PL43804B1 - - Google Patents
Download PDFInfo
- Publication number
- PL43804B1 PL43804B1 PL43804A PL4380459A PL43804B1 PL 43804 B1 PL43804 B1 PL 43804B1 PL 43804 A PL43804 A PL 43804A PL 4380459 A PL4380459 A PL 4380459A PL 43804 B1 PL43804 B1 PL 43804B1
- Authority
- PL
- Poland
- Prior art keywords
- impurities
- antibiotic
- acid
- environment
- iron
- Prior art date
Links
- 230000003115 biocidal Effects 0.000 claims description 13
- 239000012535 impurity Substances 0.000 claims description 6
- 239000003242 anti bacterial agent Substances 0.000 claims description 5
- 150000003839 salts Chemical class 0.000 claims description 4
- 239000011780 sodium chloride Substances 0.000 claims description 4
- 229940064005 Antibiotic throat preparations Drugs 0.000 claims description 3
- 229940083879 Antibiotics FOR TREATMENT OF HEMORRHOIDS AND ANAL FISSURES FOR TOPICAL USE Drugs 0.000 claims description 3
- 229940042052 Antibiotics for systemic use Drugs 0.000 claims description 3
- 229940042786 Antitubercular Antibiotics Drugs 0.000 claims description 3
- 229940093922 Gynecological Antibiotics Drugs 0.000 claims description 3
- 229940024982 Topical Antifungal Antibiotics Drugs 0.000 claims description 3
- 229940079866 intestinal antibiotics Drugs 0.000 claims description 3
- 238000000034 method Methods 0.000 claims description 3
- 229940005935 ophthalmologic Antibiotics Drugs 0.000 claims description 3
- 125000001165 hydrophobic group Chemical group 0.000 claims description 2
- 244000005700 microbiome Species 0.000 claims description 2
- 241000204060 Streptomycetaceae Species 0.000 claims 1
- 230000002378 acidificating Effects 0.000 claims 1
- YAGKRVSRTSUGEY-UHFFFAOYSA-Q hydron;iron(3+);hexacyanide Chemical class [H+].[H+].[H+].[Fe+3].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-] YAGKRVSRTSUGEY-UHFFFAOYSA-Q 0.000 claims 1
- VRWKTAYJTKRVCU-UHFFFAOYSA-N iron(6+);hexacyanide Chemical class [Fe+6].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-] VRWKTAYJTKRVCU-UHFFFAOYSA-N 0.000 claims 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 claims 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 15
- XEEYBQQBJWHFJM-UHFFFAOYSA-N iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 13
- 229910052742 iron Inorganic materials 0.000 description 7
- 238000000855 fermentation Methods 0.000 description 5
- 230000004151 fermentation Effects 0.000 description 5
- 239000000706 filtrate Substances 0.000 description 5
- 235000006408 oxalic acid Nutrition 0.000 description 5
- SVDOODSCHVSYEK-IFLJXUKPSA-N (4S,4aR,5S,5aR,6S,12aR)-4-(dimethylamino)-1,5,6,10,11,12a-hexahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide;hydron;chloride Chemical compound Cl.C1=CC=C2[C@](O)(C)[C@H]3[C@H](O)[C@H]4[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]4(O)C(=O)C3=C(O)C2=C1O SVDOODSCHVSYEK-IFLJXUKPSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N HCl Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 239000005909 Kieselgur Substances 0.000 description 4
- 229960004368 Oxytetracycline Hydrochloride Drugs 0.000 description 4
- 239000000276 potassium ferrocyanide Substances 0.000 description 4
- OCPOWIWGGAATRP-UHFFFAOYSA-N potassium hexacyanoferrate(4-) Chemical compound [K+].[K+].[K+].[K+].N#C[Fe-4](C#N)(C#N)(C#N)(C#N)C#N OCPOWIWGGAATRP-UHFFFAOYSA-N 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- 229960000625 Oxytetracycline Drugs 0.000 description 3
- 239000004100 Oxytetracycline Substances 0.000 description 3
- IWVCMVBTMGNXQD-PXOLEDIWSA-N Oxytetracycline Chemical compound C1=CC=C2[C@](O)(C)[C@H]3[C@H](O)[C@H]4[C@H](N(C)C)C(O)=C(C(N)=O)C(=O)[C@@]4(O)C(O)=C3C(=O)C2=C1O IWVCMVBTMGNXQD-PXOLEDIWSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- VHUUQVKOLVNVRT-UHFFFAOYSA-N ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 3
