidine und Verfahren zu ihrer Herstellung | |
| EP0005785A1 (de) | Cephemderivate, Verfahren zu ihrer Herstellung, pharmazeutische Präparate auf Basis dieser Verbindungen und ihre Verwendung | |
| DE2701751A1 (de) | Verfahren zur acylierung von 6-aminopenicillansaeure, 7-aminocephalosporansaeure und 7-aminodesacetoxycephalosporansaeure sowie deren derivaten | |
| DE2320013A1 (de) | Verfahren zur herstellung von cephalosporin-derivaten | |
| DE2841363C2 (da) | ||
| RU2238103C1 (ru) | Способ получения аллапинина | |
| US3227711A (en) | Process for n-formyl hydantoins of cephalosporin c | |
| GB1156854A (en) | Lactones of Optically Active Heterocyclic Amino Acids and Process for the Preparation thereof | |
| DE1620530A1 (de) | Verfahren zur Herstellung von halbsynthetischem Penicillin | |
| AT275036B (de) | Verfahren zur Herstellung von neuen Derivaten der 7-Aminocephalosporansäure | |
| DE1770361C3 (de) | Verfahren zur Herstellung von Desacetoxycephalosporinen | |
| DE2157693A1 (de) | Verfahren zur Isolierung von Cephalos porin C in Form eines mit einem Losungs mittel extrahierbaren N substituierten De nvates | |
| AT402072B (de) | Cephemderivate und verfahren zu ihrer herstellung |