- 235000011114 ammonium hydroxide Nutrition 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 239000012530 fluid Substances 0.000 description 3
- -1 iron ions Chemical class 0.000 description 3
- 235000019366 oxytetracycline Nutrition 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- DNMNDNSFJMUUFM-UHFFFAOYSA-N Prussian blue Chemical compound [Fe+3].[Fe+3].[Fe+3].[Fe+3].N#C[Fe-4](C#N)(C#N)(C#N)(C#N)C#N.N#C[Fe-4](C#N)(C#N)(C#N)(C#N)C#N.N#C[Fe-4](C#N)(C#N)(C#N)(C#N)C#N DNMNDNSFJMUUFM-UHFFFAOYSA-N 0.000 description 2
- 239000007857 degradation product Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- OKKJLVBELUTLKV-UHFFFAOYSA-N methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- 230000036740 Metabolism Effects 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-O Pyridinium Chemical compound C1=CC=[NH+]C=C1 JUJWROOIHBZHMG-UHFFFAOYSA-O 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N edta Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- ORXDSIPBTFAEKJ-UHFFFAOYSA-N ferrocyanide Chemical class N#C[Fe-4](C#N)(C#N)(C#N)(C#N)C#N ORXDSIPBTFAEKJ-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- AEIXRCIKZIZYPM-UHFFFAOYSA-M hydroxy(oxo)iron Chemical compound [O][Fe]O AEIXRCIKZIZYPM-UHFFFAOYSA-M 0.000 description 1
- 229910000462 iron(III) oxide hydroxide Inorganic materials 0.000 description 1
- 239000010807 litter Substances 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- 230000035786 metabolism Effects 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 230000000813 microbial Effects 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Publications (1)
Publication Number | Publication Date |
---|---|
PL43804B1 true PL43804B1 (pt) | 1960-10-15 |
Family
ID=
Similar Documents
Publication | Publication Date | Title |
---|---|---|
US2658078A (en) | Solvent extraction of oxytetracycline | |
NO132692B (pt) | ||
KR100200242B1 (ko) | 클라불란산염의 제조 방법 | |
CH370871A (de) | Verfahren zur Gewinnung eines antibiotischen Fermentierungsprodukts aus einer Fermentierungsbrühe | |
PL43804B1 (pt) | ||
SI9500039A (en) | Novel combined process for purification of vancomicyn hydrochloride | |
US2653900A (en) | Vitamin b12 purification process | |
US2656347A (en) | Streptomycin broth clarification with sequestering agents | |
Cook et al. | Metabolism of “wild” yeasts I. The chemical nature of pulcherrimin | |
JPH09504960A (ja) | ナタマイシン回収方法 | |
Izumi et al. | Foamy complex formation for removing and recovering of heavy metal ions in dilute solutions with N-monodecanoyl diethylenetriamine. | |
JPS55133401A (en) | Preparation of powdery chitin | |
JPH0126679B2 (pt) | ||
SU1595933A1 (ru) | Способ получени цементной меди из кислых мышь ксодержащих растворов | |
US2879203A (en) | Recovery of vitamin b12 from diluted solutions | |
DE4318235A1 (de) | Verfahren zur Herstellung von hochreinen Deferoxamin-Salzen | |
US5292943A (en) | Method for the preparation of low odor 2,3-dimercaptosuccinic acid | |
SU654612A1 (ru) | Способ выделени цитохрома | |
RU2305872C2 (ru) | Способ выделения америция из растворов смеси америция, кюрия и редкоземельных элементов | |
SU1237636A1 (ru) | Способ очистки раствора сульфата меди | |
US2540238A (en) | Purification and recovery of streptomycin | |
RU2068088C1 (ru) | Способ выщелачивания полиметаллического сырья | |
RU1786153C (ru) | Способ очистки гидроксида кобальта (II, III) от цинка | |
JP2757321B2 (ja) | エラグ酸の精製法 | |
SU1766850A1 (ru) | Способ извлечени т желых металлов из сточных вод |